@charset "UTF-8";
@import"https://fonts.googleapis.com/css2?family=Sora:wght@100..800&display=swap";/*!
* Bootstrap  v5.3.7 (https://getbootstrap.com/)
* Copyright 2011-2025 The Bootstrap Authors
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
*/
:root, [data-bs-theme=light] {
--bs-blue:#0d6efd;
--bs-indigo:#6610f2;
--bs-purple:#6f42c1;
--bs-pink:#d63384;
--bs-red:#dc3545;
--bs-orange:#fd7e14;
--bs-yellow:#ffc107;
--bs-green:#198754;
--bs-teal:#20c997;
--bs-cyan:#0dcaf0;
--bs-black:#000;
--bs-white:#fff;
--bs-gray:#6c757d;
--bs-gray-dark:#343a40;
--bs-gray-100:#f8f9fa;
--bs-gray-200:#e9ecef;
--bs-gray-300:#dee2e6;
--bs-gray-400:#ced4da;
--bs-gray-500:#adb5bd;
--bs-gray-600:#6c757d;
--bs-gray-700:#495057;
--bs-gray-800:#343a40;
--bs-gray-900:#212529;
--bs-primary:#0d6efd;
--bs-secondary:#6c757d;
--bs-success:#198754;
--bs-info:#0dcaf0;
--bs-warning:#ffc107;
--bs-danger:#dc3545;
--bs-light:#f8f9fa;
--bs-dark:#212529;
--bs-primary-rgb:13, 110, 253;
--bs-secondary-rgb:108, 117, 125;
--bs-success-rgb:25, 135, 84;
--bs-info-rgb:13, 202, 240;
--bs-warning-rgb:255, 193, 7;
--bs-danger-rgb:220, 53, 69;
--bs-light-rgb:248, 249, 250;
--bs-dark-rgb:33, 37, 41;
--bs-primary-text-emphasis:#052c65;
--bs-secondary-text-emphasis:#2b2f32;
--bs-success-text-emphasis:#0a3622;
--bs-info-text-emphasis:#055160;
--bs-warning-text-emphasis:#664d03;
--bs-danger-text-emphasis:#58151c;
--bs-light-text-emphasis:#495057;
--bs-dark-text-emphasis:#495057;
--bs-primary-bg-subtle:#cfe2ff;
--bs-secondary-bg-subtle:#e2e3e5;
--bs-success-bg-subtle:#d1e7dd;
--bs-info-bg-subtle:#cff4fc;
--bs-warning-bg-subtle:#fff3cd;
--bs-danger-bg-subtle:#f8d7da;
--bs-light-bg-subtle:#fcfcfd;
--bs-dark-bg-subtle:#ced4da;
--bs-primary-border-subtle:#9ec5fe;
--bs-secondary-border-subtle:#c4c8cb;
--bs-success-border-subtle:#a3cfbb;
--bs-info-border-subtle:#9eeaf9;
--bs-warning-border-subtle:#ffe69c;
--bs-danger-border-subtle:#f1aeb5;
--bs-light-border-subtle:#e9ecef;
--bs-dark-border-subtle:#adb5bd;
--bs-white-rgb:255, 255, 255;
--bs-black-rgb:0, 0, 0;
--bs-font-sans-serif:system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
--bs-font-monospace:SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, .15), rgba(255, 255, 255, 0));
--bs-body-font-family:var(--bs-font-sans-serif);
--bs-body-font-size:1rem;
--bs-body-font-weight:400;
--bs-body-line-height:1.5;
--bs-body-color:#212529;
--bs-body-color-rgb:33, 37, 41;
--bs-body-bg:#fff;
--bs-body-bg-rgb:255, 255, 255;
--bs-emphasis-color:#000;
--bs-emphasis-color-rgb:0, 0, 0;
--bs-secondary-color:rgba(33, 37, 41, .75);
--bs-secondary-color-rgb:33, 37, 41;
--bs-secondary-bg:#e9ecef;
--bs-secondary-bg-rgb:233, 236, 239;
--bs-tertiary-color:rgba(33, 37, 41, .5);
--bs-tertiary-color-rgb:33, 37, 41;
--bs-tertiary-bg:#f8f9fa;
--bs-tertiary-bg-rgb:248, 249, 250;
--bs-heading-color:inherit;
--bs-link-color:#0d6efd;
--bs-link-color-rgb:13, 110, 253;
--bs-link-decoration:underline;
--bs-link-hover-color:#0a58ca;
--bs-link-hover-color-rgb:10, 88, 202;
--bs-code-color:#d63384;
--bs-highlight-color:#212529;
--bs-highlight-bg:#fff3cd;
--bs-border-width:1px;
--bs-border-style:solid;
--bs-border-color:#dee2e6;
--bs-border-color-translucent:rgba(0, 0, 0, .175);
--bs-border-radius:.375rem;
--bs-border-radius-sm:.25rem;
--bs-border-radius-lg:.5rem;
--bs-border-radius-xl:1rem;
--bs-border-radius-xxl:2rem;
--bs-border-radius-2xl:var(--bs-border-radius-xxl);
--bs-border-radius-pill:50rem;
--bs-box-shadow:0 .5rem 1rem rgba(0, 0, 0, .15);
--bs-box-shadow-sm:0 .125rem .25rem rgba(0, 0, 0, .075);
--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, .175);
--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, .075);
--bs-focus-ring-width:.25rem;
--bs-focus-ring-opacity:.25;
--bs-focus-ring-color:rgba(13, 110, 253, .25);
--bs-form-valid-color:#198754;
--bs-form-valid-border-color:#198754;
--bs-form-invalid-color:#dc3545;
--bs-form-invalid-border-color:#dc3545
}
[data-bs-theme=dark] {
	color-scheme: dark;
--bs-body-color:#dee2e6;
--bs-body-color-rgb:222, 226, 230;
--bs-body-bg:#212529;
--bs-body-bg-rgb:33, 37, 41;
--bs-emphasis-color:#fff;
--bs-emphasis-color-rgb:255, 255, 255;
--bs-secondary-color:rgba(222, 226, 230, .75);
--bs-secondary-color-rgb:222, 226, 230;
--bs-secondary-bg:#343a40;
--bs-secondary-bg-rgb:52, 58, 64;
--bs-tertiary-color:rgba(222, 226, 230, .5);
--bs-tertiary-color-rgb:222, 226, 230;
--bs-tertiary-bg:#2b3035;
--bs-tertiary-bg-rgb:43, 48, 53;
--bs-primary-text-emphasis:#6ea8fe;
--bs-secondary-text-emphasis:#a7acb1;
--bs-success-text-emphasis:#75b798;
--bs-info-text-emphasis:#6edff6;
--bs-warning-text-emphasis:#ffda6a;
--bs-danger-text-emphasis:#ea868f;
--bs-light-text-emphasis:#f8f9fa;
--bs-dark-text-emphasis:#dee2e6;
--bs-primary-bg-subtle:#031633;
--bs-secondary-bg-subtle:#161719;
--bs-success-bg-subtle:#051b11;
--bs-info-bg-subtle:#032830;
--bs-warning-bg-subtle:#332701;
--bs-danger-bg-subtle:#2c0b0e;
--bs-light-bg-subtle:#343a40;
--bs-dark-bg-subtle:#1a1d20;
--bs-primary-border-subtle:#084298;
--bs-secondary-border-subtle:#41464b;
--bs-success-border-subtle:#0f5132;
--bs-info-border-subtle:#087990;
--bs-warning-border-subtle:#997404;
--bs-danger-border-subtle:#842029;
--bs-light-border-subtle:#495057;
--bs-dark-border-subtle:#343a40;
--bs-heading-color:inherit;
--bs-link-color:#6ea8fe;
--bs-link-hover-color:#8bb9fe;
--bs-link-color-rgb:110, 168, 254;
--bs-link-hover-color-rgb:139, 185, 254;
--bs-code-color:#e685b5;
--bs-highlight-color:#dee2e6;
--bs-highlight-bg:#664d03;
--bs-border-color:#495057;
--bs-border-color-translucent:rgba(255, 255, 255, .15);
--bs-form-valid-color:#75b798;
--bs-form-valid-border-color:#75b798;
--bs-form-invalid-color:#ea868f;
--bs-form-invalid-border-color:#ea868f
}
*, :after, :before {
	box-sizing: border-box
}

@media (prefers-reduced-motion:no-preference) {
:root {
	scroll-behavior: smooth
}
}
body {
	margin: 0;
	font-family: var(--bs-body-font-family);
	font-size: var(--bs-body-font-size);
	font-weight: var(--bs-body-font-weight);
	line-height: var(--bs-body-line-height);
	color: var(--bs-body-color);
	text-align: var(--bs-body-text-align);
	background-color: var(--bs-body-bg);
	-webkit-text-size-adjust: 100%;
	-webkit-tap-highlight-color: transparent
}
hr {
	margin: 1rem 0;
	color: inherit;
	border: 0;
	border-top: var(--bs-border-width) solid;
	opacity: .25
}
.h1, .h2, .h3, .h4, .h5, .h6, h1, h2, h3, h4, h5, h6 {
	margin-top: 0;
	margin-bottom: .5rem;
	font-weight: 500;
	line-height: 1.2;
	color: var(--bs-heading-color)
}
.h1, h1 {
	font-size: calc(1.375rem + 1.5vw)
}

@media (min-width:1200px) {
.h1, h1 {
	font-size: 2.5rem
}
}
.h2, h2 {
	font-size: calc(1.325rem + .9vw)
}

@media (min-width:1200px) {
.h2, h2 {
	font-size: 2rem
}
}
.h3, h3 {
	font-size: calc(1.3rem + .6vw)
}

@media (min-width:1200px) {
.h3, h3 {
	font-size: 1.75rem
}
}
.h4, h4 {
	font-size: calc(1.275rem + .3vw)
}

@media (min-width:1200px) {
.h4, h4 {
	font-size: 1.5rem
}
}
.h5, h5 {
	font-size: 1.25rem
}
.h6, h6 {
	font-size: 1rem
}
p {
	margin-top: 0;
	margin-bottom: 1rem
}
abbr[title] {
	-webkit-text-decoration: underline dotted;
	text-decoration: underline dotted;
	cursor: help;
	-webkit-text-decoration-skip-ink: none;
	text-decoration-skip-ink: none
}
address {
	margin-bottom: 1rem;
	font-style: normal;
	line-height: inherit
}
ol, ul {
	padding-left: 2rem
}
dl, ol, ul {
	margin-top: 0;
	margin-bottom: 1rem
}
ol ol, ol ul, ul ol, ul ul {
	margin-bottom: 0
}
dt {
	font-weight: 700
}
dd {
	margin-bottom: .5rem;
	margin-left: 0
}
blockquote {
	margin: 0 0 1rem
}
b, strong {
	font-weight: bolder
}
.small, small {
	font-size: .875em
}
.mark, mark {
	padding: .1875em;
	color: var(--bs-highlight-color);
	background-color: var(--bs-highlight-bg)
}
sub, sup {
	position: relative;
	font-size: .75em;
	line-height: 0;
	vertical-align: baseline
}
sub {
	bottom: -.25em
}
sup {
	top: -.5em
}
a {
	color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
	text-decoration: underline
}
a:hover {
--bs-link-color-rgb:var(--bs-link-hover-color-rgb)
}
a:not([href]):not([class]), a:not([href]):not([class]):hover {
	color: inherit;
	text-decoration: none
}
code, kbd, pre, samp {
	font-family: var(--bs-font-monospace);
	font-size: 1em
}
pre {
	display: block;
	margin-top: 0;
	margin-bottom: 1rem;
	overflow: auto;
	font-size: .875em
}
pre code {
	font-size: inherit;
	color: inherit;
	word-break: normal
}
code {
	font-size: .875em;
	color: var(--bs-code-color);
	word-wrap: break-word
}
a>code {
	color: inherit
}
kbd {
	padding: .1875rem .375rem;
	font-size: .875em;
	color: var(--bs-body-bg);
	background-color: var(--bs-body-color);
	border-radius: .25rem
}
kbd kbd {
	padding: 0;
	font-size: 1em
}
figure {
	margin: 0 0 1rem
}
img, svg {
	vertical-align: middle
}
table {
	caption-side: bottom;
	border-collapse: collapse
}
caption {
	padding-top: .5rem;
	padding-bottom: .5rem;
	color: var(--bs-secondary-color);
	text-align: left
}
th {
	text-align: inherit;
	text-align: -webkit-match-parent
}
tbody, td, tfoot, th, thead, tr {
	border-color: inherit;
	border-style: solid;
	border-width: 0
}
label {
	display: inline-block
}
button {
	border-radius: 0
}
button:focus:not(:focus-visible) {
	outline: 0
}
button, input, optgroup, select, textarea {
	margin: 0;
	font-family: inherit;
	font-size: inherit;
	line-height: inherit
}
button, select {
	text-transform: none
}
[role=button] {
	cursor: pointer
}
select {
	word-wrap: normal
}
select:disabled {
	opacity: 1
}
[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
display:none!important
}
[type=button], [type=reset], [type=submit], button {
	-webkit-appearance: button
}
[type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled), button:not(:disabled) {
	cursor: pointer
}
::-moz-focus-inner {
padding:0;
border-style:none
}
textarea {
	resize: vertical
}
fieldset {
	min-width: 0;
	padding: 0;
	margin: 0;
	border: 0
}
legend {
	float: left;
	width: 100%;
	padding: 0;
	margin-bottom: .5rem;
	line-height: inherit;
	font-size: calc(1.275rem + .3vw)
}

@media (min-width:1200px) {
legend {
	font-size: 1.5rem
}
}
legend+* {
	clear: left
}
::-webkit-datetime-edit-day-field, ::-webkit-datetime-edit-fields-wrapper, ::-webkit-datetime-edit-hour-field, ::-webkit-datetime-edit-minute, ::-webkit-datetime-edit-month-field, ::-webkit-datetime-edit-text, ::-webkit-datetime-edit-year-field {
padding:0
}
::-webkit-inner-spin-button {
height:auto
}
[type=search] {
	-webkit-appearance: textfield;
	outline-offset: -2px
}
::-webkit-search-decoration {
-webkit-appearance:none
}
::-webkit-color-swatch-wrapper {
padding:0
}
::file-selector-button {
font:inherit;
-webkit-appearance:button
}
output {
	display: inline-block
}
iframe {
	border: 0
}
summary {
	display: list-item;
	cursor: pointer
}
progress {
	vertical-align: baseline
}
[hidden] {
	display: none!important
}
.lead {
	font-size: 1.25rem;
	font-weight: 300
}
.display-1 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.625rem + 4.5vw)
}

@media (min-width:1200px) {
.display-1 {
	font-size: 5rem
}
}
.display-2 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.575rem + 3.9vw)
}

@media (min-width:1200px) {
.display-2 {
	font-size: 4.5rem
}
}
.display-3 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.525rem + 3.3vw)
}

@media (min-width:1200px) {
.display-3 {
	font-size: 4rem
}
}
.display-4 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.475rem + 2.7vw)
}

@media (min-width:1200px) {
.display-4 {
	font-size: 3.5rem
}
}
.display-5 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.425rem + 2.1vw)
}

@media (min-width:1200px) {
.display-5 {
	font-size: 3rem
}
}
.display-6 {
	font-weight: 300;
	line-height: 1.2;
	font-size: calc(1.375rem + 1.5vw)
}

@media (min-width:1200px) {
.display-6 {
	font-size: 2.5rem
}
}
.list-unstyled, .list-inline {
	padding-left: 0;
	list-style: none
}
.list-inline-item {
	display: inline-block
}
.list-inline-item:not(:last-child) {
	margin-right: .5rem
}
.initialism {
	font-size: .875em;
	text-transform: uppercase
}
.blockquote {
	margin-bottom: 1rem;
	font-size: 1.25rem
}
.blockquote>:last-child {
	margin-bottom: 0
}
.blockquote-footer {
	margin-top: -1rem;
	margin-bottom: 1rem;
	font-size: .875em;
	color: #6c757d
}
.blockquote-footer:before {
	content: "— "
}
.img-fluid {
	max-width: 100%;
	height: auto
}
.img-thumbnail {
	padding: .25rem;
	background-color: var(--bs-body-bg);
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: var(--bs-border-radius);
	max-width: 100%;
	height: auto
}
.figure {
	display: inline-block
}
.figure-img {
	margin-bottom: .5rem;
	line-height: 1
}
.figure-caption {
	font-size: .875em;
	color: var(--bs-secondary-color)
}
.container, .container-fluid, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
--bs-gutter-x:1.5rem;
--bs-gutter-y:0;
	width: 100%;
padding-right:calc(var(--bs-gutter-x) * .5);
padding-left:calc(var(--bs-gutter-x) * .5);
	margin-right: auto;
	margin-left: auto
}

@media (min-width:576px) {
.container, .container-sm {
	max-width: 540px
}
}

@media (min-width:768px) {
.container, .container-md, .container-sm {
	max-width: 720px
}
}

@media (min-width:992px) {
.container, .container-lg, .container-md, .container-sm {
	max-width: 960px
}
}

@media (min-width:1200px) {
.container, .container-lg, .container-md, .container-sm, .container-xl {
	max-width: 1140px
}
}

@media (min-width:1400px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 1320px
}
}
:root {
--bs-breakpoint-xs:0;
--bs-breakpoint-sm:576px;
--bs-breakpoint-md:768px;
--bs-breakpoint-lg:992px;
--bs-breakpoint-xl:1200px;
--bs-breakpoint-xxl:1400px
}
.row {
--bs-gutter-x:1.5rem;
--bs-gutter-y:0;
	display: flex;
	flex-wrap: wrap;
margin-top:calc(-1 * var(--bs-gutter-y));
margin-right:calc(-.5 * var(--bs-gutter-x));
margin-left:calc(-.5 * var(--bs-gutter-x))
}
.row>* {
	flex-shrink: 0;
	width: 100%;
	max-width: 100%;
padding-right:calc(var(--bs-gutter-x) * .5);
padding-left:calc(var(--bs-gutter-x) * .5);
	margin-top: var(--bs-gutter-y)
}
.col {
	flex: 1 0 0
}
.row-cols-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-auto {
	flex: 0 0 auto;
	width: auto
}
.col-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-1 {
	margin-left: 8.33333333%
}
.offset-2 {
	margin-left: 16.66666667%
}
.offset-3 {
	margin-left: 25%
}
.offset-4 {
	margin-left: 33.33333333%
}
.offset-5 {
	margin-left: 41.66666667%
}
.offset-6 {
	margin-left: 50%
}
.offset-7 {
	margin-left: 58.33333333%
}
.offset-8 {
	margin-left: 66.66666667%
}
.offset-9 {
	margin-left: 75%
}
.offset-10 {
	margin-left: 83.33333333%
}
.offset-11 {
	margin-left: 91.66666667%
}
.g-0, .gx-0 {
--bs-gutter-x:0
}
.g-0, .gy-0 {
--bs-gutter-y:0
}
.g-1, .gx-1 {
--bs-gutter-x:.25rem
}
.g-1, .gy-1 {
--bs-gutter-y:.25rem
}
.g-2, .gx-2 {
--bs-gutter-x:.5rem
}
.g-2, .gy-2 {
--bs-gutter-y:.5rem
}
.g-3, .gx-3 {
--bs-gutter-x:1rem
}
.g-3, .gy-3 {
--bs-gutter-y:1rem
}
.g-4, .gx-4 {
--bs-gutter-x:1.5rem
}
.g-4, .gy-4 {
--bs-gutter-y:1.5rem
}
.g-5, .gx-5 {
--bs-gutter-x:3rem
}
.g-5, .gy-5 {
--bs-gutter-y:3rem
}

@media (min-width:576px) {
.col-sm {
	flex: 1 0 0
}
.row-cols-sm-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-sm-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-sm-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-sm-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-sm-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-sm-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-sm-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-sm-auto {
	flex: 0 0 auto;
	width: auto
}
.col-sm-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-sm-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-sm-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-sm-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-sm-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-sm-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-sm-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-sm-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-sm-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-sm-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-sm-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-sm-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-sm-0 {
	margin-left: 0
}
.offset-sm-1 {
	margin-left: 8.33333333%
}
.offset-sm-2 {
	margin-left: 16.66666667%
}
.offset-sm-3 {
	margin-left: 25%
}
.offset-sm-4 {
	margin-left: 33.33333333%
}
.offset-sm-5 {
	margin-left: 41.66666667%
}
.offset-sm-6 {
	margin-left: 50%
}
.offset-sm-7 {
	margin-left: 58.33333333%
}
.offset-sm-8 {
	margin-left: 66.66666667%
}
.offset-sm-9 {
	margin-left: 75%
}
.offset-sm-10 {
	margin-left: 83.33333333%
}
.offset-sm-11 {
	margin-left: 91.66666667%
}
.g-sm-0, .gx-sm-0 {
--bs-gutter-x:0
}
.g-sm-0, .gy-sm-0 {
--bs-gutter-y:0
}
.g-sm-1, .gx-sm-1 {
--bs-gutter-x:.25rem
}
.g-sm-1, .gy-sm-1 {
--bs-gutter-y:.25rem
}
.g-sm-2, .gx-sm-2 {
--bs-gutter-x:.5rem
}
.g-sm-2, .gy-sm-2 {
--bs-gutter-y:.5rem
}
.g-sm-3, .gx-sm-3 {
--bs-gutter-x:1rem
}
.g-sm-3, .gy-sm-3 {
--bs-gutter-y:1rem
}
.g-sm-4, .gx-sm-4 {
--bs-gutter-x:1.5rem
}
.g-sm-4, .gy-sm-4 {
--bs-gutter-y:1.5rem
}
.g-sm-5, .gx-sm-5 {
--bs-gutter-x:3rem
}
.g-sm-5, .gy-sm-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:768px) {
.col-md {
	flex: 1 0 0
}
.row-cols-md-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-md-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-md-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-md-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-md-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-md-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-md-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-md-auto {
	flex: 0 0 auto;
	width: auto
}
.col-md-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-md-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-md-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-md-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-md-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-md-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-md-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-md-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-md-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-md-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-md-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-md-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-md-0 {
	margin-left: 0
}
.offset-md-1 {
	margin-left: 8.33333333%
}
.offset-md-2 {
	margin-left: 16.66666667%
}
.offset-md-3 {
	margin-left: 25%
}
.offset-md-4 {
	margin-left: 33.33333333%
}
.offset-md-5 {
	margin-left: 41.66666667%
}
.offset-md-6 {
	margin-left: 50%
}
.offset-md-7 {
	margin-left: 58.33333333%
}
.offset-md-8 {
	margin-left: 66.66666667%
}
.offset-md-9 {
	margin-left: 75%
}
.offset-md-10 {
	margin-left: 83.33333333%
}
.offset-md-11 {
	margin-left: 91.66666667%
}
.g-md-0, .gx-md-0 {
--bs-gutter-x:0
}
.g-md-0, .gy-md-0 {
--bs-gutter-y:0
}
.g-md-1, .gx-md-1 {
--bs-gutter-x:.25rem
}
.g-md-1, .gy-md-1 {
--bs-gutter-y:.25rem
}
.g-md-2, .gx-md-2 {
--bs-gutter-x:.5rem
}
.g-md-2, .gy-md-2 {
--bs-gutter-y:.5rem
}
.g-md-3, .gx-md-3 {
--bs-gutter-x:1rem
}
.g-md-3, .gy-md-3 {
--bs-gutter-y:1rem
}
.g-md-4, .gx-md-4 {
--bs-gutter-x:1.5rem
}
.g-md-4, .gy-md-4 {
--bs-gutter-y:1.5rem
}
.g-md-5, .gx-md-5 {
--bs-gutter-x:3rem
}
.g-md-5, .gy-md-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:992px) {
.col-lg {
	flex: 1 0 0
}
.row-cols-lg-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-lg-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-lg-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-lg-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-lg-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-lg-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-lg-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-lg-auto {
	flex: 0 0 auto;
	width: auto
}
.col-lg-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-lg-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-lg-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-lg-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-lg-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-lg-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-lg-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-lg-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-lg-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-lg-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-lg-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-lg-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-lg-0 {
	margin-left: 0
}
.offset-lg-1 {
	margin-left: 8.33333333%
}
.offset-lg-2 {
	margin-left: 16.66666667%
}
.offset-lg-3 {
	margin-left: 25%
}
.offset-lg-4 {
	margin-left: 33.33333333%
}
.offset-lg-5 {
	margin-left: 41.66666667%
}
.offset-lg-6 {
	margin-left: 50%
}
.offset-lg-7 {
	margin-left: 58.33333333%
}
.offset-lg-8 {
	margin-left: 66.66666667%
}
.offset-lg-9 {
	margin-left: 75%
}
.offset-lg-10 {
	margin-left: 83.33333333%
}
.offset-lg-11 {
	margin-left: 91.66666667%
}
.g-lg-0, .gx-lg-0 {
--bs-gutter-x:0
}
.g-lg-0, .gy-lg-0 {
--bs-gutter-y:0
}
.g-lg-1, .gx-lg-1 {
--bs-gutter-x:.25rem
}
.g-lg-1, .gy-lg-1 {
--bs-gutter-y:.25rem
}
.g-lg-2, .gx-lg-2 {
--bs-gutter-x:.5rem
}
.g-lg-2, .gy-lg-2 {
--bs-gutter-y:.5rem
}
.g-lg-3, .gx-lg-3 {
--bs-gutter-x:1rem
}
.g-lg-3, .gy-lg-3 {
--bs-gutter-y:1rem
}
.g-lg-4, .gx-lg-4 {
--bs-gutter-x:1.5rem
}
.g-lg-4, .gy-lg-4 {
--bs-gutter-y:1.5rem
}
.g-lg-5, .gx-lg-5 {
--bs-gutter-x:3rem
}
.g-lg-5, .gy-lg-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:1200px) {
.col-xl {
	flex: 1 0 0
}
.row-cols-xl-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-xl-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-xl-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-xl-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-xl-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-xl-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-xl-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xl-auto {
	flex: 0 0 auto;
	width: auto
}
.col-xl-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-xl-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xl-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-xl-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-xl-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-xl-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-xl-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-xl-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-xl-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-xl-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-xl-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-xl-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-xl-0 {
	margin-left: 0
}
.offset-xl-1 {
	margin-left: 8.33333333%
}
.offset-xl-2 {
	margin-left: 16.66666667%
}
.offset-xl-3 {
	margin-left: 25%
}
.offset-xl-4 {
	margin-left: 33.33333333%
}
.offset-xl-5 {
	margin-left: 41.66666667%
}
.offset-xl-6 {
	margin-left: 50%
}
.offset-xl-7 {
	margin-left: 58.33333333%
}
.offset-xl-8 {
	margin-left: 66.66666667%
}
.offset-xl-9 {
	margin-left: 75%
}
.offset-xl-10 {
	margin-left: 83.33333333%
}
.offset-xl-11 {
	margin-left: 91.66666667%
}
.g-xl-0, .gx-xl-0 {
--bs-gutter-x:0
}
.g-xl-0, .gy-xl-0 {
--bs-gutter-y:0
}
.g-xl-1, .gx-xl-1 {
--bs-gutter-x:.25rem
}
.g-xl-1, .gy-xl-1 {
--bs-gutter-y:.25rem
}
.g-xl-2, .gx-xl-2 {
--bs-gutter-x:.5rem
}
.g-xl-2, .gy-xl-2 {
--bs-gutter-y:.5rem
}
.g-xl-3, .gx-xl-3 {
--bs-gutter-x:1rem
}
.g-xl-3, .gy-xl-3 {
--bs-gutter-y:1rem
}
.g-xl-4, .gx-xl-4 {
--bs-gutter-x:1.5rem
}
.g-xl-4, .gy-xl-4 {
--bs-gutter-y:1.5rem
}
.g-xl-5, .gx-xl-5 {
--bs-gutter-x:3rem
}
.g-xl-5, .gy-xl-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:1400px) {
.col-xxl {
	flex: 1 0 0
}
.row-cols-xxl-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-xxl-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-xxl-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-xxl-3>* {
	flex: 0 0 auto;
	width: 33.33333333%
}
.row-cols-xxl-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-xxl-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-xxl-6>* {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xxl-auto {
	flex: 0 0 auto;
	width: auto
}
.col-xxl-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-xxl-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xxl-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-xxl-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-xxl-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-xxl-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-xxl-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-xxl-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-xxl-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-xxl-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-xxl-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-xxl-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-xxl-0 {
	margin-left: 0
}
.offset-xxl-1 {
	margin-left: 8.33333333%
}
.offset-xxl-2 {
	margin-left: 16.66666667%
}
.offset-xxl-3 {
	margin-left: 25%
}
.offset-xxl-4 {
	margin-left: 33.33333333%
}
.offset-xxl-5 {
	margin-left: 41.66666667%
}
.offset-xxl-6 {
	margin-left: 50%
}
.offset-xxl-7 {
	margin-left: 58.33333333%
}
.offset-xxl-8 {
	margin-left: 66.66666667%
}
.offset-xxl-9 {
	margin-left: 75%
}
.offset-xxl-10 {
	margin-left: 83.33333333%
}
.offset-xxl-11 {
	margin-left: 91.66666667%
}
.g-xxl-0, .gx-xxl-0 {
--bs-gutter-x:0
}
.g-xxl-0, .gy-xxl-0 {
--bs-gutter-y:0
}
.g-xxl-1, .gx-xxl-1 {
--bs-gutter-x:.25rem
}
.g-xxl-1, .gy-xxl-1 {
--bs-gutter-y:.25rem
}
.g-xxl-2, .gx-xxl-2 {
--bs-gutter-x:.5rem
}
.g-xxl-2, .gy-xxl-2 {
--bs-gutter-y:.5rem
}
.g-xxl-3, .gx-xxl-3 {
--bs-gutter-x:1rem
}
.g-xxl-3, .gy-xxl-3 {
--bs-gutter-y:1rem
}
.g-xxl-4, .gx-xxl-4 {
--bs-gutter-x:1.5rem
}
.g-xxl-4, .gy-xxl-4 {
--bs-gutter-y:1.5rem
}
.g-xxl-5, .gx-xxl-5 {
--bs-gutter-x:3rem
}
.g-xxl-5, .gy-xxl-5 {
--bs-gutter-y:3rem
}
}
.table {
--bs-table-color-type:initial;
--bs-table-bg-type:initial;
--bs-table-color-state:initial;
--bs-table-bg-state:initial;
--bs-table-color:var(--bs-emphasis-color);
--bs-table-bg:var(--bs-body-bg);
--bs-table-border-color:var(--bs-border-color);
--bs-table-accent-bg:transparent;
--bs-table-striped-color:var(--bs-emphasis-color);
--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), .05);
--bs-table-active-color:var(--bs-emphasis-color);
--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), .1);
--bs-table-hover-color:var(--bs-emphasis-color);
--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), .075);
	width: 100%;
	margin-bottom: 1rem;
	vertical-align: top;
	border-color: var(--bs-table-border-color)
}
.table>:not(caption)>*>* {
	padding: .5rem;
	color: var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));
	background-color: var(--bs-table-bg);
	border-bottom-width: var(--bs-border-width);
	box-shadow: inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))
}
.table>tbody {
	vertical-align: inherit
}
.table>thead {
	vertical-align: bottom
}
.table-group-divider {
border-top:calc(var(--bs-border-width) * 2) solid currentcolor
}
.caption-top {
	caption-side: top
}
.table-sm>:not(caption)>*>* {
	padding: .25rem
}
.table-bordered>:not(caption)>* {
	border-width: var(--bs-border-width) 0
}
.table-bordered>:not(caption)>*>* {
	border-width: 0 var(--bs-border-width)
}
.table-borderless>:not(caption)>*>* {
	border-bottom-width: 0
}
.table-borderless>:not(:first-child) {
	border-top-width: 0
}
.table-striped>tbody>tr:nth-of-type(odd)>* {
--bs-table-color-type:var(--bs-table-striped-color);
--bs-table-bg-type:var(--bs-table-striped-bg)
}
.table-striped-columns>:not(caption)>tr>:nth-child(2n) {
--bs-table-color-type:var(--bs-table-striped-color);
--bs-table-bg-type:var(--bs-table-striped-bg)
}
.table-active {
--bs-table-color-state:var(--bs-table-active-color);
--bs-table-bg-state:var(--bs-table-active-bg)
}
.table-hover>tbody>tr:hover>* {
--bs-table-color-state:var(--bs-table-hover-color);
--bs-table-bg-state:var(--bs-table-hover-bg)
}
.table-primary {
--bs-table-color:#000;
--bs-table-bg:#cfe2ff;
--bs-table-border-color:#a6b5cc;
--bs-table-striped-bg:#c5d7f2;
--bs-table-striped-color:#000;
--bs-table-active-bg:#bacbe6;
--bs-table-active-color:#000;
--bs-table-hover-bg:#bfd1ec;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-secondary {
--bs-table-color:#000;
--bs-table-bg:#e2e3e5;
--bs-table-border-color:#b5b6b7;
--bs-table-striped-bg:#d7d8da;
--bs-table-striped-color:#000;
--bs-table-active-bg:#cbccce;
--bs-table-active-color:#000;
--bs-table-hover-bg:#d1d2d4;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-success {
--bs-table-color:#000;
--bs-table-bg:#d1e7dd;
--bs-table-border-color:#a7b9b1;
--bs-table-striped-bg:#c7dbd2;
--bs-table-striped-color:#000;
--bs-table-active-bg:#bcd0c7;
--bs-table-active-color:#000;
--bs-table-hover-bg:#c1d6cc;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-info {
--bs-table-color:#000;
--bs-table-bg:#cff4fc;
--bs-table-border-color:#a6c3ca;
--bs-table-striped-bg:#c5e8ef;
--bs-table-striped-color:#000;
--bs-table-active-bg:#badce3;
--bs-table-active-color:#000;
--bs-table-hover-bg:#bfe2e9;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-warning {
--bs-table-color:#000;
--bs-table-bg:#fff3cd;
--bs-table-border-color:#ccc2a4;
--bs-table-striped-bg:#f2e7c3;
--bs-table-striped-color:#000;
--bs-table-active-bg:#e6dbb9;
--bs-table-active-color:#000;
--bs-table-hover-bg:#ece1be;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-danger {
--bs-table-color:#000;
--bs-table-bg:#f8d7da;
--bs-table-border-color:#c6acae;
--bs-table-striped-bg:#eccccf;
--bs-table-striped-color:#000;
--bs-table-active-bg:#dfc2c4;
--bs-table-active-color:#000;
--bs-table-hover-bg:#e5c7ca;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-light {
--bs-table-color:#000;
--bs-table-bg:#f8f9fa;
--bs-table-border-color:#c6c7c8;
--bs-table-striped-bg:#ecedee;
--bs-table-striped-color:#000;
--bs-table-active-bg:#dfe0e1;
--bs-table-active-color:#000;
--bs-table-hover-bg:#e5e6e7;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-dark {
--bs-table-color:#fff;
--bs-table-bg:#212529;
--bs-table-border-color:#4d5154;
--bs-table-striped-bg:#2c3034;
--bs-table-striped-color:#fff;
--bs-table-active-bg:#373b3e;
--bs-table-active-color:#fff;
--bs-table-hover-bg:#323539;
--bs-table-hover-color:#fff;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-responsive {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}

@media (max-width:575.98px) {
.table-responsive-sm {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:767.98px) {
.table-responsive-md {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:991.98px) {
.table-responsive-lg {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:1199.98px) {
.table-responsive-xl {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:1399.98px) {
.table-responsive-xxl {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}
.form-label {
	margin-bottom: .5rem
}
.col-form-label {
	padding-top: calc(.375rem + var(--bs-border-width));
	padding-bottom: calc(.375rem + var(--bs-border-width));
	margin-bottom: 0;
	font-size: inherit;
	line-height: 1.5
}
.col-form-label-lg {
	padding-top: calc(.5rem + var(--bs-border-width));
	padding-bottom: calc(.5rem + var(--bs-border-width));
	font-size: 1.25rem
}
.col-form-label-sm {
	padding-top: calc(.25rem + var(--bs-border-width));
	padding-bottom: calc(.25rem + var(--bs-border-width));
	font-size: .875rem
}
.form-text {
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-secondary-color)
}
.form-control {
	display: block;
	width: 100%;
	padding: .375rem .75rem;
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	background-color: var(--bs-body-bg);
	background-clip: padding-box;
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: var(--bs-border-radius);
	transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-control {
	transition: none
}
}
.form-control[type=file] {
	overflow: hidden
}
.form-control[type=file]:not(:disabled):not([readonly]) {
	cursor: pointer
}
.form-control:focus {
	color: var(--bs-body-color);
	background-color: var(--bs-body-bg);
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem #0d6efd40
}
.form-control::-webkit-date-and-time-value {
min-width:85px;
height:1.5em;
margin:0
}
.form-control::-webkit-datetime-edit {
display:block;
padding:0
}
.form-control::-moz-placeholder {
color:var(--bs-secondary-color);
opacity:1
}
.form-control::placeholder {
color:var(--bs-secondary-color);
opacity:1
}
.form-control:disabled {
	background-color: var(--bs-secondary-bg);
	opacity: 1
}
.form-control::file-selector-button {
padding:.375rem .75rem;
margin:-.375rem -.75rem;
margin-inline-end:.75rem;
color:var(--bs-body-color);
background-color:var(--bs-tertiary-bg);
pointer-events:none;
border-color:inherit;
border-style:solid;
border-width:0;
border-inline-end-width:var(--bs-border-width);
border-radius:0;
transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-control::file-selector-button {
transition:none
}
}
.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
background-color:var(--bs-secondary-bg)
}
.form-control-plaintext {
	display: block;
	width: 100%;
	padding: .375rem 0;
	margin-bottom: 0;
	line-height: 1.5;
	color: var(--bs-body-color);
	background-color: transparent;
	border: solid transparent;
	border-width: var(--bs-border-width) 0
}
.form-control-plaintext:focus {
	outline: 0
}
.form-control-plaintext.form-control-lg, .form-control-plaintext.form-control-sm {
	padding-right: 0;
	padding-left: 0
}
.form-control-sm {
min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));
	padding: .25rem .5rem;
	font-size: .875rem;
	border-radius: var(--bs-border-radius-sm)
}
.form-control-sm::file-selector-button {
padding:.25rem .5rem;
margin:-.25rem -.5rem;
margin-inline-end:.5rem
}
.form-control-lg {
min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
	padding: .5rem 1rem;
	font-size: 1.25rem;
	border-radius: var(--bs-border-radius-lg)
}
.form-control-lg::file-selector-button {
padding:.5rem 1rem;
margin:-.5rem -1rem;
margin-inline-end:1rem
}
textarea.form-control {
min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))
}
textarea.form-control-sm {
min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))
}
textarea.form-control-lg {
min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))
}
.form-control-color {
	width: 3rem;
height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));
	padding: .375rem
}
.form-control-color:not(:disabled):not([readonly]) {
	cursor: pointer
}
.form-control-color::-moz-color-swatch {
border:0!important;
border-radius:var(--bs-border-radius)
}
.form-control-color::-webkit-color-swatch {
border:0!important;
border-radius:var(--bs-border-radius)
}
.form-control-color.form-control-sm {
height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))
}
.form-control-color.form-control-lg {
height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))
}
.form-select {
--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
	display: block;
	width: 100%;
	padding: .375rem 2.25rem .375rem .75rem;
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	background-color: var(--bs-body-bg);
	background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
	background-repeat: no-repeat;
	background-position: right .75rem center;
	background-size: 16px 12px;
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: var(--bs-border-radius);
	transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-select {
	transition: none
}
}
.form-select:focus {
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem #0d6efd40
}
.form-select[multiple], .form-select[size]:not([size="1"]) {
	padding-right: .75rem;
	background-image: none
}
.form-select:disabled {
	background-color: var(--bs-secondary-bg)
}
.form-select:-moz-focusring {
color:transparent;
text-shadow:0 0 0 var(--bs-body-color)
}
.form-select-sm {
	padding-top: .25rem;
	padding-bottom: .25rem;
	padding-left: .5rem;
	font-size: .875rem;
	border-radius: var(--bs-border-radius-sm)
}
.form-select-lg {
	padding-top: .5rem;
	padding-bottom: .5rem;
	padding-left: 1rem;
	font-size: 1.25rem;
	border-radius: var(--bs-border-radius-lg)
}
[data-bs-theme=dark] .form-select {
--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")
}
.form-check {
	display: block;
	min-height: 1.5rem;
	padding-left: 1.5em;
	margin-bottom: .125rem
}
.form-check .form-check-input {
	float: left;
	margin-left: -1.5em
}
.form-check-reverse {
	padding-right: 1.5em;
	padding-left: 0;
	text-align: right
}
.form-check-reverse .form-check-input {
	float: right;
	margin-right: -1.5em;
	margin-left: 0
}
.form-check-input {
--bs-form-check-bg:var(--bs-body-bg);
	flex-shrink: 0;
	width: 1em;
	height: 1em;
	margin-top: .25em;
	vertical-align: top;
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	background-color: var(--bs-form-check-bg);
	background-image: var(--bs-form-check-bg-image);
	background-repeat: no-repeat;
	background-position: center;
	background-size: contain;
	border: var(--bs-border-width) solid var(--bs-border-color);
	-webkit-print-color-adjust: exact;
	print-color-adjust: exact
}
.form-check-input[type=checkbox] {
	border-radius: .25em
}
.form-check-input[type=radio] {
	border-radius: 50%
}
.form-check-input:active {
	filter: brightness(90%)
}
.form-check-input:focus {
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem #0d6efd40
}
.form-check-input:checked {
	background-color: #0d6efd;
	border-color: #0d6efd
}
.form-check-input:checked[type=checkbox] {
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")
}
.form-check-input:checked[type=radio] {
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")
}
.form-check-input[type=checkbox]:indeterminate {
	background-color: #0d6efd;
	border-color: #0d6efd;
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")
}
.form-check-input:disabled {
	pointer-events: none;
	filter: none;
	opacity: .5
}
.form-check-input:disabled~.form-check-label, .form-check-input[disabled]~.form-check-label {
	cursor: default;
	opacity: .5
}
.form-switch {
	padding-left: 2.5em
}
.form-switch .form-check-input {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");
	width: 2em;
	margin-left: -2.5em;
	background-image: var(--bs-form-switch-bg);
	background-position: left center;
	border-radius: 2em;
	transition: background-position .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-switch .form-check-input {
	transition: none
}
}
.form-switch .form-check-input:focus {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")
}
.form-switch .form-check-input:checked {
	background-position: right center;
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")
}
.form-switch.form-check-reverse {
	padding-right: 2.5em;
	padding-left: 0
}
.form-switch.form-check-reverse .form-check-input {
	margin-right: -2.5em;
	margin-left: 0
}
.form-check-inline {
	display: inline-block;
	margin-right: 1rem
}
.btn-check {
	position: absolute;
	clip: rect(0,0,0,0);
	pointer-events: none
}
.btn-check:disabled+.btn, .btn-check[disabled]+.btn {
	pointer-events: none;
	filter: none;
	opacity: .65
}
[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")
}
.form-range {
	width: 100%;
	height: 1.5rem;
	padding: 0;
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	background-color: transparent
}
.form-range:focus {
	outline: 0
}
.form-range:focus::-webkit-slider-thumb {
box-shadow:0 0 0 1px #fff, 0 0 0 .25rem #0d6efd40
}
.form-range:focus::-moz-range-thumb {
box-shadow:0 0 0 1px #fff, 0 0 0 .25rem #0d6efd40
}
.form-range::-moz-focus-outer {
border:0
}
.form-range::-webkit-slider-thumb {
width:1rem;
height:1rem;
margin-top:-.25rem;
-webkit-appearance:none;
-moz-appearance:none;
appearance:none;
background-color:#0d6efd;
border:0;
border-radius:1rem;
-webkit-transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-range::-webkit-slider-thumb {
-webkit-transition:none;
transition:none
}
}
.form-range::-webkit-slider-thumb:active {
background-color:#b6d4fe
}
.form-range::-webkit-slider-runnable-track {
width:100%;
height:.5rem;
color:transparent;
cursor:pointer;
background-color:var(--bs-secondary-bg);
border-color:transparent;
border-radius:1rem
}
.form-range::-moz-range-thumb {
width:1rem;
height:1rem;
-moz-appearance:none;
-webkit-appearance:none;
appearance:none;
background-color:#0d6efd;
border:0;
border-radius:1rem;
-moz-transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-range::-moz-range-thumb {
-moz-transition:none;
transition:none
}
}
.form-range::-moz-range-thumb:active {
background-color:#b6d4fe
}
.form-range::-moz-range-track {
width:100%;
height:.5rem;
color:transparent;
cursor:pointer;
background-color:var(--bs-secondary-bg);
border-color:transparent;
border-radius:1rem
}
.form-range:disabled {
	pointer-events: none
}
.form-range:disabled::-webkit-slider-thumb {
background-color:var(--bs-secondary-color)
}
.form-range:disabled::-moz-range-thumb {
background-color:var(--bs-secondary-color)
}
.form-floating {
	position: relative
}
.form-floating>.form-control, .form-floating>.form-control-plaintext, .form-floating>.form-select {
height:calc(3.5rem + calc(var(--bs-border-width) * 2));
min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));
	line-height: 1.25
}
.form-floating>label {
	position: absolute;
	top: 0;
	left: 0;
	z-index: 2;
	max-width: 100%;
	height: 100%;
	padding: 1rem .75rem;
	overflow: hidden;
	color: rgba(var(--bs-body-color-rgb), .65);
	text-align: start;
	text-overflow: ellipsis;
	white-space: nowrap;
	pointer-events: none;
	border: var(--bs-border-width) solid transparent;
	transform-origin: 0 0;
	transition: opacity .1s ease-in-out, transform .1s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-floating>label {
	transition: none
}
}
.form-floating>.form-control, .form-floating>.form-control-plaintext {
	padding: 1rem .75rem
}
.form-floating>.form-control-plaintext::-moz-placeholder, .form-floating>.form-control::-moz-placeholder {
color:transparent
}
.form-floating>.form-control-plaintext::placeholder, .form-floating>.form-control::placeholder {
color:transparent
}
.form-floating>.form-control-plaintext:not(:-moz-placeholder), .form-floating>.form-control:not(:-moz-placeholder) {
	padding-top: 1.625rem;
	padding-bottom: .625rem
}
.form-floating>.form-control-plaintext:focus, .form-floating>.form-control-plaintext:not(:placeholder-shown), .form-floating>.form-control:focus, .form-floating>.form-control:not(:placeholder-shown) {
	padding-top: 1.625rem;
	padding-bottom: .625rem
}
.form-floating>.form-control-plaintext:-webkit-autofill, .form-floating>.form-control:-webkit-autofill {
padding-top:1.625rem;
padding-bottom:.625rem
}
.form-floating>.form-select {
	padding-top: 1.625rem;
	padding-bottom: .625rem;
	padding-left: .75rem
}
.form-floating>.form-control:not(:-moz-placeholder)~label {
	transform: scale(.85) translateY(-.5rem) translate(.15rem)
}
.form-floating>.form-control-plaintext~label, .form-floating>.form-control:focus~label, .form-floating>.form-control:not(:placeholder-shown)~label, .form-floating>.form-select~label {
	transform: scale(.85) translateY(-.5rem) translate(.15rem)
}
.form-floating>.form-control:-webkit-autofill~label {
transform:scale(.85) translateY(-.5rem) translate(.15rem)
}
.form-floating>textarea:not(:-moz-placeholder)~label:after {
	position: absolute;
	top: 1rem;
	right: .375rem;
	bottom: 1rem;
	left: .375rem;
	z-index: -1;
	height: 1.5em;
	content: "";
	background-color: var(--bs-body-bg);
	border-radius: var(--bs-border-radius)
}
.form-floating>textarea:focus~label:after, .form-floating>textarea:not(:placeholder-shown)~label:after {
	position: absolute;
	top: 1rem;
	right: .375rem;
	bottom: 1rem;
	left: .375rem;
	z-index: -1;
	height: 1.5em;
	content: "";
	background-color: var(--bs-body-bg);
	border-radius: var(--bs-border-radius)
}
.form-floating>textarea:disabled~label:after {
	background-color: var(--bs-secondary-bg)
}
.form-floating>.form-control-plaintext~label {
	border-width: var(--bs-border-width) 0
}
.form-floating>.form-control:disabled~label, .form-floating>:disabled~label {
	color: #6c757d
}
.input-group {
	position: relative;
	display: flex;
	flex-wrap: wrap;
	align-items: stretch;
	width: 100%
}
.input-group>.form-control, .input-group>.form-floating, .input-group>.form-select {
	position: relative;
	flex: 1 1 auto;
	width: 1%;
	min-width: 0
}
.input-group>.form-control:focus, .input-group>.form-floating:focus-within, .input-group>.form-select:focus {
z-index:5
}
.input-group .btn {
	position: relative;
	z-index: 2
}
.input-group .btn:focus {
	z-index: 5
}
.input-group-text {
	display: flex;
	align-items: center;
	padding: .375rem .75rem;
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	text-align: center;
	white-space: nowrap;
	background-color: var(--bs-tertiary-bg);
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: var(--bs-border-radius)
}
.input-group-lg>.btn, .input-group-lg>.form-control, .input-group-lg>.form-select, .input-group-lg>.input-group-text {
	padding: .5rem 1rem;
	font-size: 1.25rem;
	border-radius: var(--bs-border-radius-lg)
}
.input-group-sm>.btn, .input-group-sm>.form-control, .input-group-sm>.form-select, .input-group-sm>.input-group-text {
	padding: .25rem .5rem;
	font-size: .875rem;
	border-radius: var(--bs-border-radius-sm)
}
.input-group-lg>.form-select, .input-group-sm>.form-select {
	padding-right: 3rem
}
.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3), .input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control, .input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select, .input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4), .input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control, .input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select, .input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
margin-left:calc(-1 * var(--bs-border-width));
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.input-group>.form-floating:not(:first-child)>.form-control, .input-group>.form-floating:not(:first-child)>.form-select {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.valid-feedback {
	display: none;
	width: 100%;
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-form-valid-color)
}
.valid-tooltip {
	position: absolute;
	top: 100%;
	z-index: 5;
	display: none;
	max-width: 100%;
	padding: .25rem .5rem;
	margin-top: .1rem;
	font-size: .875rem;
	color: #fff;
	background-color: var(--bs-success);
	border-radius: var(--bs-border-radius)
}
.is-valid~.valid-feedback, .is-valid~.valid-tooltip, .was-validated :valid~.valid-feedback, .was-validated :valid~.valid-tooltip {
display:block
}
.form-control.is-valid, .was-validated .form-control:valid {
border-color:var(--bs-form-valid-border-color);
padding-right:calc(1.5em + .75rem);
background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1'/%3e%3c/svg%3e");
background-repeat:no-repeat;
background-position:right calc(.375em + .1875rem) center;
background-size:calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-valid:focus, .was-validated .form-control:valid:focus {
border-color:var(--bs-form-valid-border-color);
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
padding-right:calc(1.5em + .75rem);
background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.form-select.is-valid, .was-validated .form-select:valid {
border-color:var(--bs-form-valid-border-color)
}
.form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"], .was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"] {
--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1'/%3e%3c/svg%3e");
padding-right:4.125rem;
background-position:right .75rem center, center right 2.25rem;
background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-select.is-valid:focus, .was-validated .form-select:valid:focus {
border-color:var(--bs-form-valid-border-color);
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.form-control-color.is-valid, .was-validated .form-control-color:valid {
width:calc(3.75rem + 1.5em)
}
.form-check-input.is-valid, .was-validated .form-check-input:valid {
border-color:var(--bs-form-valid-border-color)
}
.form-check-input.is-valid:checked, .was-validated .form-check-input:valid:checked {
background-color:var(--bs-form-valid-color)
}
.form-check-input.is-valid:focus, .was-validated .form-check-input:valid:focus {
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.form-check-input.is-valid~.form-check-label, .was-validated .form-check-input:valid~.form-check-label {
color:var(--bs-form-valid-color)
}
.form-check-inline .form-check-input~.valid-feedback {
	margin-left: .5em
}
.input-group>.form-control:not(:focus).is-valid, .input-group>.form-floating:not(:focus-within).is-valid, .input-group>.form-select:not(:focus).is-valid, .was-validated .input-group>.form-control:not(:focus):valid, .was-validated .input-group>.form-floating:not(:focus-within):valid, .was-validated .input-group>.form-select:not(:focus):valid {
z-index:3
}
.invalid-feedback {
	display: none;
	width: 100%;
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-form-invalid-color)
}
.invalid-tooltip {
	position: absolute;
	top: 100%;
	z-index: 5;
	display: none;
	max-width: 100%;
	padding: .25rem .5rem;
	margin-top: .1rem;
	font-size: .875rem;
	color: #fff;
	background-color: var(--bs-danger);
	border-radius: var(--bs-border-radius)
}
.is-invalid~.invalid-feedback, .is-invalid~.invalid-tooltip, .was-validated :invalid~.invalid-feedback, .was-validated :invalid~.invalid-tooltip {
display:block
}
.form-control.is-invalid, .was-validated .form-control:invalid {
border-color:var(--bs-form-invalid-border-color);
padding-right:calc(1.5em + .75rem);
background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
background-repeat:no-repeat;
background-position:right calc(.375em + .1875rem) center;
background-size:calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-invalid:focus, .was-validated .form-control:invalid:focus {
border-color:var(--bs-form-invalid-border-color);
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
padding-right:calc(1.5em + .75rem);
background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.form-select.is-invalid, .was-validated .form-select:invalid {
border-color:var(--bs-form-invalid-border-color)
}
.form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"], .was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"] {
--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
padding-right:4.125rem;
background-position:right .75rem center, center right 2.25rem;
background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-select.is-invalid:focus, .was-validated .form-select:invalid:focus {
border-color:var(--bs-form-invalid-border-color);
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.form-control-color.is-invalid, .was-validated .form-control-color:invalid {
width:calc(3.75rem + 1.5em)
}
.form-check-input.is-invalid, .was-validated .form-check-input:invalid {
border-color:var(--bs-form-invalid-border-color)
}
.form-check-input.is-invalid:checked, .was-validated .form-check-input:invalid:checked {
background-color:var(--bs-form-invalid-color)
}
.form-check-input.is-invalid:focus, .was-validated .form-check-input:invalid:focus {
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.form-check-input.is-invalid~.form-check-label, .was-validated .form-check-input:invalid~.form-check-label {
color:var(--bs-form-invalid-color)
}
.form-check-inline .form-check-input~.invalid-feedback {
	margin-left: .5em
}
.input-group>.form-control:not(:focus).is-invalid, .input-group>.form-floating:not(:focus-within).is-invalid, .input-group>.form-select:not(:focus).is-invalid, .was-validated .input-group>.form-control:not(:focus):invalid, .was-validated .input-group>.form-floating:not(:focus-within):invalid, .was-validated .input-group>.form-select:not(:focus):invalid {
z-index:4
}
.btn {
--bs-btn-padding-x:.75rem;
--bs-btn-padding-y:.375rem;
--bs-btn-font-family:;
--bs-btn-font-size:1rem;
--bs-btn-font-weight:400;
--bs-btn-line-height:1.5;
--bs-btn-color:var(--bs-body-color);
--bs-btn-bg:transparent;
--bs-btn-border-width:var(--bs-border-width);
--bs-btn-border-color:transparent;
--bs-btn-border-radius:var(--bs-border-radius);
--bs-btn-hover-border-color:transparent;
--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, .15), 0 1px 1px rgba(0, 0, 0, .075);
--bs-btn-disabled-opacity:.65;
--bs-btn-focus-box-shadow:0 0 0 .25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
	display: inline-block;
	padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
	font-family: var(--bs-btn-font-family);
	font-size: var(--bs-btn-font-size);
	font-weight: var(--bs-btn-font-weight);
	line-height: var(--bs-btn-line-height);
	color: var(--bs-btn-color);
	text-align: center;
	text-decoration: none;
	vertical-align: middle;
	cursor: pointer;
	-webkit-user-select: none;
	-moz-user-select: none;
	user-select: none;
	border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
	border-radius: var(--bs-btn-border-radius);
	background-color: var(--bs-btn-bg);
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.btn {
	transition: none
}
}
.btn:hover {
	color: var(--bs-btn-hover-color);
	background-color: var(--bs-btn-hover-bg);
	border-color: var(--bs-btn-hover-border-color)
}
.btn-check+.btn:hover {
	color: var(--bs-btn-color);
	background-color: var(--bs-btn-bg);
	border-color: var(--bs-btn-border-color)
}
.btn:focus-visible {
color:var(--bs-btn-hover-color);
background-color:var(--bs-btn-hover-bg);
border-color:var(--bs-btn-hover-border-color);
outline:0;
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn-check:focus-visible+.btn {
border-color:var(--bs-btn-hover-border-color);
outline:0;
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn-check:checked+.btn, .btn.active, .btn.show, .btn:first-child:active, :not(.btn-check)+.btn:active {
	color: var(--bs-btn-active-color);
	background-color: var(--bs-btn-active-bg);
	border-color: var(--bs-btn-active-border-color)
}
.btn-check:checked+.btn:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible, .btn:first-child:active:focus-visible, :not(.btn-check)+.btn:active:focus-visible {
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn-check:checked:focus-visible+.btn {
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn.disabled, .btn:disabled, fieldset:disabled .btn {
	color: var(--bs-btn-disabled-color);
	pointer-events: none;
	background-color: var(--bs-btn-disabled-bg);
	border-color: var(--bs-btn-disabled-border-color);
	opacity: var(--bs-btn-disabled-opacity)
}
.btn-primary {
--bs-btn-color:#fff;
--bs-btn-bg:#0d6efd;
--bs-btn-border-color:#0d6efd;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#0b5ed7;
--bs-btn-hover-border-color:#0a58ca;
--bs-btn-focus-shadow-rgb:49, 132, 253;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#0a58ca;
--bs-btn-active-border-color:#0a53be;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#0d6efd;
--bs-btn-disabled-border-color:#0d6efd
}
.btn-secondary {
--bs-btn-color:#fff;
--bs-btn-bg:#6c757d;
--bs-btn-border-color:#6c757d;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#5c636a;
--bs-btn-hover-border-color:#565e64;
--bs-btn-focus-shadow-rgb:130, 138, 145;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#565e64;
--bs-btn-active-border-color:#51585e;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#6c757d;
--bs-btn-disabled-border-color:#6c757d
}
.btn-success {
--bs-btn-color:#fff;
--bs-btn-bg:#198754;
--bs-btn-border-color:#198754;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#157347;
--bs-btn-hover-border-color:#146c43;
--bs-btn-focus-shadow-rgb:60, 153, 110;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#146c43;
--bs-btn-active-border-color:#13653f;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#198754;
--bs-btn-disabled-border-color:#198754
}
.btn-info {
--bs-btn-color:#000;
--bs-btn-bg:#0dcaf0;
--bs-btn-border-color:#0dcaf0;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#31d2f2;
--bs-btn-hover-border-color:#25cff2;
--bs-btn-focus-shadow-rgb:11, 172, 204;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#3dd5f3;
--bs-btn-active-border-color:#25cff2;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#0dcaf0;
--bs-btn-disabled-border-color:#0dcaf0
}
.btn-warning {
--bs-btn-color:#000;
--bs-btn-bg:#ffc107;
--bs-btn-border-color:#ffc107;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#ffca2c;
--bs-btn-hover-border-color:#ffc720;
--bs-btn-focus-shadow-rgb:217, 164, 6;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#ffcd39;
--bs-btn-active-border-color:#ffc720;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#ffc107;
--bs-btn-disabled-border-color:#ffc107
}
.btn-danger {
--bs-btn-color:#fff;
--bs-btn-bg:#dc3545;
--bs-btn-border-color:#dc3545;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#bb2d3b;
--bs-btn-hover-border-color:#b02a37;
--bs-btn-focus-shadow-rgb:225, 83, 97;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#b02a37;
--bs-btn-active-border-color:#a52834;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#dc3545;
--bs-btn-disabled-border-color:#dc3545
}
.btn-light {
--bs-btn-color:#000;
--bs-btn-bg:#f8f9fa;
--bs-btn-border-color:#f8f9fa;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#d3d4d5;
--bs-btn-hover-border-color:#c6c7c8;
--bs-btn-focus-shadow-rgb:211, 212, 213;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#c6c7c8;
--bs-btn-active-border-color:#babbbc;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#f8f9fa;
--bs-btn-disabled-border-color:#f8f9fa
}
.btn-dark {
--bs-btn-color:#fff;
--bs-btn-bg:#212529;
--bs-btn-border-color:#212529;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#424649;
--bs-btn-hover-border-color:#373b3e;
--bs-btn-focus-shadow-rgb:66, 70, 73;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#4d5154;
--bs-btn-active-border-color:#373b3e;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#212529;
--bs-btn-disabled-border-color:#212529
}
.btn-outline-primary {
--bs-btn-color:#0d6efd;
--bs-btn-border-color:#0d6efd;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#0d6efd;
--bs-btn-hover-border-color:#0d6efd;
--bs-btn-focus-shadow-rgb:13, 110, 253;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#0d6efd;
--bs-btn-active-border-color:#0d6efd;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#0d6efd;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#0d6efd;
--bs-gradient:none
}
.btn-outline-secondary {
--bs-btn-color:#6c757d;
--bs-btn-border-color:#6c757d;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#6c757d;
--bs-btn-hover-border-color:#6c757d;
--bs-btn-focus-shadow-rgb:108, 117, 125;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#6c757d;
--bs-btn-active-border-color:#6c757d;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#6c757d;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#6c757d;
--bs-gradient:none
}
.btn-outline-success {
--bs-btn-color:#198754;
--bs-btn-border-color:#198754;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#198754;
--bs-btn-hover-border-color:#198754;
--bs-btn-focus-shadow-rgb:25, 135, 84;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#198754;
--bs-btn-active-border-color:#198754;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#198754;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#198754;
--bs-gradient:none
}
.btn-outline-info {
--bs-btn-color:#0dcaf0;
--bs-btn-border-color:#0dcaf0;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#0dcaf0;
--bs-btn-hover-border-color:#0dcaf0;
--bs-btn-focus-shadow-rgb:13, 202, 240;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#0dcaf0;
--bs-btn-active-border-color:#0dcaf0;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#0dcaf0;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#0dcaf0;
--bs-gradient:none
}
.btn-outline-warning {
--bs-btn-color:#ffc107;
--bs-btn-border-color:#ffc107;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#ffc107;
--bs-btn-hover-border-color:#ffc107;
--bs-btn-focus-shadow-rgb:255, 193, 7;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#ffc107;
--bs-btn-active-border-color:#ffc107;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#ffc107;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#ffc107;
--bs-gradient:none
}
.btn-outline-danger {
--bs-btn-color:#dc3545;
--bs-btn-border-color:#dc3545;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#dc3545;
--bs-btn-hover-border-color:#dc3545;
--bs-btn-focus-shadow-rgb:220, 53, 69;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#dc3545;
--bs-btn-active-border-color:#dc3545;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#dc3545;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#dc3545;
--bs-gradient:none
}
.btn-outline-light {
--bs-btn-color:#f8f9fa;
--bs-btn-border-color:#f8f9fa;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#f8f9fa;
--bs-btn-hover-border-color:#f8f9fa;
--bs-btn-focus-shadow-rgb:248, 249, 250;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#f8f9fa;
--bs-btn-active-border-color:#f8f9fa;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#f8f9fa;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#f8f9fa;
--bs-gradient:none
}
.btn-outline-dark {
--bs-btn-color:#212529;
--bs-btn-border-color:#212529;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#212529;
--bs-btn-hover-border-color:#212529;
--bs-btn-focus-shadow-rgb:33, 37, 41;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#212529;
--bs-btn-active-border-color:#212529;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, .125);
--bs-btn-disabled-color:#212529;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#212529;
--bs-gradient:none
}
.btn-link {
--bs-btn-font-weight:400;
--bs-btn-color:var(--bs-link-color);
--bs-btn-bg:transparent;
--bs-btn-border-color:transparent;
--bs-btn-hover-color:var(--bs-link-hover-color);
--bs-btn-hover-border-color:transparent;
--bs-btn-active-color:var(--bs-link-hover-color);
--bs-btn-active-border-color:transparent;
--bs-btn-disabled-color:#6c757d;
--bs-btn-disabled-border-color:transparent;
--bs-btn-box-shadow:0 0 0 #000;
--bs-btn-focus-shadow-rgb:49, 132, 253;
	text-decoration: underline
}
.btn-link:focus-visible {
color:var(--bs-btn-color)
}
.btn-link:hover {
	color: var(--bs-btn-hover-color)
}
.btn-group-lg>.btn, .btn-lg {
--bs-btn-padding-y:.5rem;
--bs-btn-padding-x:1rem;
--bs-btn-font-size:1.25rem;
--bs-btn-border-radius:var(--bs-border-radius-lg)
}
.btn-group-sm>.btn, .btn-sm {
--bs-btn-padding-y:.25rem;
--bs-btn-padding-x:.5rem;
--bs-btn-font-size:.875rem;
--bs-btn-border-radius:var(--bs-border-radius-sm)
}
.fade {
	transition: opacity .15s linear
}

@media (prefers-reduced-motion:reduce) {
.fade {
	transition: none
}
}
.fade:not(.show) {
	opacity: 0
}
.collapse:not(.show) {
	display: none
}
.collapsing {
	height: 0;
	overflow: hidden;
	transition: height .35s ease
}

@media (prefers-reduced-motion:reduce) {
.collapsing {
	transition: none
}
}
.collapsing.collapse-horizontal {
	width: 0;
	height: auto;
	transition: width .35s ease
}

@media (prefers-reduced-motion:reduce) {
.collapsing.collapse-horizontal {
	transition: none
}
}
.dropdown, .dropdown-center, .dropend, .dropstart, .dropup, .dropup-center {
	position: relative
}
.dropdown-toggle {
	white-space: nowrap
}
.dropdown-toggle:after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid;
	border-right: .3em solid transparent;
	border-bottom: 0;
	border-left: .3em solid transparent
}
.dropdown-toggle:empty:after {
	margin-left: 0
}
.dropdown-menu {
--bs-dropdown-zindex:1000;
--bs-dropdown-min-width:10rem;
--bs-dropdown-padding-x:0;
--bs-dropdown-padding-y:.5rem;
--bs-dropdown-spacer:.125rem;
--bs-dropdown-font-size:1rem;
--bs-dropdown-color:var(--bs-body-color);
--bs-dropdown-bg:var(--bs-body-bg);
--bs-dropdown-border-color:var(--bs-border-color-translucent);
--bs-dropdown-border-radius:var(--bs-border-radius);
--bs-dropdown-border-width:var(--bs-border-width);
--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));
--bs-dropdown-divider-bg:var(--bs-border-color-translucent);
--bs-dropdown-divider-margin-y:.5rem;
--bs-dropdown-box-shadow:var(--bs-box-shadow);
--bs-dropdown-link-color:var(--bs-body-color);
--bs-dropdown-link-hover-color:var(--bs-body-color);
--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);
--bs-dropdown-link-active-color:#fff;
--bs-dropdown-link-active-bg:#0d6efd;
--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);
--bs-dropdown-item-padding-x:1rem;
--bs-dropdown-item-padding-y:.25rem;
--bs-dropdown-header-color:#6c757d;
--bs-dropdown-header-padding-x:1rem;
--bs-dropdown-header-padding-y:.5rem;
	position: absolute;
	z-index: var(--bs-dropdown-zindex);
	display: none;
	min-width: var(--bs-dropdown-min-width);
	padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
	margin: 0;
	font-size: var(--bs-dropdown-font-size);
	color: var(--bs-dropdown-color);
	text-align: left;
	list-style: none;
	background-color: var(--bs-dropdown-bg);
	background-clip: padding-box;
	border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
	border-radius: var(--bs-dropdown-border-radius)
}
.dropdown-menu[data-bs-popper] {
	top: 100%;
	left: 0;
	margin-top: var(--bs-dropdown-spacer)
}
.dropdown-menu-start {
--bs-position:start
}
.dropdown-menu-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-end {
--bs-position:end
}
.dropdown-menu-end[data-bs-popper] {
	right: 0;
	left: auto
}

@media (min-width:576px) {
.dropdown-menu-sm-start {
--bs-position:start
}
.dropdown-menu-sm-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-sm-end {
--bs-position:end
}
.dropdown-menu-sm-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:768px) {
.dropdown-menu-md-start {
--bs-position:start
}
.dropdown-menu-md-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-md-end {
--bs-position:end
}
.dropdown-menu-md-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:992px) {
.dropdown-menu-lg-start {
--bs-position:start
}
.dropdown-menu-lg-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-lg-end {
--bs-position:end
}
.dropdown-menu-lg-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:1200px) {
.dropdown-menu-xl-start {
--bs-position:start
}
.dropdown-menu-xl-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-xl-end {
--bs-position:end
}
.dropdown-menu-xl-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:1400px) {
.dropdown-menu-xxl-start {
--bs-position:start
}
.dropdown-menu-xxl-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-xxl-end {
--bs-position:end
}
.dropdown-menu-xxl-end[data-bs-popper] {
	right: 0;
	left: auto
}
}
.dropup .dropdown-menu[data-bs-popper] {
	top: auto;
	bottom: 100%;
	margin-top: 0;
	margin-bottom: var(--bs-dropdown-spacer)
}
.dropup .dropdown-toggle:after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: 0;
	border-right: .3em solid transparent;
	border-bottom: .3em solid;
	border-left: .3em solid transparent
}
.dropup .dropdown-toggle:empty:after {
	margin-left: 0
}
.dropend .dropdown-menu[data-bs-popper] {
	top: 0;
	right: auto;
	left: 100%;
	margin-top: 0;
	margin-left: var(--bs-dropdown-spacer)
}
.dropend .dropdown-toggle:after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid transparent;
	border-right: 0;
	border-bottom: .3em solid transparent;
	border-left: .3em solid
}
.dropend .dropdown-toggle:empty:after {
	margin-left: 0
}
.dropend .dropdown-toggle:after {
	vertical-align: 0
}
.dropstart .dropdown-menu[data-bs-popper] {
	top: 0;
	right: 100%;
	left: auto;
	margin-top: 0;
	margin-right: var(--bs-dropdown-spacer)
}
.dropstart .dropdown-toggle:after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: ""
}
.dropstart .dropdown-toggle:after {
	display: none
}
.dropstart .dropdown-toggle:before {
	display: inline-block;
	margin-right: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid transparent;
	border-right: .3em solid;
	border-bottom: .3em solid transparent
}
.dropstart .dropdown-toggle:empty:after {
	margin-left: 0
}
.dropstart .dropdown-toggle:before {
	vertical-align: 0
}
.dropdown-divider {
	height: 0;
	margin: var(--bs-dropdown-divider-margin-y) 0;
	overflow: hidden;
	border-top: 1px solid var(--bs-dropdown-divider-bg);
	opacity: 1
}
.dropdown-item {
	display: block;
	width: 100%;
	padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
	clear: both;
	font-weight: 400;
	color: var(--bs-dropdown-link-color);
	text-align: inherit;
	text-decoration: none;
	white-space: nowrap;
	background-color: transparent;
	border: 0;
	border-radius: var(--bs-dropdown-item-border-radius, 0)
}
.dropdown-item:focus, .dropdown-item:hover {
	color: var(--bs-dropdown-link-hover-color);
	background-color: var(--bs-dropdown-link-hover-bg)
}
.dropdown-item.active, .dropdown-item:active {
	color: var(--bs-dropdown-link-active-color);
	text-decoration: none;
	background-color: var(--bs-dropdown-link-active-bg)
}
.dropdown-item.disabled, .dropdown-item:disabled {
	color: var(--bs-dropdown-link-disabled-color);
	pointer-events: none;
	background-color: transparent
}
.dropdown-menu.show {
	display: block
}
.dropdown-header {
	display: block;
	padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
	margin-bottom: 0;
	font-size: .875rem;
	color: var(--bs-dropdown-header-color);
	white-space: nowrap
}
.dropdown-item-text {
	display: block;
	padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
	color: var(--bs-dropdown-link-color)
}
.dropdown-menu-dark {
--bs-dropdown-color:#dee2e6;
--bs-dropdown-bg:#343a40;
--bs-dropdown-border-color:var(--bs-border-color-translucent);
--bs-dropdown-box-shadow:;
--bs-dropdown-link-color:#dee2e6;
--bs-dropdown-link-hover-color:#fff;
--bs-dropdown-divider-bg:var(--bs-border-color-translucent);
--bs-dropdown-link-hover-bg:rgba(255, 255, 255, .15);
--bs-dropdown-link-active-color:#fff;
--bs-dropdown-link-active-bg:#0d6efd;
--bs-dropdown-link-disabled-color:#adb5bd;
--bs-dropdown-header-color:#adb5bd
}
.btn-group, .btn-group-vertical {
	position: relative;
	display: inline-flex;
	vertical-align: middle
}
.btn-group-vertical>.btn, .btn-group>.btn {
	position: relative;
	flex: 1 1 auto
}
.btn-group-vertical>.btn-check:checked+.btn, .btn-group-vertical>.btn-check:focus+.btn, .btn-group-vertical>.btn.active, .btn-group-vertical>.btn:active, .btn-group-vertical>.btn:focus, .btn-group-vertical>.btn:hover, .btn-group>.btn-check:checked+.btn, .btn-group>.btn-check:focus+.btn, .btn-group>.btn.active, .btn-group>.btn:active, .btn-group>.btn:focus, .btn-group>.btn:hover {
	z-index: 1
}
.btn-toolbar {
	display: flex;
	flex-wrap: wrap;
	justify-content: flex-start
}
.btn-toolbar .input-group {
	width: auto
}
.btn-group {
	border-radius: var(--bs-border-radius)
}
.btn-group>.btn-group:not(:first-child), .btn-group>:not(.btn-check:first-child)+.btn {
margin-left:calc(-1 * var(--bs-border-width))
}
.btn-group>.btn-group:not(:last-child)>.btn, .btn-group>.btn.dropdown-toggle-split:first-child, .btn-group>.btn:not(:last-child):not(.dropdown-toggle) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.btn-group>.btn-group:not(:first-child)>.btn, .btn-group>.btn:nth-child(n+3), .btn-group>:not(.btn-check)+.btn {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.dropdown-toggle-split {
	padding-right: .5625rem;
	padding-left: .5625rem
}
.dropdown-toggle-split:after, .dropend .dropdown-toggle-split:after, .dropup .dropdown-toggle-split:after {
	margin-left: 0
}
.dropstart .dropdown-toggle-split:before {
	margin-right: 0
}
.btn-group-sm>.btn+.dropdown-toggle-split, .btn-sm+.dropdown-toggle-split {
	padding-right: .375rem;
	padding-left: .375rem
}
.btn-group-lg>.btn+.dropdown-toggle-split, .btn-lg+.dropdown-toggle-split {
	padding-right: .75rem;
	padding-left: .75rem
}
.btn-group-vertical {
	flex-direction: column;
	align-items: flex-start;
	justify-content: center
}
.btn-group-vertical>.btn, .btn-group-vertical>.btn-group {
	width: 100%
}
.btn-group-vertical>.btn-group:not(:first-child), .btn-group-vertical>.btn:not(:first-child) {
margin-top:calc(-1 * var(--bs-border-width))
}
.btn-group-vertical>.btn-group:not(:last-child)>.btn, .btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle) {
	border-bottom-right-radius: 0;
	border-bottom-left-radius: 0
}
.btn-group-vertical>.btn-group:not(:first-child)>.btn, .btn-group-vertical>.btn:nth-child(n+3), .btn-group-vertical>:not(.btn-check)+.btn {
	border-top-left-radius: 0;
	border-top-right-radius: 0
}
.nav {
--bs-nav-link-padding-x:1rem;
--bs-nav-link-padding-y:.5rem;
--bs-nav-link-font-weight:;
--bs-nav-link-color:var(--bs-link-color);
--bs-nav-link-hover-color:var(--bs-link-hover-color);
--bs-nav-link-disabled-color:var(--bs-secondary-color);
	display: flex;
	flex-wrap: wrap;
	padding-left: 0;
	margin-bottom: 0;
	list-style: none
}
.nav-link {
	display: block;
	padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
	font-size: var(--bs-nav-link-font-size);
	font-weight: var(--bs-nav-link-font-weight);
	color: var(--bs-nav-link-color);
	text-decoration: none;
	background: 0 0;
	border: 0;
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.nav-link {
	transition: none
}
}
.nav-link:focus, .nav-link:hover {
	color: var(--bs-nav-link-hover-color)
}
.nav-link:focus-visible {
outline:0;
box-shadow:0 0 0 .25rem #0d6efd40
}
.nav-link.disabled, .nav-link:disabled {
	color: var(--bs-nav-link-disabled-color);
	pointer-events: none;
	cursor: default
}
.nav-tabs {
--bs-nav-tabs-border-width:var(--bs-border-width);
--bs-nav-tabs-border-color:var(--bs-border-color);
--bs-nav-tabs-border-radius:var(--bs-border-radius);
--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);
--bs-nav-tabs-link-active-bg:var(--bs-body-bg);
--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
	border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)
}
.nav-tabs .nav-link {
margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));
	border: var(--bs-nav-tabs-border-width) solid transparent;
	border-top-left-radius: var(--bs-nav-tabs-border-radius);
	border-top-right-radius: var(--bs-nav-tabs-border-radius)
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
	isolation: isolate;
	border-color: var(--bs-nav-tabs-link-hover-border-color)
}
.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
	color: var(--bs-nav-tabs-link-active-color);
	background-color: var(--bs-nav-tabs-link-active-bg);
	border-color: var(--bs-nav-tabs-link-active-border-color)
}
.nav-tabs .dropdown-menu {
margin-top:calc(-1 * var(--bs-nav-tabs-border-width));
	border-top-left-radius: 0;
	border-top-right-radius: 0
}
.nav-pills {
--bs-nav-pills-border-radius:var(--bs-border-radius);
--bs-nav-pills-link-active-color:#fff;
--bs-nav-pills-link-active-bg:#0d6efd
}
.nav-pills .nav-link {
	border-radius: var(--bs-nav-pills-border-radius)
}
.nav-pills .nav-link.active, .nav-pills .show>.nav-link {
	color: var(--bs-nav-pills-link-active-color);
	background-color: var(--bs-nav-pills-link-active-bg)
}
.nav-underline {
--bs-nav-underline-gap:1rem;
--bs-nav-underline-border-width:.125rem;
--bs-nav-underline-link-active-color:var(--bs-emphasis-color);
	gap: var(--bs-nav-underline-gap)
}
.nav-underline .nav-link {
	padding-right: 0;
	padding-left: 0;
	border-bottom: var(--bs-nav-underline-border-width) solid transparent
}
.nav-underline .nav-link:focus, .nav-underline .nav-link:hover {
	border-bottom-color: currentcolor
}
.nav-underline .nav-link.active, .nav-underline .show>.nav-link {
	font-weight: 700;
	color: var(--bs-nav-underline-link-active-color);
	border-bottom-color: currentcolor
}
.nav-fill .nav-item, .nav-fill>.nav-link {
	flex: 1 1 auto;
	text-align: center
}
.nav-justified .nav-item, .nav-justified>.nav-link {
	flex-grow: 1;
	flex-basis: 0;
	text-align: center
}
.nav-fill .nav-item .nav-link, .nav-justified .nav-item .nav-link {
	width: 100%
}
.tab-content>.tab-pane {
	display: none
}
.tab-content>.active {
	display: block
}
.navbar {
--bs-navbar-padding-x:0;
--bs-navbar-padding-y:.5rem;
--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), .65);
--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), .8);
--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), .3);
--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-brand-padding-y:.3125rem;
--bs-navbar-brand-margin-end:1rem;
--bs-navbar-brand-font-size:1.25rem;
--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-nav-link-padding-x:.5rem;
--bs-navbar-toggler-padding-y:.25rem;
--bs-navbar-toggler-padding-x:.75rem;
--bs-navbar-toggler-font-size:1.25rem;
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), .15);
--bs-navbar-toggler-border-radius:var(--bs-border-radius);
--bs-navbar-toggler-focus-width:.25rem;
--bs-navbar-toggler-transition:box-shadow .15s ease-in-out;
	position: relative;
	display: flex;
	flex-wrap: wrap;
	align-items: center;
	justify-content: space-between;
	padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)
}
.navbar>.container, .navbar>.container-fluid, .navbar>.container-lg, .navbar>.container-md, .navbar>.container-sm, .navbar>.container-xl, .navbar>.container-xxl {
	display: flex;
	flex-wrap: inherit;
	align-items: center;
	justify-content: space-between
}
.navbar-brand {
	padding-top: var(--bs-navbar-brand-padding-y);
	padding-bottom: var(--bs-navbar-brand-padding-y);
	margin-right: var(--bs-navbar-brand-margin-end);
	font-size: var(--bs-navbar-brand-font-size);
	color: var(--bs-navbar-brand-color);
	text-decoration: none;
	white-space: nowrap
}
.navbar-brand:focus, .navbar-brand:hover {
	color: var(--bs-navbar-brand-hover-color)
}
.navbar-nav {
--bs-nav-link-padding-x:0;
--bs-nav-link-padding-y:.5rem;
--bs-nav-link-font-weight:;
--bs-nav-link-color:var(--bs-navbar-color);
--bs-nav-link-hover-color:var(--bs-navbar-hover-color);
--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);
	display: flex;
	flex-direction: column;
	padding-left: 0;
	margin-bottom: 0;
	list-style: none
}
.navbar-nav .nav-link.active, .navbar-nav .nav-link.show {
	color: var(--bs-navbar-active-color)
}
.navbar-nav .dropdown-menu {
	position: static
}
.navbar-text {
	padding-top: .5rem;
	padding-bottom: .5rem;
	color: var(--bs-navbar-color)
}
.navbar-text a, .navbar-text a:focus, .navbar-text a:hover {
	color: var(--bs-navbar-active-color)
}
.navbar-collapse {
	flex-grow: 1;
	flex-basis: 100%;
	align-items: center
}
.navbar-toggler {
	padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
	font-size: var(--bs-navbar-toggler-font-size);
	line-height: 1;
	color: var(--bs-navbar-color);
	background-color: transparent;
	border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
	border-radius: var(--bs-navbar-toggler-border-radius);
	transition: var(--bs-navbar-toggler-transition)
}

@media (prefers-reduced-motion:reduce) {
.navbar-toggler {
	transition: none
}
}
.navbar-toggler:hover {
	text-decoration: none
}
.navbar-toggler:focus {
	text-decoration: none;
	outline: 0;
	box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width)
}
.navbar-toggler-icon {
	display: inline-block;
	width: 1.5em;
	height: 1.5em;
	vertical-align: middle;
	background-image: var(--bs-navbar-toggler-icon-bg);
	background-repeat: no-repeat;
	background-position: center;
	background-size: 100%
}
.navbar-nav-scroll {
	max-height: var(--bs-scroll-height, 75vh);
	overflow-y: auto
}

@media (min-width:576px) {
.navbar-expand-sm {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-sm .navbar-nav {
	flex-direction: row
}
.navbar-expand-sm .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-sm .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-sm .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-sm .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-sm .navbar-toggler {
	display: none
}
.navbar-expand-sm .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-sm .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-sm .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:768px) {
.navbar-expand-md {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-md .navbar-nav {
	flex-direction: row
}
.navbar-expand-md .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-md .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-md .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-md .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-md .navbar-toggler {
	display: none
}
.navbar-expand-md .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-md .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-md .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:992px) {
.navbar-expand-lg {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-lg .navbar-nav {
	flex-direction: row
}
.navbar-expand-lg .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-lg .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-lg .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-lg .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-lg .navbar-toggler {
	display: none
}
.navbar-expand-lg .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-lg .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-lg .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:1200px) {
.navbar-expand-xl {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-xl .navbar-nav {
	flex-direction: row
}
.navbar-expand-xl .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-xl .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-xl .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-xl .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-xl .navbar-toggler {
	display: none
}
.navbar-expand-xl .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-xl .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-xl .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:1400px) {
.navbar-expand-xxl {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-xxl .navbar-nav {
	flex-direction: row
}
.navbar-expand-xxl .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-xxl .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-xxl .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-xxl .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-xxl .navbar-toggler {
	display: none
}
.navbar-expand-xxl .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-xxl .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-xxl .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}
.navbar-expand {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand .navbar-nav {
	flex-direction: row
}
.navbar-expand .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand .navbar-toggler {
	display: none
}
.navbar-expand .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
.navbar-dark, .navbar[data-bs-theme=dark] {
--bs-navbar-color:rgba(255, 255, 255, .55);
--bs-navbar-hover-color:rgba(255, 255, 255, .75);
--bs-navbar-disabled-color:rgba(255, 255, 255, .25);
--bs-navbar-active-color:#fff;
--bs-navbar-brand-color:#fff;
--bs-navbar-brand-hover-color:#fff;
--bs-navbar-toggler-border-color:rgba(255, 255, 255, .1);
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
[data-bs-theme=dark] .navbar-toggler-icon {
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
.card {
--bs-card-spacer-y:1rem;
--bs-card-spacer-x:1rem;
--bs-card-title-spacer-y:.5rem;
--bs-card-title-color:;
--bs-card-subtitle-color:;
--bs-card-border-width:var(--bs-border-width);
--bs-card-border-color:var(--bs-border-color-translucent);
--bs-card-border-radius:var(--bs-border-radius);
--bs-card-box-shadow:;
--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
--bs-card-cap-padding-y:.5rem;
--bs-card-cap-padding-x:1rem;
--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), .03);
--bs-card-cap-color:;
--bs-card-height:;
--bs-card-color:;
--bs-card-bg:var(--bs-body-bg);
--bs-card-img-overlay-padding:1rem;
--bs-card-group-margin:.75rem;
	position: relative;
	display: flex;
	flex-direction: column;
	min-width: 0;
	height: var(--bs-card-height);
	color: var(--bs-body-color);
	word-wrap: break-word;
	background-color: var(--bs-card-bg);
	background-clip: border-box;
	border: var(--bs-card-border-width) solid var(--bs-card-border-color);
	border-radius: var(--bs-card-border-radius)
}
.card>hr {
	margin-right: 0;
	margin-left: 0
}
.card>.list-group {
	border-top: inherit;
	border-bottom: inherit
}
.card>.list-group:first-child {
	border-top-width: 0;
	border-top-left-radius: var(--bs-card-inner-border-radius);
	border-top-right-radius: var(--bs-card-inner-border-radius)
}
.card>.list-group:last-child {
	border-bottom-width: 0;
	border-bottom-right-radius: var(--bs-card-inner-border-radius);
	border-bottom-left-radius: var(--bs-card-inner-border-radius)
}
.card>.card-header+.list-group, .card>.list-group+.card-footer {
	border-top: 0
}
.card-body {
	flex: 1 1 auto;
	padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
	color: var(--bs-card-color)
}
.card-title {
	margin-bottom: var(--bs-card-title-spacer-y);
	color: var(--bs-card-title-color)
}
.card-subtitle {
margin-top:calc(-.5 * var(--bs-card-title-spacer-y));
	margin-bottom: 0;
	color: var(--bs-card-subtitle-color)
}
.card-text:last-child {
	margin-bottom: 0
}
.card-link+.card-link {
	margin-left: var(--bs-card-spacer-x)
}
.card-header {
	padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
	margin-bottom: 0;
	color: var(--bs-card-cap-color);
	background-color: var(--bs-card-cap-bg);
	border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color)
}
.card-header:first-child {
	border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0
}
.card-footer {
	padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
	color: var(--bs-card-cap-color);
	background-color: var(--bs-card-cap-bg);
	border-top: var(--bs-card-border-width) solid var(--bs-card-border-color)
}
.card-footer:last-child {
	border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)
}
.card-header-tabs {
margin-right:calc(-.5 * var(--bs-card-cap-padding-x));
margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));
margin-left:calc(-.5 * var(--bs-card-cap-padding-x));
	border-bottom: 0
}
.card-header-tabs .nav-link.active {
	background-color: var(--bs-card-bg);
	border-bottom-color: var(--bs-card-bg)
}
.card-header-pills {
margin-right:calc(-.5 * var(--bs-card-cap-padding-x));
margin-left:calc(-.5 * var(--bs-card-cap-padding-x))
}
.card-img-overlay {
	position: absolute;
	top: 0;
	right: 0;
	bottom: 0;
	left: 0;
	padding: var(--bs-card-img-overlay-padding);
	border-radius: var(--bs-card-inner-border-radius)
}
.card-img, .card-img-bottom, .card-img-top {
	width: 100%
}
.card-img, .card-img-top {
	border-top-left-radius: var(--bs-card-inner-border-radius);
	border-top-right-radius: var(--bs-card-inner-border-radius)
}
.card-img, .card-img-bottom {
	border-bottom-right-radius: var(--bs-card-inner-border-radius);
	border-bottom-left-radius: var(--bs-card-inner-border-radius)
}
.card-group>.card {
	margin-bottom: var(--bs-card-group-margin)
}

@media (min-width:576px) {
.card-group {
	display: flex;
	flex-flow: row wrap
}
.card-group>.card {
	flex: 1 0 0;
	margin-bottom: 0
}
.card-group>.card+.card {
	margin-left: 0;
	border-left: 0
}
.card-group>.card:not(:last-child) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.card-group>.card:not(:last-child)>.card-header, .card-group>.card:not(:last-child)>.card-img-top {
	border-top-right-radius: 0
}
.card-group>.card:not(:last-child)>.card-footer, .card-group>.card:not(:last-child)>.card-img-bottom {
	border-bottom-right-radius: 0
}
.card-group>.card:not(:first-child) {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.card-group>.card:not(:first-child)>.card-header, .card-group>.card:not(:first-child)>.card-img-top {
	border-top-left-radius: 0
}
.card-group>.card:not(:first-child)>.card-footer, .card-group>.card:not(:first-child)>.card-img-bottom {
	border-bottom-left-radius: 0
}
}
.accordion {
--bs-accordion-color:var(--bs-body-color);
--bs-accordion-bg:var(--bs-body-bg);
--bs-accordion-transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out, border-radius .15s ease;
--bs-accordion-border-color:var(--bs-border-color);
--bs-accordion-border-width:var(--bs-border-width);
--bs-accordion-border-radius:var(--bs-border-radius);
--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
--bs-accordion-btn-padding-x:1.25rem;
--bs-accordion-btn-padding-y:1rem;
--bs-accordion-btn-color:var(--bs-body-color);
--bs-accordion-btn-bg:var(--bs-accordion-bg);
--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
--bs-accordion-btn-icon-width:1.25rem;
--bs-accordion-btn-icon-transform:rotate(-180deg);
--bs-accordion-btn-icon-transition:transform .2s ease-in-out;
--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23052c65' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
--bs-accordion-btn-focus-box-shadow:0 0 0 .25rem rgba(13, 110, 253, .25);
--bs-accordion-body-padding-x:1.25rem;
--bs-accordion-body-padding-y:1rem;
--bs-accordion-active-color:var(--bs-primary-text-emphasis);
--bs-accordion-active-bg:var(--bs-primary-bg-subtle)
}
.accordion-button {
	position: relative;
	display: flex;
	align-items: center;
	width: 100%;
	padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
	font-size: 1rem;
	color: var(--bs-accordion-btn-color);
	text-align: left;
	background-color: var(--bs-accordion-btn-bg);
	border: 0;
	border-radius: 0;
	overflow-anchor: none;
	transition: var(--bs-accordion-transition)
}

@media (prefers-reduced-motion:reduce) {
.accordion-button {
	transition: none
}
}
.accordion-button:not(.collapsed) {
	color: var(--bs-accordion-active-color);
	background-color: var(--bs-accordion-active-bg);
box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)
}
.accordion-button:not(.collapsed):after {
	background-image: var(--bs-accordion-btn-active-icon);
	transform: var(--bs-accordion-btn-icon-transform)
}
.accordion-button:after {
	flex-shrink: 0;
	width: var(--bs-accordion-btn-icon-width);
	height: var(--bs-accordion-btn-icon-width);
	margin-left: auto;
	content: "";
	background-image: var(--bs-accordion-btn-icon);
	background-repeat: no-repeat;
	background-size: var(--bs-accordion-btn-icon-width);
	transition: var(--bs-accordion-btn-icon-transition)
}

@media (prefers-reduced-motion:reduce) {
.accordion-button:after {
	transition: none
}
}
.accordion-button:hover {
	z-index: 2
}
.accordion-button:focus {
	z-index: 3;
	outline: 0;
	box-shadow: var(--bs-accordion-btn-focus-box-shadow)
}
.accordion-header {
	margin-bottom: 0
}
.accordion-item {
	color: var(--bs-accordion-color);
	background-color: var(--bs-accordion-bg);
	border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)
}
.accordion-item:first-of-type {
	border-top-left-radius: var(--bs-accordion-border-radius);
	border-top-right-radius: var(--bs-accordion-border-radius)
}
.accordion-item:first-of-type>.accordion-header .accordion-button {
	border-top-left-radius: var(--bs-accordion-inner-border-radius);
	border-top-right-radius: var(--bs-accordion-inner-border-radius)
}
.accordion-item:not(:first-of-type) {
	border-top: 0
}
.accordion-item:last-of-type {
	border-bottom-right-radius: var(--bs-accordion-border-radius);
	border-bottom-left-radius: var(--bs-accordion-border-radius)
}
.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed {
	border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
	border-bottom-left-radius: var(--bs-accordion-inner-border-radius)
}
.accordion-item:last-of-type>.accordion-collapse {
	border-bottom-right-radius: var(--bs-accordion-border-radius);
	border-bottom-left-radius: var(--bs-accordion-border-radius)
}
.accordion-body {
	padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)
}
.accordion-flush>.accordion-item {
	border-right: 0;
	border-left: 0;
	border-radius: 0
}
.accordion-flush>.accordion-item:first-child {
	border-top: 0
}
.accordion-flush>.accordion-item:last-child {
	border-bottom: 0
}
.accordion-flush>.accordion-item>.accordion-collapse, .accordion-flush>.accordion-item>.accordion-header .accordion-button, .accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed {
	border-radius: 0
}
[data-bs-theme=dark] .accordion-button:after {
--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e");
--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e")
}
.breadcrumb {
--bs-breadcrumb-padding-x:0;
--bs-breadcrumb-padding-y:0;
--bs-breadcrumb-margin-bottom:1rem;
--bs-breadcrumb-bg:;
--bs-breadcrumb-border-radius:;
--bs-breadcrumb-divider-color:var(--bs-secondary-color);
--bs-breadcrumb-item-padding-x:.5rem;
--bs-breadcrumb-item-active-color:var(--bs-secondary-color);
	display: flex;
	flex-wrap: wrap;
	padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
	margin-bottom: var(--bs-breadcrumb-margin-bottom);
	font-size: var(--bs-breadcrumb-font-size);
	list-style: none;
	background-color: var(--bs-breadcrumb-bg);
	border-radius: var(--bs-breadcrumb-border-radius)
}
.breadcrumb-item+.breadcrumb-item {
	padding-left: var(--bs-breadcrumb-item-padding-x)
}
.breadcrumb-item+.breadcrumb-item:before {
	float: left;
	padding-right: var(--bs-breadcrumb-item-padding-x);
	color: var(--bs-breadcrumb-divider-color);
	content: var(--bs-breadcrumb-divider, "../index-4.html")
}
.breadcrumb-item.active {
	color: var(--bs-breadcrumb-item-active-color)
}
.pagination {
--bs-pagination-padding-x:.75rem;
--bs-pagination-padding-y:.375rem;
--bs-pagination-font-size:1rem;
--bs-pagination-color:var(--bs-link-color);
--bs-pagination-bg:var(--bs-body-bg);
--bs-pagination-border-width:var(--bs-border-width);
--bs-pagination-border-color:var(--bs-border-color);
--bs-pagination-border-radius:var(--bs-border-radius);
--bs-pagination-hover-color:var(--bs-link-hover-color);
--bs-pagination-hover-bg:var(--bs-tertiary-bg);
--bs-pagination-hover-border-color:var(--bs-border-color);
--bs-pagination-focus-color:var(--bs-link-hover-color);
--bs-pagination-focus-bg:var(--bs-secondary-bg);
--bs-pagination-focus-box-shadow:0 0 0 .25rem rgba(13, 110, 253, .25);
--bs-pagination-active-color:#fff;
--bs-pagination-active-bg:#0d6efd;
--bs-pagination-active-border-color:#0d6efd;
--bs-pagination-disabled-color:var(--bs-secondary-color);
--bs-pagination-disabled-bg:var(--bs-secondary-bg);
--bs-pagination-disabled-border-color:var(--bs-border-color);
	display: flex;
	padding-left: 0;
	list-style: none
}
.page-link {
	position: relative;
	display: block;
	padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
	font-size: var(--bs-pagination-font-size);
	color: var(--bs-pagination-color);
	text-decoration: none;
	background-color: var(--bs-pagination-bg);
	border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.page-link {
	transition: none
}
}
.page-link:hover {
	z-index: 2;
	color: var(--bs-pagination-hover-color);
	background-color: var(--bs-pagination-hover-bg);
	border-color: var(--bs-pagination-hover-border-color)
}
.page-link:focus {
	z-index: 3;
	color: var(--bs-pagination-focus-color);
	background-color: var(--bs-pagination-focus-bg);
	outline: 0;
	box-shadow: var(--bs-pagination-focus-box-shadow)
}
.active>.page-link, .page-link.active {
	z-index: 3;
	color: var(--bs-pagination-active-color);
	background-color: var(--bs-pagination-active-bg);
	border-color: var(--bs-pagination-active-border-color)
}
.disabled>.page-link, .page-link.disabled {
	color: var(--bs-pagination-disabled-color);
	pointer-events: none;
	background-color: var(--bs-pagination-disabled-bg);
	border-color: var(--bs-pagination-disabled-border-color)
}
.page-item:not(:first-child) .page-link {
margin-left:calc(-1 * var(--bs-border-width))
}
.page-item:first-child .page-link {
	border-top-left-radius: var(--bs-pagination-border-radius);
	border-bottom-left-radius: var(--bs-pagination-border-radius)
}
.page-item:last-child .page-link {
	border-top-right-radius: var(--bs-pagination-border-radius);
	border-bottom-right-radius: var(--bs-pagination-border-radius)
}
.pagination-lg {
--bs-pagination-padding-x:1.5rem;
--bs-pagination-padding-y:.75rem;
--bs-pagination-font-size:1.25rem;
--bs-pagination-border-radius:var(--bs-border-radius-lg)
}
.pagination-sm {
--bs-pagination-padding-x:.5rem;
--bs-pagination-padding-y:.25rem;
--bs-pagination-font-size:.875rem;
--bs-pagination-border-radius:var(--bs-border-radius-sm)
}
.badge {
--bs-badge-padding-x:.65em;
--bs-badge-padding-y:.35em;
--bs-badge-font-size:.75em;
--bs-badge-font-weight:700;
--bs-badge-color:#fff;
--bs-badge-border-radius:var(--bs-border-radius);
	display: inline-block;
	padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
	font-size: var(--bs-badge-font-size);
	font-weight: var(--bs-badge-font-weight);
	line-height: 1;
	color: var(--bs-badge-color);
	text-align: center;
	white-space: nowrap;
	vertical-align: baseline;
	border-radius: var(--bs-badge-border-radius)
}
.badge:empty {
	display: none
}
.btn .badge {
	position: relative;
	top: -1px
}
.alert {
--bs-alert-bg:transparent;
--bs-alert-padding-x:1rem;
--bs-alert-padding-y:1rem;
--bs-alert-margin-bottom:1rem;
--bs-alert-color:inherit;
--bs-alert-border-color:transparent;
--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);
--bs-alert-border-radius:var(--bs-border-radius);
--bs-alert-link-color:inherit;
	position: relative;
	padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
	margin-bottom: var(--bs-alert-margin-bottom);
	color: var(--bs-alert-color);
	background-color: var(--bs-alert-bg);
	border: var(--bs-alert-border);
	border-radius: var(--bs-alert-border-radius)
}
.alert-heading {
	color: inherit
}
.alert-link {
	font-weight: 700;
	color: var(--bs-alert-link-color)
}
.alert-dismissible {
	padding-right: 3rem
}
.alert-dismissible .btn-close {
	position: absolute;
	top: 0;
	right: 0;
	z-index: 2;
	padding: 1.25rem 1rem
}
.alert-primary {
--bs-alert-color:var(--bs-primary-text-emphasis);
--bs-alert-bg:var(--bs-primary-bg-subtle);
--bs-alert-border-color:var(--bs-primary-border-subtle);
--bs-alert-link-color:var(--bs-primary-text-emphasis)
}
.alert-secondary {
--bs-alert-color:var(--bs-secondary-text-emphasis);
--bs-alert-bg:var(--bs-secondary-bg-subtle);
--bs-alert-border-color:var(--bs-secondary-border-subtle);
--bs-alert-link-color:var(--bs-secondary-text-emphasis)
}
.alert-success {
--bs-alert-color:var(--bs-success-text-emphasis);
--bs-alert-bg:var(--bs-success-bg-subtle);
--bs-alert-border-color:var(--bs-success-border-subtle);
--bs-alert-link-color:var(--bs-success-text-emphasis)
}
.alert-info {
--bs-alert-color:var(--bs-info-text-emphasis);
--bs-alert-bg:var(--bs-info-bg-subtle);
--bs-alert-border-color:var(--bs-info-border-subtle);
--bs-alert-link-color:var(--bs-info-text-emphasis)
}
.alert-warning {
--bs-alert-color:var(--bs-warning-text-emphasis);
--bs-alert-bg:var(--bs-warning-bg-subtle);
--bs-alert-border-color:var(--bs-warning-border-subtle);
--bs-alert-link-color:var(--bs-warning-text-emphasis)
}
.alert-danger {
--bs-alert-color:var(--bs-danger-text-emphasis);
--bs-alert-bg:var(--bs-danger-bg-subtle);
--bs-alert-border-color:var(--bs-danger-border-subtle);
--bs-alert-link-color:var(--bs-danger-text-emphasis)
}
.alert-light {
--bs-alert-color:var(--bs-light-text-emphasis);
--bs-alert-bg:var(--bs-light-bg-subtle);
--bs-alert-border-color:var(--bs-light-border-subtle);
--bs-alert-link-color:var(--bs-light-text-emphasis)
}
.alert-dark {
--bs-alert-color:var(--bs-dark-text-emphasis);
--bs-alert-bg:var(--bs-dark-bg-subtle);
--bs-alert-border-color:var(--bs-dark-border-subtle);
--bs-alert-link-color:var(--bs-dark-text-emphasis)
}
@keyframes progress-bar-stripes {
0% {
background-position-x:var(--bs-progress-height)
}
}
.progress, .progress-stacked {
--bs-progress-height:1rem;
--bs-progress-font-size:.75rem;
--bs-progress-bg:var(--bs-secondary-bg);
--bs-progress-border-radius:var(--bs-border-radius);
--bs-progress-box-shadow:var(--bs-box-shadow-inset);
--bs-progress-bar-color:#fff;
--bs-progress-bar-bg:#0d6efd;
--bs-progress-bar-transition:width .6s ease;
	display: flex;
	height: var(--bs-progress-height);
	overflow: hidden;
	font-size: var(--bs-progress-font-size);
	background-color: var(--bs-progress-bg);
	border-radius: var(--bs-progress-border-radius)
}
.progress-bar {
	display: flex;
	flex-direction: column;
	justify-content: center;
	overflow: hidden;
	color: var(--bs-progress-bar-color);
	text-align: center;
	white-space: nowrap;
	background-color: var(--bs-progress-bar-bg);
	transition: var(--bs-progress-bar-transition)
}

@media (prefers-reduced-motion:reduce) {
.progress-bar {
	transition: none
}
}
.progress-bar-striped {
	background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent);
	background-size: var(--bs-progress-height) var(--bs-progress-height)
}
.progress-stacked>.progress {
	overflow: visible
}
.progress-stacked>.progress>.progress-bar {
	width: 100%
}
.progress-bar-animated {
	animation: 1s linear infinite progress-bar-stripes
}

@media (prefers-reduced-motion:reduce) {
.progress-bar-animated {
	animation: none
}
}
.list-group {
--bs-list-group-color:var(--bs-body-color);
--bs-list-group-bg:var(--bs-body-bg);
--bs-list-group-border-color:var(--bs-border-color);
--bs-list-group-border-width:var(--bs-border-width);
--bs-list-group-border-radius:var(--bs-border-radius);
--bs-list-group-item-padding-x:1rem;
--bs-list-group-item-padding-y:.5rem;
--bs-list-group-action-color:var(--bs-secondary-color);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);
--bs-list-group-action-active-color:var(--bs-body-color);
--bs-list-group-action-active-bg:var(--bs-secondary-bg);
--bs-list-group-disabled-color:var(--bs-secondary-color);
--bs-list-group-disabled-bg:var(--bs-body-bg);
--bs-list-group-active-color:#fff;
--bs-list-group-active-bg:#0d6efd;
--bs-list-group-active-border-color:#0d6efd;
	display: flex;
	flex-direction: column;
	padding-left: 0;
	margin-bottom: 0;
	border-radius: var(--bs-list-group-border-radius)
}
.list-group-numbered {
	list-style-type: none;
	counter-reset: section
}
.list-group-numbered>.list-group-item:before {
	content: counters(section, ".") ". ";
	counter-increment: section
}
.list-group-item {
	position: relative;
	display: block;
	padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
	color: var(--bs-list-group-color);
	text-decoration: none;
	background-color: var(--bs-list-group-bg);
	border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)
}
.list-group-item:first-child {
	border-top-left-radius: inherit;
	border-top-right-radius: inherit
}
.list-group-item:last-child {
	border-bottom-right-radius: inherit;
	border-bottom-left-radius: inherit
}
.list-group-item.disabled, .list-group-item:disabled {
	color: var(--bs-list-group-disabled-color);
	pointer-events: none;
	background-color: var(--bs-list-group-disabled-bg)
}
.list-group-item.active {
	z-index: 2;
	color: var(--bs-list-group-active-color);
	background-color: var(--bs-list-group-active-bg);
	border-color: var(--bs-list-group-active-border-color)
}
.list-group-item+.list-group-item {
	border-top-width: 0
}
.list-group-item+.list-group-item.active {
margin-top:calc(-1 * var(--bs-list-group-border-width));
	border-top-width: var(--bs-list-group-border-width)
}
.list-group-item-action {
	width: 100%;
	color: var(--bs-list-group-action-color);
	text-align: inherit
}
.list-group-item-action:not(.active):focus, .list-group-item-action:not(.active):hover {
	z-index: 1;
	color: var(--bs-list-group-action-hover-color);
	text-decoration: none;
	background-color: var(--bs-list-group-action-hover-bg)
}
.list-group-item-action:not(.active):active {
	color: var(--bs-list-group-action-active-color);
	background-color: var(--bs-list-group-action-active-bg)
}
.list-group-horizontal {
	flex-direction: row
}
.list-group-horizontal>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}

@media (min-width:576px) {
.list-group-horizontal-sm {
	flex-direction: row
}
.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-sm>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-sm>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-sm>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:768px) {
.list-group-horizontal-md {
	flex-direction: row
}
.list-group-horizontal-md>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-md>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-md>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-md>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-md>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:992px) {
.list-group-horizontal-lg {
	flex-direction: row
}
.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-lg>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-lg>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-lg>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:1200px) {
.list-group-horizontal-xl {
	flex-direction: row
}
.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-xl>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-xl>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-xl>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:1400px) {
.list-group-horizontal-xxl {
	flex-direction: row
}
.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-xxl>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-xxl>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-xxl>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}
.list-group-flush {
	border-radius: 0
}
.list-group-flush>.list-group-item {
	border-width: 0 0 var(--bs-list-group-border-width)
}
.list-group-flush>.list-group-item:last-child {
	border-bottom-width: 0
}
.list-group-item-primary {
--bs-list-group-color:var(--bs-primary-text-emphasis);
--bs-list-group-bg:var(--bs-primary-bg-subtle);
--bs-list-group-border-color:var(--bs-primary-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);
--bs-list-group-active-color:var(--bs-primary-bg-subtle);
--bs-list-group-active-bg:var(--bs-primary-text-emphasis);
--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)
}
.list-group-item-secondary {
--bs-list-group-color:var(--bs-secondary-text-emphasis);
--bs-list-group-bg:var(--bs-secondary-bg-subtle);
--bs-list-group-border-color:var(--bs-secondary-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);
--bs-list-group-active-color:var(--bs-secondary-bg-subtle);
--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);
--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)
}
.list-group-item-success {
--bs-list-group-color:var(--bs-success-text-emphasis);
--bs-list-group-bg:var(--bs-success-bg-subtle);
--bs-list-group-border-color:var(--bs-success-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-success-border-subtle);
--bs-list-group-active-color:var(--bs-success-bg-subtle);
--bs-list-group-active-bg:var(--bs-success-text-emphasis);
--bs-list-group-active-border-color:var(--bs-success-text-emphasis)
}
.list-group-item-info {
--bs-list-group-color:var(--bs-info-text-emphasis);
--bs-list-group-bg:var(--bs-info-bg-subtle);
--bs-list-group-border-color:var(--bs-info-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-info-border-subtle);
--bs-list-group-active-color:var(--bs-info-bg-subtle);
--bs-list-group-active-bg:var(--bs-info-text-emphasis);
--bs-list-group-active-border-color:var(--bs-info-text-emphasis)
}
.list-group-item-warning {
--bs-list-group-color:var(--bs-warning-text-emphasis);
--bs-list-group-bg:var(--bs-warning-bg-subtle);
--bs-list-group-border-color:var(--bs-warning-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);
--bs-list-group-active-color:var(--bs-warning-bg-subtle);
--bs-list-group-active-bg:var(--bs-warning-text-emphasis);
--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)
}
.list-group-item-danger {
--bs-list-group-color:var(--bs-danger-text-emphasis);
--bs-list-group-bg:var(--bs-danger-bg-subtle);
--bs-list-group-border-color:var(--bs-danger-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);
--bs-list-group-active-color:var(--bs-danger-bg-subtle);
--bs-list-group-active-bg:var(--bs-danger-text-emphasis);
--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)
}
.list-group-item-light {
--bs-list-group-color:var(--bs-light-text-emphasis);
--bs-list-group-bg:var(--bs-light-bg-subtle);
--bs-list-group-border-color:var(--bs-light-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-light-border-subtle);
--bs-list-group-active-color:var(--bs-light-bg-subtle);
--bs-list-group-active-bg:var(--bs-light-text-emphasis);
--bs-list-group-active-border-color:var(--bs-light-text-emphasis)
}
.list-group-item-dark {
--bs-list-group-color:var(--bs-dark-text-emphasis);
--bs-list-group-bg:var(--bs-dark-bg-subtle);
--bs-list-group-border-color:var(--bs-dark-border-subtle);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);
--bs-list-group-action-active-color:var(--bs-emphasis-color);
--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);
--bs-list-group-active-color:var(--bs-dark-bg-subtle);
--bs-list-group-active-bg:var(--bs-dark-text-emphasis);
--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)
}
.btn-close {
--bs-btn-close-color:#000;
--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414'/%3e%3c/svg%3e");
--bs-btn-close-opacity:.5;
--bs-btn-close-hover-opacity:.75;
--bs-btn-close-focus-shadow:0 0 0 .25rem rgba(13, 110, 253, .25);
--bs-btn-close-focus-opacity:1;
--bs-btn-close-disabled-opacity:.25;
	box-sizing: content-box;
	width: 1em;
	height: 1em;
	padding: .25em;
	color: var(--bs-btn-close-color);
	background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
	filter: var(--bs-btn-close-filter);
	border: 0;
	border-radius: .375rem;
	opacity: var(--bs-btn-close-opacity)
}
.btn-close:hover {
	color: var(--bs-btn-close-color);
	text-decoration: none;
	opacity: var(--bs-btn-close-hover-opacity)
}
.btn-close:focus {
	outline: 0;
	box-shadow: var(--bs-btn-close-focus-shadow);
	opacity: var(--bs-btn-close-focus-opacity)
}
.btn-close.disabled, .btn-close:disabled {
	pointer-events: none;
	-webkit-user-select: none;
	-moz-user-select: none;
	user-select: none;
	opacity: var(--bs-btn-close-disabled-opacity)
}
.btn-close-white {
--bs-btn-close-filter:invert(1) grayscale(100%) brightness(200%)
}
:root, [data-bs-theme=light] {
--bs-btn-close-filter:
}
[data-bs-theme=dark] {
--bs-btn-close-filter:invert(1) grayscale(100%) brightness(200%)
}
.toast {
--bs-toast-zindex:1090;
--bs-toast-padding-x:.75rem;
--bs-toast-padding-y:.5rem;
--bs-toast-spacing:1.5rem;
--bs-toast-max-width:350px;
--bs-toast-font-size:.875rem;
--bs-toast-color:;
--bs-toast-bg:rgba(var(--bs-body-bg-rgb), .85);
--bs-toast-border-width:var(--bs-border-width);
--bs-toast-border-color:var(--bs-border-color-translucent);
--bs-toast-border-radius:var(--bs-border-radius);
--bs-toast-box-shadow:var(--bs-box-shadow);
--bs-toast-header-color:var(--bs-secondary-color);
--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), .85);
--bs-toast-header-border-color:var(--bs-border-color-translucent);
	width: var(--bs-toast-max-width);
	max-width: 100%;
	font-size: var(--bs-toast-font-size);
	color: var(--bs-toast-color);
	pointer-events: auto;
	background-color: var(--bs-toast-bg);
	background-clip: padding-box;
	border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
	box-shadow: var(--bs-toast-box-shadow);
	border-radius: var(--bs-toast-border-radius)
}
.toast.showing {
	opacity: 0
}
.toast:not(.show) {
	display: none
}
.toast-container {
--bs-toast-zindex:1090;
	position: absolute;
	z-index: var(--bs-toast-zindex);
	width: -moz-max-content;
	width: max-content;
	max-width: 100%;
	pointer-events: none
}
.toast-container>:not(:last-child) {
	margin-bottom: var(--bs-toast-spacing)
}
.toast-header {
	display: flex;
	align-items: center;
	padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
	color: var(--bs-toast-header-color);
	background-color: var(--bs-toast-header-bg);
	background-clip: padding-box;
	border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
	border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
	border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))
}
.toast-header .btn-close {
margin-right:calc(-.5 * var(--bs-toast-padding-x));
	margin-left: var(--bs-toast-padding-x)
}
.toast-body {
	padding: var(--bs-toast-padding-x);
	word-wrap: break-word
}
.modal {
--bs-modal-zindex:1055;
--bs-modal-width:500px;
--bs-modal-padding:1rem;
--bs-modal-margin:.5rem;
--bs-modal-color:var(--bs-body-color);
--bs-modal-bg:var(--bs-body-bg);
--bs-modal-border-color:var(--bs-border-color-translucent);
--bs-modal-border-width:var(--bs-border-width);
--bs-modal-border-radius:var(--bs-border-radius-lg);
--bs-modal-box-shadow:var(--bs-box-shadow-sm);
--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
--bs-modal-header-padding-x:1rem;
--bs-modal-header-padding-y:1rem;
--bs-modal-header-padding:1rem 1rem;
--bs-modal-header-border-color:var(--bs-border-color);
--bs-modal-header-border-width:var(--bs-border-width);
--bs-modal-title-line-height:1.5;
--bs-modal-footer-gap:.5rem;
--bs-modal-footer-bg:;
--bs-modal-footer-border-color:var(--bs-border-color);
--bs-modal-footer-border-width:var(--bs-border-width);
	position: fixed;
	top: 0;
	left: 0;
	z-index: var(--bs-modal-zindex);
	display: none;
	width: 100%;
	height: 100%;
	overflow-x: hidden;
	overflow-y: auto;
	outline: 0
}
.modal-dialog {
	position: relative;
	width: auto;
	margin: var(--bs-modal-margin);
	pointer-events: none
}
.modal.fade .modal-dialog {
	transform: translateY(-50px);
	transition: transform .3s ease-out
}

@media (prefers-reduced-motion:reduce) {
.modal.fade .modal-dialog {
	transition: none
}
}
.modal.show .modal-dialog {
	transform: none
}
.modal.modal-static .modal-dialog {
	transform: scale(1.02)
}
.modal-dialog-scrollable {
height:calc(100% - var(--bs-modal-margin) * 2)
}
.modal-dialog-scrollable .modal-content {
	max-height: 100%;
	overflow: hidden
}
.modal-dialog-scrollable .modal-body {
	overflow-y: auto
}
.modal-dialog-centered {
	display: flex;
	align-items: center;
min-height:calc(100% - var(--bs-modal-margin) * 2)
}
.modal-content {
	position: relative;
	display: flex;
	flex-direction: column;
	width: 100%;
	color: var(--bs-modal-color);
	pointer-events: auto;
	background-color: var(--bs-modal-bg);
	background-clip: padding-box;
	border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
	border-radius: var(--bs-modal-border-radius);
	outline: 0
}
.modal-backdrop {
--bs-backdrop-zindex:1050;
--bs-backdrop-bg:#000;
--bs-backdrop-opacity:.5;
	position: fixed;
	top: 0;
	left: 0;
	z-index: var(--bs-backdrop-zindex);
	width: 100vw;
	height: 100vh;
	background-color: var(--bs-backdrop-bg)
}
.modal-backdrop.fade {
	opacity: 0
}
.modal-backdrop.show {
	opacity: var(--bs-backdrop-opacity)
}
.modal-header {
	display: flex;
	flex-shrink: 0;
	align-items: center;
	padding: var(--bs-modal-header-padding);
	border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
	border-top-left-radius: var(--bs-modal-inner-border-radius);
	border-top-right-radius: var(--bs-modal-inner-border-radius)
}
.modal-header .btn-close {
padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);
margin-top:calc(-.5 * var(--bs-modal-header-padding-y));
margin-right:calc(-.5 * var(--bs-modal-header-padding-x));
margin-bottom:calc(-.5 * var(--bs-modal-header-padding-y));
	margin-left: auto
}
.modal-title {
	margin-bottom: 0;
	line-height: var(--bs-modal-title-line-height)
}
.modal-body {
	position: relative;
	flex: 1 1 auto;
	padding: var(--bs-modal-padding)
}
.modal-footer {
	display: flex;
	flex-shrink: 0;
	flex-wrap: wrap;
	align-items: center;
	justify-content: flex-end;
padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);
	background-color: var(--bs-modal-footer-bg);
	border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
	border-bottom-right-radius: var(--bs-modal-inner-border-radius);
	border-bottom-left-radius: var(--bs-modal-inner-border-radius)
}
.modal-footer>* {
margin:calc(var(--bs-modal-footer-gap) * .5)
}

@media (min-width:576px) {
.modal {
--bs-modal-margin:1.75rem;
--bs-modal-box-shadow:var(--bs-box-shadow)
}
.modal-dialog {
	max-width: var(--bs-modal-width);
	margin-right: auto;
	margin-left: auto
}
.modal-sm {
--bs-modal-width:300px
}
}

@media (min-width:992px) {
.modal-lg, .modal-xl {
--bs-modal-width:800px
}
}

@media (min-width:1200px) {
.modal-xl {
--bs-modal-width:1140px
}
}
.modal-fullscreen {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen .modal-footer, .modal-fullscreen .modal-header {
	border-radius: 0
}
.modal-fullscreen .modal-body {
	overflow-y: auto
}

@media (max-width:575.98px) {
.modal-fullscreen-sm-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-sm-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-sm-down .modal-footer, .modal-fullscreen-sm-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-sm-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:767.98px) {
.modal-fullscreen-md-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-md-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-md-down .modal-footer, .modal-fullscreen-md-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-md-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:991.98px) {
.modal-fullscreen-lg-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-lg-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-lg-down .modal-footer, .modal-fullscreen-lg-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-lg-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:1199.98px) {
.modal-fullscreen-xl-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-xl-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-xl-down .modal-footer, .modal-fullscreen-xl-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-xl-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:1399.98px) {
.modal-fullscreen-xxl-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-xxl-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-xxl-down .modal-footer, .modal-fullscreen-xxl-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-xxl-down .modal-body {
	overflow-y: auto
}
}
.tooltip {
--bs-tooltip-zindex:1080;
--bs-tooltip-max-width:200px;
--bs-tooltip-padding-x:.5rem;
--bs-tooltip-padding-y:.25rem;
--bs-tooltip-margin:;
--bs-tooltip-font-size:.875rem;
--bs-tooltip-color:var(--bs-body-bg);
--bs-tooltip-bg:var(--bs-emphasis-color);
--bs-tooltip-border-radius:var(--bs-border-radius);
--bs-tooltip-opacity:.9;
--bs-tooltip-arrow-width:.8rem;
--bs-tooltip-arrow-height:.4rem;
	z-index: var(--bs-tooltip-zindex);
	display: block;
	margin: var(--bs-tooltip-margin);
	font-family: var(--bs-font-sans-serif);
	font-style: normal;
	font-weight: 400;
	line-height: 1.5;
	text-align: left;
	text-align: start;
	text-decoration: none;
	text-shadow: none;
	text-transform: none;
	letter-spacing: normal;
	word-break: normal;
	white-space: normal;
	word-spacing: normal;
	line-break: auto;
	font-size: var(--bs-tooltip-font-size);
	word-wrap: break-word;
	opacity: 0
}
.tooltip.show {
	opacity: var(--bs-tooltip-opacity)
}
.tooltip .tooltip-arrow {
	display: block;
	width: var(--bs-tooltip-arrow-width);
	height: var(--bs-tooltip-arrow-height)
}
.tooltip .tooltip-arrow:before {
	position: absolute;
	content: "";
	border-color: transparent;
	border-style: solid
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow, .bs-tooltip-top .tooltip-arrow {
bottom:calc(-1 * var(--bs-tooltip-arrow-height))
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow:before, .bs-tooltip-top .tooltip-arrow:before {
	top: -1px;
border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
	border-top-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow, .bs-tooltip-end .tooltip-arrow {
left:calc(-1 * var(--bs-tooltip-arrow-height));
	width: var(--bs-tooltip-arrow-height);
	height: var(--bs-tooltip-arrow-width)
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow:before, .bs-tooltip-end .tooltip-arrow:before {
	right: -1px;
border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
	border-right-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow, .bs-tooltip-bottom .tooltip-arrow {
top:calc(-1 * var(--bs-tooltip-arrow-height))
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow:before, .bs-tooltip-bottom .tooltip-arrow:before {
	bottom: -1px;
border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
	border-bottom-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow, .bs-tooltip-start .tooltip-arrow {
right:calc(-1 * var(--bs-tooltip-arrow-height));
	width: var(--bs-tooltip-arrow-height);
	height: var(--bs-tooltip-arrow-width)
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow:before, .bs-tooltip-start .tooltip-arrow:before {
	left: -1px;
border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
	border-left-color: var(--bs-tooltip-bg)
}
.tooltip-inner {
	max-width: var(--bs-tooltip-max-width);
	padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
	color: var(--bs-tooltip-color);
	text-align: center;
	background-color: var(--bs-tooltip-bg);
	border-radius: var(--bs-tooltip-border-radius)
}
.popover {
--bs-popover-zindex:1070;
--bs-popover-max-width:276px;
--bs-popover-font-size:.875rem;
--bs-popover-bg:var(--bs-body-bg);
--bs-popover-border-width:var(--bs-border-width);
--bs-popover-border-color:var(--bs-border-color-translucent);
--bs-popover-border-radius:var(--bs-border-radius-lg);
--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));
--bs-popover-box-shadow:var(--bs-box-shadow);
--bs-popover-header-padding-x:1rem;
--bs-popover-header-padding-y:.5rem;
--bs-popover-header-font-size:1rem;
--bs-popover-header-color:inherit;
--bs-popover-header-bg:var(--bs-secondary-bg);
--bs-popover-body-padding-x:1rem;
--bs-popover-body-padding-y:1rem;
--bs-popover-body-color:var(--bs-body-color);
--bs-popover-arrow-width:1rem;
--bs-popover-arrow-height:.5rem;
--bs-popover-arrow-border:var(--bs-popover-border-color);
	z-index: var(--bs-popover-zindex);
	display: block;
	max-width: var(--bs-popover-max-width);
	font-family: var(--bs-font-sans-serif);
	font-style: normal;
	font-weight: 400;
	line-height: 1.5;
	text-align: left;
	text-align: start;
	text-decoration: none;
	text-shadow: none;
	text-transform: none;
	letter-spacing: normal;
	word-break: normal;
	white-space: normal;
	word-spacing: normal;
	line-break: auto;
	font-size: var(--bs-popover-font-size);
	word-wrap: break-word;
	background-color: var(--bs-popover-bg);
	background-clip: padding-box;
	border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
	border-radius: var(--bs-popover-border-radius)
}
.popover .popover-arrow {
	display: block;
	width: var(--bs-popover-arrow-width);
	height: var(--bs-popover-arrow-height)
}
.popover .popover-arrow:after, .popover .popover-arrow:before {
	position: absolute;
	display: block;
	content: "";
	border-color: transparent;
	border-style: solid;
	border-width: 0
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow, .bs-popover-top>.popover-arrow {
bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow:after, .bs-popover-auto[data-popper-placement^=top]>.popover-arrow:before, .bs-popover-top>.popover-arrow:after, .bs-popover-top>.popover-arrow:before {
border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow:before, .bs-popover-top>.popover-arrow:before {
	bottom: 0;
	border-top-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow:after, .bs-popover-top>.popover-arrow:after {
	bottom: var(--bs-popover-border-width);
	border-top-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow, .bs-popover-end>.popover-arrow {
left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
	width: var(--bs-popover-arrow-height);
	height: var(--bs-popover-arrow-width)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow:after, .bs-popover-auto[data-popper-placement^=right]>.popover-arrow:before, .bs-popover-end>.popover-arrow:after, .bs-popover-end>.popover-arrow:before {
border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow:before, .bs-popover-end>.popover-arrow:before {
	left: 0;
	border-right-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow:after, .bs-popover-end>.popover-arrow:after {
	left: var(--bs-popover-border-width);
	border-right-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow, .bs-popover-bottom>.popover-arrow {
top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow:after, .bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow:before, .bs-popover-bottom>.popover-arrow:after, .bs-popover-bottom>.popover-arrow:before {
border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow:before, .bs-popover-bottom>.popover-arrow:before {
	top: 0;
	border-bottom-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow:after, .bs-popover-bottom>.popover-arrow:after {
	top: var(--bs-popover-border-width);
	border-bottom-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=bottom] .popover-header:before, .bs-popover-bottom .popover-header:before {
	position: absolute;
	top: 0;
	left: 50%;
	display: block;
	width: var(--bs-popover-arrow-width);
margin-left:calc(-.5 * var(--bs-popover-arrow-width));
	content: "";
	border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow, .bs-popover-start>.popover-arrow {
right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
	width: var(--bs-popover-arrow-height);
	height: var(--bs-popover-arrow-width)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow:after, .bs-popover-auto[data-popper-placement^=left]>.popover-arrow:before, .bs-popover-start>.popover-arrow:after, .bs-popover-start>.popover-arrow:before {
border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow:before, .bs-popover-start>.popover-arrow:before {
	right: 0;
	border-left-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow:after, .bs-popover-start>.popover-arrow:after {
	right: var(--bs-popover-border-width);
	border-left-color: var(--bs-popover-bg)
}
.popover-header {
	padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
	margin-bottom: 0;
	font-size: var(--bs-popover-header-font-size);
	color: var(--bs-popover-header-color);
	background-color: var(--bs-popover-header-bg);
	border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
	border-top-left-radius: var(--bs-popover-inner-border-radius);
	border-top-right-radius: var(--bs-popover-inner-border-radius)
}
.popover-header:empty {
	display: none
}
.popover-body {
	padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
	color: var(--bs-popover-body-color)
}
.carousel {
	position: relative
}
.carousel.pointer-event {
	touch-action: pan-y
}
.carousel-inner {
	position: relative;
	width: 100%;
	overflow: hidden
}
.carousel-inner:after {
	display: block;
	clear: both;
	content: ""
}
.carousel-item {
	position: relative;
	display: none;
	float: left;
	width: 100%;
	margin-right: -100%;
	backface-visibility: hidden;
	transition: transform .6s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.carousel-item {
	transition: none
}
}
.carousel-item-next, .carousel-item-prev, .carousel-item.active {
	display: block
}
.active.carousel-item-end, .carousel-item-next:not(.carousel-item-start) {
	transform: translate(100%)
}
.active.carousel-item-start, .carousel-item-prev:not(.carousel-item-end) {
	transform: translate(-100%)
}
.carousel-fade .carousel-item {
	opacity: 0;
	transition-property: opacity;
	transform: none
}
.carousel-fade .carousel-item-next.carousel-item-start, .carousel-fade .carousel-item-prev.carousel-item-end, .carousel-fade .carousel-item.active {
	z-index: 1;
	opacity: 1
}
.carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
	z-index: 0;
	opacity: 0;
	transition: opacity 0s .6s
}

@media (prefers-reduced-motion:reduce) {
.carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
	transition: none
}
}
.carousel-control-next, .carousel-control-prev {
	position: absolute;
	top: 0;
	bottom: 0;
	z-index: 1;
	display: flex;
	align-items: center;
	justify-content: center;
	width: 15%;
	padding: 0;
	color: #fff;
	text-align: center;
	background: 0 0;
	filter: var(--bs-carousel-control-icon-filter);
	border: 0;
	opacity: .5;
	transition: opacity .15s ease
}

@media (prefers-reduced-motion:reduce) {
.carousel-control-next, .carousel-control-prev {
	transition: none
}
}
.carousel-control-next:focus, .carousel-control-next:hover, .carousel-control-prev:focus, .carousel-control-prev:hover {
	color: #fff;
	text-decoration: none;
	outline: 0;
	opacity: .9
}
.carousel-control-prev {
	left: 0
}
.carousel-control-next {
	right: 0
}
.carousel-control-next-icon, .carousel-control-prev-icon {
	display: inline-block;
	width: 2rem;
	height: 2rem;
	background-repeat: no-repeat;
	background-position: 50%;
	background-size: 100% 100%
}
.carousel-control-prev-icon {
	background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0'/%3e%3c/svg%3e")
}
.carousel-control-next-icon {
	background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e")
}
.carousel-indicators {
	position: absolute;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 2;
	display: flex;
	justify-content: center;
	padding: 0;
	margin-right: 15%;
	margin-bottom: 1rem;
	margin-left: 15%
}
.carousel-indicators [data-bs-target] {
	box-sizing: content-box;
	flex: 0 1 auto;
	width: 30px;
	height: 3px;
	padding: 0;
	margin-right: 3px;
	margin-left: 3px;
	text-indent: -999px;
	cursor: pointer;
	background-color: var(--bs-carousel-indicator-active-bg);
	background-clip: padding-box;
	border: 0;
	border-top: 10px solid transparent;
	border-bottom: 10px solid transparent;
	opacity: .5;
	transition: opacity .6s ease
}

@media (prefers-reduced-motion:reduce) {
.carousel-indicators [data-bs-target] {
	transition: none
}
}
.carousel-indicators .active {
	opacity: 1
}
.carousel-caption {
	position: absolute;
	right: 15%;
	bottom: 1.25rem;
	left: 15%;
	padding-top: 1.25rem;
	padding-bottom: 1.25rem;
	color: var(--bs-carousel-caption-color);
	text-align: center
}
.carousel-dark {
--bs-carousel-indicator-active-bg:#000;
--bs-carousel-caption-color:#000;
--bs-carousel-control-icon-filter:invert(1) grayscale(100)
}
:root, [data-bs-theme=light] {
--bs-carousel-indicator-active-bg:#fff;
--bs-carousel-caption-color:#fff;
--bs-carousel-control-icon-filter:
}
[data-bs-theme=dark] {
--bs-carousel-indicator-active-bg:#000;
--bs-carousel-caption-color:#000;
--bs-carousel-control-icon-filter:invert(1) grayscale(100)
}
.spinner-border, .spinner-grow {
	display: inline-block;
	width: var(--bs-spinner-width);
	height: var(--bs-spinner-height);
	vertical-align: var(--bs-spinner-vertical-align);
	border-radius: 50%;
	animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)
}
@keyframes spinner-border {
to {
transform:rotate(360deg)
}
}
.spinner-border {
--bs-spinner-width:2rem;
--bs-spinner-height:2rem;
--bs-spinner-vertical-align:-.125em;
--bs-spinner-border-width:.25em;
--bs-spinner-animation-speed:.75s;
--bs-spinner-animation-name:spinner-border;
	border: var(--bs-spinner-border-width) solid currentcolor;
	border-right-color: transparent
}
.spinner-border-sm {
--bs-spinner-width:1rem;
--bs-spinner-height:1rem;
--bs-spinner-border-width:.2em
}
@keyframes spinner-grow {
0% {
transform:scale(0)
}
50% {
opacity:1;
transform:none
}
}
.spinner-grow {
--bs-spinner-width:2rem;
--bs-spinner-height:2rem;
--bs-spinner-vertical-align:-.125em;
--bs-spinner-animation-speed:.75s;
--bs-spinner-animation-name:spinner-grow;
	background-color: currentcolor;
	opacity: 0
}
.spinner-grow-sm {
--bs-spinner-width:1rem;
--bs-spinner-height:1rem
}

@media (prefers-reduced-motion:reduce) {
.spinner-border, .spinner-grow {
--bs-spinner-animation-speed:1.5s
}
}
.offcanvas, .offcanvas-lg, .offcanvas-md, .offcanvas-sm, .offcanvas-xl, .offcanvas-xxl {
--bs-offcanvas-zindex:1045;
--bs-offcanvas-width:400px;
--bs-offcanvas-height:30vh;
--bs-offcanvas-padding-x:1rem;
--bs-offcanvas-padding-y:1rem;
--bs-offcanvas-color:var(--bs-body-color);
--bs-offcanvas-bg:var(--bs-body-bg);
--bs-offcanvas-border-width:var(--bs-border-width);
--bs-offcanvas-border-color:var(--bs-border-color-translucent);
--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);
--bs-offcanvas-transition:transform .3s ease-in-out;
--bs-offcanvas-title-line-height:1.5
}

@media (max-width:575.98px) {
.offcanvas-sm {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:575.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-sm {
	transition: none
}
}

@media (max-width:575.98px) {
.offcanvas-sm.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas-sm.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas-sm.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas-sm.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas-sm.show:not(.hiding), .offcanvas-sm.showing {
	transform: none
}
.offcanvas-sm.hiding, .offcanvas-sm.show, .offcanvas-sm.showing {
	visibility: visible
}
}

@media (min-width:576px) {
.offcanvas-sm {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-sm .offcanvas-header {
	display: none
}
.offcanvas-sm .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:767.98px) {
.offcanvas-md {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:767.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-md {
	transition: none
}
}

@media (max-width:767.98px) {
.offcanvas-md.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas-md.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas-md.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas-md.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas-md.show:not(.hiding), .offcanvas-md.showing {
	transform: none
}
.offcanvas-md.hiding, .offcanvas-md.show, .offcanvas-md.showing {
	visibility: visible
}
}

@media (min-width:768px) {
.offcanvas-md {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-md .offcanvas-header {
	display: none
}
.offcanvas-md .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:991.98px) {
.offcanvas-lg {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:991.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-lg {
	transition: none
}
}

@media (max-width:991.98px) {
.offcanvas-lg.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas-lg.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas-lg.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas-lg.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas-lg.show:not(.hiding), .offcanvas-lg.showing {
	transform: none
}
.offcanvas-lg.hiding, .offcanvas-lg.show, .offcanvas-lg.showing {
	visibility: visible
}
}

@media (min-width:992px) {
.offcanvas-lg {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-lg .offcanvas-header {
	display: none
}
.offcanvas-lg .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:1199.98px) {
.offcanvas-xl {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:1199.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-xl {
	transition: none
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas-xl.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas-xl.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas-xl.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas-xl.show:not(.hiding), .offcanvas-xl.showing {
	transform: none
}
.offcanvas-xl.hiding, .offcanvas-xl.show, .offcanvas-xl.showing {
	visibility: visible
}
}

@media (min-width:1200px) {
.offcanvas-xl {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-xl .offcanvas-header {
	display: none
}
.offcanvas-xl .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:1399.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-xxl {
	transition: none
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas-xxl.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas-xxl.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas-xxl.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas-xxl.show:not(.hiding), .offcanvas-xxl.showing {
	transform: none
}
.offcanvas-xxl.hiding, .offcanvas-xxl.show, .offcanvas-xxl.showing {
	visibility: visible
}
}

@media (min-width:1400px) {
.offcanvas-xxl {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-xxl .offcanvas-header {
	display: none
}
.offcanvas-xxl .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}
.offcanvas {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}

@media (prefers-reduced-motion:reduce) {
.offcanvas {
	transition: none
}
}
.offcanvas.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(-100%)
}
.offcanvas.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translate(100%)
}
.offcanvas.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas.show:not(.hiding), .offcanvas.showing {
	transform: none
}
.offcanvas.hiding, .offcanvas.show, .offcanvas.showing {
	visibility: visible
}
.offcanvas-backdrop {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1040;
	width: 100vw;
	height: 100vh;
	background-color: #000
}
.offcanvas-backdrop.fade {
	opacity: 0
}
.offcanvas-backdrop.show {
	opacity: .5
}
.offcanvas-header {
	display: flex;
	align-items: center;
	padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)
}
.offcanvas-header .btn-close {
padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);
margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));
margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));
margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y));
	margin-left: auto
}
.offcanvas-title {
	margin-bottom: 0;
	line-height: var(--bs-offcanvas-title-line-height)
}
.offcanvas-body {
	flex-grow: 1;
	padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
	overflow-y: auto
}
.placeholder {
	display: inline-block;
	min-height: 1em;
	vertical-align: middle;
	cursor: wait;
	background-color: currentcolor;
	opacity: .5
}
.placeholder.btn:before {
	display: inline-block;
	content: ""
}
.placeholder-xs {
	min-height: .6em
}
.placeholder-sm {
	min-height: .8em
}
.placeholder-lg {
	min-height: 1.2em
}
.placeholder-glow .placeholder {
	animation: placeholder-glow 2s ease-in-out infinite
}
@keyframes placeholder-glow {
50% {
opacity:.2
}
}
.placeholder-wave {
	-webkit-mask-image: linear-gradient(130deg, #000 55%, rgba(0,0,0,.8) 75%, #000 95%);
	mask-image: linear-gradient(130deg, #000 55%, #000c, #000 95%);
	-webkit-mask-size: 200% 100%;
	mask-size: 200% 100%;
	animation: placeholder-wave 2s linear infinite
}
@keyframes placeholder-wave {
to {
-webkit-mask-position:-200% 0%;
mask-position:-200% 0%
}
}
.clearfix:after {
	display: block;
	clear: both;
	content: ""
}
.text-bg-primary {
	color: #fff!important;
	background-color: RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-secondary {
	color: #fff!important;
	background-color: RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-success {
	color: #fff!important;
	background-color: RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-info {
	color: #000!important;
	background-color: RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-warning {
	color: #000!important;
	background-color: RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-danger {
	color: #fff!important;
	background-color: RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-light {
	color: #000!important;
	background-color: RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1))!important
}
.text-bg-dark {
	color: #fff!important;
	background-color: RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1))!important
}
.link-primary {
	color: RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-primary:focus, .link-primary:hover {
	color: RGBA(10, 88, 202, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(10, 88, 202, var(--bs-link-underline-opacity, 1))!important
}
.link-secondary {
	color: RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-secondary:focus, .link-secondary:hover {
	color: RGBA(86, 94, 100, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1))!important
}
.link-success {
	color: RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-success:focus, .link-success:hover {
	color: RGBA(20, 108, 67, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(20, 108, 67, var(--bs-link-underline-opacity, 1))!important
}
.link-info {
	color: RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-info:focus, .link-info:hover {
	color: RGBA(61, 213, 243, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(61, 213, 243, var(--bs-link-underline-opacity, 1))!important
}
.link-warning {
	color: RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-warning:focus, .link-warning:hover {
	color: RGBA(255, 205, 57, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(255, 205, 57, var(--bs-link-underline-opacity, 1))!important
}
.link-danger {
	color: RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-danger:focus, .link-danger:hover {
	color: RGBA(176, 42, 55, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(176, 42, 55, var(--bs-link-underline-opacity, 1))!important
}
.link-light {
	color: RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-light:focus, .link-light:hover {
	color: RGBA(249, 250, 251, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1))!important
}
.link-dark {
	color: RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-dark:focus, .link-dark:hover {
	color: RGBA(26, 30, 33, var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1))!important
}
.link-body-emphasis {
	color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1))!important;
	text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-body-emphasis:focus, .link-body-emphasis:hover {
	color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, .75))!important;
	text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, .75))!important
}
.focus-ring:focus {
	outline: 0;
	box-shadow: var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)
}
.icon-link {
	display: inline-flex;
	gap: .375rem;
	align-items: center;
	text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, .5));
	text-underline-offset: .25em;
	backface-visibility: hidden
}
.icon-link>.bi {
	flex-shrink: 0;
	width: 1em;
	height: 1em;
	fill: currentcolor;
	transition: .2s ease-in-out transform
}

@media (prefers-reduced-motion:reduce) {
.icon-link>.bi {
	transition: none
}
}
.icon-link-hover:focus-visible>.bi, .icon-link-hover:hover>.bi {
transform:var(--bs-icon-link-transform, translate3d(.25em, 0, 0))
}
.ratio {
	position: relative;
	width: 100%
}
.ratio:before {
	display: block;
	padding-top: var(--bs-aspect-ratio);
	content: ""
}
.ratio>* {
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%
}
.ratio-1x1 {
--bs-aspect-ratio:100%
}
.ratio-4x3 {
--bs-aspect-ratio:75%
}
.ratio-16x9 {
--bs-aspect-ratio:56.25%
}
.ratio-21x9 {
--bs-aspect-ratio:42.8571428571%
}
.fixed-top {
	position: fixed;
	top: 0;
	right: 0;
	left: 0;
	z-index: 1030
}
.fixed-bottom {
	position: fixed;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 1030
}
.sticky-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}

@media (min-width:576px) {
.sticky-sm-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-sm-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:768px) {
.sticky-md-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-md-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:992px) {
.sticky-lg-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-lg-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:1200px) {
.sticky-xl-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-xl-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:1400px) {
.sticky-xxl-top {
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-xxl-bottom {
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}
.hstack {
	display: flex;
	flex-direction: row;
	align-items: center;
	align-self: stretch
}
.vstack {
	display: flex;
	flex: 1 1 auto;
	flex-direction: column;
	align-self: stretch
}
.visually-hidden, .visually-hidden-focusable:not(:focus):not(:focus-within) {
	width: 1px!important;
	height: 1px!important;
	padding: 0!important;
	margin: -1px!important;
	overflow: hidden!important;
	clip: rect(0,0,0,0)!important;
	white-space: nowrap!important;
	border: 0!important
}
.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption), .visually-hidden:not(caption) {
	position: absolute!important
}
.visually-hidden *, .visually-hidden-focusable:not(:focus):not(:focus-within) * {
	overflow: hidden!important
}
.stretched-link:after {
	position: absolute;
	top: 0;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 1;
	content: ""
}
.text-truncate {
	overflow: hidden;
	text-overflow: ellipsis;
	white-space: nowrap
}
.vr {
	display: inline-block;
	align-self: stretch;
	width: var(--bs-border-width);
	min-height: 1em;
	background-color: currentcolor;
	opacity: .25
}
.align-baseline {
	vertical-align: baseline!important
}
.align-top {
	vertical-align: top!important
}
.align-middle {
	vertical-align: middle!important
}
.align-bottom {
	vertical-align: bottom!important
}
.align-text-bottom {
	vertical-align: text-bottom!important
}
.align-text-top {
	vertical-align: text-top!important
}
.float-start {
	float: left!important
}
.float-end {
	float: right!important
}
.float-none {
	float: none!important
}
.object-fit-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.opacity-0 {
	opacity: 0!important
}
.opacity-25 {
	opacity: .25!important
}
.opacity-50 {
	opacity: .5!important
}
.opacity-75 {
	opacity: .75!important
}
.opacity-100 {
	opacity: 1!important
}
.overflow-auto {
	overflow: auto!important
}
.overflow-hidden {
	overflow: hidden!important
}
.overflow-visible {
	overflow: visible!important
}
.overflow-scroll {
	overflow: scroll!important
}
.overflow-x-auto {
	overflow-x: auto!important
}
.overflow-x-hidden {
	overflow-x: hidden!important
}
.overflow-x-visible {
	overflow-x: visible!important
}
.overflow-x-scroll {
	overflow-x: scroll!important
}
.overflow-y-auto {
	overflow-y: auto!important
}
.overflow-y-hidden {
	overflow-y: hidden!important
}
.overflow-y-visible {
	overflow-y: visible!important
}
.overflow-y-scroll {
	overflow-y: scroll!important
}
.d-inline {
	display: inline!important
}
.d-inline-block {
	display: inline-block!important
}
.d-block {
	display: block!important
}
.d-grid {
	display: grid!important
}
.d-inline-grid {
	display: inline-grid!important
}
.d-table {
	display: table!important
}
.d-table-row {
	display: table-row!important
}
.d-table-cell {
	display: table-cell!important
}
.d-flex {
	display: flex!important
}
.d-inline-flex {
	display: inline-flex!important
}
.d-none {
	display: none!important
}
.shadow {
	box-shadow: var(--bs-box-shadow)!important
}
.shadow-sm {
	box-shadow: var(--bs-box-shadow-sm)!important
}
.shadow-lg {
	box-shadow: var(--bs-box-shadow-lg)!important
}
.shadow-none {
	box-shadow: none!important
}
.focus-ring-primary {
--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-secondary {
--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-success {
--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-info {
--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-warning {
--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-danger {
--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-light {
--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))
}
.focus-ring-dark {
--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))
}
.position-static {
	position: static!important
}
.position-relative {
	position: relative!important
}
.position-absolute {
	position: absolute!important
}
.position-fixed {
	position: fixed!important
}
.position-sticky {
	position: sticky!important
}
.top-0 {
	top: 0!important
}
.top-50 {
	top: 50%!important
}
.top-100 {
	top: 100%!important
}
.bottom-0 {
	bottom: 0!important
}
.bottom-50 {
	bottom: 50%!important
}
.bottom-100 {
	bottom: 100%!important
}
.start-0 {
	left: 0!important
}
.start-50 {
	left: 50%!important
}
.start-100 {
	left: 100%!important
}
.end-0 {
	right: 0!important
}
.end-50 {
	right: 50%!important
}
.end-100 {
	right: 100%!important
}
.translate-middle {
	transform: translate(-50%, -50%)!important
}
.translate-middle-x {
	transform: translate(-50%)!important
}
.translate-middle-y {
	transform: translateY(-50%)!important
}
.border {
	border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-0 {
	border: 0!important
}
.border-top {
	border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-top-0 {
	border-top: 0!important
}
.border-end {
	border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-end-0 {
	border-right: 0!important
}
.border-bottom {
	border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-bottom-0 {
	border-bottom: 0!important
}
.border-start {
	border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-start-0 {
	border-left: 0!important
}
.border-primary {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity))!important
}
.border-secondary {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity))!important
}
.border-success {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity))!important
}
.border-info {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity))!important
}
.border-warning {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity))!important
}
.border-danger {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity))!important
}
.border-light {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity))!important
}
.border-dark {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity))!important
}
.border-black {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-black-rgb), var(--bs-border-opacity))!important
}
.border-white {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity))!important
}
.border-primary-subtle {
	border-color: var(--bs-primary-border-subtle)!important
}
.border-secondary-subtle {
	border-color: var(--bs-secondary-border-subtle)!important
}
.border-success-subtle {
	border-color: var(--bs-success-border-subtle)!important
}
.border-info-subtle {
	border-color: var(--bs-info-border-subtle)!important
}
.border-warning-subtle {
	border-color: var(--bs-warning-border-subtle)!important
}
.border-danger-subtle {
	border-color: var(--bs-danger-border-subtle)!important
}
.border-light-subtle {
	border-color: var(--bs-light-border-subtle)!important
}
.border-dark-subtle {
	border-color: var(--bs-dark-border-subtle)!important
}
.border-1 {
	border-width: 1px!important
}
.border-2 {
	border-width: 2px!important
}
.border-3 {
	border-width: 3px!important
}
.border-4 {
	border-width: 4px!important
}
.border-5 {
	border-width: 5px!important
}
.border-opacity-10 {
--bs-border-opacity:.1
}
.border-opacity-25 {
--bs-border-opacity:.25
}
.border-opacity-50 {
--bs-border-opacity:.5
}
.border-opacity-75 {
--bs-border-opacity:.75
}
.border-opacity-100 {
--bs-border-opacity:1
}
.w-25 {
	width: 25%!important
}
.w-50 {
	width: 50%!important
}
.w-75 {
	width: 75%!important
}
.w-100 {
	width: 100%!important
}
.w-auto {
	width: auto!important
}
.mw-100 {
	max-width: 100%!important
}
.vw-100 {
	width: 100vw!important
}
.min-vw-100 {
	min-width: 100vw!important
}
.h-25 {
	height: 25%!important
}
.h-50 {
	height: 50%!important
}
.h-75 {
	height: 75%!important
}
.h-100 {
	height: 100%!important
}
.h-auto {
	height: auto!important
}
.mh-100 {
	max-height: 100%!important
}
.vh-100 {
	height: 100vh!important
}
.min-vh-100 {
	min-height: 100vh!important
}
.flex-fill {
	flex: 1 1 auto!important
}
.flex-row {
	flex-direction: row!important
}
.flex-column {
	flex-direction: column!important
}
.flex-row-reverse {
	flex-direction: row-reverse!important
}
.flex-column-reverse {
	flex-direction: column-reverse!important
}
.flex-grow-0 {
	flex-grow: 0!important
}
.flex-grow-1 {
	flex-grow: 1!important
}
.flex-shrink-0 {
	flex-shrink: 0!important
}
.flex-shrink-1 {
	flex-shrink: 1!important
}
.flex-wrap {
	flex-wrap: wrap!important
}
.flex-nowrap {
	flex-wrap: nowrap!important
}
.flex-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-start {
	justify-content: flex-start!important
}
.justify-content-end {
	justify-content: flex-end!important
}
.justify-content-center {
	justify-content: center!important
}
.justify-content-between {
	justify-content: space-between!important
}
.justify-content-around {
	justify-content: space-around!important
}
.justify-content-evenly {
	justify-content: space-evenly!important
}
.align-items-start {
	align-items: flex-start!important
}
.align-items-end {
	align-items: flex-end!important
}
.align-items-center {
	align-items: center!important
}
.align-items-baseline {
	align-items: baseline!important
}
.align-items-stretch {
	align-items: stretch!important
}
.align-content-start {
	align-content: flex-start!important
}
.align-content-end {
	align-content: flex-end!important
}
.align-content-center {
	align-content: center!important
}
.align-content-between {
	align-content: space-between!important
}
.align-content-around {
	align-content: space-around!important
}
.align-content-stretch {
	align-content: stretch!important
}
.align-self-auto {
	align-self: auto!important
}
.align-self-start {
	align-self: flex-start!important
}
.align-self-end {
	align-self: flex-end!important
}
.align-self-center {
	align-self: center!important
}
.align-self-baseline {
	align-self: baseline!important
}
.align-self-stretch {
	align-self: stretch!important
}
.order-first {
	order: -1!important
}
.order-0 {
	order: 0!important
}
.order-1 {
	order: 1!important
}
.order-2 {
	order: 2!important
}
.order-3 {
	order: 3!important
}
.order-4 {
	order: 4!important
}
.order-5 {
	order: 5!important
}
.order-last {
	order: 6!important
}
.m-0 {
	margin: 0!important
}
.m-1 {
	margin: .25rem!important
}
.m-2 {
	margin: .5rem!important
}
.m-3 {
	margin: 1rem!important
}
.m-4 {
	margin: 1.5rem!important
}
.m-5 {
	margin: 3rem!important
}
.m-auto {
	margin: auto!important
}
.mx-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-0 {
	margin-top: 0!important
}
.mt-1 {
	margin-top: .25rem!important
}
.mt-2 {
	margin-top: .5rem!important
}
.mt-3 {
	margin-top: 1rem!important
}
.mt-4 {
	margin-top: 1.5rem!important
}
.mt-5 {
	margin-top: 3rem!important
}
.mt-auto {
	margin-top: auto!important
}
.me-0 {
	margin-right: 0!important
}
.me-1 {
	margin-right: .25rem!important
}
.me-2 {
	margin-right: .5rem!important
}
.me-3 {
	margin-right: 1rem!important
}
.me-4 {
	margin-right: 1.5rem!important
}
.me-5 {
	margin-right: 3rem!important
}
.me-auto {
	margin-right: auto!important
}
.mb-0 {
	margin-bottom: 0!important
}
.mb-1 {
	margin-bottom: .25rem!important
}
.mb-2 {
	margin-bottom: .5rem!important
}
.mb-3 {
	margin-bottom: 1rem!important
}
.mb-4 {
	margin-bottom: 1.5rem!important
}
.mb-5 {
	margin-bottom: 3rem!important
}
.mb-auto {
	margin-bottom: auto!important
}
.ms-0 {
	margin-left: 0!important
}
.ms-1 {
	margin-left: .25rem!important
}
.ms-2 {
	margin-left: .5rem!important
}
.ms-3 {
	margin-left: 1rem!important
}
.ms-4 {
	margin-left: 1.5rem!important
}
.ms-5 {
	margin-left: 3rem!important
}
.ms-auto {
	margin-left: auto!important
}
.p-0 {
	padding: 0!important
}
.p-1 {
	padding: .25rem!important
}
.p-2 {
	padding: .5rem!important
}
.p-3 {
	padding: 1rem!important
}
.p-4 {
	padding: 1.5rem!important
}
.p-5 {
	padding: 3rem!important
}
.px-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-0 {
	padding-top: 0!important
}
.pt-1 {
	padding-top: .25rem!important
}
.pt-2 {
	padding-top: .5rem!important
}
.pt-3 {
	padding-top: 1rem!important
}
.pt-4 {
	padding-top: 1.5rem!important
}
.pt-5 {
	padding-top: 3rem!important
}
.pe-0 {
	padding-right: 0!important
}
.pe-1 {
	padding-right: .25rem!important
}
.pe-2 {
	padding-right: .5rem!important
}
.pe-3 {
	padding-right: 1rem!important
}
.pe-4 {
	padding-right: 1.5rem!important
}
.pe-5 {
	padding-right: 3rem!important
}
.pb-0 {
	padding-bottom: 0!important
}
.pb-1 {
	padding-bottom: .25rem!important
}
.pb-2 {
	padding-bottom: .5rem!important
}
.pb-3 {
	padding-bottom: 1rem!important
}
.pb-4 {
	padding-bottom: 1.5rem!important
}
.pb-5 {
	padding-bottom: 3rem!important
}
.ps-0 {
	padding-left: 0!important
}
.ps-1 {
	padding-left: .25rem!important
}
.ps-2 {
	padding-left: .5rem!important
}
.ps-3 {
	padding-left: 1rem!important
}
.ps-4 {
	padding-left: 1.5rem!important
}
.ps-5 {
	padding-left: 3rem!important
}
.gap-0 {
	gap: 0!important
}
.gap-1 {
	gap: .25rem!important
}
.gap-2 {
	gap: .5rem!important
}
.gap-3 {
	gap: 1rem!important
}
.gap-4 {
	gap: 1.5rem!important
}
.gap-5 {
	gap: 3rem!important
}
.row-gap-0 {
	row-gap: 0!important
}
.row-gap-1 {
	row-gap: .25rem!important
}
.row-gap-2 {
	row-gap: .5rem!important
}
.row-gap-3 {
	row-gap: 1rem!important
}
.row-gap-4 {
	row-gap: 1.5rem!important
}
.row-gap-5 {
	row-gap: 3rem!important
}
.column-gap-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.font-monospace {
	font-family: var(--bs-font-monospace)!important
}
.fs-1 {
	font-size: calc(1.375rem + 1.5vw)!important
}
.fs-2 {
	font-size: calc(1.325rem + .9vw)!important
}
.fs-3 {
	font-size: calc(1.3rem + .6vw)!important
}
.fs-4 {
	font-size: calc(1.275rem + .3vw)!important
}
.fs-5 {
	font-size: 1.25rem!important
}
.fs-6 {
	font-size: 1rem!important
}
.fst-italic {
	font-style: italic!important
}
.fst-normal {
	font-style: normal!important
}
.fw-lighter {
	font-weight: lighter!important
}
.fw-light {
	font-weight: 300!important
}
.fw-normal {
	font-weight: 400!important
}
.fw-medium {
	font-weight: 500!important
}
.fw-semibold {
	font-weight: 600!important
}
.fw-bold {
	font-weight: 700!important
}
.fw-bolder {
	font-weight: bolder!important
}
.lh-1 {
	line-height: 1!important
}
.lh-sm {
	line-height: 1.25!important
}
.lh-base {
	line-height: 1.5!important
}
.lh-lg {
	line-height: 2!important
}
.text-start {
	text-align: left!important
}
.text-end {
	text-align: right!important
}
.text-center {
	text-align: center!important
}
.text-decoration-none {
	text-decoration: none!important
}
.text-decoration-underline {
	text-decoration: underline!important
}
.text-decoration-line-through {
	text-decoration: line-through!important
}
.text-lowercase {
	text-transform: lowercase!important
}
.text-uppercase {
	text-transform: uppercase!important
}
.text-capitalize {
	text-transform: capitalize!important
}
.text-wrap {
	white-space: normal!important
}
.text-nowrap {
	white-space: nowrap!important
}
.text-break {
	word-wrap: break-word!important;
	word-break: break-word!important
}
.text-primary {
--bs-text-opacity:1;
	color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity))!important
}
.text-secondary {
--bs-text-opacity:1;
	color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity))!important
}
.text-success {
--bs-text-opacity:1;
	color: rgba(var(--bs-success-rgb), var(--bs-text-opacity))!important
}
.text-info {
--bs-text-opacity:1;
	color: rgba(var(--bs-info-rgb), var(--bs-text-opacity))!important
}
.text-warning {
--bs-text-opacity:1;
	color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity))!important
}
.text-danger {
--bs-text-opacity:1;
	color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity))!important
}
.text-light {
--bs-text-opacity:1;
	color: rgba(var(--bs-light-rgb), var(--bs-text-opacity))!important
}
.text-dark {
--bs-text-opacity:1;
	color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity))!important
}
.text-black {
--bs-text-opacity:1;
	color: rgba(var(--bs-black-rgb), var(--bs-text-opacity))!important
}
.text-white {
--bs-text-opacity:1;
	color: rgba(var(--bs-white-rgb), var(--bs-text-opacity))!important
}
.text-body {
--bs-text-opacity:1;
	color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity))!important
}
.text-muted {
--bs-text-opacity:1;
	color: var(--bs-secondary-color)!important
}
.text-black-50 {
--bs-text-opacity:1;
	color: #00000080!important
}
.text-white-50 {
--bs-text-opacity:1;
	color: #ffffff80!important
}
.text-body-secondary {
--bs-text-opacity:1;
	color: var(--bs-secondary-color)!important
}
.text-body-tertiary {
--bs-text-opacity:1;
	color: var(--bs-tertiary-color)!important
}
.text-body-emphasis {
--bs-text-opacity:1;
	color: var(--bs-emphasis-color)!important
}
.text-reset {
--bs-text-opacity:1;
	color: inherit!important
}
.text-opacity-25 {
--bs-text-opacity:.25
}
.text-opacity-50 {
--bs-text-opacity:.5
}
.text-opacity-75 {
--bs-text-opacity:.75
}
.text-opacity-100 {
--bs-text-opacity:1
}
.text-primary-emphasis {
	color: var(--bs-primary-text-emphasis)!important
}
.text-secondary-emphasis {
	color: var(--bs-secondary-text-emphasis)!important
}
.text-success-emphasis {
	color: var(--bs-success-text-emphasis)!important
}
.text-info-emphasis {
	color: var(--bs-info-text-emphasis)!important
}
.text-warning-emphasis {
	color: var(--bs-warning-text-emphasis)!important
}
.text-danger-emphasis {
	color: var(--bs-danger-text-emphasis)!important
}
.text-light-emphasis {
	color: var(--bs-light-text-emphasis)!important
}
.text-dark-emphasis {
	color: var(--bs-dark-text-emphasis)!important
}
.link-opacity-10, .link-opacity-10-hover:hover {
--bs-link-opacity:.1
}
.link-opacity-25, .link-opacity-25-hover:hover {
--bs-link-opacity:.25
}
.link-opacity-50, .link-opacity-50-hover:hover {
--bs-link-opacity:.5
}
.link-opacity-75, .link-opacity-75-hover:hover {
--bs-link-opacity:.75
}
.link-opacity-100, .link-opacity-100-hover:hover {
--bs-link-opacity:1
}
.link-offset-1, .link-offset-1-hover:hover {
	text-underline-offset: .125em!important
}
.link-offset-2, .link-offset-2-hover:hover {
	text-underline-offset: .25em!important
}
.link-offset-3, .link-offset-3-hover:hover {
	text-underline-offset: .375em!important
}
.link-underline-primary {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-secondary {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-success {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-info {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-warning {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-danger {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-light {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline-dark {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity))!important
}
.link-underline {
--bs-link-underline-opacity:1;
	text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1))!important
}
.link-underline-opacity-0, .link-underline-opacity-0-hover:hover {
--bs-link-underline-opacity:0
}
.link-underline-opacity-10, .link-underline-opacity-10-hover:hover {
--bs-link-underline-opacity:.1
}
.link-underline-opacity-25, .link-underline-opacity-25-hover:hover {
--bs-link-underline-opacity:.25
}
.link-underline-opacity-50, .link-underline-opacity-50-hover:hover {
--bs-link-underline-opacity:.5
}
.link-underline-opacity-75, .link-underline-opacity-75-hover:hover {
--bs-link-underline-opacity:.75
}
.link-underline-opacity-100, .link-underline-opacity-100-hover:hover {
--bs-link-underline-opacity:1
}
.bg-primary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity))!important
}
.bg-secondary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity))!important
}
.bg-success {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity))!important
}
.bg-info {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity))!important
}
.bg-warning {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity))!important
}
.bg-danger {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity))!important
}
.bg-light {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity))!important
}
.bg-dark {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity))!important
}
.bg-black {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity))!important
}
.bg-white {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity))!important
}
.bg-body {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-transparent {
--bs-bg-opacity:1;
	background-color: transparent!important
}
.bg-body-secondary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-body-tertiary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-opacity-10 {
--bs-bg-opacity:.1
}
.bg-opacity-25 {
--bs-bg-opacity:.25
}
.bg-opacity-50 {
--bs-bg-opacity:.5
}
.bg-opacity-75 {
--bs-bg-opacity:.75
}
.bg-opacity-100 {
--bs-bg-opacity:1
}
.bg-primary-subtle {
	background-color: var(--bs-primary-bg-subtle)!important
}
.bg-secondary-subtle {
	background-color: var(--bs-secondary-bg-subtle)!important
}
.bg-success-subtle {
	background-color: var(--bs-success-bg-subtle)!important
}
.bg-info-subtle {
	background-color: var(--bs-info-bg-subtle)!important
}
.bg-warning-subtle {
	background-color: var(--bs-warning-bg-subtle)!important
}
.bg-danger-subtle {
	background-color: var(--bs-danger-bg-subtle)!important
}
.bg-light-subtle {
	background-color: var(--bs-light-bg-subtle)!important
}
.bg-dark-subtle {
	background-color: var(--bs-dark-bg-subtle)!important
}
.bg-gradient {
	background-image: var(--bs-gradient)!important
}
.user-select-all {
	-webkit-user-select: all!important;
	-moz-user-select: all!important;
	user-select: all!important
}
.user-select-auto {
	-webkit-user-select: auto!important;
	-moz-user-select: auto!important;
	user-select: auto!important
}
.user-select-none {
	-webkit-user-select: none!important;
	-moz-user-select: none!important;
	user-select: none!important
}
.pe-none {
	pointer-events: none!important
}
.pe-auto {
	pointer-events: auto!important
}
.rounded {
	border-radius: var(--bs-border-radius)!important
}
.rounded-0 {
	border-radius: 0!important
}
.rounded-1 {
	border-radius: var(--bs-border-radius-sm)!important
}
.rounded-2 {
	border-radius: var(--bs-border-radius)!important
}
.rounded-3 {
	border-radius: var(--bs-border-radius-lg)!important
}
.rounded-4 {
	border-radius: var(--bs-border-radius-xl)!important
}
.rounded-5 {
	border-radius: var(--bs-border-radius-xxl)!important
}
.rounded-circle {
	border-radius: 50%!important
}
.rounded-pill {
	border-radius: var(--bs-border-radius-pill)!important
}
.rounded-top {
	border-top-left-radius: var(--bs-border-radius)!important;
	border-top-right-radius: var(--bs-border-radius)!important
}
.rounded-top-0 {
	border-top-left-radius: 0!important;
	border-top-right-radius: 0!important
}
.rounded-top-1 {
	border-top-left-radius: var(--bs-border-radius-sm)!important;
	border-top-right-radius: var(--bs-border-radius-sm)!important
}
.rounded-top-2 {
	border-top-left-radius: var(--bs-border-radius)!important;
	border-top-right-radius: var(--bs-border-radius)!important
}
.rounded-top-3 {
	border-top-left-radius: var(--bs-border-radius-lg)!important;
	border-top-right-radius: var(--bs-border-radius-lg)!important
}
.rounded-top-4 {
	border-top-left-radius: var(--bs-border-radius-xl)!important;
	border-top-right-radius: var(--bs-border-radius-xl)!important
}
.rounded-top-5 {
	border-top-left-radius: var(--bs-border-radius-xxl)!important;
	border-top-right-radius: var(--bs-border-radius-xxl)!important
}
.rounded-top-circle {
	border-top-left-radius: 50%!important;
	border-top-right-radius: 50%!important
}
.rounded-top-pill {
	border-top-left-radius: var(--bs-border-radius-pill)!important;
	border-top-right-radius: var(--bs-border-radius-pill)!important
}
.rounded-end {
	border-top-right-radius: var(--bs-border-radius)!important;
	border-bottom-right-radius: var(--bs-border-radius)!important
}
.rounded-end-0 {
	border-top-right-radius: 0!important;
	border-bottom-right-radius: 0!important
}
.rounded-end-1 {
	border-top-right-radius: var(--bs-border-radius-sm)!important;
	border-bottom-right-radius: var(--bs-border-radius-sm)!important
}
.rounded-end-2 {
	border-top-right-radius: var(--bs-border-radius)!important;
	border-bottom-right-radius: var(--bs-border-radius)!important
}
.rounded-end-3 {
	border-top-right-radius: var(--bs-border-radius-lg)!important;
	border-bottom-right-radius: var(--bs-border-radius-lg)!important
}
.rounded-end-4 {
	border-top-right-radius: var(--bs-border-radius-xl)!important;
	border-bottom-right-radius: var(--bs-border-radius-xl)!important
}
.rounded-end-5 {
	border-top-right-radius: var(--bs-border-radius-xxl)!important;
	border-bottom-right-radius: var(--bs-border-radius-xxl)!important
}
.rounded-end-circle {
	border-top-right-radius: 50%!important;
	border-bottom-right-radius: 50%!important
}
.rounded-end-pill {
	border-top-right-radius: var(--bs-border-radius-pill)!important;
	border-bottom-right-radius: var(--bs-border-radius-pill)!important
}
.rounded-bottom {
	border-bottom-right-radius: var(--bs-border-radius)!important;
	border-bottom-left-radius: var(--bs-border-radius)!important
}
.rounded-bottom-0 {
	border-bottom-right-radius: 0!important;
	border-bottom-left-radius: 0!important
}
.rounded-bottom-1 {
	border-bottom-right-radius: var(--bs-border-radius-sm)!important;
	border-bottom-left-radius: var(--bs-border-radius-sm)!important
}
.rounded-bottom-2 {
	border-bottom-right-radius: var(--bs-border-radius)!important;
	border-bottom-left-radius: var(--bs-border-radius)!important
}
.rounded-bottom-3 {
	border-bottom-right-radius: var(--bs-border-radius-lg)!important;
	border-bottom-left-radius: var(--bs-border-radius-lg)!important
}
.rounded-bottom-4 {
	border-bottom-right-radius: var(--bs-border-radius-xl)!important;
	border-bottom-left-radius: var(--bs-border-radius-xl)!important
}
.rounded-bottom-5 {
	border-bottom-right-radius: var(--bs-border-radius-xxl)!important;
	border-bottom-left-radius: var(--bs-border-radius-xxl)!important
}
.rounded-bottom-circle {
	border-bottom-right-radius: 50%!important;
	border-bottom-left-radius: 50%!important
}
.rounded-bottom-pill {
	border-bottom-right-radius: var(--bs-border-radius-pill)!important;
	border-bottom-left-radius: var(--bs-border-radius-pill)!important
}
.rounded-start {
	border-bottom-left-radius: var(--bs-border-radius)!important;
	border-top-left-radius: var(--bs-border-radius)!important
}
.rounded-start-0 {
	border-bottom-left-radius: 0!important;
	border-top-left-radius: 0!important
}
.rounded-start-1 {
	border-bottom-left-radius: var(--bs-border-radius-sm)!important;
	border-top-left-radius: var(--bs-border-radius-sm)!important
}
.rounded-start-2 {
	border-bottom-left-radius: var(--bs-border-radius)!important;
	border-top-left-radius: var(--bs-border-radius)!important
}
.rounded-start-3 {
	border-bottom-left-radius: var(--bs-border-radius-lg)!important;
	border-top-left-radius: var(--bs-border-radius-lg)!important
}
.rounded-start-4 {
	border-bottom-left-radius: var(--bs-border-radius-xl)!important;
	border-top-left-radius: var(--bs-border-radius-xl)!important
}
.rounded-start-5 {
	border-bottom-left-radius: var(--bs-border-radius-xxl)!important;
	border-top-left-radius: var(--bs-border-radius-xxl)!important
}
.rounded-start-circle {
	border-bottom-left-radius: 50%!important;
	border-top-left-radius: 50%!important
}
.rounded-start-pill {
	border-bottom-left-radius: var(--bs-border-radius-pill)!important;
	border-top-left-radius: var(--bs-border-radius-pill)!important
}
.visible {
	visibility: visible!important
}
.invisible {
	visibility: hidden!important
}
.z-n1 {
	z-index: -1!important
}
.z-0 {
	z-index: 0!important
}
.z-1 {
	z-index: 1!important
}
.z-2 {
	z-index: 2!important
}
.z-3 {
	z-index: 3!important
}

@media (min-width:576px) {
.float-sm-start {
	float: left!important
}
.float-sm-end {
	float: right!important
}
.float-sm-none {
	float: none!important
}
.object-fit-sm-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-sm-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-sm-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-sm-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-sm-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-sm-inline {
	display: inline!important
}
.d-sm-inline-block {
	display: inline-block!important
}
.d-sm-block {
	display: block!important
}
.d-sm-grid {
	display: grid!important
}
.d-sm-inline-grid {
	display: inline-grid!important
}
.d-sm-table {
	display: table!important
}
.d-sm-table-row {
	display: table-row!important
}
.d-sm-table-cell {
	display: table-cell!important
}
.d-sm-flex {
	display: flex!important
}
.d-sm-inline-flex {
	display: inline-flex!important
}
.d-sm-none {
	display: none!important
}
.flex-sm-fill {
	flex: 1 1 auto!important
}
.flex-sm-row {
	flex-direction: row!important
}
.flex-sm-column {
	flex-direction: column!important
}
.flex-sm-row-reverse {
	flex-direction: row-reverse!important
}
.flex-sm-column-reverse {
	flex-direction: column-reverse!important
}
.flex-sm-grow-0 {
	flex-grow: 0!important
}
.flex-sm-grow-1 {
	flex-grow: 1!important
}
.flex-sm-shrink-0 {
	flex-shrink: 0!important
}
.flex-sm-shrink-1 {
	flex-shrink: 1!important
}
.flex-sm-wrap {
	flex-wrap: wrap!important
}
.flex-sm-nowrap {
	flex-wrap: nowrap!important
}
.flex-sm-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-sm-start {
	justify-content: flex-start!important
}
.justify-content-sm-end {
	justify-content: flex-end!important
}
.justify-content-sm-center {
	justify-content: center!important
}
.justify-content-sm-between {
	justify-content: space-between!important
}
.justify-content-sm-around {
	justify-content: space-around!important
}
.justify-content-sm-evenly {
	justify-content: space-evenly!important
}
.align-items-sm-start {
	align-items: flex-start!important
}
.align-items-sm-end {
	align-items: flex-end!important
}
.align-items-sm-center {
	align-items: center!important
}
.align-items-sm-baseline {
	align-items: baseline!important
}
.align-items-sm-stretch {
	align-items: stretch!important
}
.align-content-sm-start {
	align-content: flex-start!important
}
.align-content-sm-end {
	align-content: flex-end!important
}
.align-content-sm-center {
	align-content: center!important
}
.align-content-sm-between {
	align-content: space-between!important
}
.align-content-sm-around {
	align-content: space-around!important
}
.align-content-sm-stretch {
	align-content: stretch!important
}
.align-self-sm-auto {
	align-self: auto!important
}
.align-self-sm-start {
	align-self: flex-start!important
}
.align-self-sm-end {
	align-self: flex-end!important
}
.align-self-sm-center {
	align-self: center!important
}
.align-self-sm-baseline {
	align-self: baseline!important
}
.align-self-sm-stretch {
	align-self: stretch!important
}
.order-sm-first {
	order: -1!important
}
.order-sm-0 {
	order: 0!important
}
.order-sm-1 {
	order: 1!important
}
.order-sm-2 {
	order: 2!important
}
.order-sm-3 {
	order: 3!important
}
.order-sm-4 {
	order: 4!important
}
.order-sm-5 {
	order: 5!important
}
.order-sm-last {
	order: 6!important
}
.m-sm-0 {
	margin: 0!important
}
.m-sm-1 {
	margin: .25rem!important
}
.m-sm-2 {
	margin: .5rem!important
}
.m-sm-3 {
	margin: 1rem!important
}
.m-sm-4 {
	margin: 1.5rem!important
}
.m-sm-5 {
	margin: 3rem!important
}
.m-sm-auto {
	margin: auto!important
}
.mx-sm-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-sm-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-sm-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-sm-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-sm-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-sm-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-sm-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-sm-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-sm-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-sm-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-sm-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-sm-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-sm-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-sm-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-sm-0 {
	margin-top: 0!important
}
.mt-sm-1 {
	margin-top: .25rem!important
}
.mt-sm-2 {
	margin-top: .5rem!important
}
.mt-sm-3 {
	margin-top: 1rem!important
}
.mt-sm-4 {
	margin-top: 1.5rem!important
}
.mt-sm-5 {
	margin-top: 3rem!important
}
.mt-sm-auto {
	margin-top: auto!important
}
.me-sm-0 {
	margin-right: 0!important
}
.me-sm-1 {
	margin-right: .25rem!important
}
.me-sm-2 {
	margin-right: .5rem!important
}
.me-sm-3 {
	margin-right: 1rem!important
}
.me-sm-4 {
	margin-right: 1.5rem!important
}
.me-sm-5 {
	margin-right: 3rem!important
}
.me-sm-auto {
	margin-right: auto!important
}
.mb-sm-0 {
	margin-bottom: 0!important
}
.mb-sm-1 {
	margin-bottom: .25rem!important
}
.mb-sm-2 {
	margin-bottom: .5rem!important
}
.mb-sm-3 {
	margin-bottom: 1rem!important
}
.mb-sm-4 {
	margin-bottom: 1.5rem!important
}
.mb-sm-5 {
	margin-bottom: 3rem!important
}
.mb-sm-auto {
	margin-bottom: auto!important
}
.ms-sm-0 {
	margin-left: 0!important
}
.ms-sm-1 {
	margin-left: .25rem!important
}
.ms-sm-2 {
	margin-left: .5rem!important
}
.ms-sm-3 {
	margin-left: 1rem!important
}
.ms-sm-4 {
	margin-left: 1.5rem!important
}
.ms-sm-5 {
	margin-left: 3rem!important
}
.ms-sm-auto {
	margin-left: auto!important
}
.p-sm-0 {
	padding: 0!important
}
.p-sm-1 {
	padding: .25rem!important
}
.p-sm-2 {
	padding: .5rem!important
}
.p-sm-3 {
	padding: 1rem!important
}
.p-sm-4 {
	padding: 1.5rem!important
}
.p-sm-5 {
	padding: 3rem!important
}
.px-sm-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-sm-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-sm-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-sm-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-sm-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-sm-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-sm-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-sm-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-sm-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-sm-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-sm-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-sm-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-sm-0 {
	padding-top: 0!important
}
.pt-sm-1 {
	padding-top: .25rem!important
}
.pt-sm-2 {
	padding-top: .5rem!important
}
.pt-sm-3 {
	padding-top: 1rem!important
}
.pt-sm-4 {
	padding-top: 1.5rem!important
}
.pt-sm-5 {
	padding-top: 3rem!important
}
.pe-sm-0 {
	padding-right: 0!important
}
.pe-sm-1 {
	padding-right: .25rem!important
}
.pe-sm-2 {
	padding-right: .5rem!important
}
.pe-sm-3 {
	padding-right: 1rem!important
}
.pe-sm-4 {
	padding-right: 1.5rem!important
}
.pe-sm-5 {
	padding-right: 3rem!important
}
.pb-sm-0 {
	padding-bottom: 0!important
}
.pb-sm-1 {
	padding-bottom: .25rem!important
}
.pb-sm-2 {
	padding-bottom: .5rem!important
}
.pb-sm-3 {
	padding-bottom: 1rem!important
}
.pb-sm-4 {
	padding-bottom: 1.5rem!important
}
.pb-sm-5 {
	padding-bottom: 3rem!important
}
.ps-sm-0 {
	padding-left: 0!important
}
.ps-sm-1 {
	padding-left: .25rem!important
}
.ps-sm-2 {
	padding-left: .5rem!important
}
.ps-sm-3 {
	padding-left: 1rem!important
}
.ps-sm-4 {
	padding-left: 1.5rem!important
}
.ps-sm-5 {
	padding-left: 3rem!important
}
.gap-sm-0 {
	gap: 0!important
}
.gap-sm-1 {
	gap: .25rem!important
}
.gap-sm-2 {
	gap: .5rem!important
}
.gap-sm-3 {
	gap: 1rem!important
}
.gap-sm-4 {
	gap: 1.5rem!important
}
.gap-sm-5 {
	gap: 3rem!important
}
.row-gap-sm-0 {
	row-gap: 0!important
}
.row-gap-sm-1 {
	row-gap: .25rem!important
}
.row-gap-sm-2 {
	row-gap: .5rem!important
}
.row-gap-sm-3 {
	row-gap: 1rem!important
}
.row-gap-sm-4 {
	row-gap: 1.5rem!important
}
.row-gap-sm-5 {
	row-gap: 3rem!important
}
.column-gap-sm-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-sm-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-sm-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-sm-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-sm-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-sm-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-sm-start {
	text-align: left!important
}
.text-sm-end {
	text-align: right!important
}
.text-sm-center {
	text-align: center!important
}
}

@media (min-width:768px) {
.float-md-start {
	float: left!important
}
.float-md-end {
	float: right!important
}
.float-md-none {
	float: none!important
}
.object-fit-md-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-md-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-md-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-md-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-md-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-md-inline {
	display: inline!important
}
.d-md-inline-block {
	display: inline-block!important
}
.d-md-block {
	display: block!important
}
.d-md-grid {
	display: grid!important
}
.d-md-inline-grid {
	display: inline-grid!important
}
.d-md-table {
	display: table!important
}
.d-md-table-row {
	display: table-row!important
}
.d-md-table-cell {
	display: table-cell!important
}
.d-md-flex {
	display: flex!important
}
.d-md-inline-flex {
	display: inline-flex!important
}
.d-md-none {
	display: none!important
}
.flex-md-fill {
	flex: 1 1 auto!important
}
.flex-md-row {
	flex-direction: row!important
}
.flex-md-column {
	flex-direction: column!important
}
.flex-md-row-reverse {
	flex-direction: row-reverse!important
}
.flex-md-column-reverse {
	flex-direction: column-reverse!important
}
.flex-md-grow-0 {
	flex-grow: 0!important
}
.flex-md-grow-1 {
	flex-grow: 1!important
}
.flex-md-shrink-0 {
	flex-shrink: 0!important
}
.flex-md-shrink-1 {
	flex-shrink: 1!important
}
.flex-md-wrap {
	flex-wrap: wrap!important
}
.flex-md-nowrap {
	flex-wrap: nowrap!important
}
.flex-md-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-md-start {
	justify-content: flex-start!important
}
.justify-content-md-end {
	justify-content: flex-end!important
}
.justify-content-md-center {
	justify-content: center!important
}
.justify-content-md-between {
	justify-content: space-between!important
}
.justify-content-md-around {
	justify-content: space-around!important
}
.justify-content-md-evenly {
	justify-content: space-evenly!important
}
.align-items-md-start {
	align-items: flex-start!important
}
.align-items-md-end {
	align-items: flex-end!important
}
.align-items-md-center {
	align-items: center!important
}
.align-items-md-baseline {
	align-items: baseline!important
}
.align-items-md-stretch {
	align-items: stretch!important
}
.align-content-md-start {
	align-content: flex-start!important
}
.align-content-md-end {
	align-content: flex-end!important
}
.align-content-md-center {
	align-content: center!important
}
.align-content-md-between {
	align-content: space-between!important
}
.align-content-md-around {
	align-content: space-around!important
}
.align-content-md-stretch {
	align-content: stretch!important
}
.align-self-md-auto {
	align-self: auto!important
}
.align-self-md-start {
	align-self: flex-start!important
}
.align-self-md-end {
	align-self: flex-end!important
}
.align-self-md-center {
	align-self: center!important
}
.align-self-md-baseline {
	align-self: baseline!important
}
.align-self-md-stretch {
	align-self: stretch!important
}
.order-md-first {
	order: -1!important
}
.order-md-0 {
	order: 0!important
}
.order-md-1 {
	order: 1!important
}
.order-md-2 {
	order: 2!important
}
.order-md-3 {
	order: 3!important
}
.order-md-4 {
	order: 4!important
}
.order-md-5 {
	order: 5!important
}
.order-md-last {
	order: 6!important
}
.m-md-0 {
	margin: 0!important
}
.m-md-1 {
	margin: .25rem!important
}
.m-md-2 {
	margin: .5rem!important
}
.m-md-3 {
	margin: 1rem!important
}
.m-md-4 {
	margin: 1.5rem!important
}
.m-md-5 {
	margin: 3rem!important
}
.m-md-auto {
	margin: auto!important
}
.mx-md-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-md-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-md-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-md-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-md-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-md-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-md-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-md-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-md-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-md-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-md-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-md-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-md-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-md-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-md-0 {
	margin-top: 0!important
}
.mt-md-1 {
	margin-top: .25rem!important
}
.mt-md-2 {
	margin-top: .5rem!important
}
.mt-md-3 {
	margin-top: 1rem!important
}
.mt-md-4 {
	margin-top: 1.5rem!important
}
.mt-md-5 {
	margin-top: 3rem!important
}
.mt-md-auto {
	margin-top: auto!important
}
.me-md-0 {
	margin-right: 0!important
}
.me-md-1 {
	margin-right: .25rem!important
}
.me-md-2 {
	margin-right: .5rem!important
}
.me-md-3 {
	margin-right: 1rem!important
}
.me-md-4 {
	margin-right: 1.5rem!important
}
.me-md-5 {
	margin-right: 3rem!important
}
.me-md-auto {
	margin-right: auto!important
}
.mb-md-0 {
	margin-bottom: 0!important
}
.mb-md-1 {
	margin-bottom: .25rem!important
}
.mb-md-2 {
	margin-bottom: .5rem!important
}
.mb-md-3 {
	margin-bottom: 1rem!important
}
.mb-md-4 {
	margin-bottom: 1.5rem!important
}
.mb-md-5 {
	margin-bottom: 3rem!important
}
.mb-md-auto {
	margin-bottom: auto!important
}
.ms-md-0 {
	margin-left: 0!important
}
.ms-md-1 {
	margin-left: .25rem!important
}
.ms-md-2 {
	margin-left: .5rem!important
}
.ms-md-3 {
	margin-left: 1rem!important
}
.ms-md-4 {
	margin-left: 1.5rem!important
}
.ms-md-5 {
	margin-left: 3rem!important
}
.ms-md-auto {
	margin-left: auto!important
}
.p-md-0 {
	padding: 0!important
}
.p-md-1 {
	padding: .25rem!important
}
.p-md-2 {
	padding: .5rem!important
}
.p-md-3 {
	padding: 1rem!important
}
.p-md-4 {
	padding: 1.5rem!important
}
.p-md-5 {
	padding: 3rem!important
}
.px-md-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-md-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-md-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-md-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-md-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-md-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-md-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-md-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-md-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-md-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-md-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-md-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-md-0 {
	padding-top: 0!important
}
.pt-md-1 {
	padding-top: .25rem!important
}
.pt-md-2 {
	padding-top: .5rem!important
}
.pt-md-3 {
	padding-top: 1rem!important
}
.pt-md-4 {
	padding-top: 1.5rem!important
}
.pt-md-5 {
	padding-top: 3rem!important
}
.pe-md-0 {
	padding-right: 0!important
}
.pe-md-1 {
	padding-right: .25rem!important
}
.pe-md-2 {
	padding-right: .5rem!important
}
.pe-md-3 {
	padding-right: 1rem!important
}
.pe-md-4 {
	padding-right: 1.5rem!important
}
.pe-md-5 {
	padding-right: 3rem!important
}
.pb-md-0 {
	padding-bottom: 0!important
}
.pb-md-1 {
	padding-bottom: .25rem!important
}
.pb-md-2 {
	padding-bottom: .5rem!important
}
.pb-md-3 {
	padding-bottom: 1rem!important
}
.pb-md-4 {
	padding-bottom: 1.5rem!important
}
.pb-md-5 {
	padding-bottom: 3rem!important
}
.ps-md-0 {
	padding-left: 0!important
}
.ps-md-1 {
	padding-left: .25rem!important
}
.ps-md-2 {
	padding-left: .5rem!important
}
.ps-md-3 {
	padding-left: 1rem!important
}
.ps-md-4 {
	padding-left: 1.5rem!important
}
.ps-md-5 {
	padding-left: 3rem!important
}
.gap-md-0 {
	gap: 0!important
}
.gap-md-1 {
	gap: .25rem!important
}
.gap-md-2 {
	gap: .5rem!important
}
.gap-md-3 {
	gap: 1rem!important
}
.gap-md-4 {
	gap: 1.5rem!important
}
.gap-md-5 {
	gap: 3rem!important
}
.row-gap-md-0 {
	row-gap: 0!important
}
.row-gap-md-1 {
	row-gap: .25rem!important
}
.row-gap-md-2 {
	row-gap: .5rem!important
}
.row-gap-md-3 {
	row-gap: 1rem!important
}
.row-gap-md-4 {
	row-gap: 1.5rem!important
}
.row-gap-md-5 {
	row-gap: 3rem!important
}
.column-gap-md-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-md-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-md-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-md-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-md-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-md-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-md-start {
	text-align: left!important
}
.text-md-end {
	text-align: right!important
}
.text-md-center {
	text-align: center!important
}
}

@media (min-width:992px) {
.float-lg-start {
	float: left!important
}
.float-lg-end {
	float: right!important
}
.float-lg-none {
	float: none!important
}
.object-fit-lg-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-lg-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-lg-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-lg-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-lg-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-lg-inline {
	display: inline!important
}
.d-lg-inline-block {
	display: inline-block!important
}
.d-lg-block {
	display: block!important
}
.d-lg-grid {
	display: grid!important
}
.d-lg-inline-grid {
	display: inline-grid!important
}
.d-lg-table {
	display: table!important
}
.d-lg-table-row {
	display: table-row!important
}
.d-lg-table-cell {
	display: table-cell!important
}
.d-lg-flex {
	display: flex!important
}
.d-lg-inline-flex {
	display: inline-flex!important
}
.d-lg-none {
	display: none!important
}
.flex-lg-fill {
	flex: 1 1 auto!important
}
.flex-lg-row {
	flex-direction: row!important
}
.flex-lg-column {
	flex-direction: column!important
}
.flex-lg-row-reverse {
	flex-direction: row-reverse!important
}
.flex-lg-column-reverse {
	flex-direction: column-reverse!important
}
.flex-lg-grow-0 {
	flex-grow: 0!important
}
.flex-lg-grow-1 {
	flex-grow: 1!important
}
.flex-lg-shrink-0 {
	flex-shrink: 0!important
}
.flex-lg-shrink-1 {
	flex-shrink: 1!important
}
.flex-lg-wrap {
	flex-wrap: wrap!important
}
.flex-lg-nowrap {
	flex-wrap: nowrap!important
}
.flex-lg-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-lg-start {
	justify-content: flex-start!important
}
.justify-content-lg-end {
	justify-content: flex-end!important
}
.justify-content-lg-center {
	justify-content: center!important
}
.justify-content-lg-between {
	justify-content: space-between!important
}
.justify-content-lg-around {
	justify-content: space-around!important
}
.justify-content-lg-evenly {
	justify-content: space-evenly!important
}
.align-items-lg-start {
	align-items: flex-start!important
}
.align-items-lg-end {
	align-items: flex-end!important
}
.align-items-lg-center {
	align-items: center!important
}
.align-items-lg-baseline {
	align-items: baseline!important
}
.align-items-lg-stretch {
	align-items: stretch!important
}
.align-content-lg-start {
	align-content: flex-start!important
}
.align-content-lg-end {
	align-content: flex-end!important
}
.align-content-lg-center {
	align-content: center!important
}
.align-content-lg-between {
	align-content: space-between!important
}
.align-content-lg-around {
	align-content: space-around!important
}
.align-content-lg-stretch {
	align-content: stretch!important
}
.align-self-lg-auto {
	align-self: auto!important
}
.align-self-lg-start {
	align-self: flex-start!important
}
.align-self-lg-end {
	align-self: flex-end!important
}
.align-self-lg-center {
	align-self: center!important
}
.align-self-lg-baseline {
	align-self: baseline!important
}
.align-self-lg-stretch {
	align-self: stretch!important
}
.order-lg-first {
	order: -1!important
}
.order-lg-0 {
	order: 0!important
}
.order-lg-1 {
	order: 1!important
}
.order-lg-2 {
	order: 2!important
}
.order-lg-3 {
	order: 3!important
}
.order-lg-4 {
	order: 4!important
}
.order-lg-5 {
	order: 5!important
}
.order-lg-last {
	order: 6!important
}
.m-lg-0 {
	margin: 0!important
}
.m-lg-1 {
	margin: .25rem!important
}
.m-lg-2 {
	margin: .5rem!important
}
.m-lg-3 {
	margin: 1rem!important
}
.m-lg-4 {
	margin: 1.5rem!important
}
.m-lg-5 {
	margin: 3rem!important
}
.m-lg-auto {
	margin: auto!important
}
.mx-lg-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-lg-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-lg-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-lg-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-lg-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-lg-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-lg-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-lg-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-lg-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-lg-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-lg-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-lg-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-lg-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-lg-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-lg-0 {
	margin-top: 0!important
}
.mt-lg-1 {
	margin-top: .25rem!important
}
.mt-lg-2 {
	margin-top: .5rem!important
}
.mt-lg-3 {
	margin-top: 1rem!important
}
.mt-lg-4 {
	margin-top: 1.5rem!important
}
.mt-lg-5 {
	margin-top: 3rem!important
}
.mt-lg-auto {
	margin-top: auto!important
}
.me-lg-0 {
	margin-right: 0!important
}
.me-lg-1 {
	margin-right: .25rem!important
}
.me-lg-2 {
	margin-right: .5rem!important
}
.me-lg-3 {
	margin-right: 1rem!important
}
.me-lg-4 {
	margin-right: 1.5rem!important
}
.me-lg-5 {
	margin-right: 3rem!important
}
.me-lg-auto {
	margin-right: auto!important
}
.mb-lg-0 {
	margin-bottom: 0!important
}
.mb-lg-1 {
	margin-bottom: .25rem!important
}
.mb-lg-2 {
	margin-bottom: .5rem!important
}
.mb-lg-3 {
	margin-bottom: 1rem!important
}
.mb-lg-4 {
	margin-bottom: 1.5rem!important
}
.mb-lg-5 {
	margin-bottom: 3rem!important
}
.mb-lg-auto {
	margin-bottom: auto!important
}
.ms-lg-0 {
	margin-left: 0!important
}
.ms-lg-1 {
	margin-left: .25rem!important
}
.ms-lg-2 {
	margin-left: .5rem!important
}
.ms-lg-3 {
	margin-left: 1rem!important
}
.ms-lg-4 {
	margin-left: 1.5rem!important
}
.ms-lg-5 {
	margin-left: 3rem!important
}
.ms-lg-auto {
	margin-left: auto!important
}
.p-lg-0 {
	padding: 0!important
}
.p-lg-1 {
	padding: .25rem!important
}
.p-lg-2 {
	padding: .5rem!important
}
.p-lg-3 {
	padding: 1rem!important
}
.p-lg-4 {
	padding: 1.5rem!important
}
.p-lg-5 {
	padding: 3rem!important
}
.px-lg-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-lg-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-lg-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-lg-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-lg-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-lg-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-lg-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-lg-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-lg-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-lg-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-lg-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-lg-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-lg-0 {
	padding-top: 0!important
}
.pt-lg-1 {
	padding-top: .25rem!important
}
.pt-lg-2 {
	padding-top: .5rem!important
}
.pt-lg-3 {
	padding-top: 1rem!important
}
.pt-lg-4 {
	padding-top: 1.5rem!important
}
.pt-lg-5 {
	padding-top: 3rem!important
}
.pe-lg-0 {
	padding-right: 0!important
}
.pe-lg-1 {
	padding-right: .25rem!important
}
.pe-lg-2 {
	padding-right: .5rem!important
}
.pe-lg-3 {
	padding-right: 1rem!important
}
.pe-lg-4 {
	padding-right: 1.5rem!important
}
.pe-lg-5 {
	padding-right: 3rem!important
}
.pb-lg-0 {
	padding-bottom: 0!important
}
.pb-lg-1 {
	padding-bottom: .25rem!important
}
.pb-lg-2 {
	padding-bottom: .5rem!important
}
.pb-lg-3 {
	padding-bottom: 1rem!important
}
.pb-lg-4 {
	padding-bottom: 1.5rem!important
}
.pb-lg-5 {
	padding-bottom: 3rem!important
}
.ps-lg-0 {
	padding-left: 0!important
}
.ps-lg-1 {
	padding-left: .25rem!important
}
.ps-lg-2 {
	padding-left: .5rem!important
}
.ps-lg-3 {
	padding-left: 1rem!important
}
.ps-lg-4 {
	padding-left: 1.5rem!important
}
.ps-lg-5 {
	padding-left: 3rem!important
}
.gap-lg-0 {
	gap: 0!important
}
.gap-lg-1 {
	gap: .25rem!important
}
.gap-lg-2 {
	gap: .5rem!important
}
.gap-lg-3 {
	gap: 1rem!important
}
.gap-lg-4 {
	gap: 1.5rem!important
}
.gap-lg-5 {
	gap: 3rem!important
}
.row-gap-lg-0 {
	row-gap: 0!important
}
.row-gap-lg-1 {
	row-gap: .25rem!important
}
.row-gap-lg-2 {
	row-gap: .5rem!important
}
.row-gap-lg-3 {
	row-gap: 1rem!important
}
.row-gap-lg-4 {
	row-gap: 1.5rem!important
}
.row-gap-lg-5 {
	row-gap: 3rem!important
}
.column-gap-lg-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-lg-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-lg-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-lg-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-lg-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-lg-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-lg-start {
	text-align: left!important
}
.text-lg-end {
	text-align: right!important
}
.text-lg-center {
	text-align: center!important
}
}

@media (min-width:1200px) {
.float-xl-start {
	float: left!important
}
.float-xl-end {
	float: right!important
}
.float-xl-none {
	float: none!important
}
.object-fit-xl-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-xl-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-xl-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-xl-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-xl-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-xl-inline {
	display: inline!important
}
.d-xl-inline-block {
	display: inline-block!important
}
.d-xl-block {
	display: block!important
}
.d-xl-grid {
	display: grid!important
}
.d-xl-inline-grid {
	display: inline-grid!important
}
.d-xl-table {
	display: table!important
}
.d-xl-table-row {
	display: table-row!important
}
.d-xl-table-cell {
	display: table-cell!important
}
.d-xl-flex {
	display: flex!important
}
.d-xl-inline-flex {
	display: inline-flex!important
}
.d-xl-none {
	display: none!important
}
.flex-xl-fill {
	flex: 1 1 auto!important
}
.flex-xl-row {
	flex-direction: row!important
}
.flex-xl-column {
	flex-direction: column!important
}
.flex-xl-row-reverse {
	flex-direction: row-reverse!important
}
.flex-xl-column-reverse {
	flex-direction: column-reverse!important
}
.flex-xl-grow-0 {
	flex-grow: 0!important
}
.flex-xl-grow-1 {
	flex-grow: 1!important
}
.flex-xl-shrink-0 {
	flex-shrink: 0!important
}
.flex-xl-shrink-1 {
	flex-shrink: 1!important
}
.flex-xl-wrap {
	flex-wrap: wrap!important
}
.flex-xl-nowrap {
	flex-wrap: nowrap!important
}
.flex-xl-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-xl-start {
	justify-content: flex-start!important
}
.justify-content-xl-end {
	justify-content: flex-end!important
}
.justify-content-xl-center {
	justify-content: center!important
}
.justify-content-xl-between {
	justify-content: space-between!important
}
.justify-content-xl-around {
	justify-content: space-around!important
}
.justify-content-xl-evenly {
	justify-content: space-evenly!important
}
.align-items-xl-start {
	align-items: flex-start!important
}
.align-items-xl-end {
	align-items: flex-end!important
}
.align-items-xl-center {
	align-items: center!important
}
.align-items-xl-baseline {
	align-items: baseline!important
}
.align-items-xl-stretch {
	align-items: stretch!important
}
.align-content-xl-start {
	align-content: flex-start!important
}
.align-content-xl-end {
	align-content: flex-end!important
}
.align-content-xl-center {
	align-content: center!important
}
.align-content-xl-between {
	align-content: space-between!important
}
.align-content-xl-around {
	align-content: space-around!important
}
.align-content-xl-stretch {
	align-content: stretch!important
}
.align-self-xl-auto {
	align-self: auto!important
}
.align-self-xl-start {
	align-self: flex-start!important
}
.align-self-xl-end {
	align-self: flex-end!important
}
.align-self-xl-center {
	align-self: center!important
}
.align-self-xl-baseline {
	align-self: baseline!important
}
.align-self-xl-stretch {
	align-self: stretch!important
}
.order-xl-first {
	order: -1!important
}
.order-xl-0 {
	order: 0!important
}
.order-xl-1 {
	order: 1!important
}
.order-xl-2 {
	order: 2!important
}
.order-xl-3 {
	order: 3!important
}
.order-xl-4 {
	order: 4!important
}
.order-xl-5 {
	order: 5!important
}
.order-xl-last {
	order: 6!important
}
.m-xl-0 {
	margin: 0!important
}
.m-xl-1 {
	margin: .25rem!important
}
.m-xl-2 {
	margin: .5rem!important
}
.m-xl-3 {
	margin: 1rem!important
}
.m-xl-4 {
	margin: 1.5rem!important
}
.m-xl-5 {
	margin: 3rem!important
}
.m-xl-auto {
	margin: auto!important
}
.mx-xl-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-xl-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-xl-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-xl-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-xl-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-xl-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-xl-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-xl-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-xl-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-xl-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-xl-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-xl-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-xl-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-xl-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-xl-0 {
	margin-top: 0!important
}
.mt-xl-1 {
	margin-top: .25rem!important
}
.mt-xl-2 {
	margin-top: .5rem!important
}
.mt-xl-3 {
	margin-top: 1rem!important
}
.mt-xl-4 {
	margin-top: 1.5rem!important
}
.mt-xl-5 {
	margin-top: 3rem!important
}
.mt-xl-auto {
	margin-top: auto!important
}
.me-xl-0 {
	margin-right: 0!important
}
.me-xl-1 {
	margin-right: .25rem!important
}
.me-xl-2 {
	margin-right: .5rem!important
}
.me-xl-3 {
	margin-right: 1rem!important
}
.me-xl-4 {
	margin-right: 1.5rem!important
}
.me-xl-5 {
	margin-right: 3rem!important
}
.me-xl-auto {
	margin-right: auto!important
}
.mb-xl-0 {
	margin-bottom: 0!important
}
.mb-xl-1 {
	margin-bottom: .25rem!important
}
.mb-xl-2 {
	margin-bottom: .5rem!important
}
.mb-xl-3 {
	margin-bottom: 1rem!important
}
.mb-xl-4 {
	margin-bottom: 1.5rem!important
}
.mb-xl-5 {
	margin-bottom: 3rem!important
}
.mb-xl-auto {
	margin-bottom: auto!important
}
.ms-xl-0 {
	margin-left: 0!important
}
.ms-xl-1 {
	margin-left: .25rem!important
}
.ms-xl-2 {
	margin-left: .5rem!important
}
.ms-xl-3 {
	margin-left: 1rem!important
}
.ms-xl-4 {
	margin-left: 1.5rem!important
}
.ms-xl-5 {
	margin-left: 3rem!important
}
.ms-xl-auto {
	margin-left: auto!important
}
.p-xl-0 {
	padding: 0!important
}
.p-xl-1 {
	padding: .25rem!important
}
.p-xl-2 {
	padding: .5rem!important
}
.p-xl-3 {
	padding: 1rem!important
}
.p-xl-4 {
	padding: 1.5rem!important
}
.p-xl-5 {
	padding: 3rem!important
}
.px-xl-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-xl-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-xl-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-xl-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-xl-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-xl-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-xl-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-xl-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-xl-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-xl-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-xl-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-xl-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-xl-0 {
	padding-top: 0!important
}
.pt-xl-1 {
	padding-top: .25rem!important
}
.pt-xl-2 {
	padding-top: .5rem!important
}
.pt-xl-3 {
	padding-top: 1rem!important
}
.pt-xl-4 {
	padding-top: 1.5rem!important
}
.pt-xl-5 {
	padding-top: 3rem!important
}
.pe-xl-0 {
	padding-right: 0!important
}
.pe-xl-1 {
	padding-right: .25rem!important
}
.pe-xl-2 {
	padding-right: .5rem!important
}
.pe-xl-3 {
	padding-right: 1rem!important
}
.pe-xl-4 {
	padding-right: 1.5rem!important
}
.pe-xl-5 {
	padding-right: 3rem!important
}
.pb-xl-0 {
	padding-bottom: 0!important
}
.pb-xl-1 {
	padding-bottom: .25rem!important
}
.pb-xl-2 {
	padding-bottom: .5rem!important
}
.pb-xl-3 {
	padding-bottom: 1rem!important
}
.pb-xl-4 {
	padding-bottom: 1.5rem!important
}
.pb-xl-5 {
	padding-bottom: 3rem!important
}
.ps-xl-0 {
	padding-left: 0!important
}
.ps-xl-1 {
	padding-left: .25rem!important
}
.ps-xl-2 {
	padding-left: .5rem!important
}
.ps-xl-3 {
	padding-left: 1rem!important
}
.ps-xl-4 {
	padding-left: 1.5rem!important
}
.ps-xl-5 {
	padding-left: 3rem!important
}
.gap-xl-0 {
	gap: 0!important
}
.gap-xl-1 {
	gap: .25rem!important
}
.gap-xl-2 {
	gap: .5rem!important
}
.gap-xl-3 {
	gap: 1rem!important
}
.gap-xl-4 {
	gap: 1.5rem!important
}
.gap-xl-5 {
	gap: 3rem!important
}
.row-gap-xl-0 {
	row-gap: 0!important
}
.row-gap-xl-1 {
	row-gap: .25rem!important
}
.row-gap-xl-2 {
	row-gap: .5rem!important
}
.row-gap-xl-3 {
	row-gap: 1rem!important
}
.row-gap-xl-4 {
	row-gap: 1.5rem!important
}
.row-gap-xl-5 {
	row-gap: 3rem!important
}
.column-gap-xl-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-xl-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-xl-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-xl-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-xl-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-xl-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-xl-start {
	text-align: left!important
}
.text-xl-end {
	text-align: right!important
}
.text-xl-center {
	text-align: center!important
}
}

@media (min-width:1400px) {
.float-xxl-start {
	float: left!important
}
.float-xxl-end {
	float: right!important
}
.float-xxl-none {
	float: none!important
}
.object-fit-xxl-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-xxl-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-xxl-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-xxl-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-xxl-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-xxl-inline {
	display: inline!important
}
.d-xxl-inline-block {
	display: inline-block!important
}
.d-xxl-block {
	display: block!important
}
.d-xxl-grid {
	display: grid!important
}
.d-xxl-inline-grid {
	display: inline-grid!important
}
.d-xxl-table {
	display: table!important
}
.d-xxl-table-row {
	display: table-row!important
}
.d-xxl-table-cell {
	display: table-cell!important
}
.d-xxl-flex {
	display: flex!important
}
.d-xxl-inline-flex {
	display: inline-flex!important
}
.d-xxl-none {
	display: none!important
}
.flex-xxl-fill {
	flex: 1 1 auto!important
}
.flex-xxl-row {
	flex-direction: row!important
}
.flex-xxl-column {
	flex-direction: column!important
}
.flex-xxl-row-reverse {
	flex-direction: row-reverse!important
}
.flex-xxl-column-reverse {
	flex-direction: column-reverse!important
}
.flex-xxl-grow-0 {
	flex-grow: 0!important
}
.flex-xxl-grow-1 {
	flex-grow: 1!important
}
.flex-xxl-shrink-0 {
	flex-shrink: 0!important
}
.flex-xxl-shrink-1 {
	flex-shrink: 1!important
}
.flex-xxl-wrap {
	flex-wrap: wrap!important
}
.flex-xxl-nowrap {
	flex-wrap: nowrap!important
}
.flex-xxl-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-xxl-start {
	justify-content: flex-start!important
}
.justify-content-xxl-end {
	justify-content: flex-end!important
}
.justify-content-xxl-center {
	justify-content: center!important
}
.justify-content-xxl-between {
	justify-content: space-between!important
}
.justify-content-xxl-around {
	justify-content: space-around!important
}
.justify-content-xxl-evenly {
	justify-content: space-evenly!important
}
.align-items-xxl-start {
	align-items: flex-start!important
}
.align-items-xxl-end {
	align-items: flex-end!important
}
.align-items-xxl-center {
	align-items: center!important
}
.align-items-xxl-baseline {
	align-items: baseline!important
}
.align-items-xxl-stretch {
	align-items: stretch!important
}
.align-content-xxl-start {
	align-content: flex-start!important
}
.align-content-xxl-end {
	align-content: flex-end!important
}
.align-content-xxl-center {
	align-content: center!important
}
.align-content-xxl-between {
	align-content: space-between!important
}
.align-content-xxl-around {
	align-content: space-around!important
}
.align-content-xxl-stretch {
	align-content: stretch!important
}
.align-self-xxl-auto {
	align-self: auto!important
}
.align-self-xxl-start {
	align-self: flex-start!important
}
.align-self-xxl-end {
	align-self: flex-end!important
}
.align-self-xxl-center {
	align-self: center!important
}
.align-self-xxl-baseline {
	align-self: baseline!important
}
.align-self-xxl-stretch {
	align-self: stretch!important
}
.order-xxl-first {
	order: -1!important
}
.order-xxl-0 {
	order: 0!important
}
.order-xxl-1 {
	order: 1!important
}
.order-xxl-2 {
	order: 2!important
}
.order-xxl-3 {
	order: 3!important
}
.order-xxl-4 {
	order: 4!important
}
.order-xxl-5 {
	order: 5!important
}
.order-xxl-last {
	order: 6!important
}
.m-xxl-0 {
	margin: 0!important
}
.m-xxl-1 {
	margin: .25rem!important
}
.m-xxl-2 {
	margin: .5rem!important
}
.m-xxl-3 {
	margin: 1rem!important
}
.m-xxl-4 {
	margin: 1.5rem!important
}
.m-xxl-5 {
	margin: 3rem!important
}
.m-xxl-auto {
	margin: auto!important
}
.mx-xxl-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-xxl-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-xxl-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-xxl-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-xxl-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-xxl-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-xxl-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-xxl-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-xxl-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-xxl-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-xxl-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-xxl-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-xxl-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-xxl-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-xxl-0 {
	margin-top: 0!important
}
.mt-xxl-1 {
	margin-top: .25rem!important
}
.mt-xxl-2 {
	margin-top: .5rem!important
}
.mt-xxl-3 {
	margin-top: 1rem!important
}
.mt-xxl-4 {
	margin-top: 1.5rem!important
}
.mt-xxl-5 {
	margin-top: 3rem!important
}
.mt-xxl-auto {
	margin-top: auto!important
}
.me-xxl-0 {
	margin-right: 0!important
}
.me-xxl-1 {
	margin-right: .25rem!important
}
.me-xxl-2 {
	margin-right: .5rem!important
}
.me-xxl-3 {
	margin-right: 1rem!important
}
.me-xxl-4 {
	margin-right: 1.5rem!important
}
.me-xxl-5 {
	margin-right: 3rem!important
}
.me-xxl-auto {
	margin-right: auto!important
}
.mb-xxl-0 {
	margin-bottom: 0!important
}
.mb-xxl-1 {
	margin-bottom: .25rem!important
}
.mb-xxl-2 {
	margin-bottom: .5rem!important
}
.mb-xxl-3 {
	margin-bottom: 1rem!important
}
.mb-xxl-4 {
	margin-bottom: 1.5rem!important
}
.mb-xxl-5 {
	margin-bottom: 3rem!important
}
.mb-xxl-auto {
	margin-bottom: auto!important
}
.ms-xxl-0 {
	margin-left: 0!important
}
.ms-xxl-1 {
	margin-left: .25rem!important
}
.ms-xxl-2 {
	margin-left: .5rem!important
}
.ms-xxl-3 {
	margin-left: 1rem!important
}
.ms-xxl-4 {
	margin-left: 1.5rem!important
}
.ms-xxl-5 {
	margin-left: 3rem!important
}
.ms-xxl-auto {
	margin-left: auto!important
}
.p-xxl-0 {
	padding: 0!important
}
.p-xxl-1 {
	padding: .25rem!important
}
.p-xxl-2 {
	padding: .5rem!important
}
.p-xxl-3 {
	padding: 1rem!important
}
.p-xxl-4 {
	padding: 1.5rem!important
}
.p-xxl-5 {
	padding: 3rem!important
}
.px-xxl-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-xxl-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-xxl-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-xxl-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-xxl-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-xxl-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-xxl-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-xxl-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-xxl-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-xxl-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-xxl-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-xxl-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-xxl-0 {
	padding-top: 0!important
}
.pt-xxl-1 {
	padding-top: .25rem!important
}
.pt-xxl-2 {
	padding-top: .5rem!important
}
.pt-xxl-3 {
	padding-top: 1rem!important
}
.pt-xxl-4 {
	padding-top: 1.5rem!important
}
.pt-xxl-5 {
	padding-top: 3rem!important
}
.pe-xxl-0 {
	padding-right: 0!important
}
.pe-xxl-1 {
	padding-right: .25rem!important
}
.pe-xxl-2 {
	padding-right: .5rem!important
}
.pe-xxl-3 {
	padding-right: 1rem!important
}
.pe-xxl-4 {
	padding-right: 1.5rem!important
}
.pe-xxl-5 {
	padding-right: 3rem!important
}
.pb-xxl-0 {
	padding-bottom: 0!important
}
.pb-xxl-1 {
	padding-bottom: .25rem!important
}
.pb-xxl-2 {
	padding-bottom: .5rem!important
}
.pb-xxl-3 {
	padding-bottom: 1rem!important
}
.pb-xxl-4 {
	padding-bottom: 1.5rem!important
}
.pb-xxl-5 {
	padding-bottom: 3rem!important
}
.ps-xxl-0 {
	padding-left: 0!important
}
.ps-xxl-1 {
	padding-left: .25rem!important
}
.ps-xxl-2 {
	padding-left: .5rem!important
}
.ps-xxl-3 {
	padding-left: 1rem!important
}
.ps-xxl-4 {
	padding-left: 1.5rem!important
}
.ps-xxl-5 {
	padding-left: 3rem!important
}
.gap-xxl-0 {
	gap: 0!important
}
.gap-xxl-1 {
	gap: .25rem!important
}
.gap-xxl-2 {
	gap: .5rem!important
}
.gap-xxl-3 {
	gap: 1rem!important
}
.gap-xxl-4 {
	gap: 1.5rem!important
}
.gap-xxl-5 {
	gap: 3rem!important
}
.row-gap-xxl-0 {
	row-gap: 0!important
}
.row-gap-xxl-1 {
	row-gap: .25rem!important
}
.row-gap-xxl-2 {
	row-gap: .5rem!important
}
.row-gap-xxl-3 {
	row-gap: 1rem!important
}
.row-gap-xxl-4 {
	row-gap: 1.5rem!important
}
.row-gap-xxl-5 {
	row-gap: 3rem!important
}
.column-gap-xxl-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-xxl-1 {
	-moz-column-gap: .25rem!important;
	column-gap: .25rem!important
}
.column-gap-xxl-2 {
	-moz-column-gap: .5rem!important;
	column-gap: .5rem!important
}
.column-gap-xxl-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-xxl-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-xxl-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-xxl-start {
	text-align: left!important
}
.text-xxl-end {
	text-align: right!important
}
.text-xxl-center {
	text-align: center!important
}
}

@media (min-width:1200px) {
.fs-1 {
	font-size: 2.5rem!important
}
.fs-2 {
	font-size: 2rem!important
}
.fs-3 {
	font-size: 1.75rem!important
}
.fs-4 {
	font-size: 1.5rem!important
}
}

@media print {
.d-print-inline {
	display: inline!important
}
.d-print-inline-block {
	display: inline-block!important
}
.d-print-block {
	display: block!important
}
.d-print-grid {
	display: grid!important
}
.d-print-inline-grid {
	display: inline-grid!important
}
.d-print-table {
	display: table!important
}
.d-print-table-row {
	display: table-row!important
}
.d-print-table-cell {
	display: table-cell!important
}
.d-print-flex {
	display: flex!important
}
.d-print-inline-flex {
	display: inline-flex!important
}
.d-print-none {
	display: none!important
}
}
@font-face {
	font-family: swiper-icons;
	src: url(data:application/font-woff;charset=utf-8;base64,\ d09GRgABAAAAAAZgABAAAAAADAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABGRlRNAAAGRAAAABoAAAAci6qHkUdERUYAAAWgAAAAIwAAACQAYABXR1BPUwAABhQAAAAuAAAANuAY7+xHU1VCAAAFxAAAAFAAAABm2fPczU9TLzIAAAHcAAAASgAAAGBP9V5RY21hcAAAAkQAAACIAAABYt6F0cBjdnQgAAACzAAAAAQAAAAEABEBRGdhc3AAAAWYAAAACAAAAAj//wADZ2x5ZgAAAywAAADMAAAD2MHtryVoZWFkAAABbAAAADAAAAA2E2+eoWhoZWEAAAGcAAAAHwAAACQC9gDzaG10eAAAAigAAAAZAAAArgJkABFsb2NhAAAC0AAAAFoAAABaFQAUGG1heHAAAAG8AAAAHwAAACAAcABAbmFtZQAAA/gAAAE5AAACXvFdBwlwb3N0AAAFNAAAAGIAAACE5s74hXjaY2BkYGAAYpf5Hu/j+W2+MnAzMYDAzaX6QjD6/4//Bxj5GA8AuRwMYGkAPywL13jaY2BkYGA88P8Agx4j+/8fQDYfA1AEBWgDAIB2BOoAeNpjYGRgYNBh4GdgYgABEMnIABJzYNADCQAACWgAsQB42mNgYfzCOIGBlYGB0YcxjYGBwR1Kf2WQZGhhYGBiYGVmgAFGBiQQkOaawtDAoMBQxXjg/wEGPcYDDA4wNUA2CCgwsAAAO4EL6gAAeNpj2M0gyAACqxgGNWBkZ2D4/wMA+xkDdgAAAHjaY2BgYGaAYBkGRgYQiAHyGMF8FgYHIM3DwMHABGQrMOgyWDLEM1T9/w8UBfEMgLzE////P/5//f/V/xv+r4eaAAeMbAxwIUYmIMHEgKYAYjUcsDAwsLKxc3BycfPw8jEQA/gZBASFhEVExcQlJKWkZWTl5BUUlZRVVNXUNTQZBgMAAMR+E+gAEQFEAAAAKgAqACoANAA+AEgAUgBcAGYAcAB6AIQAjgCYAKIArAC2AMAAygDUAN4A6ADyAPwBBgEQARoBJAEuATgBQgFMAVYBYAFqAXQBfgGIAZIBnAGmAbIBzgHsAAB42u2NMQ6CUAyGW568x9AneYYgm4MJbhKFaExIOAVX8ApewSt4Bic4AfeAid3VOBixDxfPYEza5O+Xfi04YADggiUIULCuEJK8VhO4bSvpdnktHI5QCYtdi2sl8ZnXaHlqUrNKzdKcT8cjlq+rwZSvIVczNiezsfnP/uznmfPFBNODM2K7MTQ45YEAZqGP81AmGGcF3iPqOop0r1SPTaTbVkfUe4HXj97wYE+yNwWYxwWu4v1ugWHgo3S1XdZEVqWM7ET0cfnLGxWfkgR42o2PvWrDMBSFj/IHLaF0zKjRgdiVMwScNRAoWUoH78Y2icB/yIY09An6AH2Bdu/UB+yxopYshQiEvnvu0dURgDt8QeC8PDw7Fpji3fEA4z/PEJ6YOB5hKh4dj3EvXhxPqH/SKUY3rJ7srZ4FZnh1PMAtPhwP6fl2PMJMPDgeQ4rY8YT6Gzao0eAEA409DuggmTnFnOcSCiEiLMgxCiTI6Cq5DZUd3Qmp10vO0LaLTd2cjN4fOumlc7lUYbSQcZFkutRG7g6JKZKy0RmdLY680CDnEJ+UMkpFFe1RN7nxdVpXrC4aTtnaurOnYercZg2YVmLN/d/gczfEimrE/fs/bOuq29Zmn8tloORaXgZgGa78yO9/cnXm2BpaGvq25Dv9S4E9+5SIc9PqupJKhYFSSl47+Qcr1mYNAAAAeNptw0cKwkAAAMDZJA8Q7OUJvkLsPfZ6zFVERPy8qHh2YER+3i/BP83vIBLLySsoKimrqKqpa2hp6+jq6RsYGhmbmJqZSy0sraxtbO3sHRydnEMU4uR6yx7JJXveP7WrDycAAAAAAAH//wACeNpjYGRgYOABYhkgZgJCZgZNBkYGLQZtIJsFLMYAAAw3ALgAeNolizEKgDAQBCchRbC2sFER0YD6qVQiBCv/H9ezGI6Z5XBAw8CBK/m5iQQVauVbXLnOrMZv2oLdKFa8Pjuru2hJzGabmOSLzNMzvutpB3N42mNgZGBg4GKQYzBhYMxJLMlj4GBgAYow/P/PAJJhLM6sSoWKfWCAAwDAjgbRAAB42mNgYGBkAIIbCZo5IPrmUn0hGA0AO8EFTQAA);
	font-weight: 400;
	font-style: normal
}
:root {
--swiper-theme-color: #007aff
}
:host {
position:relative;
display:block;
margin-left:auto;
margin-right:auto;
z-index:1
}
.swiper {
	margin-left: auto;
	margin-right: auto;
	position: relative;
	overflow: hidden;
	list-style: none;
	padding: 0;
	z-index: 1;
	display: block
}
.swiper-vertical>.swiper-wrapper {
	flex-direction: column
}
.swiper-wrapper {
	position: relative;
	width: 100%;
	height: 100%;
	z-index: 1;
	display: flex;
	transition-property: transform;
	transition-timing-function: var(--swiper-wrapper-transition-timing-function, initial);
	box-sizing: content-box
}
.swiper-android .swiper-slide, .swiper-ios .swiper-slide, .swiper-wrapper {
	transform: translateZ(0)
}
.swiper-horizontal {
	touch-action: pan-y
}
.swiper-vertical {
	touch-action: pan-x
}
.swiper-slide {
	flex-shrink: 0;
	width: 100%;
	height: 100%;
	position: relative;
	transition-property: transform;
	display: block
}
.swiper-slide-invisible-blank {
	visibility: hidden
}
.swiper-autoheight, .swiper-autoheight .swiper-slide {
	height: auto
}
.swiper-autoheight .swiper-wrapper {
	align-items: flex-start;
	transition-property: transform, height
}
.swiper-backface-hidden .swiper-slide {
	transform: translateZ(0);
	backface-visibility: hidden
}
.swiper-3d.swiper-css-mode .swiper-wrapper {
	perspective: 1200px
}
.swiper-3d .swiper-wrapper {
	transform-style: preserve-3d
}
.swiper-3d {
	perspective: 1200px
}
.swiper-3d .swiper-slide, .swiper-3d .swiper-cube-shadow {
	transform-style: preserve-3d
}
.swiper-css-mode>.swiper-wrapper {
	overflow: auto;
	scrollbar-width: none;
	-ms-overflow-style: none
}
.swiper-css-mode>.swiper-wrapper::-webkit-scrollbar {
display:none
}
.swiper-css-mode>.swiper-wrapper>.swiper-slide {
	scroll-snap-align: start start
}
.swiper-css-mode.swiper-horizontal>.swiper-wrapper {
	scroll-snap-type: x mandatory
}
.swiper-css-mode.swiper-vertical>.swiper-wrapper {
	scroll-snap-type: y mandatory
}
.swiper-css-mode.swiper-free-mode>.swiper-wrapper {
	scroll-snap-type: none
}
.swiper-css-mode.swiper-free-mode>.swiper-wrapper>.swiper-slide {
	scroll-snap-align: none
}
.swiper-css-mode.swiper-centered>.swiper-wrapper:before {
	content: "";
	flex-shrink: 0;
	order: 9999
}
.swiper-css-mode.swiper-centered>.swiper-wrapper>.swiper-slide {
	scroll-snap-align: center center;
	scroll-snap-stop: always
}
.swiper-css-mode.swiper-centered.swiper-horizontal>.swiper-wrapper>.swiper-slide:first-child {
	margin-inline-start: var(--swiper-centered-offset-before)
}
.swiper-css-mode.swiper-centered.swiper-horizontal>.swiper-wrapper:before {
	height: 100%;
	min-height: 1px;
	width: var(--swiper-centered-offset-after)
}
.swiper-css-mode.swiper-centered.swiper-vertical>.swiper-wrapper>.swiper-slide:first-child {
	margin-block-start: var(--swiper-centered-offset-before)
}
.swiper-css-mode.swiper-centered.swiper-vertical>.swiper-wrapper:before {
	width: 100%;
	min-width: 1px;
	height: var(--swiper-centered-offset-after)
}
.swiper-3d .swiper-slide-shadow, .swiper-3d .swiper-slide-shadow-left, .swiper-3d .swiper-slide-shadow-right, .swiper-3d .swiper-slide-shadow-top, .swiper-3d .swiper-slide-shadow-bottom {
	position: absolute;
	left: 0;
	top: 0;
	width: 100%;
	height: 100%;
	pointer-events: none;
	z-index: 10
}
.swiper-3d .swiper-slide-shadow {
	background: #00000026
}
.swiper-3d .swiper-slide-shadow-left {
	background-image: linear-gradient(to left, #00000080, #0000)
}
.swiper-3d .swiper-slide-shadow-right {
	background-image: linear-gradient(to right, #00000080, #0000)
}
.swiper-3d .swiper-slide-shadow-top {
	background-image: linear-gradient(to top, #00000080, #0000)
}
.swiper-3d .swiper-slide-shadow-bottom {
	background-image: linear-gradient(to bottom, #00000080, #0000)
}
.swiper-lazy-preloader {
	width: 42px;
	height: 42px;
	position: absolute;
	left: 50%;
	top: 50%;
	margin-left: -21px;
	margin-top: -21px;
	z-index: 10;
	transform-origin: 50%;
	box-sizing: border-box;
	border: 4px solid var(--swiper-preloader-color, var(--swiper-theme-color));
	border-radius: 50%;
	border-top-color: transparent
}
.swiper:not(.swiper-watch-progress) .swiper-lazy-preloader, .swiper-watch-progress .swiper-slide-visible .swiper-lazy-preloader {
	animation: swiper-preloader-spin 1s infinite linear
}
.swiper-lazy-preloader-white {
--swiper-preloader-color: #fff
}
.swiper-lazy-preloader-black {
--swiper-preloader-color: #000
}
@keyframes swiper-preloader-spin {
0% {
transform:rotate(0)
}
to {
transform:rotate(360deg)
}
}/*!
 * Tabler Icons 3.34.0 by tabler - https://tabler.io
 * License - https://github.com/tabler/tabler-icons/blob/master/LICENSE
 */
@font-face {
	font-family: tabler-icons;
	font-style: normal;
	font-weight: 400;
	src: url(tabler-icons-P9EZA0U-8aff.woff2?v3.34.0) format("woff2"), url(tabler-icons-CjtRj09Zd41d.woff?) format("woff"), url(tabler-icons-CcKWk9Q78aff.ttf?v3.34.0) format("truetype")
}
.ti {
	font-family: tabler-icons!important;
	speak: none;
	font-style: normal;
	font-weight: 400;
	font-variant: normal;
	text-transform: none;
	line-height: 1;
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale
}
.ti-a-b:before {
	content: ""
}
.ti-a-b-2:before {
	content: ""
}
.ti-a-b-off:before {
	content: ""
}
.ti-abacus:before {
	content: ""
}
.ti-abacus-off:before {
	content: ""
}
.ti-abc:before {
	content: ""
}
.ti-access-point:before {
	content: ""
}
.ti-access-point-off:before {
	content: ""
}
.ti-accessible:before {
	content: ""
}
.ti-accessible-filled:before {
	content: ""
}
.ti-accessible-off:before {
	content: ""
}
.ti-activity:before {
	content: ""
}
.ti-activity-heartbeat:before {
	content: ""
}
.ti-ad:before {
	content: ""
}
.ti-ad-2:before {
	content: ""
}
.ti-ad-circle:before {
	content: ""
}
.ti-ad-circle-filled:before {
	content: ""
}
.ti-ad-circle-off:before {
	content: ""
}
.ti-ad-filled:before {
	content: ""
}
.ti-ad-off:before {
	content: ""
}
.ti-address-book:before {
	content: ""
}
.ti-address-book-off:before {
	content: ""
}
.ti-adjustments:before {
	content: ""
}
.ti-adjustments-alt:before {
	content: ""
}
.ti-adjustments-bolt:before {
	content: ""
}
.ti-adjustments-cancel:before {
	content: ""
}
.ti-adjustments-check:before {
	content: ""
}
.ti-adjustments-code:before {
	content: ""
}
.ti-adjustments-cog:before {
	content: ""
}
.ti-adjustments-dollar:before {
	content: ""
}
.ti-adjustments-down:before {
	content: ""
}
.ti-adjustments-exclamation:before {
	content: ""
}
.ti-adjustments-filled:before {
	content: ""
}
.ti-adjustments-heart:before {
	content: ""
}
.ti-adjustments-horizontal:before {
	content: ""
}
.ti-adjustments-minus:before {
	content: ""
}
.ti-adjustments-off:before {
	content: ""
}
.ti-adjustments-pause:before {
	content: ""
}
.ti-adjustments-pin:before {
	content: ""
}
.ti-adjustments-plus:before {
	content: ""
}
.ti-adjustments-question:before {
	content: ""
}
.ti-adjustments-search:before {
	content: ""
}
.ti-adjustments-share:before {
	content: ""
}
.ti-adjustments-spark:before {
	content: "ﾾ"
}
.ti-adjustments-star:before {
	content: ""
}
.ti-adjustments-up:before {
	content: ""
}
.ti-adjustments-x:before {
	content: ""
}
.ti-aerial-lift:before {
	content: ""
}
.ti-aerial-lift-filled:before {
	content: "𐄁"
}
.ti-affiliate:before {
	content: ""
}
.ti-affiliate-filled:before {
	content: ""
}
.ti-ai:before {
	content: "ﻧ"
}
.ti-air-balloon:before {
	content: ""
}
.ti-air-balloon-filled:before {
	content: "𐄀"
}
.ti-air-conditioning:before {
	content: ""
}
.ti-air-conditioning-disabled:before {
	content: ""
}
.ti-air-traffic-control:before {
	content: "fi"
}
.ti-alarm:before {
	content: ""
}
.ti-alarm-average:before {
	content: "ﲞ"
}
.ti-alarm-filled:before {
	content: ""
}
.ti-alarm-minus:before {
	content: ""
}
.ti-alarm-minus-filled:before {
	content: ""
}
.ti-alarm-off:before {
	content: ""
}
.ti-alarm-plus:before {
	content: ""
}
.ti-alarm-plus-filled:before {
	content: ""
}
.ti-alarm-smoke:before {
	content: "𐂶"
}
.ti-alarm-snooze:before {
	content: ""
}
.ti-alarm-snooze-filled:before {
	content: ""
}
.ti-album:before {
	content: ""
}
.ti-album-off:before {
	content: ""
}
.ti-alert-circle:before {
	content: ""
}
.ti-alert-circle-filled:before {
	content: ""
}
.ti-alert-circle-off:before {
	content: "ﱥ"
}
.ti-alert-hexagon:before {
	content: ""
}
.ti-alert-hexagon-filled:before {
	content: "勤"
}
.ti-alert-hexagon-off:before {
	content: "ﱦ"
}
.ti-alert-octagon:before {
	content: ""
}
.ti-alert-octagon-filled:before {
	content: ""
}
.ti-alert-small:before {
	content: ""
}
.ti-alert-small-off:before {
	content: "ﱧ"
}
.ti-alert-square:before {
	content: ""
}
.ti-alert-square-filled:before {
	content: "卑"
}
.ti-alert-square-rounded:before {
	content: ""
}
.ti-alert-square-rounded-filled:before {
	content: "喝"
}
.ti-alert-square-rounded-off:before {
	content: "ﱨ"
}
.ti-alert-triangle:before {
	content: ""
}
.ti-alert-triangle-filled:before {
	content: ""
}
.ti-alert-triangle-off:before {
	content: "ﱩ"
}
.ti-alien:before {
	content: ""
}
.ti-alien-filled:before {
	content: ""
}
.ti-align-box-bottom-center:before {
	content: ""
}
.ti-align-box-bottom-center-filled:before {
	content: ""
}
.ti-align-box-bottom-left:before {
	content: ""
}
.ti-align-box-bottom-left-filled:before {
	content: ""
}
.ti-align-box-bottom-right:before {
	content: ""
}
.ti-align-box-bottom-right-filled:before {
	content: ""
}
.ti-align-box-center-bottom:before {
	content: "頋"
}
.ti-align-box-center-middle:before {
	content: ""
}
.ti-align-box-center-middle-filled:before {
	content: ""
}
.ti-align-box-center-stretch:before {
	content: "頻"
}
.ti-align-box-center-top:before {
	content: "鬒"
}
.ti-align-box-left-bottom:before {
	content: ""
}
.ti-align-box-left-bottom-filled:before {
	content: ""
}
.ti-align-box-left-middle:before {
	content: ""
}
.ti-align-box-left-middle-filled:before {
	content: ""
}
.ti-align-box-left-stretch:before {
	content: "龜"
}
.ti-align-box-left-top:before {
	content: ""
}
.ti-align-box-left-top-filled:before {
	content: ""
}
.ti-align-box-right-bottom:before {
	content: ""
}
.ti-align-box-right-bottom-filled:before {
	content: ""
}
.ti-align-box-right-middle:before {
	content: ""
}
.ti-align-box-right-middle-filled:before {
	content: ""
}
.ti-align-box-right-stretch:before {
	content: "𢡊"
}
.ti-align-box-right-top:before {
	content: ""
}
.ti-align-box-right-top-filled:before {
	content: ""
}
.ti-align-box-top-center:before {
	content: ""
}
.ti-align-box-top-center-filled:before {
	content: ""
}
.ti-align-box-top-left:before {
	content: ""
}
.ti-align-box-top-left-filled:before {
	content: ""
}
.ti-align-box-top-right:before {
	content: ""
}
.ti-align-box-top-right-filled:before {
	content: ""
}
.ti-align-center:before {
	content: ""
}
.ti-align-justified:before {
	content: ""
}
.ti-align-left:before {
	content: ""
}
.ti-align-left-2:before {
	content: "＀"
}
.ti-align-right:before {
	content: ""
}
.ti-align-right-2:before {
	content: "\feff"
}
.ti-alpha:before {
	content: ""
}
.ti-alphabet-arabic:before {
	content: "Ｏ"
}
.ti-alphabet-bangla:before {
	content: "Ｎ"
}
.ti-alphabet-cyrillic:before {
	content: ""
}
.ti-alphabet-greek:before {
	content: ""
}
.ti-alphabet-hebrew:before {
	content: "Ｍ"
}
.ti-alphabet-korean:before {
	content: "Ｌ"
}
.ti-alphabet-latin:before {
	content: ""
}
.ti-alphabet-thai:before {
	content: "Ｋ"
}
.ti-alt:before {
	content: "ﱔ"
}
.ti-ambulance:before {
	content: ""
}
.ti-ampersand:before {
	content: ""
}
.ti-analyze:before {
	content: ""
}
.ti-analyze-filled:before {
	content: ""
}
.ti-analyze-off:before {
	content: ""
}
.ti-anchor:before {
	content: ""
}
.ti-anchor-off:before {
	content: ""
}
.ti-angle:before {
	content: ""
}
.ti-ankh:before {
	content: ""
}
.ti-antenna:before {
	content: ""
}
.ti-antenna-bars-1:before {
	content: ""
}
.ti-antenna-bars-2:before {
	content: ""
}
.ti-antenna-bars-3:before {
	content: ""
}
.ti-antenna-bars-4:before {
	content: ""
}
.ti-antenna-bars-5:before {
	content: ""
}
.ti-antenna-bars-off:before {
	content: ""
}
.ti-antenna-off:before {
	content: ""
}
.ti-aperture:before {
	content: ""
}
.ti-aperture-off:before {
	content: ""
}
.ti-api:before {
	content: ""
}
.ti-api-app:before {
	content: ""
}
.ti-api-app-off:before {
	content: ""
}
.ti-api-off:before {
	content: ""
}
.ti-app-window:before {
	content: ""
}
.ti-app-window-filled:before {
	content: ""
}
.ti-apple:before {
	content: ""
}
.ti-apple-filled:before {
	content: "𐀗"
}
.ti-apps:before {
	content: ""
}
.ti-apps-filled:before {
	content: ""
}
.ti-apps-off:before {
	content: ""
}
.ti-archery-arrow:before {
	content: "ﱕ"
}
.ti-archive:before {
	content: ""
}
.ti-archive-filled:before {
	content: "廒"
}
.ti-archive-off:before {
	content: ""
}
.ti-armchair:before {
	content: ""
}
.ti-armchair-2:before {
	content: ""
}
.ti-armchair-2-off:before {
	content: ""
}
.ti-armchair-off:before {
	content: ""
}
.ti-arrow-autofit-content:before {
	content: ""
}
.ti-arrow-autofit-content-filled:before {
	content: ""
}
.ti-arrow-autofit-down:before {
	content: ""
}
.ti-arrow-autofit-down-filled:before {
	content: "𐄓"
}
.ti-arrow-autofit-height:before {
	content: ""
}
.ti-arrow-autofit-height-filled:before {
	content: "𐄒"
}
.ti-arrow-autofit-left:before {
	content: ""
}
.ti-arrow-autofit-left-filled:before {
	content: "𐄑"
}
.ti-arrow-autofit-right:before {
	content: ""
}
.ti-arrow-autofit-right-filled:before {
	content: "𐄐"
}
.ti-arrow-autofit-up:before {
	content: ""
}
.ti-arrow-autofit-up-filled:before {
	content: "𐄏"
}
.ti-arrow-autofit-width:before {
	content: ""
}
.ti-arrow-autofit-width-filled:before {
	content: "𐄎"
}
.ti-arrow-back:before {
	content: ""
}
.ti-arrow-back-up:before {
	content: ""
}
.ti-arrow-back-up-double:before {
	content: "溺"
}
.ti-arrow-badge-down:before {
	content: ""
}
.ti-arrow-badge-down-filled:before {
	content: ""
}
.ti-arrow-badge-left:before {
	content: ""
}
.ti-arrow-badge-left-filled:before {
	content: ""
}
.ti-arrow-badge-right:before {
	content: ""
}
.ti-arrow-badge-right-filled:before {
	content: ""
}
.ti-arrow-badge-up:before {
	content: ""
}
.ti-arrow-badge-up-filled:before {
	content: ""
}
.ti-arrow-bar-both:before {
	content: "﫝"
}
.ti-arrow-bar-down:before {
	content: ""
}
.ti-arrow-bar-left:before {
	content: ""
}
.ti-arrow-bar-right:before {
	content: ""
}
.ti-arrow-bar-to-down:before {
	content: ""
}
.ti-arrow-bar-to-down-dashed:before {
	content: "𐅤"
}
.ti-arrow-bar-to-left:before {
	content: ""
}
.ti-arrow-bar-to-left-dashed:before {
	content: "𐅣"
}
.ti-arrow-bar-to-right:before {
	content: ""
}
.ti-arrow-bar-to-right-dashed:before {
	content: "𐅢"
}
.ti-arrow-bar-to-up:before {
	content: ""
}
.ti-arrow-bar-to-up-dashed:before {
	content: "𐅡"
}
.ti-arrow-bar-up:before {
	content: ""
}
.ti-arrow-bear-left:before {
	content: ""
}
.ti-arrow-bear-left-2:before {
	content: ""
}
.ti-arrow-bear-right:before {
	content: ""
}
.ti-arrow-bear-right-2:before {
	content: ""
}
.ti-arrow-big-down:before {
	content: ""
}
.ti-arrow-big-down-filled:before {
	content: ""
}
.ti-arrow-big-down-line:before {
	content: ""
}
.ti-arrow-big-down-line-filled:before {
	content: ""
}
.ti-arrow-big-down-lines:before {
	content: ""
}
.ti-arrow-big-down-lines-filled:before {
	content: ""
}
.ti-arrow-big-left:before {
	content: ""
}
.ti-arrow-big-left-filled:before {
	content: ""
}
.ti-arrow-big-left-line:before {
	content: ""
}
.ti-arrow-big-left-line-filled:before {
	content: ""
}
.ti-arrow-big-left-lines:before {
	content: ""
}
.ti-arrow-big-left-lines-filled:before {
	content: ""
}
.ti-arrow-big-right:before {
	content: ""
}
.ti-arrow-big-right-filled:before {
	content: ""
}
.ti-arrow-big-right-line:before {
	content: ""
}
.ti-arrow-big-right-line-filled:before {
	content: ""
}
.ti-arrow-big-right-lines:before {
	content: ""
}
.ti-arrow-big-right-lines-filled:before {
	content: ""
}
.ti-arrow-big-up:before {
	content: ""
}
.ti-arrow-big-up-filled:before {
	content: ""
}
.ti-arrow-big-up-line:before {
	content: ""
}
.ti-arrow-big-up-line-filled:before {
	content: ""
}
.ti-arrow-big-up-lines:before {
	content: ""
}
.ti-arrow-big-up-lines-filled:before {
	content: ""
}
.ti-arrow-bounce:before {
	content: ""
}
.ti-arrow-capsule:before {
	content: "﫞"
}
.ti-arrow-curve-left:before {
	content: ""
}
.ti-arrow-curve-right:before {
	content: ""
}
.ti-arrow-down:before {
	content: ""
}
.ti-arrow-down-bar:before {
	content: ""
}
.ti-arrow-down-circle:before {
	content: ""
}
.ti-arrow-down-circle-filled:before {
	content: "𐀻"
}
.ti-arrow-down-dashed:before {
	content: "𐁪"
}
.ti-arrow-down-from-arc:before {
	content: "ﶆ"
}
.ti-arrow-down-left:before {
	content: ""
}
.ti-arrow-down-left-circle:before {
	content: ""
}
.ti-arrow-down-rhombus:before {
	content: ""
}
.ti-arrow-down-rhombus-filled:before {
	content: "𐀺"
}
.ti-arrow-down-right:before {
	content: ""
}
.ti-arrow-down-right-circle:before {
	content: ""
}
.ti-arrow-down-square:before {
	content: ""
}
.ti-arrow-down-square-filled:before {
	content: "𐀹"
}
.ti-arrow-down-tail:before {
	content: ""
}
.ti-arrow-down-to-arc:before {
	content: "ﶇ"
}
.ti-arrow-elbow-left:before {
	content: "吝"
}
.ti-arrow-elbow-right:before {
	content: "燐"
}
.ti-arrow-fork:before {
	content: ""
}
.ti-arrow-forward:before {
	content: ""
}
.ti-arrow-forward-up:before {
	content: ""
}
.ti-arrow-forward-up-double:before {
	content: "璘"
}
.ti-arrow-guide:before {
	content: ""
}
.ti-arrow-guide-filled:before {
	content: "𐀸"
}
.ti-arrow-iteration:before {
	content: ""
}
.ti-arrow-left:before {
	content: ""
}
.ti-arrow-left-bar:before {
	content: ""
}
.ti-arrow-left-circle:before {
	content: ""
}
.ti-arrow-left-circle-filled:before {
	content: "𐀷"
}
.ti-arrow-left-dashed:before {
	content: "𐁩"
}
.ti-arrow-left-from-arc:before {
	content: "ﶈ"
}
.ti-arrow-left-rhombus:before {
	content: ""
}
.ti-arrow-left-rhombus-filled:before {
	content: "𐀶"
}
.ti-arrow-left-right:before {
	content: ""
}
.ti-arrow-left-square:before {
	content: ""
}
.ti-arrow-left-square-filled:before {
	content: "𐀵"
}
.ti-arrow-left-tail:before {
	content: ""
}
.ti-arrow-left-to-arc:before {
	content: "ﶉ"
}
.ti-arrow-loop-left:before {
	content: ""
}
.ti-arrow-loop-left-2:before {
	content: ""
}
.ti-arrow-loop-right:before {
	content: ""
}
.ti-arrow-loop-right-2:before {
	content: ""
}
.ti-arrow-merge:before {
	content: ""
}
.ti-arrow-merge-alt-left:before {
	content: "ﲟ"
}
.ti-arrow-merge-alt-right:before {
	content: "ﲠ"
}
.ti-arrow-merge-both:before {
	content: ""
}
.ti-arrow-merge-left:before {
	content: ""
}
.ti-arrow-merge-right:before {
	content: ""
}
.ti-arrow-move-down:before {
	content: ""
}
.ti-arrow-move-down-filled:before {
	content: "𐀴"
}
.ti-arrow-move-left:before {
	content: ""
}
.ti-arrow-move-left-filled:before {
	content: "𐀳"
}
.ti-arrow-move-right:before {
	content: ""
}
.ti-arrow-move-right-filled:before {
	content: "𐀲"
}
.ti-arrow-move-up:before {
	content: ""
}
.ti-arrow-move-up-filled:before {
	content: "𐀱"
}
.ti-arrow-narrow-down:before {
	content: ""
}
.ti-arrow-narrow-down-dashed:before {
	content: "𐁨"
}
.ti-arrow-narrow-left:before {
	content: ""
}
.ti-arrow-narrow-left-dashed:before {
	content: "𐁧"
}
.ti-arrow-narrow-right:before {
	content: ""
}
.ti-arrow-narrow-right-dashed:before {
	content: "𐁦"
}
.ti-arrow-narrow-up:before {
	content: ""
}
.ti-arrow-narrow-up-dashed:before {
	content: "𐁥"
}
.ti-arrow-ramp-left:before {
	content: ""
}
.ti-arrow-ramp-left-2:before {
	content: ""
}
.ti-arrow-ramp-left-3:before {
	content: ""
}
.ti-arrow-ramp-right:before {
	content: ""
}
.ti-arrow-ramp-right-2:before {
	content: ""
}
.ti-arrow-ramp-right-3:before {
	content: ""
}
.ti-arrow-right:before {
	content: ""
}
.ti-arrow-right-bar:before {
	content: ""
}
.ti-arrow-right-circle:before {
	content: ""
}
.ti-arrow-right-circle-filled:before {
	content: "𐀰"
}
.ti-arrow-right-dashed:before {
	content: "𐁤"
}
.ti-arrow-right-from-arc:before {
	content: "ﶊ"
}
.ti-arrow-right-rhombus:before {
	content: ""
}
.ti-arrow-right-rhombus-filled:before {
	content: "𐀯"
}
.ti-arrow-right-square:before {
	content: ""
}
.ti-arrow-right-square-filled:before {
	content: "𐀮"
}
.ti-arrow-right-tail:before {
	content: ""
}
.ti-arrow-right-to-arc:before {
	content: "ﶋ"
}
.ti-arrow-rotary-first-left:before {
	content: ""
}
.ti-arrow-rotary-first-right:before {
	content: ""
}
.ti-arrow-rotary-last-left:before {
	content: ""
}
.ti-arrow-rotary-last-right:before {
	content: ""
}
.ti-arrow-rotary-left:before {
	content: ""
}
.ti-arrow-rotary-right:before {
	content: ""
}
.ti-arrow-rotary-straight:before {
	content: ""
}
.ti-arrow-roundabout-left:before {
	content: ""
}
.ti-arrow-roundabout-right:before {
	content: ""
}
.ti-arrow-sharp-turn-left:before {
	content: ""
}
.ti-arrow-sharp-turn-right:before {
	content: ""
}
.ti-arrow-up:before {
	content: ""
}
.ti-arrow-up-bar:before {
	content: ""
}
.ti-arrow-up-circle:before {
	content: ""
}
.ti-arrow-up-circle-filled:before {
	content: "𐀭"
}
.ti-arrow-up-dashed:before {
	content: "𐁣"
}
.ti-arrow-up-from-arc:before {
	content: "ﶌ"
}
.ti-arrow-up-left:before {
	content: ""
}
.ti-arrow-up-left-circle:before {
	content: ""
}
.ti-arrow-up-rhombus:before {
	content: ""
}
.ti-arrow-up-rhombus-filled:before {
	content: "𐀬"
}
.ti-arrow-up-right:before {
	content: ""
}
.ti-arrow-up-right-circle:before {
	content: ""
}
.ti-arrow-up-square:before {
	content: ""
}
.ti-arrow-up-square-filled:before {
	content: "𐀫"
}
.ti-arrow-up-tail:before {
	content: ""
}
.ti-arrow-up-to-arc:before {
	content: "ﶍ"
}
.ti-arrow-wave-left-down:before {
	content: ""
}
.ti-arrow-wave-left-up:before {
	content: ""
}
.ti-arrow-wave-right-down:before {
	content: ""
}
.ti-arrow-wave-right-up:before {
	content: ""
}
.ti-arrow-zig-zag:before {
	content: ""
}
.ti-arrows-cross:before {
	content: ""
}
.ti-arrows-diagonal:before {
	content: ""
}
.ti-arrows-diagonal-2:before {
	content: ""
}
.ti-arrows-diagonal-minimize:before {
	content: ""
}
.ti-arrows-diagonal-minimize-2:before {
	content: ""
}
.ti-arrows-diff:before {
	content: ""
}
.ti-arrows-double-ne-sw:before {
	content: ""
}
.ti-arrows-double-nw-se:before {
	content: ""
}
.ti-arrows-double-se-nw:before {
	content: ""
}
.ti-arrows-double-sw-ne:before {
	content: ""
}
.ti-arrows-down:before {
	content: ""
}
.ti-arrows-down-up:before {
	content: ""
}
.ti-arrows-exchange:before {
	content: ""
}
.ti-arrows-exchange-2:before {
	content: ""
}
.ti-arrows-horizontal:before {
	content: ""
}
.ti-arrows-join:before {
	content: ""
}
.ti-arrows-join-2:before {
	content: ""
}
.ti-arrows-left:before {
	content: ""
}
.ti-arrows-left-down:before {
	content: ""
}
.ti-arrows-left-right:before {
	content: ""
}
.ti-arrows-maximize:before {
	content: ""
}
.ti-arrows-minimize:before {
	content: ""
}
.ti-arrows-move:before {
	content: ""
}
.ti-arrows-move-horizontal:before {
	content: ""
}
.ti-arrows-move-vertical:before {
	content: ""
}
.ti-arrows-random:before {
	content: ""
}
.ti-arrows-right:before {
	content: ""
}
.ti-arrows-right-down:before {
	content: ""
}
.ti-arrows-right-left:before {
	content: ""
}
.ti-arrows-shuffle:before {
	content: ""
}
.ti-arrows-shuffle-2:before {
	content: ""
}
.ti-arrows-sort:before {
	content: ""
}
.ti-arrows-split:before {
	content: ""
}
.ti-arrows-split-2:before {
	content: ""
}
.ti-arrows-transfer-down:before {
	content: ""
}
.ti-arrows-transfer-up:before {
	content: ""
}
.ti-arrows-transfer-up-down:before {
	content: "ﾬ"
}
.ti-arrows-up:before {
	content: ""
}
.ti-arrows-up-down:before {
	content: ""
}
.ti-arrows-up-left:before {
	content: ""
}
.ti-arrows-up-right:before {
	content: ""
}
.ti-arrows-vertical:before {
	content: ""
}
.ti-artboard:before {
	content: ""
}
.ti-artboard-filled:before {
	content: "廙"
}
.ti-artboard-off:before {
	content: ""
}
.ti-article:before {
	content: ""
}
.ti-article-filled:before {
	content: ""
}
.ti-article-off:before {
	content: ""
}
.ti-aspect-ratio:before {
	content: ""
}
.ti-aspect-ratio-filled:before {
	content: ""
}
.ti-aspect-ratio-off:before {
	content: ""
}
.ti-assembly:before {
	content: ""
}
.ti-assembly-filled:before {
	content: "ﺞ"
}
.ti-assembly-off:before {
	content: ""
}
.ti-asset:before {
	content: ""
}
.ti-asset-filled:before {
	content: "ﺝ"
}
.ti-asterisk:before {
	content: ""
}
.ti-asterisk-simple:before {
	content: ""
}
.ti-at:before {
	content: ""
}
.ti-at-off:before {
	content: ""
}
.ti-atom:before {
	content: ""
}
.ti-atom-2:before {
	content: ""
}
.ti-atom-2-filled:before {
	content: ""
}
.ti-atom-off:before {
	content: ""
}
.ti-augmented-reality:before {
	content: ""
}
.ti-augmented-reality-2:before {
	content: ""
}
.ti-augmented-reality-off:before {
	content: ""
}
.ti-auth-2fa:before {
	content: ""
}
.ti-automatic-gearbox:before {
	content: "ﲉ"
}
.ti-automatic-gearbox-filled:before {
	content: "𐀪"
}
.ti-automation:before {
	content: "ﻸ"
}
.ti-avocado:before {
	content: "ﶎ"
}
.ti-award:before {
	content: ""
}
.ti-award-filled:before {
	content: ""
}
.ti-award-off:before {
	content: ""
}
.ti-axe:before {
	content: ""
}
.ti-axis-x:before {
	content: ""
}
.ti-axis-y:before {
	content: ""
}
.ti-baby-bottle:before {
	content: ""
}
.ti-baby-carriage:before {
	content: ""
}
.ti-baby-carriage-filled:before {
	content: "ﺜ"
}
.ti-background:before {
	content: "ﴬ"
}
.ti-backhoe:before {
	content: ""
}
.ti-backpack:before {
	content: ""
}
.ti-backpack-off:before {
	content: ""
}
.ti-backslash:before {
	content: "調"
}
.ti-backspace:before {
	content: ""
}
.ti-backspace-filled:before {
	content: ""
}
.ti-badge:before {
	content: ""
}
.ti-badge-2k:before {
	content: "𐂵"
}
.ti-badge-3d:before {
	content: ""
}
.ti-badge-3d-filled:before {
	content: "ﺛ"
}
.ti-badge-3k:before {
	content: "𐂴"
}
.ti-badge-4k:before {
	content: ""
}
.ti-badge-4k-filled:before {
	content: "ﺚ"
}
.ti-badge-5k:before {
	content: "𐂳"
}
.ti-badge-8k:before {
	content: ""
}
.ti-badge-8k-filled:before {
	content: "ﺙ"
}
.ti-badge-ad:before {
	content: ""
}
.ti-badge-ad-filled:before {
	content: "ﺘ"
}
.ti-badge-ad-off:before {
	content: "ﶏ"
}
.ti-badge-ar:before {
	content: ""
}
.ti-badge-ar-filled:before {
	content: "ﺗ"
}
.ti-badge-cc:before {
	content: ""
}
.ti-badge-cc-filled:before {
	content: "ﺖ"
}
.ti-badge-filled:before {
	content: ""
}
.ti-badge-hd:before {
	content: ""
}
.ti-badge-hd-filled:before {
	content: "ﺕ"
}
.ti-badge-off:before {
	content: ""
}
.ti-badge-sd:before {
	content: ""
}
.ti-badge-sd-filled:before {
	content: "ﺔ"
}
.ti-badge-tm:before {
	content: ""
}
.ti-badge-tm-filled:before {
	content: "ﺓ"
}
.ti-badge-vo:before {
	content: ""
}
.ti-badge-vo-filled:before {
	content: "ﺒ"
}
.ti-badge-vr:before {
	content: ""
}
.ti-badge-vr-filled:before {
	content: "ﺑ"
}
.ti-badge-wc:before {
	content: ""
}
.ti-badge-wc-filled:before {
	content: "ﺐ"
}
.ti-badges:before {
	content: ""
}
.ti-badges-filled:before {
	content: ""
}
.ti-badges-off:before {
	content: ""
}
.ti-baguette:before {
	content: ""
}
.ti-ball-american-football:before {
	content: ""
}
.ti-ball-american-football-off:before {
	content: ""
}
.ti-ball-baseball:before {
	content: ""
}
.ti-ball-basketball:before {
	content: ""
}
.ti-ball-bowling:before {
	content: ""
}
.ti-ball-football:before {
	content: ""
}
.ti-ball-football-off:before {
	content: ""
}
.ti-ball-tennis:before {
	content: ""
}
.ti-ball-volleyball:before {
	content: ""
}
.ti-balloon:before {
	content: ""
}
.ti-balloon-filled:before {
	content: "彩"
}
.ti-balloon-off:before {
	content: ""
}
.ti-ballpen:before {
	content: ""
}
.ti-ballpen-filled:before {
	content: "徭"
}
.ti-ballpen-off:before {
	content: ""
}
.ti-ban:before {
	content: ""
}
.ti-bandage:before {
	content: ""
}
.ti-bandage-filled:before {
	content: ""
}
.ti-bandage-off:before {
	content: ""
}
.ti-barbell:before {
	content: ""
}
.ti-barbell-filled:before {
	content: "ﺏ"
}
.ti-barbell-off:before {
	content: ""
}
.ti-barcode:before {
	content: ""
}
.ti-barcode-off:before {
	content: ""
}
.ti-barrel:before {
	content: ""
}
.ti-barrel-off:before {
	content: ""
}
.ti-barrier-block:before {
	content: ""
}
.ti-barrier-block-filled:before {
	content: "ﺎ"
}
.ti-barrier-block-off:before {
	content: ""
}
.ti-baseline:before {
	content: ""
}
.ti-baseline-density-large:before {
	content: "藺"
}
.ti-baseline-density-medium:before {
	content: "隣"
}
.ti-baseline-density-small:before {
	content: "鱗"
}
.ti-basket:before {
	content: ""
}
.ti-basket-bolt:before {
	content: "ףּ"
}
.ti-basket-cancel:before {
	content: "פּ"
}
.ti-basket-check:before {
	content: "﭅"
}
.ti-basket-code:before {
	content: "צּ"
}
.ti-basket-cog:before {
	content: "קּ"
}
.ti-basket-discount:before {
	content: "רּ"
}
.ti-basket-dollar:before {
	content: "שּ"
}
.ti-basket-down:before {
	content: "תּ"
}
.ti-basket-exclamation:before {
	content: "וֹ"
}
.ti-basket-filled:before {
	content: ""
}
.ti-basket-heart:before {
	content: "בֿ"
}
.ti-basket-minus:before {
	content: "כֿ"
}
.ti-basket-off:before {
	content: ""
}
.ti-basket-pause:before {
	content: "פֿ"
}
.ti-basket-pin:before {
	content: "ﭏ"
}
.ti-basket-plus:before {
	content: "ﭐ"
}
.ti-basket-question:before {
	content: "ﭑ"
}
.ti-basket-search:before {
	content: "ﭒ"
}
.ti-basket-share:before {
	content: "ﭓ"
}
.ti-basket-star:before {
	content: "ﭔ"
}
.ti-basket-up:before {
	content: "ﭕ"
}
.ti-basket-x:before {
	content: "ﭖ"
}
.ti-bat:before {
	content: ""
}
.ti-bath:before {
	content: ""
}
.ti-bath-filled:before {
	content: ""
}
.ti-bath-off:before {
	content: ""
}
.ti-battery:before {
	content: ""
}
.ti-battery-1:before {
	content: ""
}
.ti-battery-1-filled:before {
	content: ""
}
.ti-battery-2:before {
	content: ""
}
.ti-battery-2-filled:before {
	content: ""
}
.ti-battery-3:before {
	content: ""
}
.ti-battery-3-filled:before {
	content: ""
}
.ti-battery-4:before {
	content: ""
}
.ti-battery-4-filled:before {
	content: ""
}
.ti-battery-automotive:before {
	content: ""
}
.ti-battery-automotive-filled:before {
	content: "𐀩"
}
.ti-battery-charging:before {
	content: ""
}
.ti-battery-charging-2:before {
	content: ""
}
.ti-battery-eco:before {
	content: ""
}
.ti-battery-exclamation:before {
	content: "＝"
}
.ti-battery-filled:before {
	content: ""
}
.ti-battery-off:before {
	content: ""
}
.ti-battery-spark:before {
	content: "ﾽ"
}
.ti-battery-vertical:before {
	content: "３"
}
.ti-battery-vertical-1:before {
	content: "＜"
}
.ti-battery-vertical-1-filled:before {
	content: "𐀨"
}
.ti-battery-vertical-2:before {
	content: "；"
}
.ti-battery-vertical-2-filled:before {
	content: "𐀧"
}
.ti-battery-vertical-3:before {
	content: "："
}
.ti-battery-vertical-3-filled:before {
	content: "𐀦"
}
.ti-battery-vertical-4:before {
	content: "９"
}
.ti-battery-vertical-4-filled:before {
	content: "𐀥"
}
.ti-battery-vertical-charging:before {
	content: "７"
}
.ti-battery-vertical-charging-2:before {
	content: "８"
}
.ti-battery-vertical-eco:before {
	content: "６"
}
.ti-battery-vertical-exclamation:before {
	content: "５"
}
.ti-battery-vertical-filled:before {
	content: "𐀤"
}
.ti-battery-vertical-off:before {
	content: "４"
}
.ti-beach:before {
	content: ""
}
.ti-beach-off:before {
	content: ""
}
.ti-bed:before {
	content: ""
}
.ti-bed-filled:before {
	content: ""
}
.ti-bed-flat:before {
	content: "ﲡ"
}
.ti-bed-flat-filled:before {
	content: "ﺍ"
}
.ti-bed-off:before {
	content: ""
}
.ti-beer:before {
	content: ""
}
.ti-beer-filled:before {
	content: ""
}
.ti-beer-off:before {
	content: ""
}
.ti-bell:before {
	content: ""
}
.ti-bell-bolt:before {
	content: ""
}
.ti-bell-cancel:before {
	content: ""
}
.ti-bell-check:before {
	content: ""
}
.ti-bell-code:before {
	content: ""
}
.ti-bell-cog:before {
	content: ""
}
.ti-bell-dollar:before {
	content: ""
}
.ti-bell-down:before {
	content: ""
}
.ti-bell-exclamation:before {
	content: ""
}
.ti-bell-filled:before {
	content: ""
}
.ti-bell-heart:before {
	content: ""
}
.ti-bell-minus:before {
	content: ""
}
.ti-bell-minus-filled:before {
	content: ""
}
.ti-bell-off:before {
	content: ""
}
.ti-bell-pause:before {
	content: ""
}
.ti-bell-pin:before {
	content: ""
}
.ti-bell-plus:before {
	content: ""
}
.ti-bell-plus-filled:before {
	content: ""
}
.ti-bell-question:before {
	content: ""
}
.ti-bell-ringing:before {
	content: ""
}
.ti-bell-ringing-2:before {
	content: ""
}
.ti-bell-ringing-2-filled:before {
	content: ""
}
.ti-bell-ringing-filled:before {
	content: ""
}
.ti-bell-school:before {
	content: ""
}
.ti-bell-search:before {
	content: ""
}
.ti-bell-share:before {
	content: ""
}
.ti-bell-star:before {
	content: ""
}
.ti-bell-up:before {
	content: ""
}
.ti-bell-x:before {
	content: ""
}
.ti-bell-x-filled:before {
	content: ""
}
.ti-bell-z:before {
	content: ""
}
.ti-bell-z-filled:before {
	content: ""
}
.ti-beta:before {
	content: ""
}
.ti-bible:before {
	content: ""
}
.ti-bike:before {
	content: ""
}
.ti-bike-filled:before {
	content: "𐀣"
}
.ti-bike-off:before {
	content: ""
}
.ti-binary:before {
	content: ""
}
.ti-binary-off:before {
	content: ""
}
.ti-binary-tree:before {
	content: ""
}
.ti-binary-tree-2:before {
	content: ""
}
.ti-binary-tree-2-filled:before {
	content: "･"
}
.ti-binary-tree-filled:before {
	content: "､"
}
.ti-binoculars:before {
	content: "﻾"
}
.ti-binoculars-filled:before {
	content: "＋"
}
.ti-biohazard:before {
	content: ""
}
.ti-biohazard-filled:before {
	content: "ﺌ"
}
.ti-biohazard-off:before {
	content: ""
}
.ti-blade:before {
	content: ""
}
.ti-blade-filled:before {
	content: ""
}
.ti-bleach:before {
	content: ""
}
.ti-bleach-chlorine:before {
	content: ""
}
.ti-bleach-no-chlorine:before {
	content: ""
}
.ti-bleach-off:before {
	content: ""
}
.ti-blend-mode:before {
	content: "ﺰ"
}
.ti-blender:before {
	content: "ﲢ"
}
.ti-blender-filled:before {
	content: "𐀢"
}
.ti-blob:before {
	content: "ﺯ"
}
.ti-blob-filled:before {
	content: "ﺱ"
}
.ti-blockquote:before {
	content: ""
}
.ti-blocks:before {
	content: "𐂲"
}
.ti-bluetooth:before {
	content: ""
}
.ti-bluetooth-connected:before {
	content: ""
}
.ti-bluetooth-off:before {
	content: ""
}
.ti-bluetooth-x:before {
	content: ""
}
.ti-blur:before {
	content: ""
}
.ti-blur-off:before {
	content: ""
}
.ti-bmp:before {
	content: ""
}
.ti-body-scan:before {
	content: "ﲣ"
}
.ti-bold:before {
	content: ""
}
.ti-bold-off:before {
	content: ""
}
.ti-bolt:before {
	content: ""
}
.ti-bolt-filled:before {
	content: "𐀡"
}
.ti-bolt-off:before {
	content: ""
}
.ti-bomb:before {
	content: ""
}
.ti-bomb-filled:before {
	content: "惘"
}
.ti-bone:before {
	content: ""
}
.ti-bone-filled:before {
	content: "ﺋ"
}
.ti-bone-off:before {
	content: ""
}
.ti-bong:before {
	content: ""
}
.ti-bong-filled:before {
	content: "𐀠"
}
.ti-bong-off:before {
	content: ""
}
.ti-book:before {
	content: ""
}
.ti-book-2:before {
	content: ""
}
.ti-book-download:before {
	content: ""
}
.ti-book-filled:before {
	content: "慎"
}
.ti-book-off:before {
	content: ""
}
.ti-book-upload:before {
	content: ""
}
.ti-bookmark:before {
	content: ""
}
.ti-bookmark-ai:before {
	content: "ﲊ"
}
.ti-bookmark-edit:before {
	content: "艹"
}
.ti-bookmark-filled:before {
	content: "愈"
}
.ti-bookmark-minus:before {
	content: "著"
}
.ti-bookmark-off:before {
	content: ""
}
.ti-bookmark-plus:before {
	content: "褐"
}
.ti-bookmark-question:before {
	content: "視"
}
.ti-bookmarks:before {
	content: ""
}
.ti-bookmarks-filled:before {
	content: "ײַ"
}
.ti-bookmarks-off:before {
	content: ""
}
.ti-books:before {
	content: ""
}
.ti-books-off:before {
	content: ""
}
.ti-boom:before {
	content: "ﶾ"
}
.ti-boom-filled:before {
	content: "ﺊ"
}
.ti-border-all:before {
	content: ""
}
.ti-border-bottom:before {
	content: ""
}
.ti-border-bottom-plus:before {
	content: "ﶽ"
}
.ti-border-corner-ios:before {
	content: "ﶘ"
}
.ti-border-corner-pill:before {
	content: "ﵢ"
}
.ti-border-corner-rounded:before {
	content: "ﵣ"
}
.ti-border-corner-square:before {
	content: "ﵤ"
}
.ti-border-corners:before {
	content: ""
}
.ti-border-horizontal:before {
	content: ""
}
.ti-border-inner:before {
	content: ""
}
.ti-border-left:before {
	content: ""
}
.ti-border-left-plus:before {
	content: "ﶼ"
}
.ti-border-none:before {
	content: ""
}
.ti-border-outer:before {
	content: ""
}
.ti-border-radius:before {
	content: ""
}
.ti-border-right:before {
	content: ""
}
.ti-border-right-plus:before {
	content: "ﶻ"
}
.ti-border-sides:before {
	content: ""
}
.ti-border-style:before {
	content: ""
}
.ti-border-style-2:before {
	content: ""
}
.ti-border-top:before {
	content: ""
}
.ti-border-top-plus:before {
	content: "ﶺ"
}
.ti-border-vertical:before {
	content: ""
}
.ti-bottle:before {
	content: ""
}
.ti-bottle-filled:before {
	content: "憎"
}
.ti-bottle-off:before {
	content: ""
}
.ti-bounce-left:before {
	content: ""
}
.ti-bounce-left-filled:before {
	content: "ﬠ"
}
.ti-bounce-right:before {
	content: ""
}
.ti-bounce-right-filled:before {
	content: "ﬡ"
}
.ti-bow:before {
	content: ""
}
.ti-bow-filled:before {
	content: "ﺉ"
}
.ti-bowl:before {
	content: ""
}
.ti-bowl-chopsticks:before {
	content: "﶐"
}
.ti-bowl-chopsticks-filled:before {
	content: "ﺈ"
}
.ti-bowl-filled:before {
	content: "ﬢ"
}
.ti-bowl-spoon:before {
	content: "﶑"
}
.ti-bowl-spoon-filled:before {
	content: "ﺇ"
}
.ti-bowling:before {
	content: "𐂱"
}
.ti-box:before {
	content: ""
}
.ti-box-align-bottom:before {
	content: ""
}
.ti-box-align-bottom-filled:before {
	content: "慠"
}
.ti-box-align-bottom-left:before {
	content: ""
}
.ti-box-align-bottom-left-filled:before {
	content: "懲"
}
.ti-box-align-bottom-right:before {
	content: ""
}
.ti-box-align-bottom-right-filled:before {
	content: "戴"
}
.ti-box-align-left:before {
	content: ""
}
.ti-box-align-left-filled:before {
	content: "揄"
}
.ti-box-align-right:before {
	content: ""
}
.ti-box-align-right-filled:before {
	content: "搜"
}
.ti-box-align-top:before {
	content: ""
}
.ti-box-align-top-filled:before {
	content: "摒"
}
.ti-box-align-top-left:before {
	content: ""
}
.ti-box-align-top-left-filled:before {
	content: "敖"
}
.ti-box-align-top-right:before {
	content: ""
}
.ti-box-align-top-right-filled:before {
	content: "晴"
}
.ti-box-margin:before {
	content: ""
}
.ti-box-model:before {
	content: ""
}
.ti-box-model-2:before {
	content: ""
}
.ti-box-model-2-off:before {
	content: ""
}
.ti-box-model-off:before {
	content: ""
}
.ti-box-multiple:before {
	content: ""
}
.ti-box-multiple-0:before {
	content: ""
}
.ti-box-multiple-1:before {
	content: ""
}
.ti-box-multiple-2:before {
	content: ""
}
.ti-box-multiple-3:before {
	content: ""
}
.ti-box-multiple-4:before {
	content: ""
}
.ti-box-multiple-5:before {
	content: ""
}
.ti-box-multiple-6:before {
	content: ""
}
.ti-box-multiple-7:before {
	content: ""
}
.ti-box-multiple-8:before {
	content: ""
}
.ti-box-multiple-9:before {
	content: ""
}
.ti-box-multiple-filled:before {
	content: "𐀟"
}
.ti-box-off:before {
	content: ""
}
.ti-box-padding:before {
	content: ""
}
.ti-braces:before {
	content: ""
}
.ti-braces-off:before {
	content: ""
}
.ti-brackets:before {
	content: ""
}
.ti-brackets-angle:before {
	content: "ﲲ"
}
.ti-brackets-angle-off:before {
	content: "ﲱ"
}
.ti-brackets-contain:before {
	content: ""
}
.ti-brackets-contain-end:before {
	content: ""
}
.ti-brackets-contain-start:before {
	content: ""
}
.ti-brackets-off:before {
	content: ""
}
.ti-braille:before {
	content: ""
}
.ti-brain:before {
	content: ""
}
.ti-brand-4chan:before {
	content: ""
}
.ti-brand-abstract:before {
	content: ""
}
.ti-brand-adobe:before {
	content: ""
}
.ti-brand-adobe-after-effect:before {
	content: "Ｊ"
}
.ti-brand-adobe-illustrator:before {
	content: "Ｉ"
}
.ti-brand-adobe-indesign:before {
	content: "Ｈ"
}
.ti-brand-adobe-photoshop:before {
	content: "Ｇ"
}
.ti-brand-adobe-premier:before {
	content: "Ｆ"
}
.ti-brand-adobe-xd:before {
	content: "Ｅ"
}
.ti-brand-adonis-js:before {
	content: ""
}
.ti-brand-airbnb:before {
	content: ""
}
.ti-brand-airtable:before {
	content: ""
}
.ti-brand-algolia:before {
	content: ""
}
.ti-brand-alipay:before {
	content: ""
}
.ti-brand-alpine-js:before {
	content: ""
}
.ti-brand-amazon:before {
	content: ""
}
.ti-brand-amd:before {
	content: ""
}
.ti-brand-amie:before {
	content: "ﾫ"
}
.ti-brand-amigo:before {
	content: ""
}
.ti-brand-among-us:before {
	content: ""
}
.ti-brand-android:before {
	content: ""
}
.ti-brand-angular:before {
	content: ""
}
.ti-brand-angular-filled:before {
	content: "𐂕"
}
.ti-brand-ansible:before {
	content: "並"
}
.ti-brand-ao3:before {
	content: ""
}
.ti-brand-appgallery:before {
	content: ""
}
.ti-brand-apple:before {
	content: ""
}
.ti-brand-apple-arcade:before {
	content: ""
}
.ti-brand-apple-filled:before {
	content: "ﵴ"
}
.ti-brand-apple-news:before {
	content: "Ｄ"
}
.ti-brand-apple-podcast:before {
	content: ""
}
.ti-brand-appstore:before {
	content: ""
}
.ti-brand-arc:before {
	content: "ﺮ"
}
.ti-brand-asana:before {
	content: ""
}
.ti-brand-astro:before {
	content: "ﶹ"
}
.ti-brand-auth0:before {
	content: "ﲳ"
}
.ti-brand-aws:before {
	content: "社"
}
.ti-brand-azure:before {
	content: "祉"
}
.ti-brand-backbone:before {
	content: ""
}
.ti-brand-badoo:before {
	content: ""
}
.ti-brand-baidu:before {
	content: ""
}
.ti-brand-bandcamp:before {
	content: ""
}
.ti-brand-bandlab:before {
	content: ""
}
.ti-brand-beats:before {
	content: ""
}
.ti-brand-bebo:before {
	content: "ﾪ"
}
.ti-brand-behance:before {
	content: ""
}
.ti-brand-bilibili:before {
	content: ""
}
.ti-brand-binance:before {
	content: ""
}
.ti-brand-bing:before {
	content: ""
}
.ti-brand-bitbucket:before {
	content: ""
}
.ti-brand-bitbucket-filled:before {
	content: "𐃋"
}
.ti-brand-blackberry:before {
	content: ""
}
.ti-brand-blender:before {
	content: ""
}
.ti-brand-blogger:before {
	content: ""
}
.ti-brand-bluesky:before {
	content: "ﵵ"
}
.ti-brand-booking:before {
	content: ""
}
.ti-brand-bootstrap:before {
	content: ""
}
.ti-brand-bulma:before {
	content: ""
}
.ti-brand-bumble:before {
	content: ""
}
.ti-brand-bunpo:before {
	content: ""
}
.ti-brand-c-sharp:before {
	content: ""
}
.ti-brand-cake:before {
	content: ""
}
.ti-brand-cakephp:before {
	content: ""
}
.ti-brand-campaignmonitor:before {
	content: ""
}
.ti-brand-carbon:before {
	content: ""
}
.ti-brand-cashapp:before {
	content: ""
}
.ti-brand-chrome:before {
	content: ""
}
.ti-brand-cinema-4d:before {
	content: "况"
}
.ti-brand-citymapper:before {
	content: ""
}
.ti-brand-cloudflare:before {
	content: "祈"
}
.ti-brand-codecov:before {
	content: ""
}
.ti-brand-codepen:before {
	content: ""
}
.ti-brand-codesandbox:before {
	content: ""
}
.ti-brand-cohost:before {
	content: ""
}
.ti-brand-coinbase:before {
	content: ""
}
.ti-brand-comedy-central:before {
	content: ""
}
.ti-brand-coreos:before {
	content: ""
}
.ti-brand-couchdb:before {
	content: ""
}
.ti-brand-couchsurfing:before {
	content: ""
}
.ti-brand-cpp:before {
	content: ""
}
.ti-brand-craft:before {
	content: "全"
}
.ti-brand-crunchbase:before {
	content: ""
}
.ti-brand-css3:before {
	content: ""
}
.ti-brand-ctemplar:before {
	content: ""
}
.ti-brand-cucumber:before {
	content: ""
}
.ti-brand-cupra:before {
	content: ""
}
.ti-brand-cypress:before {
	content: ""
}
.ti-brand-d3:before {
	content: ""
}
.ti-brand-databricks:before {
	content: "ﱁ"
}
.ti-brand-days-counter:before {
	content: ""
}
.ti-brand-dcos:before {
	content: ""
}
.ti-brand-debian:before {
	content: ""
}
.ti-brand-deezer:before {
	content: ""
}
.ti-brand-deliveroo:before {
	content: ""
}
.ti-brand-deno:before {
	content: ""
}
.ti-brand-denodo:before {
	content: ""
}
.ti-brand-deviantart:before {
	content: ""
}
.ti-brand-digg:before {
	content: "侀"
}
.ti-brand-dingtalk:before {
	content: ""
}
.ti-brand-discord:before {
	content: ""
}
.ti-brand-discord-filled:before {
	content: ""
}
.ti-brand-disney:before {
	content: ""
}
.ti-brand-disqus:before {
	content: ""
}
.ti-brand-django:before {
	content: ""
}
.ti-brand-docker:before {
	content: ""
}
.ti-brand-doctrine:before {
	content: ""
}
.ti-brand-dolby-digital:before {
	content: ""
}
.ti-brand-douban:before {
	content: ""
}
.ti-brand-dribbble:before {
	content: ""
}
.ti-brand-dribbble-filled:before {
	content: ""
}
.ti-brand-drops:before {
	content: ""
}
.ti-brand-drupal:before {
	content: ""
}
.ti-brand-edge:before {
	content: ""
}
.ti-brand-elastic:before {
	content: ""
}
.ti-brand-electronic-arts:before {
	content: "充"
}
.ti-brand-ember:before {
	content: ""
}
.ti-brand-envato:before {
	content: ""
}
.ti-brand-etsy:before {
	content: ""
}
.ti-brand-evernote:before {
	content: ""
}
.ti-brand-facebook:before {
	content: ""
}
.ti-brand-facebook-filled:before {
	content: ""
}
.ti-brand-feedly:before {
	content: "冀"
}
.ti-brand-figma:before {
	content: ""
}
.ti-brand-filezilla:before {
	content: "勇"
}
.ti-brand-finder:before {
	content: ""
}
.ti-brand-firebase:before {
	content: ""
}
.ti-brand-firefox:before {
	content: ""
}
.ti-brand-fiverr:before {
	content: ""
}
.ti-brand-flickr:before {
	content: ""
}
.ti-brand-flightradar24:before {
	content: ""
}
.ti-brand-flipboard:before {
	content: ""
}
.ti-brand-flutter:before {
	content: ""
}
.ti-brand-fortnite:before {
	content: ""
}
.ti-brand-foursquare:before {
	content: ""
}
.ti-brand-framer:before {
	content: ""
}
.ti-brand-framer-motion:before {
	content: ""
}
.ti-brand-funimation:before {
	content: ""
}
.ti-brand-gatsby:before {
	content: ""
}
.ti-brand-git:before {
	content: ""
}
.ti-brand-github:before {
	content: ""
}
.ti-brand-github-copilot:before {
	content: ""
}
.ti-brand-github-filled:before {
	content: ""
}
.ti-brand-gitlab:before {
	content: ""
}
.ti-brand-gmail:before {
	content: ""
}
.ti-brand-golang:before {
	content: ""
}
.ti-brand-google:before {
	content: ""
}
.ti-brand-google-analytics:before {
	content: ""
}
.ti-brand-google-big-query:before {
	content: ""
}
.ti-brand-google-drive:before {
	content: ""
}
.ti-brand-google-filled:before {
	content: "ﴚ"
}
.ti-brand-google-fit:before {
	content: ""
}
.ti-brand-google-home:before {
	content: ""
}
.ti-brand-google-maps:before {
	content: "祐"
}
.ti-brand-google-one:before {
	content: ""
}
.ti-brand-google-photos:before {
	content: ""
}
.ti-brand-google-play:before {
	content: ""
}
.ti-brand-google-podcasts:before {
	content: ""
}
.ti-brand-grammarly:before {
	content: ""
}
.ti-brand-graphql:before {
	content: ""
}
.ti-brand-gravatar:before {
	content: ""
}
.ti-brand-grindr:before {
	content: ""
}
.ti-brand-guardian:before {
	content: ""
}
.ti-brand-gumroad:before {
	content: ""
}
.ti-brand-hackerrank:before {
	content: "Ｃ"
}
.ti-brand-hbo:before {
	content: ""
}
.ti-brand-headlessui:before {
	content: ""
}
.ti-brand-hexo:before {
	content: "祖"
}
.ti-brand-hipchat:before {
	content: ""
}
.ti-brand-html5:before {
	content: ""
}
.ti-brand-inertia:before {
	content: ""
}
.ti-brand-instagram:before {
	content: ""
}
.ti-brand-instagram-filled:before {
	content: "𐂔"
}
.ti-brand-intercom:before {
	content: ""
}
.ti-brand-itch:before {
	content: "諸"
}
.ti-brand-javascript:before {
	content: ""
}
.ti-brand-juejin:before {
	content: ""
}
.ti-brand-kako-talk:before {
	content: "ﴭ"
}
.ti-brand-kbin:before {
	content: "𢡄"
}
.ti-brand-kick:before {
	content: "﨣"
}
.ti-brand-kick-filled:before {
	content: "𐂓"
}
.ti-brand-kickstarter:before {
	content: ""
}
.ti-brand-kotlin:before {
	content: ""
}
.ti-brand-laravel:before {
	content: ""
}
.ti-brand-lastfm:before {
	content: ""
}
.ti-brand-leetcode:before {
	content: "祝"
}
.ti-brand-letterboxd:before {
	content: "﨤"
}
.ti-brand-line:before {
	content: ""
}
.ti-brand-linkedin:before {
	content: ""
}
.ti-brand-linkedin-filled:before {
	content: "𐂒"
}
.ti-brand-linktree:before {
	content: ""
}
.ti-brand-linqpad:before {
	content: ""
}
.ti-brand-livewire:before {
	content: "ﵶ"
}
.ti-brand-loom:before {
	content: ""
}
.ti-brand-mailgun:before {
	content: ""
}
.ti-brand-mantine:before {
	content: ""
}
.ti-brand-mastercard:before {
	content: ""
}
.ti-brand-mastodon:before {
	content: ""
}
.ti-brand-matrix:before {
	content: ""
}
.ti-brand-mcdonalds:before {
	content: ""
}
.ti-brand-medium:before {
	content: ""
}
.ti-brand-meetup:before {
	content: "ﱪ"
}
.ti-brand-mercedes:before {
	content: ""
}
.ti-brand-messenger:before {
	content: ""
}
.ti-brand-messenger-filled:before {
	content: "𐂧"
}
.ti-brand-meta:before {
	content: ""
}
.ti-brand-metabrainz:before {
	content: "２"
}
.ti-brand-minecraft:before {
	content: "﫯"
}
.ti-brand-miniprogram:before {
	content: ""
}
.ti-brand-mixpanel:before {
	content: ""
}
.ti-brand-monday:before {
	content: ""
}
.ti-brand-mongodb:before {
	content: ""
}
.ti-brand-my-oppo:before {
	content: ""
}
.ti-brand-mysql:before {
	content: ""
}
.ti-brand-national-geographic:before {
	content: ""
}
.ti-brand-nem:before {
	content: ""
}
.ti-brand-netbeans:before {
	content: ""
}
.ti-brand-netease-music:before {
	content: ""
}
.ti-brand-netflix:before {
	content: ""
}
.ti-brand-nexo:before {
	content: ""
}
.ti-brand-nextcloud:before {
	content: ""
}
.ti-brand-nextjs:before {
	content: ""
}
.ti-brand-nodejs:before {
	content: "﫠"
}
.ti-brand-nord-vpn:before {
	content: ""
}
.ti-brand-notion:before {
	content: ""
}
.ti-brand-npm:before {
	content: ""
}
.ti-brand-nuxt:before {
	content: ""
}
.ti-brand-nytimes:before {
	content: ""
}
.ti-brand-oauth:before {
	content: "禍"
}
.ti-brand-office:before {
	content: ""
}
.ti-brand-ok-ru:before {
	content: ""
}
.ti-brand-onedrive:before {
	content: ""
}
.ti-brand-onlyfans:before {
	content: ""
}
.ti-brand-open-source:before {
	content: ""
}
.ti-brand-open-source-filled:before {
	content: "𐂑"
}
.ti-brand-openai:before {
	content: ""
}
.ti-brand-openvpn:before {
	content: ""
}
.ti-brand-opera:before {
	content: ""
}
.ti-brand-opera-filled:before {
	content: "𐂐"
}
.ti-brand-pagekit:before {
	content: ""
}
.ti-brand-parsinta:before {
	content: "ﱂ"
}
.ti-brand-patreon:before {
	content: ""
}
.ti-brand-patreon-filled:before {
	content: "ﳿ"
}
.ti-brand-paypal:before {
	content: ""
}
.ti-brand-paypal-filled:before {
	content: ""
}
.ti-brand-paypay:before {
	content: ""
}
.ti-brand-peanut:before {
	content: ""
}
.ti-brand-pepsi:before {
	content: ""
}
.ti-brand-php:before {
	content: ""
}
.ti-brand-picsart:before {
	content: ""
}
.ti-brand-pinterest:before {
	content: ""
}
.ti-brand-pinterest-filled:before {
	content: "𐂏"
}
.ti-brand-planetscale:before {
	content: ""
}
.ti-brand-pnpm:before {
	content: "ﵷ"
}
.ti-brand-pocket:before {
	content: ""
}
.ti-brand-polymer:before {
	content: ""
}
.ti-brand-powershell:before {
	content: ""
}
.ti-brand-printables:before {
	content: "ﴛ"
}
.ti-brand-prisma:before {
	content: ""
}
.ti-brand-producthunt:before {
	content: ""
}
.ti-brand-pushbullet:before {
	content: ""
}
.ti-brand-pushover:before {
	content: ""
}
.ti-brand-python:before {
	content: ""
}
.ti-brand-qq:before {
	content: ""
}
.ti-brand-radix-ui:before {
	content: ""
}
.ti-brand-react:before {
	content: ""
}
.ti-brand-react-native:before {
	content: ""
}
.ti-brand-reason:before {
	content: ""
}
.ti-brand-reddit:before {
	content: ""
}
.ti-brand-redhat:before {
	content: ""
}
.ti-brand-redux:before {
	content: ""
}
.ti-brand-revolut:before {
	content: ""
}
.ti-brand-rumble:before {
	content: "𣏕"
}
.ti-brand-rust:before {
	content: "禎"
}
.ti-brand-safari:before {
	content: ""
}
.ti-brand-samsungpass:before {
	content: ""
}
.ti-brand-sass:before {
	content: ""
}
.ti-brand-sentry:before {
	content: ""
}
.ti-brand-sharik:before {
	content: ""
}
.ti-brand-shazam:before {
	content: ""
}
.ti-brand-shopee:before {
	content: ""
}
.ti-brand-sketch:before {
	content: ""
}
.ti-brand-sketch-filled:before {
	content: "𐂎"
}
.ti-brand-skype:before {
	content: ""
}
.ti-brand-slack:before {
	content: ""
}
.ti-brand-snapchat:before {
	content: ""
}
.ti-brand-snapchat-filled:before {
	content: "𐂍"
}
.ti-brand-snapseed:before {
	content: ""
}
.ti-brand-snowflake:before {
	content: ""
}
.ti-brand-socket-io:before {
	content: ""
}
.ti-brand-solidjs:before {
	content: ""
}
.ti-brand-soundcloud:before {
	content: ""
}
.ti-brand-spacehey:before {
	content: ""
}
.ti-brand-speedtest:before {
	content: "勺"
}
.ti-brand-spotify:before {
	content: ""
}
.ti-brand-spotify-filled:before {
	content: "ﺆ"
}
.ti-brand-stackoverflow:before {
	content: ""
}
.ti-brand-stackshare:before {
	content: ""
}
.ti-brand-steam:before {
	content: ""
}
.ti-brand-steam-filled:before {
	content: "𐂌"
}
.ti-brand-stocktwits:before {
	content: "ﵸ"
}
.ti-brand-storj:before {
	content: "穀"
}
.ti-brand-storybook:before {
	content: ""
}
.ti-brand-storytel:before {
	content: ""
}
.ti-brand-strava:before {
	content: ""
}
.ti-brand-stripe:before {
	content: ""
}
.ti-brand-stripe-filled:before {
	content: "𐂋"
}
.ti-brand-sublime-text:before {
	content: ""
}
.ti-brand-sugarizer:before {
	content: ""
}
.ti-brand-supabase:before {
	content: ""
}
.ti-brand-superhuman:before {
	content: ""
}
.ti-brand-supernova:before {
	content: ""
}
.ti-brand-surfshark:before {
	content: ""
}
.ti-brand-svelte:before {
	content: ""
}
.ti-brand-swift:before {
	content: "突"
}
.ti-brand-symfony:before {
	content: ""
}
.ti-brand-tabler:before {
	content: ""
}
.ti-brand-tabler-filled:before {
	content: "𐂊"
}
.ti-brand-tailwind:before {
	content: ""
}
.ti-brand-taobao:before {
	content: ""
}
.ti-brand-teams:before {
	content: "﫟"
}
.ti-brand-ted:before {
	content: ""
}
.ti-brand-telegram:before {
	content: ""
}
.ti-brand-terraform:before {
	content: "節"
}
.ti-brand-tesla:before {
	content: "𐂙"
}
.ti-brand-tether:before {
	content: ""
}
.ti-brand-thingiverse:before {
	content: "ﴜ"
}
.ti-brand-threads:before {
	content: "fl"
}
.ti-brand-threejs:before {
	content: ""
}
.ti-brand-tidal:before {
	content: ""
}
.ti-brand-tiktok:before {
	content: ""
}
.ti-brand-tiktok-filled:before {
	content: ""
}
.ti-brand-tinder:before {
	content: ""
}
.ti-brand-tinder-filled:before {
	content: "𐂉"
}
.ti-brand-topbuzz:before {
	content: ""
}
.ti-brand-torchain:before {
	content: ""
}
.ti-brand-toyota:before {
	content: ""
}
.ti-brand-trello:before {
	content: ""
}
.ti-brand-tripadvisor:before {
	content: ""
}
.ti-brand-tumblr:before {
	content: ""
}
.ti-brand-tumblr-filled:before {
	content: "𐂈"
}
.ti-brand-twilio:before {
	content: ""
}
.ti-brand-twitch:before {
	content: ""
}
.ti-brand-twitter:before {
	content: ""
}
.ti-brand-twitter-filled:before {
	content: ""
}
.ti-brand-typescript:before {
	content: ""
}
.ti-brand-uber:before {
	content: ""
}
.ti-brand-ubuntu:before {
	content: ""
}
.ti-brand-unity:before {
	content: ""
}
.ti-brand-unsplash:before {
	content: ""
}
.ti-brand-upwork:before {
	content: ""
}
.ti-brand-valorant:before {
	content: ""
}
.ti-brand-vercel:before {
	content: ""
}
.ti-brand-vercel-filled:before {
	content: "𐂇"
}
.ti-brand-vimeo:before {
	content: ""
}
.ti-brand-vimeo-filled:before {
	content: "𐂆"
}
.ti-brand-vinted:before {
	content: ""
}
.ti-brand-visa:before {
	content: ""
}
.ti-brand-visual-studio:before {
	content: ""
}
.ti-brand-vite:before {
	content: ""
}
.ti-brand-vivaldi:before {
	content: ""
}
.ti-brand-vk:before {
	content: ""
}
.ti-brand-vlc:before {
	content: "喝"
}
.ti-brand-volkswagen:before {
	content: ""
}
.ti-brand-vsco:before {
	content: ""
}
.ti-brand-vscode:before {
	content: ""
}
.ti-brand-vue:before {
	content: ""
}
.ti-brand-walmart:before {
	content: ""
}
.ti-brand-waze:before {
	content: ""
}
.ti-brand-webflow:before {
	content: ""
}
.ti-brand-wechat:before {
	content: ""
}
.ti-brand-weibo:before {
	content: ""
}
.ti-brand-weibo-filled:before {
	content: "𐂦"
}
.ti-brand-whatsapp:before {
	content: ""
}
.ti-brand-whatsapp-filled:before {
	content: "𐂅"
}
.ti-brand-wikipedia:before {
	content: "啕"
}
.ti-brand-windows:before {
	content: ""
}
.ti-brand-windows-filled:before {
	content: "𐂄"
}
.ti-brand-windy:before {
	content: ""
}
.ti-brand-wish:before {
	content: ""
}
.ti-brand-wix:before {
	content: ""
}
.ti-brand-wordpress:before {
	content: ""
}
.ti-brand-x:before {
	content: "ﰏ"
}
.ti-brand-x-filled:before {
	content: "ﰡ"
}
.ti-brand-xamarin:before {
	content: "喙"
}
.ti-brand-xbox:before {
	content: ""
}
.ti-brand-xdeep:before {
	content: "ﰐ"
}
.ti-brand-xing:before {
	content: ""
}
.ti-brand-yahoo:before {
	content: ""
}
.ti-brand-yandex:before {
	content: "﫡"
}
.ti-brand-yarn:before {
	content: "ﵹ"
}
.ti-brand-yatse:before {
	content: ""
}
.ti-brand-ycombinator:before {
	content: ""
}
.ti-brand-youtube:before {
	content: ""
}
.ti-brand-youtube-filled:before {
	content: "ﰢ"
}
.ti-brand-youtube-kids:before {
	content: ""
}
.ti-brand-zalando:before {
	content: ""
}
.ti-brand-zapier:before {
	content: ""
}
.ti-brand-zeit:before {
	content: ""
}
.ti-brand-zhihu:before {
	content: ""
}
.ti-brand-zoom:before {
	content: ""
}
.ti-brand-zulip:before {
	content: ""
}
.ti-brand-zwift:before {
	content: ""
}
.ti-bread:before {
	content: ""
}
.ti-bread-filled:before {
	content: "ﺅ"
}
.ti-bread-off:before {
	content: ""
}
.ti-briefcase:before {
	content: ""
}
.ti-briefcase-2:before {
	content: "ffi"
}
.ti-briefcase-2-filled:before {
	content: "ﺄ"
}
.ti-briefcase-filled:before {
	content: "ﴀ"
}
.ti-briefcase-off:before {
	content: ""
}
.ti-brightness:before {
	content: ""
}
.ti-brightness-2:before {
	content: ""
}
.ti-brightness-auto:before {
	content: "ﶙ"
}
.ti-brightness-auto-filled:before {
	content: "ﺃ"
}
.ti-brightness-down:before {
	content: ""
}
.ti-brightness-down-filled:before {
	content: "ﬣ"
}
.ti-brightness-filled:before {
	content: "ﺂ"
}
.ti-brightness-half:before {
	content: ""
}
.ti-brightness-off:before {
	content: ""
}
.ti-brightness-up:before {
	content: ""
}
.ti-brightness-up-filled:before {
	content: "ﬤ"
}
.ti-broadcast:before {
	content: ""
}
.ti-broadcast-off:before {
	content: ""
}
.ti-browser:before {
	content: ""
}
.ti-browser-check:before {
	content: ""
}
.ti-browser-maximize:before {
	content: "𐂰"
}
.ti-browser-minus:before {
	content: "𐂯"
}
.ti-browser-off:before {
	content: ""
}
.ti-browser-plus:before {
	content: ""
}
.ti-browser-share:before {
	content: "𐂮"
}
.ti-browser-x:before {
	content: ""
}
.ti-brush:before {
	content: ""
}
.ti-brush-off:before {
	content: ""
}
.ti-bubble:before {
	content: "ﺺ"
}
.ti-bubble-filled:before {
	content: "ﻃ"
}
.ti-bubble-minus:before {
	content: "ﺾ"
}
.ti-bubble-plus:before {
	content: "ﺽ"
}
.ti-bubble-tea:before {
	content: "ｑ"
}
.ti-bubble-tea-2:before {
	content: "ｒ"
}
.ti-bubble-text:before {
	content: "ﺼ"
}
.ti-bubble-text-filled:before {
	content: "𐂥"
}
.ti-bubble-x:before {
	content: "ﺻ"
}
.ti-bucket:before {
	content: ""
}
.ti-bucket-droplet:before {
	content: ""
}
.ti-bucket-off:before {
	content: ""
}
.ti-bug:before {
	content: ""
}
.ti-bug-filled:before {
	content: "ﴁ"
}
.ti-bug-off:before {
	content: ""
}
.ti-building:before {
	content: ""
}
.ti-building-airport:before {
	content: "ﾩ"
}
.ti-building-arch:before {
	content: ""
}
.ti-building-bank:before {
	content: ""
}
.ti-building-bridge:before {
	content: ""
}
.ti-building-bridge-2:before {
	content: ""
}
.ti-building-bridge-2-filled:before {
	content: "𐆉"
}
.ti-building-broadcast-tower:before {
	content: ""
}
.ti-building-broadcast-tower-filled:before {
	content: "ﺁ"
}
.ti-building-burj-al-arab:before {
	content: "ｐ"
}
.ti-building-carousel:before {
	content: ""
}
.ti-building-castle:before {
	content: ""
}
.ti-building-church:before {
	content: ""
}
.ti-building-circus:before {
	content: ""
}
.ti-building-cog:before {
	content: "𐁢"
}
.ti-building-community:before {
	content: ""
}
.ti-building-cottage:before {
	content: ""
}
.ti-building-estate:before {
	content: ""
}
.ti-building-factory:before {
	content: ""
}
.ti-building-factory-2:before {
	content: ""
}
.ti-building-fortress:before {
	content: ""
}
.ti-building-hospital:before {
	content: ""
}
.ti-building-lighthouse:before {
	content: ""
}
.ti-building-minus:before {
	content: "𐁡"
}
.ti-building-monument:before {
	content: ""
}
.ti-building-mosque:before {
	content: "練"
}
.ti-building-off:before {
	content: "﻽"
}
.ti-building-pavilion:before {
	content: ""
}
.ti-building-plus:before {
	content: "𐁠"
}
.ti-building-skyscraper:before {
	content: ""
}
.ti-building-stadium:before {
	content: ""
}
.ti-building-store:before {
	content: ""
}
.ti-building-tunnel:before {
	content: ""
}
.ti-building-warehouse:before {
	content: ""
}
.ti-building-wind-turbine:before {
	content: ""
}
.ti-buildings:before {
	content: "｀"
}
.ti-bulb:before {
	content: ""
}
.ti-bulb-filled:before {
	content: ""
}
.ti-bulb-off:before {
	content: ""
}
.ti-bulldozer:before {
	content: ""
}
.ti-burger:before {
	content: "ﲴ"
}
.ti-bus:before {
	content: ""
}
.ti-bus-filled:before {
	content: "𐃿"
}
.ti-bus-off:before {
	content: ""
}
.ti-bus-stop:before {
	content: ""
}
.ti-businessplan:before {
	content: ""
}
.ti-butterfly:before {
	content: ""
}
.ti-butterfly-filled:before {
	content: "𐀖"
}
.ti-cactus:before {
	content: ""
}
.ti-cactus-filled:before {
	content: "ﬥ"
}
.ti-cactus-off:before {
	content: ""
}
.ti-cake:before {
	content: ""
}
.ti-cake-off:before {
	content: ""
}
.ti-cake-roll:before {
	content: "𐂽"
}
.ti-calculator:before {
	content: ""
}
.ti-calculator-filled:before {
	content: "ﬦ"
}
.ti-calculator-off:before {
	content: ""
}
.ti-calendar:before {
	content: ""
}
.ti-calendar-bolt:before {
	content: ""
}
.ti-calendar-cancel:before {
	content: ""
}
.ti-calendar-check:before {
	content: ""
}
.ti-calendar-clock:before {
	content: "ﴮ"
}
.ti-calendar-code:before {
	content: ""
}
.ti-calendar-cog:before {
	content: ""
}
.ti-calendar-dollar:before {
	content: ""
}
.ti-calendar-dot:before {
	content: "﴾"
}
.ti-calendar-down:before {
	content: ""
}
.ti-calendar-due:before {
	content: ""
}
.ti-calendar-event:before {
	content: ""
}
.ti-calendar-event-filled:before {
	content: "𐂹"
}
.ti-calendar-exclamation:before {
	content: ""
}
.ti-calendar-filled:before {
	content: "ﬧ"
}
.ti-calendar-heart:before {
	content: ""
}
.ti-calendar-minus:before {
	content: ""
}
.ti-calendar-month:before {
	content: "ﴯ"
}
.ti-calendar-month-filled:before {
	content: "𐂸"
}
.ti-calendar-off:before {
	content: ""
}
.ti-calendar-pause:before {
	content: ""
}
.ti-calendar-pin:before {
	content: ""
}
.ti-calendar-plus:before {
	content: ""
}
.ti-calendar-question:before {
	content: ""
}
.ti-calendar-repeat:before {
	content: "㮝"
}
.ti-calendar-sad:before {
	content: "ﴝ"
}
.ti-calendar-search:before {
	content: ""
}
.ti-calendar-share:before {
	content: ""
}
.ti-calendar-smile:before {
	content: "ﴞ"
}
.ti-calendar-star:before {
	content: ""
}
.ti-calendar-stats:before {
	content: ""
}
.ti-calendar-time:before {
	content: ""
}
.ti-calendar-up:before {
	content: ""
}
.ti-calendar-user:before {
	content: "ﴟ"
}
.ti-calendar-week:before {
	content: "ﴰ"
}
.ti-calendar-week-filled:before {
	content: "𐂷"
}
.ti-calendar-x:before {
	content: ""
}
.ti-camera:before {
	content: ""
}
.ti-camera-ai:before {
	content: "ﾨ"
}
.ti-camera-bitcoin:before {
	content: "ﾧ"
}
.ti-camera-bolt:before {
	content: ""
}
.ti-camera-cancel:before {
	content: ""
}
.ti-camera-check:before {
	content: ""
}
.ti-camera-code:before {
	content: ""
}
.ti-camera-cog:before {
	content: ""
}
.ti-camera-dollar:before {
	content: ""
}
.ti-camera-down:before {
	content: ""
}
.ti-camera-exclamation:before {
	content: ""
}
.ti-camera-filled:before {
	content: "嘆"
}
.ti-camera-heart:before {
	content: ""
}
.ti-camera-minus:before {
	content: ""
}
.ti-camera-moon:before {
	content: "ﾦ"
}
.ti-camera-off:before {
	content: ""
}
.ti-camera-pause:before {
	content: ""
}
.ti-camera-pin:before {
	content: ""
}
.ti-camera-plus:before {
	content: ""
}
.ti-camera-question:before {
	content: ""
}
.ti-camera-rotate:before {
	content: ""
}
.ti-camera-search:before {
	content: ""
}
.ti-camera-selfie:before {
	content: ""
}
.ti-camera-share:before {
	content: ""
}
.ti-camera-spark:before {
	content: "ﾼ"
}
.ti-camera-star:before {
	content: ""
}
.ti-camera-up:before {
	content: ""
}
.ti-camera-x:before {
	content: ""
}
.ti-camper:before {
	content: "逸"
}
.ti-campfire:before {
	content: ""
}
.ti-campfire-filled:before {
	content: "ﬨ"
}
.ti-cancel:before {
	content: "１"
}
.ti-candle:before {
	content: ""
}
.ti-candle-filled:before {
	content: "ﰣ"
}
.ti-candy:before {
	content: ""
}
.ti-candy-off:before {
	content: ""
}
.ti-cane:before {
	content: ""
}
.ti-cannabis:before {
	content: ""
}
.ti-cannabis-filled:before {
	content: "𐀕"
}
.ti-cap-projecting:before {
	content: "Ｂ"
}
.ti-cap-rounded:before {
	content: "Ａ"
}
.ti-cap-straight:before {
	content: "＠"
}
.ti-capsule:before {
	content: "﫣"
}
.ti-capsule-filled:before {
	content: "ﰤ"
}
.ti-capsule-horizontal:before {
	content: "﫢"
}
.ti-capsule-horizontal-filled:before {
	content: "ﰥ"
}
.ti-capture:before {
	content: ""
}
.ti-capture-filled:before {
	content: "﬩"
}
.ti-capture-off:before {
	content: ""
}
.ti-car:before {
	content: ""
}
.ti-car-4wd:before {
	content: "ﶸ"
}
.ti-car-4wd-filled:before {
	content: "𐀞"
}
.ti-car-crane:before {
	content: ""
}
.ti-car-crane-filled:before {
	content: "𐃾"
}
.ti-car-crash:before {
	content: ""
}
.ti-car-fan:before {
	content: "ﶳ"
}
.ti-car-fan-1:before {
	content: "ﶷ"
}
.ti-car-fan-2:before {
	content: "ﶶ"
}
.ti-car-fan-3:before {
	content: "ﶵ"
}
.ti-car-fan-auto:before {
	content: "ﶴ"
}
.ti-car-fan-filled:before {
	content: "𐀝"
}
.ti-car-filled:before {
	content: "𐁌"
}
.ti-car-garage:before {
	content: "ﱷ"
}
.ti-car-off:before {
	content: ""
}
.ti-car-suv:before {
	content: "ﲋ"
}
.ti-car-suv-filled:before {
	content: "𐁍"
}
.ti-car-turbine:before {
	content: ""
}
.ti-carambola:before {
	content: "ﺹ"
}
.ti-carambola-filled:before {
	content: "𐀔"
}
.ti-caravan:before {
	content: ""
}
.ti-caravan-filled:before {
	content: "𐃽"
}
.ti-cardboards:before {
	content: ""
}
.ti-cardboards-filled:before {
	content: "𐀜"
}
.ti-cardboards-off:before {
	content: ""
}
.ti-cards:before {
	content: ""
}
.ti-cards-filled:before {
	content: "ﰦ"
}
.ti-caret-down:before {
	content: ""
}
.ti-caret-down-filled:before {
	content: "שׁ"
}
.ti-caret-left:before {
	content: ""
}
.ti-caret-left-filled:before {
	content: "שׂ"
}
.ti-caret-left-right:before {
	content: "ﱃ"
}
.ti-caret-left-right-filled:before {
	content: "ﴂ"
}
.ti-caret-right:before {
	content: ""
}
.ti-caret-right-filled:before {
	content: "שּׁ"
}
.ti-caret-up:before {
	content: ""
}
.ti-caret-up-down:before {
	content: "ﱄ"
}
.ti-caret-up-down-filled:before {
	content: "ﴃ"
}
.ti-caret-up-filled:before {
	content: "שּׂ"
}
.ti-carousel-horizontal:before {
	content: ""
}
.ti-carousel-horizontal-filled:before {
	content: "朗"
}
.ti-carousel-vertical:before {
	content: ""
}
.ti-carousel-vertical-filled:before {
	content: "望"
}
.ti-carrot:before {
	content: ""
}
.ti-carrot-off:before {
	content: ""
}
.ti-cash:before {
	content: ""
}
.ti-cash-banknote:before {
	content: ""
}
.ti-cash-banknote-edit:before {
	content: "𐅉"
}
.ti-cash-banknote-filled:before {
	content: "ﺀ"
}
.ti-cash-banknote-heart:before {
	content: "𐅈"
}
.ti-cash-banknote-minus:before {
	content: "𐅇"
}
.ti-cash-banknote-move:before {
	content: "𐅅"
}
.ti-cash-banknote-move-back:before {
	content: "𐅆"
}
.ti-cash-banknote-off:before {
	content: ""
}
.ti-cash-banknote-plus:before {
	content: "𐅄"
}
.ti-cash-edit:before {
	content: "𐅃"
}
.ti-cash-heart:before {
	content: "𐅂"
}
.ti-cash-minus:before {
	content: "𐅁"
}
.ti-cash-move:before {
	content: "𐄿"
}
.ti-cash-move-back:before {
	content: "𐅀"
}
.ti-cash-off:before {
	content: ""
}
.ti-cash-plus:before {
	content: "𐄾"
}
.ti-cash-register:before {
	content: "ﻦ"
}
.ti-cast:before {
	content: ""
}
.ti-cast-off:before {
	content: ""
}
.ti-cat:before {
	content: ""
}
.ti-category:before {
	content: ""
}
.ti-category-2:before {
	content: ""
}
.ti-category-filled:before {
	content: "אַ"
}
.ti-category-minus:before {
	content: "ﴠ"
}
.ti-category-plus:before {
	content: "ﴡ"
}
.ti-ce:before {
	content: ""
}
.ti-ce-off:before {
	content: ""
}
.ti-cell:before {
	content: ""
}
.ti-cell-signal-1:before {
	content: ""
}
.ti-cell-signal-2:before {
	content: ""
}
.ti-cell-signal-3:before {
	content: ""
}
.ti-cell-signal-4:before {
	content: ""
}
.ti-cell-signal-5:before {
	content: ""
}
.ti-cell-signal-off:before {
	content: ""
}
.ti-certificate:before {
	content: ""
}
.ti-certificate-2:before {
	content: ""
}
.ti-certificate-2-off:before {
	content: ""
}
.ti-certificate-off:before {
	content: ""
}
.ti-chair-director:before {
	content: ""
}
.ti-chalkboard:before {
	content: ""
}
.ti-chalkboard-off:before {
	content: ""
}
.ti-chalkboard-teacher:before {
	content: "𐅠"
}
.ti-charging-pile:before {
	content: ""
}
.ti-charging-pile-filled:before {
	content: "𐀛"
}
.ti-chart-arcs:before {
	content: ""
}
.ti-chart-arcs-3:before {
	content: ""
}
.ti-chart-area:before {
	content: ""
}
.ti-chart-area-filled:before {
	content: ""
}
.ti-chart-area-line:before {
	content: ""
}
.ti-chart-area-line-filled:before {
	content: ""
}
.ti-chart-arrows:before {
	content: ""
}
.ti-chart-arrows-vertical:before {
	content: ""
}
.ti-chart-bar:before {
	content: ""
}
.ti-chart-bar-off:before {
	content: ""
}
.ti-chart-bar-popular:before {
	content: "ﻷ"
}
.ti-chart-bubble:before {
	content: ""
}
.ti-chart-bubble-filled:before {
	content: ""
}
.ti-chart-candle:before {
	content: ""
}
.ti-chart-candle-filled:before {
	content: ""
}
.ti-chart-circles:before {
	content: ""
}
.ti-chart-cohort:before {
	content: "ﻶ"
}
.ti-chart-column:before {
	content: "ﾥ"
}
.ti-chart-covariate:before {
	content: "ﾤ"
}
.ti-chart-donut:before {
	content: ""
}
.ti-chart-donut-2:before {
	content: ""
}
.ti-chart-donut-3:before {
	content: ""
}
.ti-chart-donut-4:before {
	content: ""
}
.ti-chart-donut-filled:before {
	content: ""
}
.ti-chart-dots:before {
	content: ""
}
.ti-chart-dots-2:before {
	content: ""
}
.ti-chart-dots-2-filled:before {
	content: "𐃝"
}
.ti-chart-dots-3:before {
	content: ""
}
.ti-chart-dots-3-filled:before {
	content: "𐃜"
}
.ti-chart-dots-filled:before {
	content: "ﴄ"
}
.ti-chart-funnel:before {
	content: "ﻵ"
}
.ti-chart-funnel-filled:before {
	content: "𐃛"
}
.ti-chart-grid-dots:before {
	content: ""
}
.ti-chart-grid-dots-filled:before {
	content: "ﴅ"
}
.ti-chart-histogram:before {
	content: ""
}
.ti-chart-infographic:before {
	content: ""
}
.ti-chart-line:before {
	content: ""
}
.ti-chart-pie:before {
	content: ""
}
.ti-chart-pie-2:before {
	content: ""
}
.ti-chart-pie-2-filled:before {
	content: "𐃚"
}
.ti-chart-pie-3:before {
	content: ""
}
.ti-chart-pie-3-filled:before {
	content: "𐃙"
}
.ti-chart-pie-4:before {
	content: ""
}
.ti-chart-pie-4-filled:before {
	content: "𐃘"
}
.ti-chart-pie-filled:before {
	content: ""
}
.ti-chart-pie-off:before {
	content: ""
}
.ti-chart-ppf:before {
	content: ""
}
.ti-chart-radar:before {
	content: ""
}
.ti-chart-sankey:before {
	content: ""
}
.ti-chart-scatter:before {
	content: "ﶓ"
}
.ti-chart-scatter-3d:before {
	content: "ﶒ"
}
.ti-chart-treemap:before {
	content: ""
}
.ti-check:before {
	content: ""
}
.ti-checkbox:before {
	content: ""
}
.ti-checklist:before {
	content: ""
}
.ti-checks:before {
	content: ""
}
.ti-checkup-list:before {
	content: ""
}
.ti-cheese:before {
	content: ""
}
.ti-chef-hat:before {
	content: ""
}
.ti-chef-hat-filled:before {
	content: "𐃗"
}
.ti-chef-hat-off:before {
	content: ""
}
.ti-cherry:before {
	content: ""
}
.ti-cherry-filled:before {
	content: ""
}
.ti-chess:before {
	content: ""
}
.ti-chess-bishop:before {
	content: ""
}
.ti-chess-bishop-filled:before {
	content: ""
}
.ti-chess-filled:before {
	content: ""
}
.ti-chess-king:before {
	content: ""
}
.ti-chess-king-filled:before {
	content: ""
}
.ti-chess-knight:before {
	content: ""
}
.ti-chess-knight-filled:before {
	content: ""
}
.ti-chess-queen:before {
	content: ""
}
.ti-chess-queen-filled:before {
	content: ""
}
.ti-chess-rook:before {
	content: ""
}
.ti-chess-rook-filled:before {
	content: ""
}
.ti-chevron-compact-down:before {
	content: "﫰"
}
.ti-chevron-compact-left:before {
	content: "﫱"
}
.ti-chevron-compact-right:before {
	content: "﫲"
}
.ti-chevron-compact-up:before {
	content: "﫳"
}
.ti-chevron-down:before {
	content: ""
}
.ti-chevron-down-left:before {
	content: ""
}
.ti-chevron-down-right:before {
	content: ""
}
.ti-chevron-left:before {
	content: ""
}
.ti-chevron-left-pipe:before {
	content: "﫤"
}
.ti-chevron-right:before {
	content: ""
}
.ti-chevron-right-pipe:before {
	content: "﫥"
}
.ti-chevron-up:before {
	content: ""
}
.ti-chevron-up-left:before {
	content: ""
}
.ti-chevron-up-right:before {
	content: ""
}
.ti-chevrons-down:before {
	content: ""
}
.ti-chevrons-down-left:before {
	content: ""
}
.ti-chevrons-down-right:before {
	content: ""
}
.ti-chevrons-left:before {
	content: ""
}
.ti-chevrons-right:before {
	content: ""
}
.ti-chevrons-up:before {
	content: ""
}
.ti-chevrons-up-left:before {
	content: ""
}
.ti-chevrons-up-right:before {
	content: ""
}
.ti-chisel:before {
	content: ""
}
.ti-christmas-ball:before {
	content: "ﴱ"
}
.ti-christmas-tree:before {
	content: ""
}
.ti-christmas-tree-filled:before {
	content: "𐀚"
}
.ti-christmas-tree-off:before {
	content: ""
}
.ti-circle:before {
	content: ""
}
.ti-circle-arrow-down:before {
	content: ""
}
.ti-circle-arrow-down-filled:before {
	content: ""
}
.ti-circle-arrow-down-left:before {
	content: ""
}
.ti-circle-arrow-down-left-filled:before {
	content: ""
}
.ti-circle-arrow-down-right:before {
	content: ""
}
.ti-circle-arrow-down-right-filled:before {
	content: ""
}
.ti-circle-arrow-left:before {
	content: ""
}
.ti-circle-arrow-left-filled:before {
	content: ""
}
.ti-circle-arrow-right:before {
	content: ""
}
.ti-circle-arrow-right-filled:before {
	content: ""
}
.ti-circle-arrow-up:before {
	content: ""
}
.ti-circle-arrow-up-filled:before {
	content: ""
}
.ti-circle-arrow-up-left:before {
	content: ""
}
.ti-circle-arrow-up-left-filled:before {
	content: ""
}
.ti-circle-arrow-up-right:before {
	content: ""
}
.ti-circle-arrow-up-right-filled:before {
	content: ""
}
.ti-circle-caret-down:before {
	content: ""
}
.ti-circle-caret-down-filled:before {
	content: "𐃖"
}
.ti-circle-caret-left:before {
	content: ""
}
.ti-circle-caret-left-filled:before {
	content: "𐃕"
}
.ti-circle-caret-right:before {
	content: ""
}
.ti-circle-caret-right-filled:before {
	content: "𐃔"
}
.ti-circle-caret-up:before {
	content: ""
}
.ti-circle-caret-up-filled:before {
	content: "𐃓"
}
.ti-circle-check:before {
	content: ""
}
.ti-circle-check-filled:before {
	content: ""
}
.ti-circle-chevron-down:before {
	content: ""
}
.ti-circle-chevron-down-filled:before {
	content: "𐃒"
}
.ti-circle-chevron-left:before {
	content: ""
}
.ti-circle-chevron-left-filled:before {
	content: "𐃑"
}
.ti-circle-chevron-right:before {
	content: ""
}
.ti-circle-chevron-right-filled:before {
	content: "𐃐"
}
.ti-circle-chevron-up:before {
	content: ""
}
.ti-circle-chevron-up-filled:before {
	content: "𐃏"
}
.ti-circle-chevrons-down:before {
	content: ""
}
.ti-circle-chevrons-down-filled:before {
	content: "𐃯"
}
.ti-circle-chevrons-left:before {
	content: ""
}
.ti-circle-chevrons-left-filled:before {
	content: "𐃮"
}
.ti-circle-chevrons-right:before {
	content: ""
}
.ti-circle-chevrons-right-filled:before {
	content: "𐃭"
}
.ti-circle-chevrons-up:before {
	content: ""
}
.ti-circle-chevrons-up-filled:before {
	content: "𐃬"
}
.ti-circle-dashed:before {
	content: ""
}
.ti-circle-dashed-check:before {
	content: "ﺸ"
}
.ti-circle-dashed-letter-a:before {
	content: "ﾚ"
}
.ti-circle-dashed-letter-b:before {
	content: "ﾙ"
}
.ti-circle-dashed-letter-c:before {
	content: "ﾘ"
}
.ti-circle-dashed-letter-d:before {
	content: "ﾗ"
}
.ti-circle-dashed-letter-e:before {
	content: "ﾖ"
}
.ti-circle-dashed-letter-f:before {
	content: "ﾕ"
}
.ti-circle-dashed-letter-g:before {
	content: "ﾔ"
}
.ti-circle-dashed-letter-h:before {
	content: "ﾓ"
}
.ti-circle-dashed-letter-i:before {
	content: "ﾒ"
}
.ti-circle-dashed-letter-j:before {
	content: "ﾑ"
}
.ti-circle-dashed-letter-k:before {
	content: "ﾐ"
}
.ti-circle-dashed-letter-l:before {
	content: "ﾏ"
}
.ti-circle-dashed-letter-m:before {
	content: "ﾍ"
}
.ti-circle-dashed-letter-n:before {
	content: "ﾌ"
}
.ti-circle-dashed-letter-o:before {
	content: "ﾋ"
}
.ti-circle-dashed-letter-p:before {
	content: "ﾊ"
}
.ti-circle-dashed-letter-q:before {
	content: "ﾉ"
}
.ti-circle-dashed-letter-r:before {
	content: "ﾈ"
}
.ti-circle-dashed-letter-s:before {
	content: "ﾇ"
}
.ti-circle-dashed-letter-t:before {
	content: "ﾆ"
}
.ti-circle-dashed-letter-u:before {
	content: "ﾅ"
}
.ti-circle-dashed-letter-v:before {
	content: "ﾄ"
}
.ti-circle-dashed-letter-w:before {
	content: "ﾃ"
}
.ti-circle-dashed-letter-x:before {
	content: "ﾂ"
}
.ti-circle-dashed-letter-y:before {
	content: "ﾁ"
}
.ti-circle-dashed-letter-z:before {
	content: "ﾀ"
}
.ti-circle-dashed-minus:before {
	content: "ﺷ"
}
.ti-circle-dashed-number-0:before {
	content: "ﱫ"
}
.ti-circle-dashed-number-1:before {
	content: "ﱬ"
}
.ti-circle-dashed-number-2:before {
	content: "ﱭ"
}
.ti-circle-dashed-number-3:before {
	content: "ﱮ"
}
.ti-circle-dashed-number-4:before {
	content: "ﱯ"
}
.ti-circle-dashed-number-5:before {
	content: "ﱰ"
}
.ti-circle-dashed-number-6:before {
	content: "ﱱ"
}
.ti-circle-dashed-number-7:before {
	content: "ﱲ"
}
.ti-circle-dashed-number-8:before {
	content: "ﱳ"
}
.ti-circle-dashed-number-9:before {
	content: "ﱴ"
}
.ti-circle-dashed-percentage:before {
	content: "ﵺ"
}
.ti-circle-dashed-plus:before {
	content: "ﺶ"
}
.ti-circle-dashed-x:before {
	content: "ﱵ"
}
.ti-circle-dot:before {
	content: ""
}
.ti-circle-dot-filled:before {
	content: ""
}
.ti-circle-dotted:before {
	content: ""
}
.ti-circle-dotted-letter-a:before {
	content: "ｿ"
}
.ti-circle-dotted-letter-b:before {
	content: "ｾ"
}
.ti-circle-dotted-letter-c:before {
	content: "ｽ"
}
.ti-circle-dotted-letter-d:before {
	content: "ｼ"
}
.ti-circle-dotted-letter-e:before {
	content: "ｻ"
}
.ti-circle-dotted-letter-f:before {
	content: "ｺ"
}
.ti-circle-dotted-letter-g:before {
	content: "ｹ"
}
.ti-circle-dotted-letter-h:before {
	content: "ｸ"
}
.ti-circle-dotted-letter-i:before {
	content: "ｷ"
}
.ti-circle-dotted-letter-j:before {
	content: "ｶ"
}
.ti-circle-dotted-letter-k:before {
	content: "ｵ"
}
.ti-circle-dotted-letter-l:before {
	content: "ｴ"
}
.ti-circle-dotted-letter-m:before {
	content: "ｳ"
}
.ti-circle-dotted-letter-n:before {
	content: "ｲ"
}
.ti-circle-dotted-letter-o:before {
	content: "ｱ"
}
.ti-circle-dotted-letter-p:before {
	content: "ｰ"
}
.ti-circle-dotted-letter-q:before {
	content: "ｯ"
}
.ti-circle-dotted-letter-r:before {
	content: "ｮ"
}
.ti-circle-dotted-letter-s:before {
	content: "ｭ"
}
.ti-circle-dotted-letter-t:before {
	content: "ｬ"
}
.ti-circle-dotted-letter-u:before {
	content: "ｫ"
}
.ti-circle-dotted-letter-v:before {
	content: "ｪ"
}
.ti-circle-dotted-letter-w:before {
	content: "ｩ"
}
.ti-circle-dotted-letter-x:before {
	content: "ｨ"
}
.ti-circle-dotted-letter-y:before {
	content: "ｧ"
}
.ti-circle-dotted-letter-z:before {
	content: "ｦ"
}
.ti-circle-filled:before {
	content: ""
}
.ti-circle-half:before {
	content: ""
}
.ti-circle-half-2:before {
	content: ""
}
.ti-circle-half-vertical:before {
	content: ""
}
.ti-circle-key:before {
	content: ""
}
.ti-circle-key-filled:before {
	content: ""
}
.ti-circle-letter-a:before {
	content: ""
}
.ti-circle-letter-a-filled:before {
	content: "ﹿ"
}
.ti-circle-letter-b:before {
	content: ""
}
.ti-circle-letter-b-filled:before {
	content: "ﹾ"
}
.ti-circle-letter-c:before {
	content: ""
}
.ti-circle-letter-c-filled:before {
	content: "ﹽ"
}
.ti-circle-letter-d:before {
	content: ""
}
.ti-circle-letter-d-filled:before {
	content: "ﹼ"
}
.ti-circle-letter-e:before {
	content: ""
}
.ti-circle-letter-e-filled:before {
	content: "ﹻ"
}
.ti-circle-letter-f:before {
	content: ""
}
.ti-circle-letter-f-filled:before {
	content: "ﹺ"
}
.ti-circle-letter-g:before {
	content: ""
}
.ti-circle-letter-g-filled:before {
	content: "ﹹ"
}
.ti-circle-letter-h:before {
	content: ""
}
.ti-circle-letter-h-filled:before {
	content: "ﹸ"
}
.ti-circle-letter-i:before {
	content: ""
}
.ti-circle-letter-i-filled:before {
	content: "ﹷ"
}
.ti-circle-letter-j:before {
	content: ""
}
.ti-circle-letter-j-filled:before {
	content: "ﹶ"
}
.ti-circle-letter-k:before {
	content: ""
}
.ti-circle-letter-k-filled:before {
	content: "﹵"
}
.ti-circle-letter-l:before {
	content: ""
}
.ti-circle-letter-l-filled:before {
	content: "ﹴ"
}
.ti-circle-letter-m:before {
	content: ""
}
.ti-circle-letter-m-filled:before {
	content: "ﹳ"
}
.ti-circle-letter-n:before {
	content: ""
}
.ti-circle-letter-n-filled:before {
	content: "ﹲ"
}
.ti-circle-letter-o:before {
	content: ""
}
.ti-circle-letter-o-filled:before {
	content: "ﹱ"
}
.ti-circle-letter-p:before {
	content: ""
}
.ti-circle-letter-p-filled:before {
	content: "ﹰ"
}
.ti-circle-letter-q:before {
	content: ""
}
.ti-circle-letter-q-filled:before {
	content: "﹯"
}
.ti-circle-letter-r:before {
	content: ""
}
.ti-circle-letter-r-filled:before {
	content: "﹮"
}
.ti-circle-letter-s:before {
	content: ""
}
.ti-circle-letter-s-filled:before {
	content: "﹭"
}
.ti-circle-letter-t:before {
	content: ""
}
.ti-circle-letter-t-filled:before {
	content: "﹬"
}
.ti-circle-letter-u:before {
	content: ""
}
.ti-circle-letter-u-filled:before {
	content: "﹫"
}
.ti-circle-letter-v:before {
	content: ""
}
.ti-circle-letter-v-filled:before {
	content: "﹪"
}
.ti-circle-letter-w:before {
	content: ""
}
.ti-circle-letter-w-filled:before {
	content: "﹩"
}
.ti-circle-letter-x:before {
	content: ""
}
.ti-circle-letter-x-filled:before {
	content: "﹨"
}
.ti-circle-letter-y:before {
	content: ""
}
.ti-circle-letter-y-filled:before {
	content: "﹧"
}
.ti-circle-letter-z:before {
	content: ""
}
.ti-circle-letter-z-filled:before {
	content: "﹦"
}
.ti-circle-minus:before {
	content: ""
}
.ti-circle-minus-2:before {
	content: "ﲌ"
}
.ti-circle-number-0:before {
	content: ""
}
.ti-circle-number-0-filled:before {
	content: ""
}
.ti-circle-number-1:before {
	content: ""
}
.ti-circle-number-1-filled:before {
	content: ""
}
.ti-circle-number-2:before {
	content: ""
}
.ti-circle-number-2-filled:before {
	content: ""
}
.ti-circle-number-3:before {
	content: ""
}
.ti-circle-number-3-filled:before {
	content: ""
}
.ti-circle-number-4:before {
	content: ""
}
.ti-circle-number-4-filled:before {
	content: ""
}
.ti-circle-number-5:before {
	content: ""
}
.ti-circle-number-5-filled:before {
	content: ""
}
.ti-circle-number-6:before {
	content: ""
}
.ti-circle-number-6-filled:before {
	content: ""
}
.ti-circle-number-7:before {
	content: ""
}
.ti-circle-number-7-filled:before {
	content: ""
}
.ti-circle-number-8:before {
	content: ""
}
.ti-circle-number-8-filled:before {
	content: ""
}
.ti-circle-number-9:before {
	content: ""
}
.ti-circle-number-9-filled:before {
	content: ""
}
.ti-circle-off:before {
	content: ""
}
.ti-circle-percentage:before {
	content: "ﵻ"
}
.ti-circle-percentage-filled:before {
	content: "ﻕ"
}
.ti-circle-plus:before {
	content: ""
}
.ti-circle-plus-2:before {
	content: "ﲍ"
}
.ti-circle-plus-filled:before {
	content: "ﻹ"
}
.ti-circle-rectangle:before {
	content: ""
}
.ti-circle-rectangle-filled:before {
	content: "｣"
}
.ti-circle-rectangle-off:before {
	content: ""
}
.ti-circle-square:before {
	content: ""
}
.ti-circle-triangle:before {
	content: ""
}
.ti-circle-x:before {
	content: ""
}
.ti-circle-x-filled:before {
	content: ""
}
.ti-circles:before {
	content: ""
}
.ti-circles-filled:before {
	content: ""
}
.ti-circles-relation:before {
	content: ""
}
.ti-circuit-ammeter:before {
	content: ""
}
.ti-circuit-battery:before {
	content: ""
}
.ti-circuit-bulb:before {
	content: ""
}
.ti-circuit-capacitor:before {
	content: ""
}
.ti-circuit-capacitor-polarized:before {
	content: ""
}
.ti-circuit-cell:before {
	content: ""
}
.ti-circuit-cell-plus:before {
	content: ""
}
.ti-circuit-changeover:before {
	content: ""
}
.ti-circuit-diode:before {
	content: ""
}
.ti-circuit-diode-zener:before {
	content: ""
}
.ti-circuit-ground:before {
	content: ""
}
.ti-circuit-ground-digital:before {
	content: ""
}
.ti-circuit-inductor:before {
	content: ""
}
.ti-circuit-motor:before {
	content: ""
}
.ti-circuit-pushbutton:before {
	content: ""
}
.ti-circuit-resistor:before {
	content: ""
}
.ti-circuit-switch-closed:before {
	content: ""
}
.ti-circuit-switch-open:before {
	content: ""
}
.ti-circuit-voltmeter:before {
	content: ""
}
.ti-clear-all:before {
	content: ""
}
.ti-clear-formatting:before {
	content: ""
}
.ti-click:before {
	content: ""
}
.ti-cliff-jumping:before {
	content: "ﻼ"
}
.ti-clipboard:before {
	content: ""
}
.ti-clipboard-check:before {
	content: ""
}
.ti-clipboard-check-filled:before {
	content: "𐃎"
}
.ti-clipboard-copy:before {
	content: ""
}
.ti-clipboard-data:before {
	content: ""
}
.ti-clipboard-data-filled:before {
	content: "𐃫"
}
.ti-clipboard-filled:before {
	content: "𐃌"
}
.ti-clipboard-heart:before {
	content: ""
}
.ti-clipboard-list:before {
	content: ""
}
.ti-clipboard-list-filled:before {
	content: "𐃪"
}
.ti-clipboard-off:before {
	content: ""
}
.ti-clipboard-plus:before {
	content: ""
}
.ti-clipboard-plus-filled:before {
	content: "𐅶"
}
.ti-clipboard-search:before {
	content: "𐂘"
}
.ti-clipboard-smile:before {
	content: "ﶚ"
}
.ti-clipboard-smile-filled:before {
	content: "𐅵"
}
.ti-clipboard-text:before {
	content: ""
}
.ti-clipboard-text-filled:before {
	content: "𐃩"
}
.ti-clipboard-typography:before {
	content: ""
}
.ti-clipboard-typography-filled:before {
	content: "𐃨"
}
.ti-clipboard-x:before {
	content: ""
}
.ti-clipboard-x-filled:before {
	content: "𐃍"
}
.ti-clock:before {
	content: ""
}
.ti-clock-12:before {
	content: "ﱖ"
}
.ti-clock-2:before {
	content: ""
}
.ti-clock-24:before {
	content: "ﱗ"
}
.ti-clock-bitcoin:before {
	content: "＿"
}
.ti-clock-bolt:before {
	content: ""
}
.ti-clock-cancel:before {
	content: ""
}
.ti-clock-check:before {
	content: ""
}
.ti-clock-code:before {
	content: ""
}
.ti-clock-cog:before {
	content: ""
}
.ti-clock-dollar:before {
	content: ""
}
.ti-clock-down:before {
	content: ""
}
.ti-clock-edit:before {
	content: ""
}
.ti-clock-exclamation:before {
	content: ""
}
.ti-clock-filled:before {
	content: ""
}
.ti-clock-heart:before {
	content: ""
}
.ti-clock-hour-1:before {
	content: ""
}
.ti-clock-hour-1-filled:before {
	content: "﹥"
}
.ti-clock-hour-10:before {
	content: ""
}
.ti-clock-hour-10-filled:before {
	content: "﹤"
}
.ti-clock-hour-11:before {
	content: ""
}
.ti-clock-hour-11-filled:before {
	content: "﹣"
}
.ti-clock-hour-12:before {
	content: ""
}
.ti-clock-hour-12-filled:before {
	content: "﹢"
}
.ti-clock-hour-2:before {
	content: ""
}
.ti-clock-hour-2-filled:before {
	content: "﹡"
}
.ti-clock-hour-3:before {
	content: ""
}
.ti-clock-hour-3-filled:before {
	content: "﹠"
}
.ti-clock-hour-4:before {
	content: ""
}
.ti-clock-hour-4-filled:before {
	content: "﹟"
}
.ti-clock-hour-5:before {
	content: ""
}
.ti-clock-hour-5-filled:before {
	content: "﹞"
}
.ti-clock-hour-6:before {
	content: ""
}
.ti-clock-hour-6-filled:before {
	content: "﹝"
}
.ti-clock-hour-7:before {
	content: ""
}
.ti-clock-hour-7-filled:before {
	content: "﹜"
}
.ti-clock-hour-8:before {
	content: ""
}
.ti-clock-hour-8-filled:before {
	content: "﹛"
}
.ti-clock-hour-9:before {
	content: ""
}
.ti-clock-hour-9-filled:before {
	content: "﹚"
}
.ti-clock-minus:before {
	content: ""
}
.ti-clock-off:before {
	content: ""
}
.ti-clock-pause:before {
	content: ""
}
.ti-clock-pin:before {
	content: ""
}
.ti-clock-play:before {
	content: ""
}
.ti-clock-plus:before {
	content: ""
}
.ti-clock-question:before {
	content: ""
}
.ti-clock-record:before {
	content: ""
}
.ti-clock-search:before {
	content: ""
}
.ti-clock-share:before {
	content: ""
}
.ti-clock-shield:before {
	content: ""
}
.ti-clock-star:before {
	content: ""
}
.ti-clock-stop:before {
	content: ""
}
.ti-clock-up:before {
	content: ""
}
.ti-clock-x:before {
	content: ""
}
.ti-clothes-rack:before {
	content: ""
}
.ti-clothes-rack-off:before {
	content: ""
}
.ti-cloud:before {
	content: ""
}
.ti-cloud-bitcoin:before {
	content: "＾"
}
.ti-cloud-bolt:before {
	content: ""
}
.ti-cloud-cancel:before {
	content: ""
}
.ti-cloud-check:before {
	content: ""
}
.ti-cloud-code:before {
	content: ""
}
.ti-cloud-cog:before {
	content: ""
}
.ti-cloud-computing:before {
	content: ""
}
.ti-cloud-computing-filled:before {
	content: "𐄍"
}
.ti-cloud-data-connection:before {
	content: ""
}
.ti-cloud-data-connection-filled:before {
	content: "𐄌"
}
.ti-cloud-dollar:before {
	content: ""
}
.ti-cloud-down:before {
	content: ""
}
.ti-cloud-download:before {
	content: ""
}
.ti-cloud-exclamation:before {
	content: ""
}
.ti-cloud-filled:before {
	content: ""
}
.ti-cloud-fog:before {
	content: ""
}
.ti-cloud-heart:before {
	content: ""
}
.ti-cloud-lock:before {
	content: ""
}
.ti-cloud-lock-open:before {
	content: ""
}
.ti-cloud-minus:before {
	content: ""
}
.ti-cloud-network:before {
	content: "ﱸ"
}
.ti-cloud-off:before {
	content: ""
}
.ti-cloud-pause:before {
	content: ""
}
.ti-cloud-pin:before {
	content: ""
}
.ti-cloud-plus:before {
	content: ""
}
.ti-cloud-question:before {
	content: ""
}
.ti-cloud-rain:before {
	content: ""
}
.ti-cloud-search:before {
	content: ""
}
.ti-cloud-share:before {
	content: ""
}
.ti-cloud-snow:before {
	content: ""
}
.ti-cloud-star:before {
	content: ""
}
.ti-cloud-storm:before {
	content: ""
}
.ti-cloud-up:before {
	content: ""
}
.ti-cloud-upload:before {
	content: ""
}
.ti-cloud-x:before {
	content: ""
}
.ti-clover:before {
	content: ""
}
.ti-clover-2:before {
	content: ""
}
.ti-clover-filled:before {
	content: "𐀓"
}
.ti-clubs:before {
	content: ""
}
.ti-clubs-filled:before {
	content: ""
}
.ti-code:before {
	content: ""
}
.ti-code-asterisk:before {
	content: ""
}
.ti-code-circle:before {
	content: ""
}
.ti-code-circle-2:before {
	content: ""
}
.ti-code-circle-2-filled:before {
	content: "ﻔ"
}
.ti-code-circle-filled:before {
	content: "ﻓ"
}
.ti-code-dots:before {
	content: ""
}
.ti-code-minus:before {
	content: ""
}
.ti-code-off:before {
	content: ""
}
.ti-code-plus:before {
	content: ""
}
.ti-code-variable:before {
	content: "𐂫"
}
.ti-code-variable-minus:before {
	content: "𐂭"
}
.ti-code-variable-plus:before {
	content: "𐂬"
}
.ti-coffee:before {
	content: ""
}
.ti-coffee-off:before {
	content: ""
}
.ti-coffin:before {
	content: ""
}
.ti-coin:before {
	content: ""
}
.ti-coin-bitcoin:before {
	content: ""
}
.ti-coin-bitcoin-filled:before {
	content: "ﴆ"
}
.ti-coin-euro:before {
	content: ""
}
.ti-coin-euro-filled:before {
	content: "ﴇ"
}
.ti-coin-filled:before {
	content: "ﴈ"
}
.ti-coin-monero:before {
	content: ""
}
.ti-coin-monero-filled:before {
	content: "ﴉ"
}
.ti-coin-off:before {
	content: ""
}
.ti-coin-pound:before {
	content: ""
}
.ti-coin-pound-filled:before {
	content: "ﴊ"
}
.ti-coin-rupee:before {
	content: ""
}
.ti-coin-rupee-filled:before {
	content: "ﴋ"
}
.ti-coin-taka:before {
	content: "ﴍ"
}
.ti-coin-taka-filled:before {
	content: "ﴌ"
}
.ti-coin-yen:before {
	content: ""
}
.ti-coin-yen-filled:before {
	content: "ﴎ"
}
.ti-coin-yuan:before {
	content: ""
}
.ti-coin-yuan-filled:before {
	content: "ﴏ"
}
.ti-coins:before {
	content: ""
}
.ti-color-filter:before {
	content: ""
}
.ti-color-picker:before {
	content: ""
}
.ti-color-picker-off:before {
	content: ""
}
.ti-color-swatch:before {
	content: ""
}
.ti-color-swatch-off:before {
	content: ""
}
.ti-column-insert-left:before {
	content: ""
}
.ti-column-insert-right:before {
	content: ""
}
.ti-column-remove:before {
	content: "﫴"
}
.ti-columns:before {
	content: ""
}
.ti-columns-1:before {
	content: ""
}
.ti-columns-1-filled:before {
	content: "𐆈"
}
.ti-columns-2:before {
	content: ""
}
.ti-columns-2-filled:before {
	content: "𐆇"
}
.ti-columns-3:before {
	content: ""
}
.ti-columns-3-filled:before {
	content: "𐆆"
}
.ti-columns-off:before {
	content: ""
}
.ti-comet:before {
	content: ""
}
.ti-command:before {
	content: ""
}
.ti-command-off:before {
	content: ""
}
.ti-compass:before {
	content: ""
}
.ti-compass-filled:before {
	content: "ﴐ"
}
.ti-compass-off:before {
	content: ""
}
.ti-components:before {
	content: ""
}
.ti-components-off:before {
	content: ""
}
.ti-cone:before {
	content: ""
}
.ti-cone-2:before {
	content: ""
}
.ti-cone-2-filled:before {
	content: "﹙"
}
.ti-cone-filled:before {
	content: "﹘"
}
.ti-cone-off:before {
	content: ""
}
.ti-cone-plus:before {
	content: "杖"
}
.ti-confetti:before {
	content: ""
}
.ti-confetti-filled:before {
	content: "𐆅"
}
.ti-confetti-off:before {
	content: ""
}
.ti-confucius:before {
	content: ""
}
.ti-congruent-to:before {
	content: "ﾣ"
}
.ti-container:before {
	content: ""
}
.ti-container-filled:before {
	content: "𐆄"
}
.ti-container-off:before {
	content: ""
}
.ti-contract:before {
	content: "ﻻ"
}
.ti-contrast:before {
	content: ""
}
.ti-contrast-2:before {
	content: ""
}
.ti-contrast-2-filled:before {
	content: "﹗"
}
.ti-contrast-2-off:before {
	content: ""
}
.ti-contrast-filled:before {
	content: "﹖"
}
.ti-contrast-off:before {
	content: ""
}
.ti-cooker:before {
	content: ""
}
.ti-cookie:before {
	content: "ﶱ"
}
.ti-cookie-filled:before {
	content: "﹔"
}
.ti-cookie-man:before {
	content: "ﶲ"
}
.ti-cookie-man-filled:before {
	content: "﹕"
}
.ti-cookie-off:before {
	content: ""
}
.ti-copy:before {
	content: ""
}
.ti-copy-check:before {
	content: "ﶰ"
}
.ti-copy-check-filled:before {
	content: "﹓"
}
.ti-copy-minus:before {
	content: "ﶯ"
}
.ti-copy-minus-filled:before {
	content: "﹒"
}
.ti-copy-off:before {
	content: ""
}
.ti-copy-plus:before {
	content: "ﶮ"
}
.ti-copy-plus-filled:before {
	content: "﹑"
}
.ti-copy-x:before {
	content: "ﶭ"
}
.ti-copy-x-filled:before {
	content: "﹐"
}
.ti-copyleft:before {
	content: ""
}
.ti-copyleft-filled:before {
	content: ""
}
.ti-copyleft-off:before {
	content: ""
}
.ti-copyright:before {
	content: ""
}
.ti-copyright-filled:before {
	content: ""
}
.ti-copyright-off:before {
	content: ""
}
.ti-corner-down-left:before {
	content: ""
}
.ti-corner-down-left-double:before {
	content: ""
}
.ti-corner-down-right:before {
	content: ""
}
.ti-corner-down-right-double:before {
	content: ""
}
.ti-corner-left-down:before {
	content: ""
}
.ti-corner-left-down-double:before {
	content: ""
}
.ti-corner-left-up:before {
	content: ""
}
.ti-corner-left-up-double:before {
	content: ""
}
.ti-corner-right-down:before {
	content: ""
}
.ti-corner-right-down-double:before {
	content: ""
}
.ti-corner-right-up:before {
	content: ""
}
.ti-corner-right-up-double:before {
	content: ""
}
.ti-corner-up-left:before {
	content: ""
}
.ti-corner-up-left-double:before {
	content: ""
}
.ti-corner-up-right:before {
	content: ""
}
.ti-corner-up-right-double:before {
	content: ""
}
.ti-cpu:before {
	content: ""
}
.ti-cpu-2:before {
	content: ""
}
.ti-cpu-off:before {
	content: ""
}
.ti-crane:before {
	content: ""
}
.ti-crane-off:before {
	content: ""
}
.ti-creative-commons:before {
	content: ""
}
.ti-creative-commons-by:before {
	content: ""
}
.ti-creative-commons-nc:before {
	content: ""
}
.ti-creative-commons-nd:before {
	content: ""
}
.ti-creative-commons-off:before {
	content: ""
}
.ti-creative-commons-sa:before {
	content: ""
}
.ti-creative-commons-zero:before {
	content: ""
}
.ti-credit-card:before {
	content: ""
}
.ti-credit-card-filled:before {
	content: "ﴑ"
}
.ti-credit-card-off:before {
	content: ""
}
.ti-credit-card-pay:before {
	content: "ﴲ"
}
.ti-credit-card-refund:before {
	content: "ﴳ"
}
.ti-cricket:before {
	content: ""
}
.ti-crop:before {
	content: ""
}
.ti-crop-1-1:before {
	content: "ﵐ"
}
.ti-crop-1-1-filled:before {
	content: "﹏"
}
.ti-crop-16-9:before {
	content: "ﵑ"
}
.ti-crop-16-9-filled:before {
	content: "﹎"
}
.ti-crop-3-2:before {
	content: "ﵒ"
}
.ti-crop-3-2-filled:before {
	content: "﹍"
}
.ti-crop-5-4:before {
	content: "ﵓ"
}
.ti-crop-5-4-filled:before {
	content: "﹌"
}
.ti-crop-7-5:before {
	content: "ﵔ"
}
.ti-crop-7-5-filled:before {
	content: "﹋"
}
.ti-crop-landscape:before {
	content: "ﵕ"
}
.ti-crop-landscape-filled:before {
	content: "﹊"
}
.ti-crop-portrait:before {
	content: "ﵖ"
}
.ti-crop-portrait-filled:before {
	content: "﹉"
}
.ti-cross:before {
	content: ""
}
.ti-cross-filled:before {
	content: ""
}
.ti-cross-off:before {
	content: ""
}
.ti-crosshair:before {
	content: ""
}
.ti-crown:before {
	content: ""
}
.ti-crown-off:before {
	content: ""
}
.ti-crutches:before {
	content: ""
}
.ti-crutches-off:before {
	content: ""
}
.ti-crystal-ball:before {
	content: ""
}
.ti-csv:before {
	content: ""
}
.ti-cube:before {
	content: "流"
}
.ti-cube-3d-sphere:before {
	content: ""
}
.ti-cube-3d-sphere-off:before {
	content: ""
}
.ti-cube-off:before {
	content: "歹"
}
.ti-cube-plus:before {
	content: "殺"
}
.ti-cube-send:before {
	content: ""
}
.ti-cube-spark:before {
	content: "ﾻ"
}
.ti-cube-unfolded:before {
	content: ""
}
.ti-cup:before {
	content: ""
}
.ti-cup-off:before {
	content: ""
}
.ti-curling:before {
	content: ""
}
.ti-curly-loop:before {
	content: ""
}
.ti-currency:before {
	content: ""
}
.ti-currency-afghani:before {
	content: ""
}
.ti-currency-bahraini:before {
	content: ""
}
.ti-currency-baht:before {
	content: ""
}
.ti-currency-bitcoin:before {
	content: ""
}
.ti-currency-cent:before {
	content: ""
}
.ti-currency-dinar:before {
	content: ""
}
.ti-currency-dirham:before {
	content: ""
}
.ti-currency-dogecoin:before {
	content: ""
}
.ti-currency-dollar:before {
	content: ""
}
.ti-currency-dollar-australian:before {
	content: ""
}
.ti-currency-dollar-brunei:before {
	content: ""
}
.ti-currency-dollar-canadian:before {
	content: ""
}
.ti-currency-dollar-guyanese:before {
	content: ""
}
.ti-currency-dollar-off:before {
	content: ""
}
.ti-currency-dollar-singapore:before {
	content: ""
}
.ti-currency-dollar-zimbabwean:before {
	content: ""
}
.ti-currency-dong:before {
	content: ""
}
.ti-currency-dram:before {
	content: ""
}
.ti-currency-ethereum:before {
	content: ""
}
.ti-currency-euro:before {
	content: ""
}
.ti-currency-euro-off:before {
	content: ""
}
.ti-currency-florin:before {
	content: "﫵"
}
.ti-currency-forint:before {
	content: ""
}
.ti-currency-frank:before {
	content: ""
}
.ti-currency-guarani:before {
	content: ""
}
.ti-currency-hryvnia:before {
	content: ""
}
.ti-currency-iranian-rial:before {
	content: "縉"
}
.ti-currency-kip:before {
	content: ""
}
.ti-currency-krone-czech:before {
	content: ""
}
.ti-currency-krone-danish:before {
	content: ""
}
.ti-currency-krone-swedish:before {
	content: ""
}
.ti-currency-lari:before {
	content: ""
}
.ti-currency-leu:before {
	content: ""
}
.ti-currency-lira:before {
	content: ""
}
.ti-currency-litecoin:before {
	content: ""
}
.ti-currency-lyd:before {
	content: ""
}
.ti-currency-manat:before {
	content: ""
}
.ti-currency-monero:before {
	content: ""
}
.ti-currency-naira:before {
	content: ""
}
.ti-currency-nano:before {
	content: ""
}
.ti-currency-off:before {
	content: ""
}
.ti-currency-paanga:before {
	content: ""
}
.ti-currency-peso:before {
	content: ""
}
.ti-currency-pound:before {
	content: ""
}
.ti-currency-pound-off:before {
	content: ""
}
.ti-currency-quetzal:before {
	content: ""
}
.ti-currency-real:before {
	content: ""
}
.ti-currency-renminbi:before {
	content: ""
}
.ti-currency-ripple:before {
	content: ""
}
.ti-currency-riyal:before {
	content: ""
}
.ti-currency-rubel:before {
	content: ""
}
.ti-currency-rufiyaa:before {
	content: ""
}
.ti-currency-rupee:before {
	content: ""
}
.ti-currency-rupee-nepalese:before {
	content: ""
}
.ti-currency-shekel:before {
	content: ""
}
.ti-currency-solana:before {
	content: ""
}
.ti-currency-som:before {
	content: ""
}
.ti-currency-taka:before {
	content: ""
}
.ti-currency-tenge:before {
	content: ""
}
.ti-currency-tugrik:before {
	content: ""
}
.ti-currency-won:before {
	content: ""
}
.ti-currency-xrp:before {
	content: "ﴴ"
}
.ti-currency-yen:before {
	content: ""
}
.ti-currency-yen-off:before {
	content: ""
}
.ti-currency-yuan:before {
	content: ""
}
.ti-currency-zloty:before {
	content: ""
}
.ti-current-location:before {
	content: ""
}
.ti-current-location-filled:before {
	content: "𐄥"
}
.ti-current-location-off:before {
	content: ""
}
.ti-cursor-off:before {
	content: ""
}
.ti-cursor-text:before {
	content: ""
}
.ti-cut:before {
	content: ""
}
.ti-cylinder:before {
	content: ""
}
.ti-cylinder-off:before {
	content: "滛"
}
.ti-cylinder-plus:before {
	content: "滋"
}
.ti-dashboard:before {
	content: ""
}
.ti-dashboard-filled:before {
	content: "𐀙"
}
.ti-dashboard-off:before {
	content: ""
}
.ti-database:before {
	content: ""
}
.ti-database-cog:before {
	content: "塚"
}
.ti-database-dollar:before {
	content: "﨑"
}
.ti-database-edit:before {
	content: "晴"
}
.ti-database-exclamation:before {
	content: "﨓"
}
.ti-database-export:before {
	content: ""
}
.ti-database-heart:before {
	content: "﨔"
}
.ti-database-import:before {
	content: ""
}
.ti-database-leak:before {
	content: "凞"
}
.ti-database-minus:before {
	content: "猪"
}
.ti-database-off:before {
	content: ""
}
.ti-database-plus:before {
	content: "益"
}
.ti-database-search:before {
	content: "礼"
}
.ti-database-share:before {
	content: "神"
}
.ti-database-smile:before {
	content: "ﶛ"
}
.ti-database-star:before {
	content: "祥"
}
.ti-database-x:before {
	content: "福"
}
.ti-decimal:before {
	content: "都"
}
.ti-deer:before {
	content: ""
}
.ti-delta:before {
	content: ""
}
.ti-dental:before {
	content: ""
}
.ti-dental-broken:before {
	content: ""
}
.ti-dental-off:before {
	content: ""
}
.ti-deselect:before {
	content: "麟"
}
.ti-desk:before {
	content: "ﴵ"
}
.ti-details:before {
	content: ""
}
.ti-details-off:before {
	content: ""
}
.ti-device-airpods:before {
	content: ""
}
.ti-device-airpods-case:before {
	content: ""
}
.ti-device-airtag:before {
	content: "﫦"
}
.ti-device-analytics:before {
	content: ""
}
.ti-device-audio-tape:before {
	content: ""
}
.ti-device-camera-phone:before {
	content: ""
}
.ti-device-cctv:before {
	content: ""
}
.ti-device-cctv-filled:before {
	content: "𐁋"
}
.ti-device-cctv-off:before {
	content: ""
}
.ti-device-computer-camera:before {
	content: ""
}
.ti-device-computer-camera-off:before {
	content: ""
}
.ti-device-desktop:before {
	content: ""
}
.ti-device-desktop-analytics:before {
	content: ""
}
.ti-device-desktop-bolt:before {
	content: ""
}
.ti-device-desktop-cancel:before {
	content: ""
}
.ti-device-desktop-check:before {
	content: ""
}
.ti-device-desktop-code:before {
	content: ""
}
.ti-device-desktop-cog:before {
	content: ""
}
.ti-device-desktop-dollar:before {
	content: ""
}
.ti-device-desktop-down:before {
	content: ""
}
.ti-device-desktop-exclamation:before {
	content: ""
}
.ti-device-desktop-filled:before {
	content: "𐁊"
}
.ti-device-desktop-heart:before {
	content: ""
}
.ti-device-desktop-minus:before {
	content: ""
}
.ti-device-desktop-off:before {
	content: ""
}
.ti-device-desktop-pause:before {
	content: ""
}
.ti-device-desktop-pin:before {
	content: ""
}
.ti-device-desktop-plus:before {
	content: ""
}
.ti-device-desktop-question:before {
	content: ""
}
.ti-device-desktop-search:before {
	content: ""
}
.ti-device-desktop-share:before {
	content: ""
}
.ti-device-desktop-star:before {
	content: ""
}
.ti-device-desktop-up:before {
	content: ""
}
.ti-device-desktop-x:before {
	content: ""
}
.ti-device-floppy:before {
	content: ""
}
.ti-device-gamepad:before {
	content: ""
}
.ti-device-gamepad-2:before {
	content: ""
}
.ti-device-gamepad-3:before {
	content: "ﱘ"
}
.ti-device-gamepad-3-filled:before {
	content: "𐁉"
}
.ti-device-heart-monitor:before {
	content: ""
}
.ti-device-heart-monitor-filled:before {
	content: "器"
}
.ti-device-imac:before {
	content: ""
}
.ti-device-imac-bolt:before {
	content: ""
}
.ti-device-imac-cancel:before {
	content: ""
}
.ti-device-imac-check:before {
	content: ""
}
.ti-device-imac-code:before {
	content: ""
}
.ti-device-imac-cog:before {
	content: ""
}
.ti-device-imac-dollar:before {
	content: ""
}
.ti-device-imac-down:before {
	content: ""
}
.ti-device-imac-exclamation:before {
	content: ""
}
.ti-device-imac-filled:before {
	content: "𐁈"
}
.ti-device-imac-heart:before {
	content: ""
}
.ti-device-imac-minus:before {
	content: ""
}
.ti-device-imac-off:before {
	content: ""
}
.ti-device-imac-pause:before {
	content: ""
}
.ti-device-imac-pin:before {
	content: ""
}
.ti-device-imac-plus:before {
	content: ""
}
.ti-device-imac-question:before {
	content: ""
}
.ti-device-imac-search:before {
	content: ""
}
.ti-device-imac-share:before {
	content: ""
}
.ti-device-imac-star:before {
	content: ""
}
.ti-device-imac-up:before {
	content: ""
}
.ti-device-imac-x:before {
	content: ""
}
.ti-device-ipad:before {
	content: ""
}
.ti-device-ipad-bolt:before {
	content: ""
}
.ti-device-ipad-cancel:before {
	content: ""
}
.ti-device-ipad-check:before {
	content: ""
}
.ti-device-ipad-code:before {
	content: ""
}
.ti-device-ipad-cog:before {
	content: ""
}
.ti-device-ipad-dollar:before {
	content: ""
}
.ti-device-ipad-down:before {
	content: ""
}
.ti-device-ipad-exclamation:before {
	content: ""
}
.ti-device-ipad-filled:before {
	content: "𐁇"
}
.ti-device-ipad-heart:before {
	content: ""
}
.ti-device-ipad-horizontal:before {
	content: ""
}
.ti-device-ipad-horizontal-bolt:before {
	content: ""
}
.ti-device-ipad-horizontal-cancel:before {
	content: ""
}
.ti-device-ipad-horizontal-check:before {
	content: ""
}
.ti-device-ipad-horizontal-code:before {
	content: ""
}
.ti-device-ipad-horizontal-cog:before {
	content: ""
}
.ti-device-ipad-horizontal-dollar:before {
	content: ""
}
.ti-device-ipad-horizontal-down:before {
	content: ""
}
.ti-device-ipad-horizontal-exclamation:before {
	content: ""
}
.ti-device-ipad-horizontal-heart:before {
	content: ""
}
.ti-device-ipad-horizontal-minus:before {
	content: ""
}
.ti-device-ipad-horizontal-off:before {
	content: ""
}
.ti-device-ipad-horizontal-pause:before {
	content: ""
}
.ti-device-ipad-horizontal-pin:before {
	content: ""
}
.ti-device-ipad-horizontal-plus:before {
	content: ""
}
.ti-device-ipad-horizontal-question:before {
	content: ""
}
.ti-device-ipad-horizontal-search:before {
	content: ""
}
.ti-device-ipad-horizontal-share:before {
	content: ""
}
.ti-device-ipad-horizontal-star:before {
	content: ""
}
.ti-device-ipad-horizontal-up:before {
	content: ""
}
.ti-device-ipad-horizontal-x:before {
	content: ""
}
.ti-device-ipad-minus:before {
	content: ""
}
.ti-device-ipad-off:before {
	content: ""
}
.ti-device-ipad-pause:before {
	content: ""
}
.ti-device-ipad-pin:before {
	content: ""
}
.ti-device-ipad-plus:before {
	content: ""
}
.ti-device-ipad-question:before {
	content: ""
}
.ti-device-ipad-search:before {
	content: ""
}
.ti-device-ipad-share:before {
	content: ""
}
.ti-device-ipad-star:before {
	content: ""
}
.ti-device-ipad-up:before {
	content: ""
}
.ti-device-ipad-x:before {
	content: ""
}
.ti-device-landline-phone:before {
	content: ""
}
.ti-device-laptop:before {
	content: ""
}
.ti-device-laptop-off:before {
	content: ""
}
.ti-device-mobile:before {
	content: ""
}
.ti-device-mobile-bolt:before {
	content: ""
}
.ti-device-mobile-cancel:before {
	content: ""
}
.ti-device-mobile-charging:before {
	content: ""
}
.ti-device-mobile-check:before {
	content: ""
}
.ti-device-mobile-code:before {
	content: ""
}
.ti-device-mobile-cog:before {
	content: ""
}
.ti-device-mobile-dollar:before {
	content: ""
}
.ti-device-mobile-down:before {
	content: ""
}
.ti-device-mobile-exclamation:before {
	content: ""
}
.ti-device-mobile-filled:before {
	content: "塀"
}
.ti-device-mobile-heart:before {
	content: ""
}
.ti-device-mobile-message:before {
	content: ""
}
.ti-device-mobile-minus:before {
	content: ""
}
.ti-device-mobile-off:before {
	content: ""
}
.ti-device-mobile-pause:before {
	content: ""
}
.ti-device-mobile-pin:before {
	content: ""
}
.ti-device-mobile-plus:before {
	content: ""
}
.ti-device-mobile-question:before {
	content: ""
}
.ti-device-mobile-rotated:before {
	content: ""
}
.ti-device-mobile-search:before {
	content: ""
}
.ti-device-mobile-share:before {
	content: ""
}
.ti-device-mobile-star:before {
	content: ""
}
.ti-device-mobile-up:before {
	content: ""
}
.ti-device-mobile-vibration:before {
	content: ""
}
.ti-device-mobile-x:before {
	content: ""
}
.ti-device-nintendo:before {
	content: ""
}
.ti-device-nintendo-off:before {
	content: ""
}
.ti-device-projector:before {
	content: "ﰑ"
}
.ti-device-remote:before {
	content: ""
}
.ti-device-remote-filled:before {
	content: "𐁆"
}
.ti-device-sd-card:before {
	content: ""
}
.ti-device-sim:before {
	content: ""
}
.ti-device-sim-1:before {
	content: ""
}
.ti-device-sim-2:before {
	content: ""
}
.ti-device-sim-3:before {
	content: ""
}
.ti-device-speaker:before {
	content: ""
}
.ti-device-speaker-filled:before {
	content: "𐁅"
}
.ti-device-speaker-off:before {
	content: ""
}
.ti-device-tablet:before {
	content: ""
}
.ti-device-tablet-bolt:before {
	content: ""
}
.ti-device-tablet-cancel:before {
	content: ""
}
.ti-device-tablet-check:before {
	content: ""
}
.ti-device-tablet-code:before {
	content: ""
}
.ti-device-tablet-cog:before {
	content: ""
}
.ti-device-tablet-dollar:before {
	content: ""
}
.ti-device-tablet-down:before {
	content: ""
}
.ti-device-tablet-exclamation:before {
	content: ""
}
.ti-device-tablet-filled:before {
	content: "墨"
}
.ti-device-tablet-heart:before {
	content: ""
}
.ti-device-tablet-minus:before {
	content: ""
}
.ti-device-tablet-off:before {
	content: ""
}
.ti-device-tablet-pause:before {
	content: ""
}
.ti-device-tablet-pin:before {
	content: ""
}
.ti-device-tablet-plus:before {
	content: ""
}
.ti-device-tablet-question:before {
	content: ""
}
.ti-device-tablet-search:before {
	content: ""
}
.ti-device-tablet-share:before {
	content: ""
}
.ti-device-tablet-star:before {
	content: ""
}
.ti-device-tablet-up:before {
	content: ""
}
.ti-device-tablet-x:before {
	content: ""
}
.ti-device-tv:before {
	content: ""
}
.ti-device-tv-filled:before {
	content: "𐁃"
}
.ti-device-tv-off:before {
	content: ""
}
.ti-device-tv-old:before {
	content: ""
}
.ti-device-tv-old-filled:before {
	content: "𐁄"
}
.ti-device-unknown:before {
	content: "ﻴ"
}
.ti-device-unknown-filled:before {
	content: "𐀘"
}
.ti-device-usb:before {
	content: "ﱙ"
}
.ti-device-usb-filled:before {
	content: "𐁂"
}
.ti-device-vision-pro:before {
	content: "﫧"
}
.ti-device-vision-pro-filled:before {
	content: "𐁁"
}
.ti-device-watch:before {
	content: ""
}
.ti-device-watch-bolt:before {
	content: ""
}
.ti-device-watch-cancel:before {
	content: ""
}
.ti-device-watch-check:before {
	content: ""
}
.ti-device-watch-code:before {
	content: ""
}
.ti-device-watch-cog:before {
	content: ""
}
.ti-device-watch-dollar:before {
	content: ""
}
.ti-device-watch-down:before {
	content: ""
}
.ti-device-watch-exclamation:before {
	content: ""
}
.ti-device-watch-filled:before {
	content: "𐁀"
}
.ti-device-watch-heart:before {
	content: ""
}
.ti-device-watch-minus:before {
	content: ""
}
.ti-device-watch-off:before {
	content: ""
}
.ti-device-watch-pause:before {
	content: ""
}
.ti-device-watch-pin:before {
	content: ""
}
.ti-device-watch-plus:before {
	content: ""
}
.ti-device-watch-question:before {
	content: ""
}
.ti-device-watch-search:before {
	content: ""
}
.ti-device-watch-share:before {
	content: ""
}
.ti-device-watch-star:before {
	content: ""
}
.ti-device-watch-stats:before {
	content: ""
}
.ti-device-watch-stats-2:before {
	content: ""
}
.ti-device-watch-up:before {
	content: ""
}
.ti-device-watch-x:before {
	content: ""
}
.ti-devices:before {
	content: ""
}
.ti-devices-2:before {
	content: ""
}
.ti-devices-bolt:before {
	content: ""
}
.ti-devices-cancel:before {
	content: ""
}
.ti-devices-check:before {
	content: ""
}
.ti-devices-code:before {
	content: ""
}
.ti-devices-cog:before {
	content: ""
}
.ti-devices-dollar:before {
	content: ""
}
.ti-devices-down:before {
	content: ""
}
.ti-devices-exclamation:before {
	content: ""
}
.ti-devices-heart:before {
	content: ""
}
.ti-devices-minus:before {
	content: ""
}
.ti-devices-off:before {
	content: ""
}
.ti-devices-pause:before {
	content: ""
}
.ti-devices-pc:before {
	content: ""
}
.ti-devices-pc-off:before {
	content: ""
}
.ti-devices-pin:before {
	content: ""
}
.ti-devices-plus:before {
	content: ""
}
.ti-devices-question:before {
	content: ""
}
.ti-devices-search:before {
	content: ""
}
.ti-devices-share:before {
	content: ""
}
.ti-devices-star:before {
	content: ""
}
.ti-devices-up:before {
	content: ""
}
.ti-devices-x:before {
	content: ""
}
.ti-diabolo:before {
	content: "煮"
}
.ti-diabolo-off:before {
	content: "漢"
}
.ti-diabolo-plus:before {
	content: "瀞"
}
.ti-dialpad:before {
	content: ""
}
.ti-dialpad-filled:before {
	content: "層"
}
.ti-dialpad-off:before {
	content: ""
}
.ti-diamond:before {
	content: ""
}
.ti-diamond-filled:before {
	content: ""
}
.ti-diamond-off:before {
	content: ""
}
.ti-diamonds:before {
	content: ""
}
.ti-diamonds-filled:before {
	content: ""
}
.ti-diaper:before {
	content: "ﾢ"
}
.ti-dice:before {
	content: ""
}
.ti-dice-1:before {
	content: ""
}
.ti-dice-1-filled:before {
	content: ""
}
.ti-dice-2:before {
	content: ""
}
.ti-dice-2-filled:before {
	content: ""
}
.ti-dice-3:before {
	content: ""
}
.ti-dice-3-filled:before {
	content: ""
}
.ti-dice-4:before {
	content: ""
}
.ti-dice-4-filled:before {
	content: ""
}
.ti-dice-5:before {
	content: ""
}
.ti-dice-5-filled:before {
	content: ""
}
.ti-dice-6:before {
	content: ""
}
.ti-dice-6-filled:before {
	content: ""
}
.ti-dice-filled:before {
	content: ""
}
.ti-dimensions:before {
	content: ""
}
.ti-direction:before {
	content: ""
}
.ti-direction-arrows:before {
	content: "ﴶ"
}
.ti-direction-arrows-filled:before {
	content: "𐃊"
}
.ti-direction-horizontal:before {
	content: ""
}
.ti-direction-sign:before {
	content: ""
}
.ti-direction-sign-filled:before {
	content: ""
}
.ti-direction-sign-off:before {
	content: ""
}
.ti-directions:before {
	content: ""
}
.ti-directions-filled:before {
	content: "𐀿"
}
.ti-directions-off:before {
	content: ""
}
.ti-disabled:before {
	content: ""
}
.ti-disabled-2:before {
	content: ""
}
.ti-disabled-off:before {
	content: ""
}
.ti-disc:before {
	content: ""
}
.ti-disc-filled:before {
	content: "𐀾"
}
.ti-disc-golf:before {
	content: ""
}
.ti-disc-off:before {
	content: ""
}
.ti-discount:before {
	content: ""
}
.ti-discount-filled:before {
	content: "𐀽"
}
.ti-discount-off:before {
	content: ""
}
.ti-divide:before {
	content: ""
}
.ti-dna:before {
	content: ""
}
.ti-dna-2:before {
	content: ""
}
.ti-dna-2-off:before {
	content: ""
}
.ti-dna-off:before {
	content: ""
}
.ti-dog:before {
	content: ""
}
.ti-dog-bowl:before {
	content: ""
}
.ti-door:before {
	content: ""
}
.ti-door-enter:before {
	content: ""
}
.ti-door-exit:before {
	content: ""
}
.ti-door-off:before {
	content: ""
}
.ti-dots:before {
	content: ""
}
.ti-dots-circle-horizontal:before {
	content: ""
}
.ti-dots-diagonal:before {
	content: ""
}
.ti-dots-diagonal-2:before {
	content: ""
}
.ti-dots-vertical:before {
	content: ""
}
.ti-download:before {
	content: ""
}
.ti-download-off:before {
	content: ""
}
.ti-drag-drop:before {
	content: ""
}
.ti-drag-drop-2:before {
	content: ""
}
.ti-drone:before {
	content: ""
}
.ti-drone-off:before {
	content: ""
}
.ti-drop-circle:before {
	content: ""
}
.ti-drop-circle-filled:before {
	content: "𐄷"
}
.ti-droplet:before {
	content: ""
}
.ti-droplet-bolt:before {
	content: ""
}
.ti-droplet-cancel:before {
	content: ""
}
.ti-droplet-check:before {
	content: ""
}
.ti-droplet-code:before {
	content: ""
}
.ti-droplet-cog:before {
	content: ""
}
.ti-droplet-dollar:before {
	content: ""
}
.ti-droplet-down:before {
	content: ""
}
.ti-droplet-exclamation:before {
	content: "豈"
}
.ti-droplet-filled:before {
	content: ""
}
.ti-droplet-half:before {
	content: ""
}
.ti-droplet-half-2:before {
	content: ""
}
.ti-droplet-half-2-filled:before {
	content: "ﭬ"
}
.ti-droplet-half-filled:before {
	content: ""
}
.ti-droplet-heart:before {
	content: "更"
}
.ti-droplet-minus:before {
	content: "車"
}
.ti-droplet-off:before {
	content: ""
}
.ti-droplet-pause:before {
	content: "賈"
}
.ti-droplet-pin:before {
	content: "滑"
}
.ti-droplet-plus:before {
	content: "串"
}
.ti-droplet-question:before {
	content: "句"
}
.ti-droplet-search:before {
	content: "龜"
}
.ti-droplet-share:before {
	content: "龜"
}
.ti-droplet-star:before {
	content: "契"
}
.ti-droplet-up:before {
	content: "金"
}
.ti-droplet-x:before {
	content: "喇"
}
.ti-droplets:before {
	content: "ﰒ"
}
.ti-droplets-filled:before {
	content: "𐃉"
}
.ti-dual-screen:before {
	content: "繁"
}
.ti-dual-screen-filled:before {
	content: "𐄶"
}
.ti-dumpling:before {
	content: "ﺵ"
}
.ti-dumpling-filled:before {
	content: "𐄵"
}
.ti-e-passport:before {
	content: ""
}
.ti-ear:before {
	content: ""
}
.ti-ear-off:before {
	content: ""
}
.ti-ear-scan:before {
	content: "ﵗ"
}
.ti-ease-in:before {
	content: ""
}
.ti-ease-in-control-point:before {
	content: ""
}
.ti-ease-in-control-point-filled:before {
	content: "𐅴"
}
.ti-ease-in-out:before {
	content: ""
}
.ti-ease-in-out-control-points:before {
	content: ""
}
.ti-ease-in-out-control-points-filled:before {
	content: "𐅳"
}
.ti-ease-out:before {
	content: ""
}
.ti-ease-out-control-point:before {
	content: ""
}
.ti-ease-out-control-point-filled:before {
	content: "𐅲"
}
.ti-edit:before {
	content: ""
}
.ti-edit-circle:before {
	content: ""
}
.ti-edit-circle-off:before {
	content: ""
}
.ti-edit-off:before {
	content: ""
}
.ti-egg:before {
	content: ""
}
.ti-egg-cracked:before {
	content: ""
}
.ti-egg-cracked-filled:before {
	content: "𐀒"
}
.ti-egg-filled:before {
	content: ""
}
.ti-egg-fried:before {
	content: ""
}
.ti-egg-fried-filled:before {
	content: "𐄴"
}
.ti-egg-off:before {
	content: ""
}
.ti-eggs:before {
	content: ""
}
.ti-elevator:before {
	content: ""
}
.ti-elevator-filled:before {
	content: "𐀼"
}
.ti-elevator-off:before {
	content: ""
}
.ti-emergency-bed:before {
	content: ""
}
.ti-empathize:before {
	content: ""
}
.ti-empathize-off:before {
	content: ""
}
.ti-emphasis:before {
	content: ""
}
.ti-engine:before {
	content: ""
}
.ti-engine-filled:before {
	content: "𐃼"
}
.ti-engine-off:before {
	content: ""
}
.ti-equal:before {
	content: ""
}
.ti-equal-double:before {
	content: ""
}
.ti-equal-not:before {
	content: ""
}
.ti-eraser:before {
	content: ""
}
.ti-eraser-off:before {
	content: ""
}
.ti-error-404:before {
	content: ""
}
.ti-error-404-off:before {
	content: ""
}
.ti-escalator:before {
	content: "st"
}
.ti-escalator-down:before {
	content: "ffl"
}
.ti-escalator-down-filled:before {
	content: "𐄳"
}
.ti-escalator-filled:before {
	content: "𐄱"
}
.ti-escalator-up:before {
	content: "ſt"
}
.ti-escalator-up-filled:before {
	content: "𐄲"
}
.ti-exchange:before {
	content: ""
}
.ti-exchange-filled:before {
	content: "𐄰"
}
.ti-exchange-off:before {
	content: ""
}
.ti-exclamation-circle:before {
	content: ""
}
.ti-exclamation-circle-filled:before {
	content: "｢"
}
.ti-exclamation-mark:before {
	content: ""
}
.ti-exclamation-mark-off:before {
	content: ""
}
.ti-explicit:before {
	content: ""
}
.ti-explicit-filled:before {
	content: "𐄯"
}
.ti-explicit-off:before {
	content: ""
}
.ti-exposure:before {
	content: ""
}
.ti-exposure-0:before {
	content: ""
}
.ti-exposure-filled:before {
	content: "𐄤"
}
.ti-exposure-minus-1:before {
	content: ""
}
.ti-exposure-minus-2:before {
	content: ""
}
.ti-exposure-off:before {
	content: ""
}
.ti-exposure-plus-1:before {
	content: ""
}
.ti-exposure-plus-2:before {
	content: ""
}
.ti-external-link:before {
	content: ""
}
.ti-external-link-off:before {
	content: ""
}
.ti-eye:before {
	content: ""
}
.ti-eye-bitcoin:before {
	content: "］"
}
.ti-eye-bolt:before {
	content: "ﭭ"
}
.ti-eye-cancel:before {
	content: "ﭮ"
}
.ti-eye-check:before {
	content: ""
}
.ti-eye-closed:before {
	content: ""
}
.ti-eye-code:before {
	content: "ﭯ"
}
.ti-eye-cog:before {
	content: ""
}
.ti-eye-discount:before {
	content: "ﭰ"
}
.ti-eye-dollar:before {
	content: "ﭱ"
}
.ti-eye-dotted:before {
	content: "ﺭ"
}
.ti-eye-down:before {
	content: "ﭲ"
}
.ti-eye-edit:before {
	content: ""
}
.ti-eye-exclamation:before {
	content: ""
}
.ti-eye-filled:before {
	content: ""
}
.ti-eye-heart:before {
	content: ""
}
.ti-eye-minus:before {
	content: "ﭳ"
}
.ti-eye-off:before {
	content: ""
}
.ti-eye-pause:before {
	content: "ﭴ"
}
.ti-eye-pin:before {
	content: "ﭵ"
}
.ti-eye-plus:before {
	content: "ﭶ"
}
.ti-eye-question:before {
	content: "ﭷ"
}
.ti-eye-search:before {
	content: "ﭸ"
}
.ti-eye-share:before {
	content: "ﭹ"
}
.ti-eye-spark:before {
	content: "ﾺ"
}
.ti-eye-star:before {
	content: "ﭺ"
}
.ti-eye-table:before {
	content: ""
}
.ti-eye-table-filled:before {
	content: "𐄣"
}
.ti-eye-up:before {
	content: "ﭻ"
}
.ti-eye-x:before {
	content: ""
}
.ti-eyeglass:before {
	content: ""
}
.ti-eyeglass-2:before {
	content: ""
}
.ti-eyeglass-2-filled:before {
	content: "𐄢"
}
.ti-eyeglass-filled:before {
	content: "𐃈"
}
.ti-eyeglass-off:before {
	content: ""
}
.ti-face-id:before {
	content: ""
}
.ti-face-id-error:before {
	content: ""
}
.ti-face-mask:before {
	content: ""
}
.ti-face-mask-filled:before {
	content: "𐄡"
}
.ti-face-mask-off:before {
	content: ""
}
.ti-fall:before {
	content: ""
}
.ti-favicon:before {
	content: "ﵥ"
}
.ti-favicon-filled:before {
	content: "𐁱"
}
.ti-feather:before {
	content: ""
}
.ti-feather-filled:before {
	content: "𐀑"
}
.ti-feather-off:before {
	content: ""
}
.ti-fence:before {
	content: ""
}
.ti-fence-filled:before {
	content: "𐄠"
}
.ti-fence-off:before {
	content: ""
}
.ti-ferry:before {
	content: "𐁴"
}
.ti-ferry-filled:before {
	content: "𐃻"
}
.ti-fidget-spinner:before {
	content: ""
}
.ti-fidget-spinner-filled:before {
	content: "𐄟"
}
.ti-file:before {
	content: ""
}
.ti-file-3d:before {
	content: ""
}
.ti-file-ai:before {
	content: "ﾡ"
}
.ti-file-alert:before {
	content: ""
}
.ti-file-analytics:before {
	content: ""
}
.ti-file-analytics-filled:before {
	content: "𐅱"
}
.ti-file-arrow-left:before {
	content: ""
}
.ti-file-arrow-right:before {
	content: ""
}
.ti-file-barcode:before {
	content: ""
}
.ti-file-bitcoin:before {
	content: "ﾠ"
}
.ti-file-broken:before {
	content: ""
}
.ti-file-certificate:before {
	content: ""
}
.ti-file-chart:before {
	content: ""
}
.ti-file-check:before {
	content: ""
}
.ti-file-check-filled:before {
	content: "𐄮"
}
.ti-file-code:before {
	content: ""
}
.ti-file-code-2:before {
	content: ""
}
.ti-file-code-2-filled:before {
	content: "𐄭"
}
.ti-file-code-filled:before {
	content: "𐅰"
}
.ti-file-cv:before {
	content: "署"
}
.ti-file-cv-filled:before {
	content: "𐄬"
}
.ti-file-database:before {
	content: ""
}
.ti-file-delta:before {
	content: ""
}
.ti-file-delta-filled:before {
	content: "𐄫"
}
.ti-file-description:before {
	content: ""
}
.ti-file-description-filled:before {
	content: "𐄞"
}
.ti-file-diff:before {
	content: ""
}
.ti-file-diff-filled:before {
	content: "𐅯"
}
.ti-file-digit:before {
	content: ""
}
.ti-file-digit-filled:before {
	content: "𐄝"
}
.ti-file-dislike:before {
	content: ""
}
.ti-file-dollar:before {
	content: ""
}
.ti-file-dots:before {
	content: ""
}
.ti-file-dots-filled:before {
	content: "𐅮"
}
.ti-file-download:before {
	content: ""
}
.ti-file-download-filled:before {
	content: "𐄪"
}
.ti-file-euro:before {
	content: ""
}
.ti-file-excel:before {
	content: "ﻳ"
}
.ti-file-export:before {
	content: ""
}
.ti-file-filled:before {
	content: ""
}
.ti-file-function:before {
	content: ""
}
.ti-file-function-filled:before {
	content: "𐅭"
}
.ti-file-horizontal:before {
	content: ""
}
.ti-file-horizontal-filled:before {
	content: "𐄜"
}
.ti-file-import:before {
	content: ""
}
.ti-file-infinity:before {
	content: ""
}
.ti-file-info:before {
	content: ""
}
.ti-file-info-filled:before {
	content: "𐅬"
}
.ti-file-invoice:before {
	content: ""
}
.ti-file-invoice-filled:before {
	content: "𐄛"
}
.ti-file-isr:before {
	content: "ﺬ"
}
.ti-file-lambda:before {
	content: ""
}
.ti-file-lambda-filled:before {
	content: "𐄩"
}
.ti-file-like:before {
	content: ""
}
.ti-file-minus:before {
	content: ""
}
.ti-file-minus-filled:before {
	content: "𐄚"
}
.ti-file-music:before {
	content: ""
}
.ti-file-neutral:before {
	content: "ﴢ"
}
.ti-file-neutral-filled:before {
	content: "𐄙"
}
.ti-file-off:before {
	content: ""
}
.ti-file-orientation:before {
	content: ""
}
.ti-file-pencil:before {
	content: ""
}
.ti-file-percent:before {
	content: ""
}
.ti-file-percent-filled:before {
	content: "𐄨"
}
.ti-file-phone:before {
	content: ""
}
.ti-file-phone-filled:before {
	content: "𐄧"
}
.ti-file-plus:before {
	content: ""
}
.ti-file-power:before {
	content: ""
}
.ti-file-power-filled:before {
	content: "𐄘"
}
.ti-file-report:before {
	content: ""
}
.ti-file-rss:before {
	content: ""
}
.ti-file-rss-filled:before {
	content: "𐄦"
}
.ti-file-sad:before {
	content: "ﴣ"
}
.ti-file-sad-filled:before {
	content: "𐄗"
}
.ti-file-scissors:before {
	content: ""
}
.ti-file-search:before {
	content: ""
}
.ti-file-settings:before {
	content: ""
}
.ti-file-shredder:before {
	content: ""
}
.ti-file-signal:before {
	content: ""
}
.ti-file-smile:before {
	content: "ﴤ"
}
.ti-file-smile-filled:before {
	content: "𐄖"
}
.ti-file-spark:before {
	content: "ﾹ"
}
.ti-file-spreadsheet:before {
	content: ""
}
.ti-file-stack:before {
	content: ""
}
.ti-file-star:before {
	content: ""
}
.ti-file-star-filled:before {
	content: "𐄕"
}
.ti-file-symlink:before {
	content: ""
}
.ti-file-text:before {
	content: ""
}
.ti-file-text-ai:before {
	content: "﨧"
}
.ti-file-text-filled:before {
	content: "𐄔"
}
.ti-file-text-shield:before {
	content: "𐃲"
}
.ti-file-text-spark:before {
	content: "ﾸ"
}
.ti-file-time:before {
	content: ""
}
.ti-file-type-bmp:before {
	content: "﬇"
}
.ti-file-type-css:before {
	content: "﬈"
}
.ti-file-type-csv:before {
	content: "﬉"
}
.ti-file-type-doc:before {
	content: "﬊"
}
.ti-file-type-docx:before {
	content: "﬋"
}
.ti-file-type-html:before {
	content: "﬌"
}
.ti-file-type-jpg:before {
	content: "﬍"
}
.ti-file-type-js:before {
	content: "﬎"
}
.ti-file-type-jsx:before {
	content: "﬏"
}
.ti-file-type-pdf:before {
	content: "﬐"
}
.ti-file-type-php:before {
	content: "﬑"
}
.ti-file-type-png:before {
	content: "﬒"
}
.ti-file-type-ppt:before {
	content: "ﬓ"
}
.ti-file-type-rs:before {
	content: "ﬔ"
}
.ti-file-type-sql:before {
	content: "ﬕ"
}
.ti-file-type-svg:before {
	content: "ﬖ"
}
.ti-file-type-ts:before {
	content: "ﬗ"
}
.ti-file-type-tsx:before {
	content: "﬘"
}
.ti-file-type-txt:before {
	content: "﬙"
}
.ti-file-type-vue:before {
	content: "﬚"
}
.ti-file-type-xls:before {
	content: "﬛"
}
.ti-file-type-xml:before {
	content: "﬜"
}
.ti-file-type-zip:before {
	content: "יִ"
}
.ti-file-typography:before {
	content: ""
}
.ti-file-typography-filled:before {
	content: "𐅫"
}
.ti-file-unknown:before {
	content: ""
}
.ti-file-upload:before {
	content: ""
}
.ti-file-vector:before {
	content: ""
}
.ti-file-word:before {
	content: "ﻲ"
}
.ti-file-x:before {
	content: ""
}
.ti-file-x-filled:before {
	content: ""
}
.ti-file-zip:before {
	content: ""
}
.ti-files:before {
	content: ""
}
.ti-files-off:before {
	content: ""
}
.ti-filter:before {
	content: ""
}
.ti-filter-2:before {
	content: "𐅋"
}
.ti-filter-2-bolt:before {
	content: "𐅟"
}
.ti-filter-2-cancel:before {
	content: "𐅞"
}
.ti-filter-2-check:before {
	content: "𐅝"
}
.ti-filter-2-code:before {
	content: "𐅜"
}
.ti-filter-2-cog:before {
	content: "𐅛"
}
.ti-filter-2-discount:before {
	content: "𐅚"
}
.ti-filter-2-dollar:before {
	content: "𐅙"
}
.ti-filter-2-down:before {
	content: "𐅘"
}
.ti-filter-2-edit:before {
	content: "𐅗"
}
.ti-filter-2-exclamation:before {
	content: "𐅖"
}
.ti-filter-2-minus:before {
	content: "𐅕"
}
.ti-filter-2-pause:before {
	content: "𐅔"
}
.ti-filter-2-pin:before {
	content: "𐅓"
}
.ti-filter-2-plus:before {
	content: "𐅒"
}
.ti-filter-2-question:before {
	content: "𐅑"
}
.ti-filter-2-search:before {
	content: "𐅐"
}
.ti-filter-2-share:before {
	content: "𐅏"
}
.ti-filter-2-spark:before {
	content: "𐅎"
}
.ti-filter-2-up:before {
	content: "𐅍"
}
.ti-filter-2-x:before {
	content: "𐅌"
}
.ti-filter-bolt:before {
	content: "ﭼ"
}
.ti-filter-cancel:before {
	content: "ﭽ"
}
.ti-filter-check:before {
	content: "ﭾ"
}
.ti-filter-code:before {
	content: "ﭿ"
}
.ti-filter-cog:before {
	content: "茶"
}
.ti-filter-discount:before {
	content: "ﮀ"
}
.ti-filter-dollar:before {
	content: "刺"
}
.ti-filter-down:before {
	content: "ﮁ"
}
.ti-filter-edit:before {
	content: "切"
}
.ti-filter-exclamation:before {
	content: "ﮂ"
}
.ti-filter-filled:before {
	content: "ﰧ"
}
.ti-filter-heart:before {
	content: "ﮃ"
}
.ti-filter-minus:before {
	content: "度"
}
.ti-filter-off:before {
	content: ""
}
.ti-filter-pause:before {
	content: "ﮄ"
}
.ti-filter-pin:before {
	content: "ﮅ"
}
.ti-filter-plus:before {
	content: "拓"
}
.ti-filter-question:before {
	content: "ﮆ"
}
.ti-filter-search:before {
	content: "ﮇ"
}
.ti-filter-share:before {
	content: "ﮈ"
}
.ti-filter-spark:before {
	content: "𐅊"
}
.ti-filter-star:before {
	content: "糖"
}
.ti-filter-up:before {
	content: "ﮉ"
}
.ti-filter-x:before {
	content: "宅"
}
.ti-filters:before {
	content: ""
}
.ti-filters-filled:before {
	content: "𐃇"
}
.ti-fingerprint:before {
	content: ""
}
.ti-fingerprint-off:before {
	content: ""
}
.ti-fingerprint-scan:before {
	content: "ﲵ"
}
.ti-fire-extinguisher:before {
	content: "﫶"
}
.ti-fire-hydrant:before {
	content: ""
}
.ti-fire-hydrant-off:before {
	content: ""
}
.ti-firetruck:before {
	content: ""
}
.ti-first-aid-kit:before {
	content: ""
}
.ti-first-aid-kit-off:before {
	content: ""
}
.ti-fish:before {
	content: ""
}
.ti-fish-bone:before {
	content: ""
}
.ti-fish-bone-filled:before {
	content: "𐄋"
}
.ti-fish-christianity:before {
	content: ""
}
.ti-fish-hook:before {
	content: ""
}
.ti-fish-hook-off:before {
	content: ""
}
.ti-fish-off:before {
	content: ""
}
.ti-flag:before {
	content: ""
}
.ti-flag-2:before {
	content: ""
}
.ti-flag-2-filled:before {
	content: ""
}
.ti-flag-2-off:before {
	content: ""
}
.ti-flag-3:before {
	content: ""
}
.ti-flag-3-filled:before {
	content: ""
}
.ti-flag-bitcoin:before {
	content: "＼"
}
.ti-flag-bolt:before {
	content: "ﮊ"
}
.ti-flag-cancel:before {
	content: "ﮋ"
}
.ti-flag-check:before {
	content: "ﮌ"
}
.ti-flag-code:before {
	content: "ﮍ"
}
.ti-flag-cog:before {
	content: "ﮎ"
}
.ti-flag-discount:before {
	content: "ﮏ"
}
.ti-flag-dollar:before {
	content: "ﮐ"
}
.ti-flag-down:before {
	content: "ﮑ"
}
.ti-flag-exclamation:before {
	content: "ﮒ"
}
.ti-flag-filled:before {
	content: ""
}
.ti-flag-heart:before {
	content: "ﮓ"
}
.ti-flag-minus:before {
	content: "ﮔ"
}
.ti-flag-off:before {
	content: ""
}
.ti-flag-pause:before {
	content: "ﮕ"
}
.ti-flag-pin:before {
	content: "ﮖ"
}
.ti-flag-plus:before {
	content: "ﮗ"
}
.ti-flag-question:before {
	content: "ﮘ"
}
.ti-flag-search:before {
	content: "ﮙ"
}
.ti-flag-share:before {
	content: "ﮚ"
}
.ti-flag-spark:before {
	content: "ﾷ"
}
.ti-flag-star:before {
	content: "ﮛ"
}
.ti-flag-up:before {
	content: "ﮜ"
}
.ti-flag-x:before {
	content: "ﮝ"
}
.ti-flame:before {
	content: ""
}
.ti-flame-filled:before {
	content: "𐃆"
}
.ti-flame-off:before {
	content: ""
}
.ti-flare:before {
	content: ""
}
.ti-flare-filled:before {
	content: "𐃅"
}
.ti-flask:before {
	content: ""
}
.ti-flask-2:before {
	content: ""
}
.ti-flask-2-filled:before {
	content: "ﴒ"
}
.ti-flask-2-off:before {
	content: ""
}
.ti-flask-filled:before {
	content: "ﴓ"
}
.ti-flask-off:before {
	content: ""
}
.ti-flip-flops:before {
	content: ""
}
.ti-flip-horizontal:before {
	content: ""
}
.ti-flip-vertical:before {
	content: ""
}
.ti-float-center:before {
	content: ""
}
.ti-float-left:before {
	content: ""
}
.ti-float-none:before {
	content: ""
}
.ti-float-right:before {
	content: ""
}
.ti-flower:before {
	content: ""
}
.ti-flower-filled:before {
	content: "𐀐"
}
.ti-flower-off:before {
	content: ""
}
.ti-focus:before {
	content: ""
}
.ti-focus-2:before {
	content: ""
}
.ti-focus-auto:before {
	content: "謁"
}
.ti-focus-centered:before {
	content: ""
}
.ti-fold:before {
	content: ""
}
.ti-fold-down:before {
	content: ""
}
.ti-fold-up:before {
	content: ""
}
.ti-folder:before {
	content: ""
}
.ti-folder-bolt:before {
	content: "奈"
}
.ti-folder-cancel:before {
	content: "懶"
}
.ti-folder-check:before {
	content: "癩"
}
.ti-folder-code:before {
	content: "羅"
}
.ti-folder-cog:before {
	content: "蘿"
}
.ti-folder-dollar:before {
	content: "螺"
}
.ti-folder-down:before {
	content: "裸"
}
.ti-folder-exclamation:before {
	content: "邏"
}
.ti-folder-filled:before {
	content: ""
}
.ti-folder-heart:before {
	content: "樂"
}
.ti-folder-minus:before {
	content: ""
}
.ti-folder-off:before {
	content: ""
}
.ti-folder-open:before {
	content: "﫷"
}
.ti-folder-pause:before {
	content: "洛"
}
.ti-folder-pin:before {
	content: "烙"
}
.ti-folder-plus:before {
	content: ""
}
.ti-folder-question:before {
	content: "珞"
}
.ti-folder-root:before {
	content: "﵃"
}
.ti-folder-search:before {
	content: "落"
}
.ti-folder-share:before {
	content: "酪"
}
.ti-folder-star:before {
	content: "駱"
}
.ti-folder-symlink:before {
	content: "亂"
}
.ti-folder-up:before {
	content: "卵"
}
.ti-folder-x:before {
	content: ""
}
.ti-folders:before {
	content: ""
}
.ti-folders-filled:before {
	content: "𐃄"
}
.ti-folders-off:before {
	content: ""
}
.ti-forbid:before {
	content: ""
}
.ti-forbid-2:before {
	content: ""
}
.ti-forbid-2-filled:before {
	content: "ﰨ"
}
.ti-forbid-filled:before {
	content: "ﰩ"
}
.ti-forklift:before {
	content: ""
}
.ti-forms:before {
	content: ""
}
.ti-fountain:before {
	content: ""
}
.ti-fountain-filled:before {
	content: "ﰪ"
}
.ti-fountain-off:before {
	content: ""
}
.ti-frame:before {
	content: ""
}
.ti-frame-off:before {
	content: ""
}
.ti-free-rights:before {
	content: ""
}
.ti-freeze-column:before {
	content: "謹"
}
.ti-freeze-row:before {
	content: "贈"
}
.ti-freeze-row-column:before {
	content: "賓"
}
.ti-fridge:before {
	content: ""
}
.ti-fridge-off:before {
	content: ""
}
.ti-friends:before {
	content: ""
}
.ti-friends-off:before {
	content: ""
}
.ti-frustum:before {
	content: "犯"
}
.ti-frustum-off:before {
	content: "瞧"
}
.ti-frustum-plus:before {
	content: "爵"
}
.ti-function:before {
	content: ""
}
.ti-function-filled:before {
	content: "ﰫ"
}
.ti-function-off:before {
	content: ""
}
.ti-galaxy:before {
	content: "ﲶ"
}
.ti-garden-cart:before {
	content: ""
}
.ti-garden-cart-filled:before {
	content: "𐃃"
}
.ti-garden-cart-off:before {
	content: ""
}
.ti-gas-station:before {
	content: ""
}
.ti-gas-station-filled:before {
	content: "𐃺"
}
.ti-gas-station-off:before {
	content: ""
}
.ti-gauge:before {
	content: ""
}
.ti-gauge-filled:before {
	content: "ﰬ"
}
.ti-gauge-off:before {
	content: ""
}
.ti-gavel:before {
	content: ""
}
.ti-gender-agender:before {
	content: ""
}
.ti-gender-androgyne:before {
	content: ""
}
.ti-gender-bigender:before {
	content: ""
}
.ti-gender-demiboy:before {
	content: ""
}
.ti-gender-demigirl:before {
	content: ""
}
.ti-gender-epicene:before {
	content: ""
}
.ti-gender-female:before {
	content: ""
}
.ti-gender-femme:before {
	content: ""
}
.ti-gender-genderfluid:before {
	content: ""
}
.ti-gender-genderless:before {
	content: ""
}
.ti-gender-genderqueer:before {
	content: ""
}
.ti-gender-hermaphrodite:before {
	content: ""
}
.ti-gender-intergender:before {
	content: ""
}
.ti-gender-male:before {
	content: ""
}
.ti-gender-neutrois:before {
	content: ""
}
.ti-gender-third:before {
	content: ""
}
.ti-gender-transgender:before {
	content: ""
}
.ti-gender-trasvesti:before {
	content: ""
}
.ti-geometry:before {
	content: ""
}
.ti-ghost:before {
	content: ""
}
.ti-ghost-2:before {
	content: ""
}
.ti-ghost-2-filled:before {
	content: ""
}
.ti-ghost-3:before {
	content: "ﰓ"
}
.ti-ghost-3-filled:before {
	content: "𐂤"
}
.ti-ghost-filled:before {
	content: ""
}
.ti-ghost-off:before {
	content: ""
}
.ti-gif:before {
	content: ""
}
.ti-gift:before {
	content: ""
}
.ti-gift-card:before {
	content: ""
}
.ti-gift-card-filled:before {
	content: "ﰭ"
}
.ti-gift-filled:before {
	content: "ﴔ"
}
.ti-gift-off:before {
	content: ""
}
.ti-git-branch:before {
	content: ""
}
.ti-git-branch-deleted:before {
	content: ""
}
.ti-git-cherry-pick:before {
	content: ""
}
.ti-git-commit:before {
	content: ""
}
.ti-git-compare:before {
	content: ""
}
.ti-git-fork:before {
	content: ""
}
.ti-git-merge:before {
	content: ""
}
.ti-git-pull-request:before {
	content: ""
}
.ti-git-pull-request-closed:before {
	content: ""
}
.ti-git-pull-request-draft:before {
	content: ""
}
.ti-gizmo:before {
	content: ""
}
.ti-glass:before {
	content: ""
}
.ti-glass-champagne:before {
	content: "ﶜ"
}
.ti-glass-cocktail:before {
	content: "ﶝ"
}
.ti-glass-filled:before {
	content: "𐀏"
}
.ti-glass-full:before {
	content: ""
}
.ti-glass-full-filled:before {
	content: "ﰮ"
}
.ti-glass-gin:before {
	content: "ﶞ"
}
.ti-glass-off:before {
	content: ""
}
.ti-globe:before {
	content: ""
}
.ti-globe-filled:before {
	content: "ﰯ"
}
.ti-globe-off:before {
	content: ""
}
.ti-go-game:before {
	content: ""
}
.ti-golf:before {
	content: ""
}
.ti-golf-filled:before {
	content: "𐂣"
}
.ti-golf-off:before {
	content: ""
}
.ti-gps:before {
	content: ""
}
.ti-gps-filled:before {
	content: "﹈"
}
.ti-gradienter:before {
	content: ""
}
.ti-grain:before {
	content: ""
}
.ti-graph:before {
	content: ""
}
.ti-graph-filled:before {
	content: "ﴕ"
}
.ti-graph-off:before {
	content: ""
}
.ti-grave:before {
	content: ""
}
.ti-grave-2:before {
	content: ""
}
.ti-grid-3x3:before {
	content: "ﲤ"
}
.ti-grid-4x4:before {
	content: "ﲥ"
}
.ti-grid-dots:before {
	content: ""
}
.ti-grid-goldenratio:before {
	content: "ﲦ"
}
.ti-grid-pattern:before {
	content: ""
}
.ti-grid-pattern-filled:before {
	content: "𐃂"
}
.ti-grid-scan:before {
	content: "ﲧ"
}
.ti-grill:before {
	content: ""
}
.ti-grill-fork:before {
	content: ""
}
.ti-grill-off:before {
	content: ""
}
.ti-grill-spatula:before {
	content: ""
}
.ti-grip-horizontal:before {
	content: ""
}
.ti-grip-vertical:before {
	content: ""
}
.ti-growth:before {
	content: ""
}
.ti-guitar-pick:before {
	content: ""
}
.ti-guitar-pick-filled:before {
	content: ""
}
.ti-gymnastics:before {
	content: "﵄"
}
.ti-h-1:before {
	content: ""
}
.ti-h-2:before {
	content: ""
}
.ti-h-3:before {
	content: ""
}
.ti-h-4:before {
	content: ""
}
.ti-h-5:before {
	content: ""
}
.ti-h-6:before {
	content: ""
}
.ti-hammer:before {
	content: ""
}
.ti-hammer-off:before {
	content: ""
}
.ti-hand-click:before {
	content: ""
}
.ti-hand-click-off:before {
	content: "𐃱"
}
.ti-hand-finger:before {
	content: ""
}
.ti-hand-finger-down:before {
	content: "ｏ"
}
.ti-hand-finger-left:before {
	content: "ｎ"
}
.ti-hand-finger-off:before {
	content: ""
}
.ti-hand-finger-right:before {
	content: "ｍ"
}
.ti-hand-grab:before {
	content: ""
}
.ti-hand-little-finger:before {
	content: ""
}
.ti-hand-love-you:before {
	content: ""
}
.ti-hand-middle-finger:before {
	content: ""
}
.ti-hand-move:before {
	content: ""
}
.ti-hand-off:before {
	content: ""
}
.ti-hand-ring-finger:before {
	content: ""
}
.ti-hand-sanitizer:before {
	content: ""
}
.ti-hand-stop:before {
	content: ""
}
.ti-hand-three-fingers:before {
	content: ""
}
.ti-hand-two-fingers:before {
	content: ""
}
.ti-hanger:before {
	content: ""
}
.ti-hanger-2:before {
	content: ""
}
.ti-hanger-2-filled:before {
	content: "｡"
}
.ti-hanger-off:before {
	content: ""
}
.ti-hash:before {
	content: ""
}
.ti-haze:before {
	content: ""
}
.ti-haze-moon:before {
	content: "﫸"
}
.ti-hdr:before {
	content: "嗢"
}
.ti-heading:before {
	content: ""
}
.ti-heading-off:before {
	content: ""
}
.ti-headphones:before {
	content: ""
}
.ti-headphones-filled:before {
	content: "屮"
}
.ti-headphones-off:before {
	content: ""
}
.ti-headset:before {
	content: ""
}
.ti-headset-off:before {
	content: ""
}
.ti-health-recognition:before {
	content: ""
}
.ti-heart:before {
	content: ""
}
.ti-heart-bitcoin:before {
	content: "［"
}
.ti-heart-bolt:before {
	content: "ﮞ"
}
.ti-heart-broken:before {
	content: ""
}
.ti-heart-broken-filled:before {
	content: "𐅪"
}
.ti-heart-cancel:before {
	content: "ﮟ"
}
.ti-heart-check:before {
	content: "ﮠ"
}
.ti-heart-code:before {
	content: "ﮡ"
}
.ti-heart-cog:before {
	content: "ﮢ"
}
.ti-heart-discount:before {
	content: "ﮣ"
}
.ti-heart-dollar:before {
	content: "ﮤ"
}
.ti-heart-down:before {
	content: "ﮥ"
}
.ti-heart-exclamation:before {
	content: "ﮦ"
}
.ti-heart-filled:before {
	content: ""
}
.ti-heart-handshake:before {
	content: ""
}
.ti-heart-minus:before {
	content: ""
}
.ti-heart-off:before {
	content: ""
}
.ti-heart-pause:before {
	content: "ﮧ"
}
.ti-heart-pin:before {
	content: "ﮨ"
}
.ti-heart-plus:before {
	content: ""
}
.ti-heart-question:before {
	content: "ﮩ"
}
.ti-heart-rate-monitor:before {
	content: ""
}
.ti-heart-search:before {
	content: "ﮪ"
}
.ti-heart-share:before {
	content: "ﮫ"
}
.ti-heart-spark:before {
	content: "ﾶ"
}
.ti-heart-star:before {
	content: "ﮬ"
}
.ti-heart-up:before {
	content: "ﮭ"
}
.ti-heart-x:before {
	content: "ﮮ"
}
.ti-heartbeat:before {
	content: ""
}
.ti-hearts:before {
	content: ""
}
.ti-hearts-off:before {
	content: ""
}
.ti-helicopter:before {
	content: ""
}
.ti-helicopter-filled:before {
	content: "𐃹"
}
.ti-helicopter-landing:before {
	content: ""
}
.ti-helicopter-landing-filled:before {
	content: "𐃁"
}
.ti-helmet:before {
	content: ""
}
.ti-helmet-off:before {
	content: ""
}
.ti-help:before {
	content: ""
}
.ti-help-circle:before {
	content: "欄"
}
.ti-help-circle-filled:before {
	content: "悔"
}
.ti-help-hexagon:before {
	content: ""
}
.ti-help-hexagon-filled:before {
	content: "慨"
}
.ti-help-octagon:before {
	content: ""
}
.ti-help-octagon-filled:before {
	content: "憎"
}
.ti-help-off:before {
	content: ""
}
.ti-help-small:before {
	content: "爛"
}
.ti-help-square:before {
	content: "鸞"
}
.ti-help-square-filled:before {
	content: "懲"
}
.ti-help-square-rounded:before {
	content: "蘭"
}
.ti-help-square-rounded-filled:before {
	content: "敏"
}
.ti-help-triangle:before {
	content: "嵐"
}
.ti-help-triangle-filled:before {
	content: "既"
}
.ti-hemisphere:before {
	content: "甆"
}
.ti-hemisphere-off:before {
	content: "猪"
}
.ti-hemisphere-plus:before {
	content: "瑱"
}
.ti-hexagon:before {
	content: ""
}
.ti-hexagon-3d:before {
	content: ""
}
.ti-hexagon-filled:before {
	content: ""
}
.ti-hexagon-letter-a:before {
	content: ""
}
.ti-hexagon-letter-a-filled:before {
	content: "﹇"
}
.ti-hexagon-letter-b:before {
	content: ""
}
.ti-hexagon-letter-b-filled:before {
	content: "﹆"
}
.ti-hexagon-letter-c:before {
	content: ""
}
.ti-hexagon-letter-c-filled:before {
	content: "﹅"
}
.ti-hexagon-letter-d:before {
	content: ""
}
.ti-hexagon-letter-d-filled:before {
	content: "﹄"
}
.ti-hexagon-letter-e:before {
	content: ""
}
.ti-hexagon-letter-e-filled:before {
	content: "﹃"
}
.ti-hexagon-letter-f:before {
	content: ""
}
.ti-hexagon-letter-f-filled:before {
	content: "﹂"
}
.ti-hexagon-letter-g:before {
	content: ""
}
.ti-hexagon-letter-g-filled:before {
	content: "﹁"
}
.ti-hexagon-letter-h:before {
	content: ""
}
.ti-hexagon-letter-h-filled:before {
	content: "﹀"
}
.ti-hexagon-letter-i:before {
	content: ""
}
.ti-hexagon-letter-i-filled:before {
	content: "︿"
}
.ti-hexagon-letter-j:before {
	content: ""
}
.ti-hexagon-letter-j-filled:before {
	content: "︾"
}
.ti-hexagon-letter-k:before {
	content: ""
}
.ti-hexagon-letter-k-filled:before {
	content: "︽"
}
.ti-hexagon-letter-l:before {
	content: ""
}
.ti-hexagon-letter-l-filled:before {
	content: "︼"
}
.ti-hexagon-letter-m:before {
	content: ""
}
.ti-hexagon-letter-m-filled:before {
	content: "︻"
}
.ti-hexagon-letter-n:before {
	content: ""
}
.ti-hexagon-letter-n-filled:before {
	content: "︺"
}
.ti-hexagon-letter-o:before {
	content: ""
}
.ti-hexagon-letter-o-filled:before {
	content: "︹"
}
.ti-hexagon-letter-p:before {
	content: ""
}
.ti-hexagon-letter-p-filled:before {
	content: "︸"
}
.ti-hexagon-letter-q:before {
	content: ""
}
.ti-hexagon-letter-q-filled:before {
	content: "︷"
}
.ti-hexagon-letter-r:before {
	content: ""
}
.ti-hexagon-letter-r-filled:before {
	content: "︶"
}
.ti-hexagon-letter-s:before {
	content: ""
}
.ti-hexagon-letter-s-filled:before {
	content: "︵"
}
.ti-hexagon-letter-t:before {
	content: ""
}
.ti-hexagon-letter-t-filled:before {
	content: "︴"
}
.ti-hexagon-letter-u:before {
	content: ""
}
.ti-hexagon-letter-u-filled:before {
	content: "︳"
}
.ti-hexagon-letter-v:before {
	content: ""
}
.ti-hexagon-letter-v-filled:before {
	content: "︲"
}
.ti-hexagon-letter-w:before {
	content: ""
}
.ti-hexagon-letter-w-filled:before {
	content: "︱"
}
.ti-hexagon-letter-x:before {
	content: ""
}
.ti-hexagon-letter-x-filled:before {
	content: "︰"
}
.ti-hexagon-letter-y:before {
	content: ""
}
.ti-hexagon-letter-y-filled:before {
	content: "︯"
}
.ti-hexagon-letter-z:before {
	content: ""
}
.ti-hexagon-letter-z-filled:before {
	content: "︮"
}
.ti-hexagon-minus:before {
	content: "ﲏ"
}
.ti-hexagon-minus-2:before {
	content: "ﲎ"
}
.ti-hexagon-minus-filled:before {
	content: "︭"
}
.ti-hexagon-number-0:before {
	content: ""
}
.ti-hexagon-number-0-filled:before {
	content: ""
}
.ti-hexagon-number-1:before {
	content: ""
}
.ti-hexagon-number-1-filled:before {
	content: ""
}
.ti-hexagon-number-2:before {
	content: ""
}
.ti-hexagon-number-2-filled:before {
	content: ""
}
.ti-hexagon-number-3:before {
	content: ""
}
.ti-hexagon-number-3-filled:before {
	content: ""
}
.ti-hexagon-number-4:before {
	content: ""
}
.ti-hexagon-number-4-filled:before {
	content: ""
}
.ti-hexagon-number-5:before {
	content: ""
}
.ti-hexagon-number-5-filled:before {
	content: ""
}
.ti-hexagon-number-6:before {
	content: ""
}
.ti-hexagon-number-6-filled:before {
	content: ""
}
.ti-hexagon-number-7:before {
	content: ""
}
.ti-hexagon-number-7-filled:before {
	content: ""
}
.ti-hexagon-number-8:before {
	content: ""
}
.ti-hexagon-number-8-filled:before {
	content: ""
}
.ti-hexagon-number-9:before {
	content: ""
}
.ti-hexagon-number-9-filled:before {
	content: ""
}
.ti-hexagon-off:before {
	content: ""
}
.ti-hexagon-plus:before {
	content: "ﱅ"
}
.ti-hexagon-plus-2:before {
	content: "ﲐ"
}
.ti-hexagon-plus-filled:before {
	content: "︬"
}
.ti-hexagonal-prism:before {
	content: "瘟"
}
.ti-hexagonal-prism-off:before {
	content: "画"
}
.ti-hexagonal-prism-plus:before {
	content: "瘝"
}
.ti-hexagonal-pyramid:before {
	content: "直"
}
.ti-hexagonal-pyramid-off:before {
	content: "益"
}
.ti-hexagonal-pyramid-plus:before {
	content: "盛"
}
.ti-hexagons:before {
	content: ""
}
.ti-hexagons-off:before {
	content: ""
}
.ti-hierarchy:before {
	content: ""
}
.ti-hierarchy-2:before {
	content: ""
}
.ti-hierarchy-3:before {
	content: ""
}
.ti-hierarchy-off:before {
	content: ""
}
.ti-highlight:before {
	content: ""
}
.ti-highlight-off:before {
	content: ""
}
.ti-history:before {
	content: ""
}
.ti-history-off:before {
	content: ""
}
.ti-history-toggle:before {
	content: ""
}
.ti-home:before {
	content: ""
}
.ti-home-2:before {
	content: ""
}
.ti-home-bitcoin:before {
	content: "Ｚ"
}
.ti-home-bolt:before {
	content: ""
}
.ti-home-cancel:before {
	content: ""
}
.ti-home-check:before {
	content: ""
}
.ti-home-cog:before {
	content: ""
}
.ti-home-dollar:before {
	content: ""
}
.ti-home-dot:before {
	content: ""
}
.ti-home-down:before {
	content: ""
}
.ti-home-eco:before {
	content: ""
}
.ti-home-edit:before {
	content: ""
}
.ti-home-exclamation:before {
	content: ""
}
.ti-home-filled:before {
	content: "︫"
}
.ti-home-hand:before {
	content: ""
}
.ti-home-heart:before {
	content: ""
}
.ti-home-infinity:before {
	content: ""
}
.ti-home-link:before {
	content: ""
}
.ti-home-minus:before {
	content: ""
}
.ti-home-move:before {
	content: ""
}
.ti-home-off:before {
	content: ""
}
.ti-home-plus:before {
	content: ""
}
.ti-home-question:before {
	content: ""
}
.ti-home-ribbon:before {
	content: ""
}
.ti-home-search:before {
	content: ""
}
.ti-home-share:before {
	content: ""
}
.ti-home-shield:before {
	content: ""
}
.ti-home-signal:before {
	content: ""
}
.ti-home-spark:before {
	content: "ﾵ"
}
.ti-home-star:before {
	content: ""
}
.ti-home-stats:before {
	content: ""
}
.ti-home-up:before {
	content: ""
}
.ti-home-x:before {
	content: ""
}
.ti-horse:before {
	content: "ﱆ"
}
.ti-horse-toy:before {
	content: ""
}
.ti-horseshoe:before {
	content: "ﲷ"
}
.ti-hospital:before {
	content: "ﵙ"
}
.ti-hospital-circle:before {
	content: "ﵘ"
}
.ti-hospital-circle-filled:before {
	content: "ﻒ"
}
.ti-hotel-service:before {
	content: ""
}
.ti-hourglass:before {
	content: ""
}
.ti-hourglass-empty:before {
	content: ""
}
.ti-hourglass-filled:before {
	content: ""
}
.ti-hourglass-high:before {
	content: ""
}
.ti-hourglass-low:before {
	content: ""
}
.ti-hourglass-off:before {
	content: ""
}
.ti-hours-12:before {
	content: "ﱓ"
}
.ti-hours-24:before {
	content: ""
}
.ti-html:before {
	content: ""
}
.ti-http-connect:before {
	content: "﨨"
}
.ti-http-connect-off:before {
	content: "𐃧"
}
.ti-http-delete:before {
	content: "﨩"
}
.ti-http-delete-off:before {
	content: "𐃦"
}
.ti-http-get:before {
	content: "飯"
}
.ti-http-get-off:before {
	content: "𐃥"
}
.ti-http-head:before {
	content: "飼"
}
.ti-http-head-off:before {
	content: "𐃤"
}
.ti-http-options:before {
	content: "館"
}
.ti-http-options-off:before {
	content: "𐃣"
}
.ti-http-patch:before {
	content: "鶴"
}
.ti-http-patch-off:before {
	content: "𐃢"
}
.ti-http-post:before {
	content: "郞"
}
.ti-http-post-off:before {
	content: "𐃡"
}
.ti-http-put:before {
	content: "隷"
}
.ti-http-put-off:before {
	content: "𐃠"
}
.ti-http-que:before {
	content: "者"
}
.ti-http-que-off:before {
	content: "𐃟"
}
.ti-http-trace:before {
	content: "侮"
}
.ti-http-trace-off:before {
	content: "𐃞"
}
.ti-ice-cream:before {
	content: ""
}
.ti-ice-cream-2:before {
	content: ""
}
.ti-ice-cream-off:before {
	content: ""
}
.ti-ice-skating:before {
	content: ""
}
.ti-icons:before {
	content: ""
}
.ti-icons-filled:before {
	content: "𐁰"
}
.ti-icons-off:before {
	content: ""
}
.ti-id:before {
	content: ""
}
.ti-id-badge:before {
	content: ""
}
.ti-id-badge-2:before {
	content: ""
}
.ti-id-badge-off:before {
	content: ""
}
.ti-id-off:before {
	content: ""
}
.ti-ikosaedr:before {
	content: "ﻆ"
}
.ti-image-in-picture:before {
	content: "ﶟ"
}
.ti-inbox:before {
	content: ""
}
.ti-inbox-off:before {
	content: ""
}
.ti-indent-decrease:before {
	content: ""
}
.ti-indent-increase:before {
	content: ""
}
.ti-infinity:before {
	content: ""
}
.ti-infinity-off:before {
	content: ""
}
.ti-info-circle:before {
	content: ""
}
.ti-info-circle-filled:before {
	content: ""
}
.ti-info-hexagon:before {
	content: ""
}
.ti-info-hexagon-filled:before {
	content: "暑"
}
.ti-info-octagon:before {
	content: ""
}
.ti-info-octagon-filled:before {
	content: "梅"
}
.ti-info-small:before {
	content: "濫"
}
.ti-info-square:before {
	content: ""
}
.ti-info-square-filled:before {
	content: "海"
}
.ti-info-square-rounded:before {
	content: ""
}
.ti-info-square-rounded-filled:before {
	content: ""
}
.ti-info-triangle:before {
	content: "藍"
}
.ti-info-triangle-filled:before {
	content: "渚"
}
.ti-inner-shadow-bottom:before {
	content: ""
}
.ti-inner-shadow-bottom-filled:before {
	content: ""
}
.ti-inner-shadow-bottom-left:before {
	content: ""
}
.ti-inner-shadow-bottom-left-filled:before {
	content: ""
}
.ti-inner-shadow-bottom-right:before {
	content: ""
}
.ti-inner-shadow-bottom-right-filled:before {
	content: ""
}
.ti-inner-shadow-left:before {
	content: ""
}
.ti-inner-shadow-left-filled:before {
	content: ""
}
.ti-inner-shadow-right:before {
	content: ""
}
.ti-inner-shadow-right-filled:before {
	content: ""
}
.ti-inner-shadow-top:before {
	content: ""
}
.ti-inner-shadow-top-filled:before {
	content: ""
}
.ti-inner-shadow-top-left:before {
	content: ""
}
.ti-inner-shadow-top-left-filled:before {
	content: ""
}
.ti-inner-shadow-top-right:before {
	content: ""
}
.ti-inner-shadow-top-right-filled:before {
	content: ""
}
.ti-input-ai:before {
	content: "ﱚ"
}
.ti-input-check:before {
	content: "ﱛ"
}
.ti-input-search:before {
	content: ""
}
.ti-input-spark:before {
	content: "ﾴ"
}
.ti-input-x:before {
	content: "ﱜ"
}
.ti-invoice:before {
	content: "ﺫ"
}
.ti-ironing:before {
	content: "塚"
}
.ti-ironing-1:before {
	content: ""
}
.ti-ironing-1-filled:before {
	content: "𐁯"
}
.ti-ironing-2:before {
	content: ""
}
.ti-ironing-2-filled:before {
	content: "𐁮"
}
.ti-ironing-3:before {
	content: ""
}
.ti-ironing-3-filled:before {
	content: "𐁭"
}
.ti-ironing-filled:before {
	content: "︪"
}
.ti-ironing-off:before {
	content: ""
}
.ti-ironing-steam:before {
	content: ""
}
.ti-ironing-steam-filled:before {
	content: "𐁬"
}
.ti-ironing-steam-off:before {
	content: ""
}
.ti-irregular-polyhedron:before {
	content: "磌"
}
.ti-irregular-polyhedron-off:before {
	content: "睊"
}
.ti-irregular-polyhedron-plus:before {
	content: "着"
}
.ti-italic:before {
	content: ""
}
.ti-jacket:before {
	content: ""
}
.ti-jetpack:before {
	content: ""
}
.ti-jetpack-filled:before {
	content: "︩"
}
.ti-jewish-star:before {
	content: ""
}
.ti-jewish-star-filled:before {
	content: ""
}
.ti-join-bevel:before {
	content: "ｌ"
}
.ti-join-round:before {
	content: "ｋ"
}
.ti-join-straight:before {
	content: "ｊ"
}
.ti-joker:before {
	content: "𐁟"
}
.ti-jpg:before {
	content: ""
}
.ti-json:before {
	content: ""
}
.ti-jump-rope:before {
	content: ""
}
.ti-karate:before {
	content: ""
}
.ti-kayak:before {
	content: ""
}
.ti-kerning:before {
	content: ""
}
.ti-key:before {
	content: ""
}
.ti-key-filled:before {
	content: "︨"
}
.ti-key-off:before {
	content: ""
}
.ti-keyboard:before {
	content: ""
}
.ti-keyboard-filled:before {
	content: "𐂢"
}
.ti-keyboard-hide:before {
	content: ""
}
.ti-keyboard-off:before {
	content: ""
}
.ti-keyboard-show:before {
	content: ""
}
.ti-keyframe:before {
	content: ""
}
.ti-keyframe-align-center:before {
	content: ""
}
.ti-keyframe-align-center-filled:before {
	content: "ﰰ"
}
.ti-keyframe-align-horizontal:before {
	content: ""
}
.ti-keyframe-align-horizontal-filled:before {
	content: "ﰱ"
}
.ti-keyframe-align-vertical:before {
	content: ""
}
.ti-keyframe-align-vertical-filled:before {
	content: "ﰲ"
}
.ti-keyframe-filled:before {
	content: "ﰳ"
}
.ti-keyframes:before {
	content: ""
}
.ti-keyframes-filled:before {
	content: "ﰴ"
}
.ti-label:before {
	content: "Ｘ"
}
.ti-label-filled:before {
	content: "ａ"
}
.ti-label-important:before {
	content: "ｉ"
}
.ti-label-important-filled:before {
	content: "｠"
}
.ti-label-off:before {
	content: "Ｙ"
}
.ti-ladder:before {
	content: ""
}
.ti-ladder-off:before {
	content: ""
}
.ti-ladle:before {
	content: "ﰔ"
}
.ti-lambda:before {
	content: ""
}
.ti-lamp:before {
	content: ""
}
.ti-lamp-2:before {
	content: ""
}
.ti-lamp-off:before {
	content: ""
}
.ti-lane:before {
	content: "﫹"
}
.ti-language:before {
	content: ""
}
.ti-language-hiragana:before {
	content: ""
}
.ti-language-katakana:before {
	content: ""
}
.ti-language-off:before {
	content: ""
}
.ti-lasso:before {
	content: ""
}
.ti-lasso-off:before {
	content: ""
}
.ti-lasso-polygon:before {
	content: ""
}
.ti-lasso-polygon-filled:before {
	content: "｟"
}
.ti-laurel-wreath:before {
	content: "ｅ"
}
.ti-laurel-wreath-1:before {
	content: "ｈ"
}
.ti-laurel-wreath-1-filled:before {
	content: "𐅩"
}
.ti-laurel-wreath-2:before {
	content: "ｇ"
}
.ti-laurel-wreath-2-filled:before {
	content: "𐅨"
}
.ti-laurel-wreath-3:before {
	content: "ｆ"
}
.ti-laurel-wreath-3-filled:before {
	content: "𐅧"
}
.ti-laurel-wreath-filled:before {
	content: "𐃀"
}
.ti-layers-difference:before {
	content: ""
}
.ti-layers-intersect:before {
	content: ""
}
.ti-layers-intersect-2:before {
	content: ""
}
.ti-layers-linked:before {
	content: ""
}
.ti-layers-off:before {
	content: ""
}
.ti-layers-selected:before {
	content: "ﺩ"
}
.ti-layers-selected-bottom:before {
	content: "ﺪ"
}
.ti-layers-subtract:before {
	content: ""
}
.ti-layers-union:before {
	content: ""
}
.ti-layout:before {
	content: ""
}
.ti-layout-2:before {
	content: ""
}
.ti-layout-2-filled:before {
	content: "︧"
}
.ti-layout-align-bottom:before {
	content: ""
}
.ti-layout-align-bottom-filled:before {
	content: "︦"
}
.ti-layout-align-center:before {
	content: ""
}
.ti-layout-align-center-filled:before {
	content: "︥"
}
.ti-layout-align-left:before {
	content: ""
}
.ti-layout-align-left-filled:before {
	content: "︤"
}
.ti-layout-align-middle:before {
	content: ""
}
.ti-layout-align-middle-filled:before {
	content: "︣"
}
.ti-layout-align-right:before {
	content: ""
}
.ti-layout-align-right-filled:before {
	content: "︢"
}
.ti-layout-align-top:before {
	content: ""
}
.ti-layout-align-top-filled:before {
	content: "︡"
}
.ti-layout-board:before {
	content: ""
}
.ti-layout-board-filled:before {
	content: "𐆂"
}
.ti-layout-board-split:before {
	content: ""
}
.ti-layout-board-split-filled:before {
	content: "𐆃"
}
.ti-layout-bottombar:before {
	content: ""
}
.ti-layout-bottombar-collapse:before {
	content: ""
}
.ti-layout-bottombar-collapse-filled:before {
	content: "ﰵ"
}
.ti-layout-bottombar-expand:before {
	content: ""
}
.ti-layout-bottombar-expand-filled:before {
	content: "ﰶ"
}
.ti-layout-bottombar-filled:before {
	content: "ﰷ"
}
.ti-layout-bottombar-inactive:before {
	content: "﵅"
}
.ti-layout-cards:before {
	content: ""
}
.ti-layout-cards-filled:before {
	content: "︠"
}
.ti-layout-collage:before {
	content: ""
}
.ti-layout-columns:before {
	content: ""
}
.ti-layout-dashboard:before {
	content: ""
}
.ti-layout-dashboard-filled:before {
	content: "︟"
}
.ti-layout-distribute-horizontal:before {
	content: ""
}
.ti-layout-distribute-horizontal-filled:before {
	content: "︞"
}
.ti-layout-distribute-vertical:before {
	content: ""
}
.ti-layout-distribute-vertical-filled:before {
	content: "︝"
}
.ti-layout-filled:before {
	content: "︗"
}
.ti-layout-grid:before {
	content: ""
}
.ti-layout-grid-add:before {
	content: ""
}
.ti-layout-grid-filled:before {
	content: "︜"
}
.ti-layout-grid-remove:before {
	content: "墳"
}
.ti-layout-kanban:before {
	content: ""
}
.ti-layout-kanban-filled:before {
	content: "︛"
}
.ti-layout-list:before {
	content: ""
}
.ti-layout-list-filled:before {
	content: "︚"
}
.ti-layout-navbar:before {
	content: ""
}
.ti-layout-navbar-collapse:before {
	content: ""
}
.ti-layout-navbar-collapse-filled:before {
	content: "ﰸ"
}
.ti-layout-navbar-expand:before {
	content: ""
}
.ti-layout-navbar-expand-filled:before {
	content: "ﰹ"
}
.ti-layout-navbar-filled:before {
	content: "ﰺ"
}
.ti-layout-navbar-inactive:before {
	content: "﵆"
}
.ti-layout-off:before {
	content: ""
}
.ti-layout-rows:before {
	content: ""
}
.ti-layout-sidebar:before {
	content: ""
}
.ti-layout-sidebar-filled:before {
	content: "︘"
}
.ti-layout-sidebar-inactive:before {
	content: "﵇"
}
.ti-layout-sidebar-left-collapse:before {
	content: ""
}
.ti-layout-sidebar-left-collapse-filled:before {
	content: "ﰻ"
}
.ti-layout-sidebar-left-expand:before {
	content: ""
}
.ti-layout-sidebar-left-expand-filled:before {
	content: "ﰼ"
}
.ti-layout-sidebar-right:before {
	content: ""
}
.ti-layout-sidebar-right-collapse:before {
	content: ""
}
.ti-layout-sidebar-right-collapse-filled:before {
	content: "ﰽ"
}
.ti-layout-sidebar-right-expand:before {
	content: ""
}
.ti-layout-sidebar-right-expand-filled:before {
	content: "ﰾ"
}
.ti-layout-sidebar-right-filled:before {
	content: "︙"
}
.ti-layout-sidebar-right-inactive:before {
	content: "﵈"
}
.ti-leaf:before {
	content: ""
}
.ti-leaf-2:before {
	content: "ｄ"
}
.ti-leaf-off:before {
	content: ""
}
.ti-lego:before {
	content: ""
}
.ti-lego-filled:before {
	content: "︖"
}
.ti-lego-off:before {
	content: ""
}
.ti-lemon:before {
	content: ""
}
.ti-lemon-2:before {
	content: ""
}
.ti-lemon-2-filled:before {
	content: "𐂿"
}
.ti-letter-a:before {
	content: ""
}
.ti-letter-a-small:before {
	content: "ﳇ"
}
.ti-letter-b:before {
	content: ""
}
.ti-letter-b-small:before {
	content: "ﳈ"
}
.ti-letter-c:before {
	content: ""
}
.ti-letter-c-small:before {
	content: "ﳉ"
}
.ti-letter-case:before {
	content: ""
}
.ti-letter-case-lower:before {
	content: ""
}
.ti-letter-case-toggle:before {
	content: ""
}
.ti-letter-case-upper:before {
	content: ""
}
.ti-letter-d:before {
	content: ""
}
.ti-letter-d-small:before {
	content: "ﳊ"
}
.ti-letter-e:before {
	content: ""
}
.ti-letter-e-small:before {
	content: "ﳋ"
}
.ti-letter-f:before {
	content: ""
}
.ti-letter-f-small:before {
	content: "ﳌ"
}
.ti-letter-g:before {
	content: ""
}
.ti-letter-g-small:before {
	content: "ﳍ"
}
.ti-letter-h:before {
	content: ""
}
.ti-letter-h-small:before {
	content: "ﳎ"
}
.ti-letter-i:before {
	content: ""
}
.ti-letter-i-small:before {
	content: "ﳏ"
}
.ti-letter-j:before {
	content: ""
}
.ti-letter-j-small:before {
	content: "ﳐ"
}
.ti-letter-k:before {
	content: ""
}
.ti-letter-k-small:before {
	content: "ﳑ"
}
.ti-letter-l:before {
	content: ""
}
.ti-letter-l-small:before {
	content: "ﳒ"
}
.ti-letter-m:before {
	content: ""
}
.ti-letter-m-small:before {
	content: "ﳓ"
}
.ti-letter-n:before {
	content: ""
}
.ti-letter-n-small:before {
	content: "ﳔ"
}
.ti-letter-o:before {
	content: ""
}
.ti-letter-o-small:before {
	content: "ﳕ"
}
.ti-letter-p:before {
	content: ""
}
.ti-letter-p-small:before {
	content: "ﳖ"
}
.ti-letter-q:before {
	content: ""
}
.ti-letter-q-small:before {
	content: "ﳗ"
}
.ti-letter-r:before {
	content: ""
}
.ti-letter-r-small:before {
	content: "ﳘ"
}
.ti-letter-s:before {
	content: ""
}
.ti-letter-s-small:before {
	content: "ﳙ"
}
.ti-letter-spacing:before {
	content: ""
}
.ti-letter-t:before {
	content: ""
}
.ti-letter-t-small:before {
	content: "ﳚ"
}
.ti-letter-u:before {
	content: ""
}
.ti-letter-u-small:before {
	content: "ﳛ"
}
.ti-letter-v:before {
	content: ""
}
.ti-letter-v-small:before {
	content: "ﳜ"
}
.ti-letter-w:before {
	content: ""
}
.ti-letter-w-small:before {
	content: "ﳝ"
}
.ti-letter-x:before {
	content: ""
}
.ti-letter-x-small:before {
	content: "ﳞ"
}
.ti-letter-y:before {
	content: ""
}
.ti-letter-y-small:before {
	content: "ﳟ"
}
.ti-letter-z:before {
	content: ""
}
.ti-letter-z-small:before {
	content: "ﳠ"
}
.ti-library:before {
	content: "﵌"
}
.ti-library-filled:before {
	content: "𐆀"
}
.ti-library-minus:before {
	content: "﵉"
}
.ti-library-photo:before {
	content: "﵊"
}
.ti-library-plus:before {
	content: "﵋"
}
.ti-library-plus-filled:before {
	content: "𐆁"
}
.ti-license:before {
	content: ""
}
.ti-license-off:before {
	content: ""
}
.ti-lifebuoy:before {
	content: ""
}
.ti-lifebuoy-filled:before {
	content: "𐂾"
}
.ti-lifebuoy-off:before {
	content: ""
}
.ti-lighter:before {
	content: ""
}
.ti-line:before {
	content: ""
}
.ti-line-dashed:before {
	content: ""
}
.ti-line-dotted:before {
	content: ""
}
.ti-line-height:before {
	content: ""
}
.ti-line-scan:before {
	content: "ﲸ"
}
.ti-link:before {
	content: ""
}
.ti-link-minus:before {
	content: "ﴖ"
}
.ti-link-off:before {
	content: ""
}
.ti-link-plus:before {
	content: "ﴗ"
}
.ti-list:before {
	content: ""
}
.ti-list-check:before {
	content: ""
}
.ti-list-details:before {
	content: ""
}
.ti-list-letters:before {
	content: "ﱇ"
}
.ti-list-numbers:before {
	content: ""
}
.ti-list-search:before {
	content: ""
}
.ti-list-tree:before {
	content: "﫺"
}
.ti-live-photo:before {
	content: ""
}
.ti-live-photo-filled:before {
	content: "ﻑ"
}
.ti-live-photo-off:before {
	content: ""
}
.ti-live-view:before {
	content: ""
}
.ti-live-view-filled:before {
	content: "𐂡"
}
.ti-load-balancer:before {
	content: "臭"
}
.ti-loader:before {
	content: ""
}
.ti-loader-2:before {
	content: ""
}
.ti-loader-3:before {
	content: ""
}
.ti-loader-quarter:before {
	content: ""
}
.ti-location:before {
	content: ""
}
.ti-location-bolt:before {
	content: "ﮯ"
}
.ti-location-broken:before {
	content: ""
}
.ti-location-cancel:before {
	content: "ﮰ"
}
.ti-location-check:before {
	content: "ﮱ"
}
.ti-location-code:before {
	content: "﮲"
}
.ti-location-cog:before {
	content: "﮳"
}
.ti-location-discount:before {
	content: "﮴"
}
.ti-location-dollar:before {
	content: "﮵"
}
.ti-location-down:before {
	content: "﮶"
}
.ti-location-exclamation:before {
	content: "﮷"
}
.ti-location-filled:before {
	content: ""
}
.ti-location-heart:before {
	content: "﮸"
}
.ti-location-minus:before {
	content: "﮹"
}
.ti-location-off:before {
	content: ""
}
.ti-location-pause:before {
	content: "﮺"
}
.ti-location-pin:before {
	content: "﮻"
}
.ti-location-plus:before {
	content: "﮼"
}
.ti-location-question:before {
	content: "﮽"
}
.ti-location-search:before {
	content: "﮾"
}
.ti-location-share:before {
	content: "﮿"
}
.ti-location-star:before {
	content: "﯀"
}
.ti-location-up:before {
	content: "﯁"
}
.ti-location-x:before {
	content: "﯂"
}
.ti-lock:before {
	content: ""
}
.ti-lock-access:before {
	content: ""
}
.ti-lock-access-off:before {
	content: ""
}
.ti-lock-bitcoin:before {
	content: "Ｗ"
}
.ti-lock-bolt:before {
	content: "襤"
}
.ti-lock-cancel:before {
	content: "拉"
}
.ti-lock-check:before {
	content: "臘"
}
.ti-lock-code:before {
	content: "蠟"
}
.ti-lock-cog:before {
	content: "廊"
}
.ti-lock-dollar:before {
	content: "朗"
}
.ti-lock-down:before {
	content: "浪"
}
.ti-lock-exclamation:before {
	content: "狼"
}
.ti-lock-filled:before {
	content: "︕"
}
.ti-lock-heart:before {
	content: "郎"
}
.ti-lock-minus:before {
	content: "來"
}
.ti-lock-off:before {
	content: ""
}
.ti-lock-open:before {
	content: ""
}
.ti-lock-open-2:before {
	content: "ﺨ"
}
.ti-lock-open-off:before {
	content: ""
}
.ti-lock-password:before {
	content: "ﾟ"
}
.ti-lock-pause:before {
	content: "冷"
}
.ti-lock-pin:before {
	content: "勞"
}
.ti-lock-plus:before {
	content: "擄"
}
.ti-lock-question:before {
	content: "櫓"
}
.ti-lock-search:before {
	content: "爐"
}
.ti-lock-share:before {
	content: "盧"
}
.ti-lock-square:before {
	content: ""
}
.ti-lock-square-rounded:before {
	content: ""
}
.ti-lock-square-rounded-filled:before {
	content: ""
}
.ti-lock-star:before {
	content: "老"
}
.ti-lock-up:before {
	content: "蘆"
}
.ti-lock-x:before {
	content: "虜"
}
.ti-logic-and:before {
	content: ""
}
.ti-logic-buffer:before {
	content: ""
}
.ti-logic-nand:before {
	content: ""
}
.ti-logic-nor:before {
	content: ""
}
.ti-logic-not:before {
	content: ""
}
.ti-logic-or:before {
	content: ""
}
.ti-logic-xnor:before {
	content: ""
}
.ti-logic-xor:before {
	content: ""
}
.ti-login:before {
	content: ""
}
.ti-login-2:before {
	content: "ﱶ"
}
.ti-logout:before {
	content: ""
}
.ti-logout-2:before {
	content: "奄"
}
.ti-logs:before {
	content: "ﺧ"
}
.ti-lollipop:before {
	content: ""
}
.ti-lollipop-off:before {
	content: ""
}
.ti-luggage:before {
	content: ""
}
.ti-luggage-off:before {
	content: ""
}
.ti-lungs:before {
	content: ""
}
.ti-lungs-filled:before {
	content: "︔"
}
.ti-lungs-off:before {
	content: ""
}
.ti-macro:before {
	content: ""
}
.ti-macro-filled:before {
	content: "︓"
}
.ti-macro-off:before {
	content: ""
}
.ti-magnet:before {
	content: ""
}
.ti-magnet-filled:before {
	content: "︒"
}
.ti-magnet-off:before {
	content: ""
}
.ti-magnetic:before {
	content: "ﲹ"
}
.ti-mail:before {
	content: ""
}
.ti-mail-ai:before {
	content: "僧"
}
.ti-mail-bitcoin:before {
	content: "Ｖ"
}
.ti-mail-bolt:before {
	content: "路"
}
.ti-mail-cancel:before {
	content: "露"
}
.ti-mail-check:before {
	content: "魯"
}
.ti-mail-code:before {
	content: "鷺"
}
.ti-mail-cog:before {
	content: "碌"
}
.ti-mail-dollar:before {
	content: "祿"
}
.ti-mail-down:before {
	content: "綠"
}
.ti-mail-exclamation:before {
	content: "菉"
}
.ti-mail-fast:before {
	content: ""
}
.ti-mail-filled:before {
	content: "漢"
}
.ti-mail-forward:before {
	content: ""
}
.ti-mail-heart:before {
	content: "錄"
}
.ti-mail-minus:before {
	content: "鹿"
}
.ti-mail-off:before {
	content: ""
}
.ti-mail-opened:before {
	content: ""
}
.ti-mail-opened-filled:before {
	content: "煮"
}
.ti-mail-pause:before {
	content: "論"
}
.ti-mail-pin:before {
	content: "壟"
}
.ti-mail-plus:before {
	content: "弄"
}
.ti-mail-question:before {
	content: "籠"
}
.ti-mail-search:before {
	content: "聾"
}
.ti-mail-share:before {
	content: "牢"
}
.ti-mail-spark:before {
	content: "ﾳ"
}
.ti-mail-star:before {
	content: "磊"
}
.ti-mail-up:before {
	content: "賂"
}
.ti-mail-x:before {
	content: "雷"
}
.ti-mailbox:before {
	content: ""
}
.ti-mailbox-off:before {
	content: ""
}
.ti-man:before {
	content: ""
}
.ti-man-filled:before {
	content: "︑"
}
.ti-manual-gearbox:before {
	content: ""
}
.ti-manual-gearbox-filled:before {
	content: "︐"
}
.ti-map:before {
	content: ""
}
.ti-map-2:before {
	content: ""
}
.ti-map-bolt:before {
	content: "﯃"
}
.ti-map-cancel:before {
	content: "﯄"
}
.ti-map-check:before {
	content: "﯅"
}
.ti-map-code:before {
	content: "﯆"
}
.ti-map-cog:before {
	content: "﯇"
}
.ti-map-discount:before {
	content: "﯈"
}
.ti-map-dollar:before {
	content: "﯉"
}
.ti-map-down:before {
	content: "﯊"
}
.ti-map-east:before {
	content: "ﱝ"
}
.ti-map-exclamation:before {
	content: "﯋"
}
.ti-map-heart:before {
	content: "﯌"
}
.ti-map-minus:before {
	content: "﯍"
}
.ti-map-north:before {
	content: "ﱞ"
}
.ti-map-off:before {
	content: ""
}
.ti-map-pause:before {
	content: "﯎"
}
.ti-map-pin:before {
	content: ""
}
.ti-map-pin-2:before {
	content: "ﱈ"
}
.ti-map-pin-bolt:before {
	content: "壘"
}
.ti-map-pin-cancel:before {
	content: "屢"
}
.ti-map-pin-check:before {
	content: "樓"
}
.ti-map-pin-code:before {
	content: "淚"
}
.ti-map-pin-cog:before {
	content: "漏"
}
.ti-map-pin-dollar:before {
	content: "累"
}
.ti-map-pin-down:before {
	content: "縷"
}
.ti-map-pin-exclamation:before {
	content: "陋"
}
.ti-map-pin-filled:before {
	content: ""
}
.ti-map-pin-heart:before {
	content: "勒"
}
.ti-map-pin-minus:before {
	content: "肋"
}
.ti-map-pin-off:before {
	content: ""
}
.ti-map-pin-pause:before {
	content: "凜"
}
.ti-map-pin-pin:before {
	content: "凌"
}
.ti-map-pin-plus:before {
	content: "稜"
}
.ti-map-pin-question:before {
	content: "綾"
}
.ti-map-pin-search:before {
	content: "菱"
}
.ti-map-pin-share:before {
	content: ""
}
.ti-map-pin-star:before {
	content: "陵"
}
.ti-map-pin-up:before {
	content: "讀"
}
.ti-map-pin-x:before {
	content: "拏"
}
.ti-map-pins:before {
	content: ""
}
.ti-map-plus:before {
	content: "﯏"
}
.ti-map-question:before {
	content: "﯐"
}
.ti-map-route:before {
	content: "ﱹ"
}
.ti-map-search:before {
	content: ""
}
.ti-map-share:before {
	content: "﯑"
}
.ti-map-south:before {
	content: "ﱟ"
}
.ti-map-star:before {
	content: "﯒"
}
.ti-map-up:before {
	content: "ﯓ"
}
.ti-map-west:before {
	content: "ﱠ"
}
.ti-map-x:before {
	content: "ﯔ"
}
.ti-markdown:before {
	content: ""
}
.ti-markdown-off:before {
	content: ""
}
.ti-marquee:before {
	content: ""
}
.ti-marquee-2:before {
	content: ""
}
.ti-marquee-off:before {
	content: ""
}
.ti-mars:before {
	content: ""
}
.ti-mask:before {
	content: ""
}
.ti-mask-off:before {
	content: ""
}
.ti-masks-theater:before {
	content: ""
}
.ti-masks-theater-off:before {
	content: ""
}
.ti-massage:before {
	content: ""
}
.ti-matchstick:before {
	content: ""
}
.ti-math:before {
	content: ""
}
.ti-math-1-divide-2:before {
	content: ""
}
.ti-math-1-divide-3:before {
	content: ""
}
.ti-math-avg:before {
	content: ""
}
.ti-math-cos:before {
	content: "？"
}
.ti-math-ctg:before {
	content: "Ｕ"
}
.ti-math-equal-greater:before {
	content: ""
}
.ti-math-equal-lower:before {
	content: ""
}
.ti-math-function:before {
	content: ""
}
.ti-math-function-off:before {
	content: ""
}
.ti-math-function-y:before {
	content: ""
}
.ti-math-greater:before {
	content: ""
}
.ti-math-integral:before {
	content: ""
}
.ti-math-integral-x:before {
	content: ""
}
.ti-math-integrals:before {
	content: ""
}
.ti-math-lower:before {
	content: ""
}
.ti-math-max:before {
	content: ""
}
.ti-math-max-min:before {
	content: "ﶠ"
}
.ti-math-min:before {
	content: ""
}
.ti-math-not:before {
	content: ""
}
.ti-math-off:before {
	content: ""
}
.ti-math-pi:before {
	content: ""
}
.ti-math-pi-divide-2:before {
	content: ""
}
.ti-math-sec:before {
	content: "Ｔ"
}
.ti-math-sin:before {
	content: "＞"
}
.ti-math-symbols:before {
	content: ""
}
.ti-math-tg:before {
	content: "Ｓ"
}
.ti-math-x-divide-2:before {
	content: ""
}
.ti-math-x-divide-y:before {
	content: ""
}
.ti-math-x-divide-y-2:before {
	content: ""
}
.ti-math-x-floor-divide-y:before {
	content: "𐁳"
}
.ti-math-x-minus-x:before {
	content: ""
}
.ti-math-x-minus-y:before {
	content: ""
}
.ti-math-x-plus-x:before {
	content: ""
}
.ti-math-x-plus-y:before {
	content: ""
}
.ti-math-xy:before {
	content: ""
}
.ti-math-y-minus-y:before {
	content: ""
}
.ti-math-y-plus-y:before {
	content: ""
}
.ti-matrix:before {
	content: "𐂼"
}
.ti-maximize:before {
	content: ""
}
.ti-maximize-off:before {
	content: ""
}
.ti-meat:before {
	content: ""
}
.ti-meat-off:before {
	content: ""
}
.ti-medal:before {
	content: ""
}
.ti-medal-2:before {
	content: ""
}
.ti-medical-cross:before {
	content: ""
}
.ti-medical-cross-circle:before {
	content: "﫨"
}
.ti-medical-cross-filled:before {
	content: ""
}
.ti-medical-cross-off:before {
	content: ""
}
.ti-medicine-syrup:before {
	content: ""
}
.ti-meeple:before {
	content: ""
}
.ti-meeple-filled:before {
	content: "𐂠"
}
.ti-melon:before {
	content: "ﱺ"
}
.ti-melon-filled:before {
	content: "𐀎"
}
.ti-menorah:before {
	content: ""
}
.ti-menu:before {
	content: ""
}
.ti-menu-2:before {
	content: ""
}
.ti-menu-3:before {
	content: "ｃ"
}
.ti-menu-4:before {
	content: "ｂ"
}
.ti-menu-deep:before {
	content: "﫻"
}
.ti-menu-order:before {
	content: ""
}
.ti-message:before {
	content: ""
}
.ti-message-2:before {
	content: ""
}
.ti-message-2-bolt:before {
	content: "樂"
}
.ti-message-2-cancel:before {
	content: "諾"
}
.ti-message-2-check:before {
	content: "丹"
}
.ti-message-2-code:before {
	content: ""
}
.ti-message-2-cog:before {
	content: "寧"
}
.ti-message-2-dollar:before {
	content: "怒"
}
.ti-message-2-down:before {
	content: "率"
}
.ti-message-2-exclamation:before {
	content: "異"
}
.ti-message-2-filled:before {
	content: "𐂟"
}
.ti-message-2-heart:before {
	content: "北"
}
.ti-message-2-minus:before {
	content: "磻"
}
.ti-message-2-off:before {
	content: ""
}
.ti-message-2-pause:before {
	content: "便"
}
.ti-message-2-pin:before {
	content: "復"
}
.ti-message-2-plus:before {
	content: "不"
}
.ti-message-2-question:before {
	content: "泌"
}
.ti-message-2-search:before {
	content: "數"
}
.ti-message-2-share:before {
	content: ""
}
.ti-message-2-star:before {
	content: "索"
}
.ti-message-2-up:before {
	content: "參"
}
.ti-message-2-x:before {
	content: "塞"
}
.ti-message-bolt:before {
	content: "省"
}
.ti-message-cancel:before {
	content: "葉"
}
.ti-message-chatbot:before {
	content: ""
}
.ti-message-chatbot-filled:before {
	content: "ﻐ"
}
.ti-message-check:before {
	content: "說"
}
.ti-message-circle:before {
	content: ""
}
.ti-message-circle-bolt:before {
	content: "殺"
}
.ti-message-circle-cancel:before {
	content: "辰"
}
.ti-message-circle-check:before {
	content: "沈"
}
.ti-message-circle-code:before {
	content: "拾"
}
.ti-message-circle-cog:before {
	content: "若"
}
.ti-message-circle-dollar:before {
	content: "掠"
}
.ti-message-circle-down:before {
	content: "略"
}
.ti-message-circle-exclamation:before {
	content: "亮"
}
.ti-message-circle-filled:before {
	content: "ﻏ"
}
.ti-message-circle-heart:before {
	content: "兩"
}
.ti-message-circle-minus:before {
	content: "凉"
}
.ti-message-circle-off:before {
	content: ""
}
.ti-message-circle-pause:before {
	content: "梁"
}
.ti-message-circle-pin:before {
	content: "糧"
}
.ti-message-circle-plus:before {
	content: "良"
}
.ti-message-circle-question:before {
	content: "諒"
}
.ti-message-circle-search:before {
	content: "量"
}
.ti-message-circle-share:before {
	content: "勵"
}
.ti-message-circle-star:before {
	content: "呂"
}
.ti-message-circle-up:before {
	content: "女"
}
.ti-message-circle-user:before {
	content: "ﻅ"
}
.ti-message-circle-x:before {
	content: "廬"
}
.ti-message-code:before {
	content: ""
}
.ti-message-cog:before {
	content: "旅"
}
.ti-message-dollar:before {
	content: "濾"
}
.ti-message-dots:before {
	content: ""
}
.ti-message-down:before {
	content: "礪"
}
.ti-message-exclamation:before {
	content: "閭"
}
.ti-message-filled:before {
	content: "ﻍ"
}
.ti-message-forward:before {
	content: ""
}
.ti-message-heart:before {
	content: "驪"
}
.ti-message-language:before {
	content: ""
}
.ti-message-minus:before {
	content: "麗"
}
.ti-message-off:before {
	content: ""
}
.ti-message-pause:before {
	content: "黎"
}
.ti-message-pin:before {
	content: "力"
}
.ti-message-plus:before {
	content: ""
}
.ti-message-question:before {
	content: "曆"
}
.ti-message-reply:before {
	content: "﵍"
}
.ti-message-report:before {
	content: ""
}
.ti-message-report-filled:before {
	content: "ﻎ"
}
.ti-message-search:before {
	content: "歷"
}
.ti-message-share:before {
	content: ""
}
.ti-message-star:before {
	content: "轢"
}
.ti-message-up:before {
	content: "年"
}
.ti-message-user:before {
	content: "ﻄ"
}
.ti-message-x:before {
	content: "憐"
}
.ti-messages:before {
	content: ""
}
.ti-messages-off:before {
	content: ""
}
.ti-meteor:before {
	content: ""
}
.ti-meteor-filled:before {
	content: "𐀍"
}
.ti-meteor-off:before {
	content: ""
}
.ti-meter-cube:before {
	content: "ﵼ"
}
.ti-meter-square:before {
	content: "ﵽ"
}
.ti-metronome:before {
	content: "ﴥ"
}
.ti-michelin-bib-gourmand:before {
	content: "﫩"
}
.ti-michelin-star:before {
	content: "﫫"
}
.ti-michelin-star-filled:before {
	content: "𐀌"
}
.ti-michelin-star-green:before {
	content: "﫪"
}
.ti-mickey:before {
	content: ""
}
.ti-mickey-filled:before {
	content: ""
}
.ti-microphone:before {
	content: ""
}
.ti-microphone-2:before {
	content: ""
}
.ti-microphone-2-off:before {
	content: ""
}
.ti-microphone-filled:before {
	content: "️"
}
.ti-microphone-off:before {
	content: ""
}
.ti-microscope:before {
	content: ""
}
.ti-microscope-filled:before {
	content: "𐅦"
}
.ti-microscope-off:before {
	content: ""
}
.ti-microwave:before {
	content: ""
}
.ti-microwave-filled:before {
	content: "︎"
}
.ti-microwave-off:before {
	content: ""
}
.ti-military-award:before {
	content: ""
}
.ti-military-rank:before {
	content: ""
}
.ti-military-rank-filled:before {
	content: "～"
}
.ti-milk:before {
	content: ""
}
.ti-milk-filled:before {
	content: "𐀋"
}
.ti-milk-off:before {
	content: ""
}
.ti-milkshake:before {
	content: ""
}
.ti-minimize:before {
	content: ""
}
.ti-minus:before {
	content: ""
}
.ti-minus-vertical:before {
	content: ""
}
.ti-mist:before {
	content: ""
}
.ti-mist-off:before {
	content: ""
}
.ti-mobiledata:before {
	content: "淋"
}
.ti-mobiledata-off:before {
	content: "林"
}
.ti-moneybag:before {
	content: ""
}
.ti-moneybag-edit:before {
	content: "𐄽"
}
.ti-moneybag-heart:before {
	content: "𐄼"
}
.ti-moneybag-minus:before {
	content: "𐄻"
}
.ti-moneybag-move:before {
	content: "𐄹"
}
.ti-moneybag-move-back:before {
	content: "𐄺"
}
.ti-moneybag-plus:before {
	content: "𐄸"
}
.ti-monkeybar:before {
	content: "ﺴ"
}
.ti-mood-angry:before {
	content: ""
}
.ti-mood-angry-filled:before {
	content: "＊"
}
.ti-mood-annoyed:before {
	content: ""
}
.ti-mood-annoyed-2:before {
	content: ""
}
.ti-mood-bitcoin:before {
	content: "Ｒ"
}
.ti-mood-boy:before {
	content: ""
}
.ti-mood-check:before {
	content: ""
}
.ti-mood-cog:before {
	content: ""
}
.ti-mood-confuzed:before {
	content: ""
}
.ti-mood-confuzed-filled:before {
	content: ""
}
.ti-mood-crazy-happy:before {
	content: ""
}
.ti-mood-crazy-happy-filled:before {
	content: "）"
}
.ti-mood-cry:before {
	content: ""
}
.ti-mood-dollar:before {
	content: ""
}
.ti-mood-edit:before {
	content: "洞"
}
.ti-mood-empty:before {
	content: ""
}
.ti-mood-empty-filled:before {
	content: ""
}
.ti-mood-happy:before {
	content: ""
}
.ti-mood-happy-filled:before {
	content: ""
}
.ti-mood-heart:before {
	content: ""
}
.ti-mood-kid:before {
	content: ""
}
.ti-mood-kid-filled:before {
	content: ""
}
.ti-mood-look-down:before {
	content: "ﴷ"
}
.ti-mood-look-left:before {
	content: ""
}
.ti-mood-look-right:before {
	content: ""
}
.ti-mood-look-up:before {
	content: "ﴸ"
}
.ti-mood-minus:before {
	content: ""
}
.ti-mood-nerd:before {
	content: ""
}
.ti-mood-nervous:before {
	content: ""
}
.ti-mood-neutral:before {
	content: ""
}
.ti-mood-neutral-filled:before {
	content: ""
}
.ti-mood-off:before {
	content: ""
}
.ti-mood-pin:before {
	content: ""
}
.ti-mood-plus:before {
	content: ""
}
.ti-mood-puzzled:before {
	content: "ﴹ"
}
.ti-mood-sad:before {
	content: ""
}
.ti-mood-sad-2:before {
	content: ""
}
.ti-mood-sad-dizzy:before {
	content: ""
}
.ti-mood-sad-filled:before {
	content: ""
}
.ti-mood-sad-squint:before {
	content: ""
}
.ti-mood-search:before {
	content: ""
}
.ti-mood-share:before {
	content: "暴"
}
.ti-mood-sick:before {
	content: ""
}
.ti-mood-silence:before {
	content: ""
}
.ti-mood-sing:before {
	content: ""
}
.ti-mood-smile:before {
	content: ""
}
.ti-mood-smile-beam:before {
	content: ""
}
.ti-mood-smile-dizzy:before {
	content: ""
}
.ti-mood-smile-filled:before {
	content: ""
}
.ti-mood-spark:before {
	content: "ﾲ"
}
.ti-mood-surprised:before {
	content: ""
}
.ti-mood-tongue:before {
	content: ""
}
.ti-mood-tongue-wink:before {
	content: ""
}
.ti-mood-tongue-wink-2:before {
	content: ""
}
.ti-mood-unamused:before {
	content: ""
}
.ti-mood-up:before {
	content: ""
}
.ti-mood-wink:before {
	content: ""
}
.ti-mood-wink-2:before {
	content: ""
}
.ti-mood-wrrr:before {
	content: ""
}
.ti-mood-wrrr-filled:before {
	content: "（"
}
.ti-mood-x:before {
	content: ""
}
.ti-mood-xd:before {
	content: ""
}
.ti-moon:before {
	content: ""
}
.ti-moon-2:before {
	content: ""
}
.ti-moon-filled:before {
	content: ""
}
.ti-moon-off:before {
	content: ""
}
.ti-moon-stars:before {
	content: ""
}
.ti-moped:before {
	content: ""
}
.ti-motorbike:before {
	content: ""
}
.ti-motorbike-filled:before {
	content: "𐃸"
}
.ti-mountain:before {
	content: ""
}
.ti-mountain-filled:before {
	content: "𐀊"
}
.ti-mountain-off:before {
	content: ""
}
.ti-mouse:before {
	content: ""
}
.ti-mouse-2:before {
	content: ""
}
.ti-mouse-filled:before {
	content: "אָ"
}
.ti-mouse-off:before {
	content: ""
}
.ti-moustache:before {
	content: ""
}
.ti-movie:before {
	content: ""
}
.ti-movie-off:before {
	content: ""
}
.ti-mug:before {
	content: ""
}
.ti-mug-filled:before {
	content: "𐀉"
}
.ti-mug-off:before {
	content: ""
}
.ti-multiplier-0-5x:before {
	content: ""
}
.ti-multiplier-1-5x:before {
	content: ""
}
.ti-multiplier-1x:before {
	content: ""
}
.ti-multiplier-2x:before {
	content: ""
}
.ti-mushroom:before {
	content: ""
}
.ti-mushroom-filled:before {
	content: ""
}
.ti-mushroom-off:before {
	content: ""
}
.ti-music:before {
	content: ""
}
.ti-music-bolt:before {
	content: "ﯕ"
}
.ti-music-cancel:before {
	content: "ﯖ"
}
.ti-music-check:before {
	content: "ﯗ"
}
.ti-music-code:before {
	content: "ﯘ"
}
.ti-music-cog:before {
	content: "ﯙ"
}
.ti-music-discount:before {
	content: "ﯚ"
}
.ti-music-dollar:before {
	content: "ﯛ"
}
.ti-music-down:before {
	content: "ﯜ"
}
.ti-music-exclamation:before {
	content: "ﯝ"
}
.ti-music-heart:before {
	content: "ﯞ"
}
.ti-music-minus:before {
	content: "ﯟ"
}
.ti-music-off:before {
	content: ""
}
.ti-music-pause:before {
	content: "ﯠ"
}
.ti-music-pin:before {
	content: "ﯡ"
}
.ti-music-plus:before {
	content: "ﯢ"
}
.ti-music-question:before {
	content: "ﯣ"
}
.ti-music-search:before {
	content: "ﯤ"
}
.ti-music-share:before {
	content: "ﯥ"
}
.ti-music-star:before {
	content: "ﯦ"
}
.ti-music-up:before {
	content: "ﯧ"
}
.ti-music-x:before {
	content: "ﯨ"
}
.ti-navigation:before {
	content: ""
}
.ti-navigation-bolt:before {
	content: "ﯩ"
}
.ti-navigation-cancel:before {
	content: "ﯪ"
}
.ti-navigation-check:before {
	content: "ﯫ"
}
.ti-navigation-code:before {
	content: "ﯬ"
}
.ti-navigation-cog:before {
	content: "ﯭ"
}
.ti-navigation-discount:before {
	content: "ﯮ"
}
.ti-navigation-dollar:before {
	content: "ﯯ"
}
.ti-navigation-down:before {
	content: "ﯰ"
}
.ti-navigation-east:before {
	content: "ﲺ"
}
.ti-navigation-exclamation:before {
	content: "ﯱ"
}
.ti-navigation-filled:before {
	content: ""
}
.ti-navigation-heart:before {
	content: "ﯲ"
}
.ti-navigation-minus:before {
	content: "ﯳ"
}
.ti-navigation-north:before {
	content: "ﲻ"
}
.ti-navigation-off:before {
	content: ""
}
.ti-navigation-pause:before {
	content: "ﯴ"
}
.ti-navigation-pin:before {
	content: "ﯵ"
}
.ti-navigation-plus:before {
	content: "ﯶ"
}
.ti-navigation-question:before {
	content: "ﯷ"
}
.ti-navigation-search:before {
	content: "ﯸ"
}
.ti-navigation-share:before {
	content: "ﯹ"
}
.ti-navigation-south:before {
	content: "ﲼ"
}
.ti-navigation-star:before {
	content: "ﯺ"
}
.ti-navigation-top:before {
	content: "﫬"
}
.ti-navigation-up:before {
	content: "ﯻ"
}
.ti-navigation-west:before {
	content: "ﲽ"
}
.ti-navigation-x:before {
	content: "ﯼ"
}
.ti-needle:before {
	content: ""
}
.ti-needle-thread:before {
	content: ""
}
.ti-network:before {
	content: ""
}
.ti-network-off:before {
	content: ""
}
.ti-new-section:before {
	content: ""
}
.ti-news:before {
	content: ""
}
.ti-news-off:before {
	content: ""
}
.ti-nfc:before {
	content: ""
}
.ti-nfc-off:before {
	content: ""
}
.ti-no-copyright:before {
	content: ""
}
.ti-no-creative-commons:before {
	content: ""
}
.ti-no-derivatives:before {
	content: ""
}
.ti-north-star:before {
	content: ""
}
.ti-note:before {
	content: ""
}
.ti-note-off:before {
	content: ""
}
.ti-notebook:before {
	content: ""
}
.ti-notebook-off:before {
	content: ""
}
.ti-notes:before {
	content: ""
}
.ti-notes-off:before {
	content: ""
}
.ti-notification:before {
	content: ""
}
.ti-notification-off:before {
	content: ""
}
.ti-number:before {
	content: ""
}
.ti-number-0:before {
	content: ""
}
.ti-number-0-small:before {
	content: "ﳡ"
}
.ti-number-1:before {
	content: ""
}
.ti-number-1-small:before {
	content: "ﳢ"
}
.ti-number-10:before {
	content: "𐁞"
}
.ti-number-10-small:before {
	content: "ﳣ"
}
.ti-number-100-small:before {
	content: "𐀅"
}
.ti-number-11:before {
	content: "𐁝"
}
.ti-number-11-small:before {
	content: "ﳤ"
}
.ti-number-12-small:before {
	content: "ﳥ"
}
.ti-number-123:before {
	content: ""
}
.ti-number-13-small:before {
	content: "ﳦ"
}
.ti-number-14-small:before {
	content: "ﳧ"
}
.ti-number-15-small:before {
	content: "ﳨ"
}
.ti-number-16-small:before {
	content: "ﳩ"
}
.ti-number-17-small:before {
	content: "ﳪ"
}
.ti-number-18-small:before {
	content: "ﳫ"
}
.ti-number-19-small:before {
	content: "ﳬ"
}
.ti-number-2:before {
	content: ""
}
.ti-number-2-small:before {
	content: "ﳭ"
}
.ti-number-20-small:before {
	content: "ﳮ"
}
.ti-number-21-small:before {
	content: "ﳯ"
}
.ti-number-22-small:before {
	content: "ﳰ"
}
.ti-number-23-small:before {
	content: "ﳱ"
}
.ti-number-24-small:before {
	content: "ﳲ"
}
.ti-number-25-small:before {
	content: "ﳳ"
}
.ti-number-26-small:before {
	content: "ﳴ"
}
.ti-number-27-small:before {
	content: "ﳵ"
}
.ti-number-28-small:before {
	content: "ﳶ"
}
.ti-number-29-small:before {
	content: "ﳷ"
}
.ti-number-3:before {
	content: ""
}
.ti-number-3-small:before {
	content: "ﳸ"
}
.ti-number-30-small:before {
	content: "𐀄"
}
.ti-number-31-small:before {
	content: "𐀃"
}
.ti-number-32-small:before {
	content: "𐀂"
}
.ti-number-33-small:before {
	content: "𐀁"
}
.ti-number-34-small:before {
	content: "𐀀"
}
.ti-number-35-small:before {
	content: "￿"
}
.ti-number-36-small:before {
	content: "￾"
}
.ti-number-37-small:before {
	content: "�"
}
.ti-number-38-small:before {
	content: ""
}
.ti-number-39-small:before {
	content: ""
}
.ti-number-4:before {
	content: ""
}
.ti-number-4-small:before {
	content: "ﳹ"
}
.ti-number-40-small:before {
	content: ""
}
.ti-number-41-small:before {
	content: ""
}
.ti-number-42-small:before {
	content: "￸"
}
.ti-number-43-small:before {
	content: "￷"
}
.ti-number-44-small:before {
	content: "￶"
}
.ti-number-45-small:before {
	content: "￵"
}
.ti-number-46-small:before {
	content: "￴"
}
.ti-number-47-small:before {
	content: "￳"
}
.ti-number-48-small:before {
	content: "￲"
}
.ti-number-49-small:before {
	content: "￱"
}
.ti-number-5:before {
	content: ""
}
.ti-number-5-small:before {
	content: "ﳺ"
}
.ti-number-50-small:before {
	content: "￰"
}
.ti-number-51-small:before {
	content: "￯"
}
.ti-number-52-small:before {
	content: "￮"
}
.ti-number-53-small:before {
	content: "￭"
}
.ti-number-54-small:before {
	content: "￬"
}
.ti-number-55-small:before {
	content: "￫"
}
.ti-number-56-small:before {
	content: "￪"
}
.ti-number-57-small:before {
	content: "￩"
}
.ti-number-58-small:before {
	content: "￨"
}
.ti-number-59-small:before {
	content: "￧"
}
.ti-number-6:before {
	content: ""
}
.ti-number-6-small:before {
	content: "ﳻ"
}
.ti-number-60-small:before {
	content: "￦"
}
.ti-number-61-small:before {
	content: "￥"
}
.ti-number-62-small:before {
	content: "￤"
}
.ti-number-63-small:before {
	content: "￣"
}
.ti-number-64-small:before {
	content: "￢"
}
.ti-number-65-small:before {
	content: "￡"
}
.ti-number-66-small:before {
	content: "￠"
}
.ti-number-67-small:before {
	content: "￟"
}
.ti-number-68-small:before {
	content: "￞"
}
.ti-number-69-small:before {
	content: "￝"
}
.ti-number-7:before {
	content: ""
}
.ti-number-7-small:before {
	content: "ﳼ"
}
.ti-number-70-small:before {
	content: "ￜ"
}
.ti-number-71-small:before {
	content: "ￛ"
}
.ti-number-72-small:before {
	content: "ￚ"
}
.ti-number-73-small:before {
	content: "￙"
}
.ti-number-74-small:before {
	content: "￘"
}
.ti-number-75-small:before {
	content: "ￗ"
}
.ti-number-76-small:before {
	content: "ￖ"
}
.ti-number-77-small:before {
	content: "ￕ"
}
.ti-number-78-small:before {
	content: "ￔ"
}
.ti-number-79-small:before {
	content: "ￓ"
}
.ti-number-8:before {
	content: ""
}
.ti-number-8-small:before {
	content: "ﳽ"
}
.ti-number-80-small:before {
	content: "ￒ"
}
.ti-number-81-small:before {
	content: "￑"
}
.ti-number-82-small:before {
	content: "￐"
}
.ti-number-83-small:before {
	content: "ￏ"
}
.ti-number-84-small:before {
	content: "ￎ"
}
.ti-number-85-small:before {
	content: "ￍ"
}
.ti-number-86-small:before {
	content: "ￌ"
}
.ti-number-87-small:before {
	content: "ￋ"
}
.ti-number-88-small:before {
	content: "ￊ"
}
.ti-number-89-small:before {
	content: "￉"
}
.ti-number-9:before {
	content: ""
}
.ti-number-9-small:before {
	content: "ﳾ"
}
.ti-number-90-small:before {
	content: "￈"
}
.ti-number-91-small:before {
	content: "ￇ"
}
.ti-number-92-small:before {
	content: "ￆ"
}
.ti-number-93-small:before {
	content: "ￅ"
}
.ti-number-94-small:before {
	content: "ￄ"
}
.ti-number-95-small:before {
	content: "ￃ"
}
.ti-number-96-small:before {
	content: "ￂ"
}
.ti-number-97-small:before {
	content: "￁"
}
.ti-number-98-small:before {
	content: "￀"
}
.ti-number-99-small:before {
	content: "﾿"
}
.ti-numbers:before {
	content: ""
}
.ti-nurse:before {
	content: ""
}
.ti-nurse-filled:before {
	content: "𐂞"
}
.ti-nut:before {
	content: "ﱡ"
}
.ti-object-scan:before {
	content: "ﻱ"
}
.ti-octagon:before {
	content: ""
}
.ti-octagon-filled:before {
	content: ""
}
.ti-octagon-minus:before {
	content: "ﲒ"
}
.ti-octagon-minus-2:before {
	content: "ﲑ"
}
.ti-octagon-minus-filled:before {
	content: "𐅿"
}
.ti-octagon-off:before {
	content: ""
}
.ti-octagon-plus:before {
	content: "ﲔ"
}
.ti-octagon-plus-2:before {
	content: "ﲓ"
}
.ti-octagon-plus-filled:before {
	content: "𐅾"
}
.ti-octahedron:before {
	content: "类"
}
.ti-octahedron-off:before {
	content: "窱"
}
.ti-octahedron-plus:before {
	content: "節"
}
.ti-old:before {
	content: ""
}
.ti-olympics:before {
	content: ""
}
.ti-olympics-off:before {
	content: ""
}
.ti-om:before {
	content: ""
}
.ti-omega:before {
	content: ""
}
.ti-outbound:before {
	content: ""
}
.ti-outlet:before {
	content: ""
}
.ti-oval:before {
	content: ""
}
.ti-oval-filled:before {
	content: ""
}
.ti-oval-vertical:before {
	content: ""
}
.ti-oval-vertical-filled:before {
	content: ""
}
.ti-overline:before {
	content: ""
}
.ti-package:before {
	content: ""
}
.ti-package-export:before {
	content: ""
}
.ti-package-import:before {
	content: ""
}
.ti-package-off:before {
	content: ""
}
.ti-packages:before {
	content: ""
}
.ti-pacman:before {
	content: ""
}
.ti-page-break:before {
	content: ""
}
.ti-paint:before {
	content: ""
}
.ti-paint-filled:before {
	content: ""
}
.ti-paint-off:before {
	content: ""
}
.ti-palette:before {
	content: ""
}
.ti-palette-filled:before {
	content: "𐂝"
}
.ti-palette-off:before {
	content: ""
}
.ti-panorama-horizontal:before {
	content: ""
}
.ti-panorama-horizontal-filled:before {
	content: "ﻌ"
}
.ti-panorama-horizontal-off:before {
	content: ""
}
.ti-panorama-vertical:before {
	content: ""
}
.ti-panorama-vertical-filled:before {
	content: "ﻋ"
}
.ti-panorama-vertical-off:before {
	content: ""
}
.ti-paper-bag:before {
	content: ""
}
.ti-paper-bag-off:before {
	content: ""
}
.ti-paperclip:before {
	content: ""
}
.ti-parachute:before {
	content: ""
}
.ti-parachute-off:before {
	content: ""
}
.ti-parentheses:before {
	content: ""
}
.ti-parentheses-off:before {
	content: ""
}
.ti-parking:before {
	content: ""
}
.ti-parking-circle:before {
	content: "ﵚ"
}
.ti-parking-circle-filled:before {
	content: "ﻊ"
}
.ti-parking-off:before {
	content: ""
}
.ti-password:before {
	content: ""
}
.ti-password-fingerprint:before {
	content: "ﱻ"
}
.ti-password-mobile-phone:before {
	content: "ﱼ"
}
.ti-password-user:before {
	content: "ﱽ"
}
.ti-paw:before {
	content: ""
}
.ti-paw-filled:before {
	content: ""
}
.ti-paw-off:before {
	content: ""
}
.ti-paywall:before {
	content: "ﵾ"
}
.ti-pdf:before {
	content: ""
}
.ti-peace:before {
	content: ""
}
.ti-pencil:before {
	content: ""
}
.ti-pencil-bolt:before {
	content: "ﯽ"
}
.ti-pencil-cancel:before {
	content: "ﯾ"
}
.ti-pencil-check:before {
	content: "ﯿ"
}
.ti-pencil-code:before {
	content: "ﰀ"
}
.ti-pencil-cog:before {
	content: "ﰁ"
}
.ti-pencil-discount:before {
	content: "ﰂ"
}
.ti-pencil-dollar:before {
	content: "ﰃ"
}
.ti-pencil-down:before {
	content: "ﰄ"
}
.ti-pencil-exclamation:before {
	content: "ﰅ"
}
.ti-pencil-heart:before {
	content: "ﰆ"
}
.ti-pencil-minus:before {
	content: ""
}
.ti-pencil-off:before {
	content: ""
}
.ti-pencil-pause:before {
	content: "ﰇ"
}
.ti-pencil-pin:before {
	content: "ﰈ"
}
.ti-pencil-plus:before {
	content: ""
}
.ti-pencil-question:before {
	content: "ﰉ"
}
.ti-pencil-search:before {
	content: "ﰊ"
}
.ti-pencil-share:before {
	content: "ﰋ"
}
.ti-pencil-star:before {
	content: "ﰌ"
}
.ti-pencil-up:before {
	content: "ﰍ"
}
.ti-pencil-x:before {
	content: "ﰎ"
}
.ti-pennant:before {
	content: ""
}
.ti-pennant-2:before {
	content: ""
}
.ti-pennant-2-filled:before {
	content: ""
}
.ti-pennant-filled:before {
	content: ""
}
.ti-pennant-off:before {
	content: ""
}
.ti-pentagon:before {
	content: ""
}
.ti-pentagon-filled:before {
	content: ""
}
.ti-pentagon-minus:before {
	content: "ﺳ"
}
.ti-pentagon-number-0:before {
	content: "ﱾ"
}
.ti-pentagon-number-1:before {
	content: "ﱿ"
}
.ti-pentagon-number-2:before {
	content: "ﲀ"
}
.ti-pentagon-number-3:before {
	content: "ﲁ"
}
.ti-pentagon-number-4:before {
	content: "ﲂ"
}
.ti-pentagon-number-5:before {
	content: "ﲃ"
}
.ti-pentagon-number-6:before {
	content: "ﲄ"
}
.ti-pentagon-number-7:before {
	content: "ﲅ"
}
.ti-pentagon-number-8:before {
	content: "ﲆ"
}
.ti-pentagon-number-9:before {
	content: "ﲇ"
}
.ti-pentagon-off:before {
	content: ""
}
.ti-pentagon-plus:before {
	content: "ﱉ"
}
.ti-pentagon-x:before {
	content: "ﲈ"
}
.ti-pentagram:before {
	content: ""
}
.ti-pepper:before {
	content: ""
}
.ti-pepper-off:before {
	content: ""
}
.ti-percentage:before {
	content: ""
}
.ti-percentage-0:before {
	content: "ﻥ"
}
.ti-percentage-10:before {
	content: "ﻤ"
}
.ti-percentage-100:before {
	content: "ﻣ"
}
.ti-percentage-20:before {
	content: "ﻢ"
}
.ti-percentage-25:before {
	content: "ﻡ"
}
.ti-percentage-30:before {
	content: "ﻠ"
}
.ti-percentage-33:before {
	content: "ﻟ"
}
.ti-percentage-40:before {
	content: "ﻞ"
}
.ti-percentage-50:before {
	content: "ﻝ"
}
.ti-percentage-60:before {
	content: "ﻜ"
}
.ti-percentage-66:before {
	content: "ﻛ"
}
.ti-percentage-70:before {
	content: "ﻚ"
}
.ti-percentage-75:before {
	content: "ﻙ"
}
.ti-percentage-80:before {
	content: "ﻘ"
}
.ti-percentage-90:before {
	content: "ﻗ"
}
.ti-perfume:before {
	content: ""
}
.ti-perspective:before {
	content: ""
}
.ti-perspective-off:before {
	content: ""
}
.ti-phone:before {
	content: ""
}
.ti-phone-call:before {
	content: ""
}
.ti-phone-calling:before {
	content: ""
}
.ti-phone-check:before {
	content: ""
}
.ti-phone-done:before {
	content: "ﾞ"
}
.ti-phone-end:before {
	content: "ﾝ"
}
.ti-phone-filled:before {
	content: "爫"
}
.ti-phone-incoming:before {
	content: ""
}
.ti-phone-off:before {
	content: ""
}
.ti-phone-outgoing:before {
	content: ""
}
.ti-phone-pause:before {
	content: ""
}
.ti-phone-plus:before {
	content: ""
}
.ti-phone-ringing:before {
	content: "ﾜ"
}
.ti-phone-spark:before {
	content: "ﾱ"
}
.ti-phone-x:before {
	content: ""
}
.ti-photo:before {
	content: ""
}
.ti-photo-ai:before {
	content: "免"
}
.ti-photo-bitcoin:before {
	content: "Ｑ"
}
.ti-photo-bolt:before {
	content: "戀"
}
.ti-photo-cancel:before {
	content: ""
}
.ti-photo-check:before {
	content: ""
}
.ti-photo-circle:before {
	content: "ﱊ"
}
.ti-photo-circle-minus:before {
	content: "ﱢ"
}
.ti-photo-circle-plus:before {
	content: "ﱣ"
}
.ti-photo-code:before {
	content: "撚"
}
.ti-photo-cog:before {
	content: "漣"
}
.ti-photo-dollar:before {
	content: "煉"
}
.ti-photo-down:before {
	content: ""
}
.ti-photo-edit:before {
	content: ""
}
.ti-photo-exclamation:before {
	content: "璉"
}
.ti-photo-filled:before {
	content: "琢"
}
.ti-photo-heart:before {
	content: ""
}
.ti-photo-hexagon:before {
	content: "ﱋ"
}
.ti-photo-minus:before {
	content: ""
}
.ti-photo-off:before {
	content: ""
}
.ti-photo-pause:before {
	content: "秊"
}
.ti-photo-pentagon:before {
	content: "ﱌ"
}
.ti-photo-pin:before {
	content: "練"
}
.ti-photo-plus:before {
	content: ""
}
.ti-photo-question:before {
	content: "聯"
}
.ti-photo-scan:before {
	content: "ﲨ"
}
.ti-photo-search:before {
	content: ""
}
.ti-photo-sensor:before {
	content: ""
}
.ti-photo-sensor-2:before {
	content: ""
}
.ti-photo-sensor-3:before {
	content: ""
}
.ti-photo-share:before {
	content: "輦"
}
.ti-photo-shield:before {
	content: ""
}
.ti-photo-spark:before {
	content: "ﾰ"
}
.ti-photo-square-rounded:before {
	content: "ﱍ"
}
.ti-photo-star:before {
	content: ""
}
.ti-photo-up:before {
	content: ""
}
.ti-photo-video:before {
	content: "ﲕ"
}
.ti-photo-x:before {
	content: ""
}
.ti-physotherapist:before {
	content: ""
}
.ti-piano:before {
	content: "䀘"
}
.ti-pick:before {
	content: "﫼"
}
.ti-picnic-table:before {
	content: "ﻖ"
}
.ti-picture-in-picture:before {
	content: ""
}
.ti-picture-in-picture-filled:before {
	content: "ﻁ"
}
.ti-picture-in-picture-off:before {
	content: ""
}
.ti-picture-in-picture-on:before {
	content: ""
}
.ti-picture-in-picture-top:before {
	content: ""
}
.ti-picture-in-picture-top-filled:before {
	content: "ﻂ"
}
.ti-pig:before {
	content: ""
}
.ti-pig-filled:before {
	content: "𐄊"
}
.ti-pig-money:before {
	content: ""
}
.ti-pig-off:before {
	content: ""
}
.ti-pilcrow:before {
	content: ""
}
.ti-pilcrow-left:before {
	content: "ﵿ"
}
.ti-pilcrow-right:before {
	content: "ﶀ"
}
.ti-pill:before {
	content: ""
}
.ti-pill-filled:before {
	content: "＇"
}
.ti-pill-off:before {
	content: ""
}
.ti-pills:before {
	content: ""
}
.ti-pin:before {
	content: ""
}
.ti-pin-end:before {
	content: "ﵛ"
}
.ti-pin-filled:before {
	content: ""
}
.ti-pin-invoke:before {
	content: "ﵜ"
}
.ti-ping-pong:before {
	content: ""
}
.ti-pinned:before {
	content: ""
}
.ti-pinned-filled:before {
	content: ""
}
.ti-pinned-off:before {
	content: ""
}
.ti-pizza:before {
	content: ""
}
.ti-pizza-filled:before {
	content: "𐀈"
}
.ti-pizza-off:before {
	content: ""
}
.ti-placeholder:before {
	content: ""
}
.ti-plane:before {
	content: ""
}
.ti-plane-arrival:before {
	content: ""
}
.ti-plane-departure:before {
	content: ""
}
.ti-plane-inflight:before {
	content: ""
}
.ti-plane-off:before {
	content: ""
}
.ti-plane-tilt:before {
	content: ""
}
.ti-planet:before {
	content: ""
}
.ti-planet-off:before {
	content: ""
}
.ti-plant:before {
	content: ""
}
.ti-plant-2:before {
	content: ""
}
.ti-plant-2-off:before {
	content: ""
}
.ti-plant-off:before {
	content: ""
}
.ti-play-basketball:before {
	content: "辶"
}
.ti-play-card:before {
	content: ""
}
.ti-play-card-1:before {
	content: "𐁜"
}
.ti-play-card-1-filled:before {
	content: "𐂃"
}
.ti-play-card-10:before {
	content: "𐁛"
}
.ti-play-card-10-filled:before {
	content: "𐂂"
}
.ti-play-card-2:before {
	content: "𐁚"
}
.ti-play-card-2-filled:before {
	content: "𐂁"
}
.ti-play-card-3:before {
	content: "𐁙"
}
.ti-play-card-3-filled:before {
	content: "𐂀"
}
.ti-play-card-4:before {
	content: "𐁘"
}
.ti-play-card-4-filled:before {
	content: "𐁿"
}
.ti-play-card-5:before {
	content: "𐁗"
}
.ti-play-card-5-filled:before {
	content: "𐁾"
}
.ti-play-card-6:before {
	content: "𐁖"
}
.ti-play-card-6-filled:before {
	content: "𐁽"
}
.ti-play-card-7:before {
	content: "𐁕"
}
.ti-play-card-7-filled:before {
	content: "𐁼"
}
.ti-play-card-8:before {
	content: "𐁔"
}
.ti-play-card-8-filled:before {
	content: "𐁻"
}
.ti-play-card-9:before {
	content: "𐁓"
}
.ti-play-card-9-filled:before {
	content: "𐁺"
}
.ti-play-card-a:before {
	content: "𐁒"
}
.ti-play-card-a-filled:before {
	content: "𐁹"
}
.ti-play-card-j:before {
	content: "𐁑"
}
.ti-play-card-j-filled:before {
	content: "𐁸"
}
.ti-play-card-k:before {
	content: "𐁐"
}
.ti-play-card-k-filled:before {
	content: "𐁷"
}
.ti-play-card-off:before {
	content: ""
}
.ti-play-card-q:before {
	content: "𐁏"
}
.ti-play-card-q-filled:before {
	content: "𐁶"
}
.ti-play-card-star:before {
	content: "𐁎"
}
.ti-play-card-star-filled:before {
	content: "𐁵"
}
.ti-play-football:before {
	content: "逸"
}
.ti-play-handball:before {
	content: "難"
}
.ti-play-volleyball:before {
	content: "響"
}
.ti-player-eject:before {
	content: ""
}
.ti-player-eject-filled:before {
	content: ""
}
.ti-player-pause:before {
	content: ""
}
.ti-player-pause-filled:before {
	content: ""
}
.ti-player-play:before {
	content: ""
}
.ti-player-play-filled:before {
	content: ""
}
.ti-player-record:before {
	content: ""
}
.ti-player-record-filled:before {
	content: ""
}
.ti-player-skip-back:before {
	content: ""
}
.ti-player-skip-back-filled:before {
	content: ""
}
.ti-player-skip-forward:before {
	content: ""
}
.ti-player-skip-forward-filled:before {
	content: ""
}
.ti-player-stop:before {
	content: ""
}
.ti-player-stop-filled:before {
	content: ""
}
.ti-player-track-next:before {
	content: ""
}
.ti-player-track-next-filled:before {
	content: ""
}
.ti-player-track-prev:before {
	content: ""
}
.ti-player-track-prev-filled:before {
	content: ""
}
.ti-playlist:before {
	content: ""
}
.ti-playlist-add:before {
	content: ""
}
.ti-playlist-off:before {
	content: ""
}
.ti-playlist-x:before {
	content: ""
}
.ti-playstation-circle:before {
	content: ""
}
.ti-playstation-square:before {
	content: ""
}
.ti-playstation-triangle:before {
	content: ""
}
.ti-playstation-x:before {
	content: ""
}
.ti-plug:before {
	content: ""
}
.ti-plug-connected:before {
	content: ""
}
.ti-plug-connected-x:before {
	content: ""
}
.ti-plug-off:before {
	content: ""
}
.ti-plug-x:before {
	content: ""
}
.ti-plus:before {
	content: ""
}
.ti-plus-equal:before {
	content: ""
}
.ti-plus-minus:before {
	content: ""
}
.ti-png:before {
	content: ""
}
.ti-podium:before {
	content: ""
}
.ti-podium-off:before {
	content: ""
}
.ti-point:before {
	content: ""
}
.ti-point-filled:before {
	content: ""
}
.ti-point-off:before {
	content: ""
}
.ti-pointer:before {
	content: ""
}
.ti-pointer-bolt:before {
	content: "蓮"
}
.ti-pointer-cancel:before {
	content: "連"
}
.ti-pointer-check:before {
	content: "鍊"
}
.ti-pointer-code:before {
	content: "列"
}
.ti-pointer-cog:before {
	content: "劣"
}
.ti-pointer-dollar:before {
	content: "咽"
}
.ti-pointer-down:before {
	content: "烈"
}
.ti-pointer-exclamation:before {
	content: "裂"
}
.ti-pointer-filled:before {
	content: "אּ"
}
.ti-pointer-heart:before {
	content: "說"
}
.ti-pointer-minus:before {
	content: "廉"
}
.ti-pointer-off:before {
	content: "念"
}
.ti-pointer-pause:before {
	content: "捻"
}
.ti-pointer-pin:before {
	content: "殮"
}
.ti-pointer-plus:before {
	content: "簾"
}
.ti-pointer-question:before {
	content: "獵"
}
.ti-pointer-search:before {
	content: "令"
}
.ti-pointer-share:before {
	content: "囹"
}
.ti-pointer-star:before {
	content: "寧"
}
.ti-pointer-up:before {
	content: "嶺"
}
.ti-pointer-x:before {
	content: "怜"
}
.ti-pokeball:before {
	content: ""
}
.ti-pokeball-off:before {
	content: ""
}
.ti-poker-chip:before {
	content: ""
}
.ti-polaroid:before {
	content: ""
}
.ti-polaroid-filled:before {
	content: "碑"
}
.ti-polygon:before {
	content: ""
}
.ti-polygon-off:before {
	content: ""
}
.ti-poo:before {
	content: ""
}
.ti-poo-filled:before {
	content: "ﻉ"
}
.ti-pool:before {
	content: ""
}
.ti-pool-off:before {
	content: ""
}
.ti-power:before {
	content: ""
}
.ti-pray:before {
	content: ""
}
.ti-premium-rights:before {
	content: ""
}
.ti-prescription:before {
	content: ""
}
.ti-presentation:before {
	content: ""
}
.ti-presentation-analytics:before {
	content: ""
}
.ti-presentation-analytics-filled:before {
	content: "｝"
}
.ti-presentation-filled:before {
	content: "｜"
}
.ti-presentation-off:before {
	content: ""
}
.ti-printer:before {
	content: ""
}
.ti-printer-off:before {
	content: ""
}
.ti-prism:before {
	content: "缾"
}
.ti-prism-light:before {
	content: "ﺦ"
}
.ti-prism-off:before {
	content: "絛"
}
.ti-prism-plus:before {
	content: "練"
}
.ti-prison:before {
	content: ""
}
.ti-progress:before {
	content: "嗀"
}
.ti-progress-alert:before {
	content: "輻"
}
.ti-progress-bolt:before {
	content: "行"
}
.ti-progress-check:before {
	content: "降"
}
.ti-progress-down:before {
	content: "見"
}
.ti-progress-help:before {
	content: "廓"
}
.ti-progress-x:before {
	content: "兀"
}
.ti-prompt:before {
	content: ""
}
.ti-prong:before {
	content: "ﶡ"
}
.ti-propeller:before {
	content: ""
}
.ti-propeller-off:before {
	content: ""
}
.ti-protocol:before {
	content: "ﶁ"
}
.ti-pumpkin-scary:before {
	content: ""
}
.ti-puzzle:before {
	content: ""
}
.ti-puzzle-2:before {
	content: ""
}
.ti-puzzle-filled:before {
	content: ""
}
.ti-puzzle-off:before {
	content: ""
}
.ti-pyramid:before {
	content: ""
}
.ti-pyramid-off:before {
	content: ""
}
.ti-pyramid-plus:before {
	content: "者"
}
.ti-qrcode:before {
	content: ""
}
.ti-qrcode-off:before {
	content: ""
}
.ti-question-mark:before {
	content: ""
}
.ti-quote:before {
	content: ""
}
.ti-quote-filled:before {
	content: "𐂜"
}
.ti-quote-off:before {
	content: ""
}
.ti-quotes:before {
	content: "ﬞ"
}
.ti-radar:before {
	content: ""
}
.ti-radar-2:before {
	content: ""
}
.ti-radar-filled:before {
	content: "︍"
}
.ti-radar-off:before {
	content: ""
}
.ti-radio:before {
	content: ""
}
.ti-radio-off:before {
	content: ""
}
.ti-radioactive:before {
	content: ""
}
.ti-radioactive-filled:before {
	content: ""
}
.ti-radioactive-off:before {
	content: ""
}
.ti-radius-bottom-left:before {
	content: ""
}
.ti-radius-bottom-right:before {
	content: ""
}
.ti-radius-top-left:before {
	content: ""
}
.ti-radius-top-right:before {
	content: ""
}
.ti-rainbow:before {
	content: ""
}
.ti-rainbow-off:before {
	content: ""
}
.ti-rating-12-plus:before {
	content: ""
}
.ti-rating-14-plus:before {
	content: ""
}
.ti-rating-16-plus:before {
	content: ""
}
.ti-rating-18-plus:before {
	content: ""
}
.ti-rating-21-plus:before {
	content: ""
}
.ti-razor:before {
	content: ""
}
.ti-razor-electric:before {
	content: ""
}
.ti-receipt:before {
	content: ""
}
.ti-receipt-2:before {
	content: ""
}
.ti-receipt-bitcoin:before {
	content: "ﵦ"
}
.ti-receipt-dollar:before {
	content: "ﵧ"
}
.ti-receipt-dollar-filled:before {
	content: "𐅽"
}
.ti-receipt-euro:before {
	content: "ﵨ"
}
.ti-receipt-euro-filled:before {
	content: "𐅼"
}
.ti-receipt-filled:before {
	content: "＆"
}
.ti-receipt-off:before {
	content: ""
}
.ti-receipt-pound:before {
	content: "ﵩ"
}
.ti-receipt-pound-filled:before {
	content: "𐅻"
}
.ti-receipt-refund:before {
	content: ""
}
.ti-receipt-rupee:before {
	content: "ﶂ"
}
.ti-receipt-rupee-filled:before {
	content: "𐅺"
}
.ti-receipt-tax:before {
	content: ""
}
.ti-receipt-yen:before {
	content: "ﵪ"
}
.ti-receipt-yen-filled:before {
	content: "𐅹"
}
.ti-receipt-yuan:before {
	content: "ﵫ"
}
.ti-receipt-yuan-filled:before {
	content: "𐅸"
}
.ti-recharging:before {
	content: ""
}
.ti-record-mail:before {
	content: ""
}
.ti-record-mail-off:before {
	content: ""
}
.ti-rectangle:before {
	content: ""
}
.ti-rectangle-filled:before {
	content: ""
}
.ti-rectangle-rounded-bottom:before {
	content: "﫭"
}
.ti-rectangle-rounded-top:before {
	content: "﫮"
}
.ti-rectangle-vertical:before {
	content: ""
}
.ti-rectangle-vertical-filled:before {
	content: ""
}
.ti-rectangular-prism:before {
	content: "蝹"
}
.ti-rectangular-prism-off:before {
	content: "荒"
}
.ti-rectangular-prism-plus:before {
	content: "華"
}
.ti-recycle:before {
	content: ""
}
.ti-recycle-off:before {
	content: ""
}
.ti-refresh:before {
	content: ""
}
.ti-refresh-alert:before {
	content: ""
}
.ti-refresh-dot:before {
	content: ""
}
.ti-refresh-off:before {
	content: ""
}
.ti-regex:before {
	content: ""
}
.ti-regex-off:before {
	content: ""
}
.ti-registered:before {
	content: ""
}
.ti-relation-many-to-many:before {
	content: ""
}
.ti-relation-many-to-many-filled:before {
	content: "︌"
}
.ti-relation-one-to-many:before {
	content: ""
}
.ti-relation-one-to-many-filled:before {
	content: "︋"
}
.ti-relation-one-to-one:before {
	content: ""
}
.ti-relation-one-to-one-filled:before {
	content: "︊"
}
.ti-reload:before {
	content: ""
}
.ti-reorder:before {
	content: "ﰕ"
}
.ti-repeat:before {
	content: ""
}
.ti-repeat-off:before {
	content: ""
}
.ti-repeat-once:before {
	content: ""
}
.ti-replace:before {
	content: ""
}
.ti-replace-filled:before {
	content: ""
}
.ti-replace-off:before {
	content: ""
}
.ti-replace-user:before {
	content: "𐃰"
}
.ti-report:before {
	content: ""
}
.ti-report-analytics:before {
	content: ""
}
.ti-report-medical:before {
	content: ""
}
.ti-report-money:before {
	content: ""
}
.ti-report-off:before {
	content: ""
}
.ti-report-search:before {
	content: ""
}
.ti-reserved-line:before {
	content: "臨"
}
.ti-resize:before {
	content: ""
}
.ti-restore:before {
	content: "﫽"
}
.ti-rewind-backward-10:before {
	content: "諸"
}
.ti-rewind-backward-15:before {
	content: "請"
}
.ti-rewind-backward-20:before {
	content: "謁"
}
.ti-rewind-backward-30:before {
	content: "諾"
}
.ti-rewind-backward-40:before {
	content: "諭"
}
.ti-rewind-backward-5:before {
	content: "謹"
}
.ti-rewind-backward-50:before {
	content: "變"
}
.ti-rewind-backward-60:before {
	content: "贈"
}
.ti-rewind-forward-10:before {
	content: "輸"
}
.ti-rewind-forward-15:before {
	content: "遲"
}
.ti-rewind-forward-20:before {
	content: "醙"
}
.ti-rewind-forward-30:before {
	content: "鉶"
}
.ti-rewind-forward-40:before {
	content: "陼"
}
.ti-rewind-forward-5:before {
	content: "難"
}
.ti-rewind-forward-50:before {
	content: "靖"
}
.ti-rewind-forward-60:before {
	content: "韛"
}
.ti-ribbon-health:before {
	content: ""
}
.ti-rings:before {
	content: "頻"
}
.ti-ripple:before {
	content: ""
}
.ti-ripple-off:before {
	content: ""
}
.ti-road:before {
	content: ""
}
.ti-road-off:before {
	content: ""
}
.ti-road-sign:before {
	content: ""
}
.ti-robot:before {
	content: ""
}
.ti-robot-face:before {
	content: "ﲾ"
}
.ti-robot-off:before {
	content: ""
}
.ti-rocket:before {
	content: ""
}
.ti-rocket-off:before {
	content: ""
}
.ti-roller-skating:before {
	content: ""
}
.ti-rollercoaster:before {
	content: ""
}
.ti-rollercoaster-filled:before {
	content: "𐃷"
}
.ti-rollercoaster-off:before {
	content: ""
}
.ti-rosette:before {
	content: ""
}
.ti-rosette-discount:before {
	content: ""
}
.ti-rosette-discount-check:before {
	content: ""
}
.ti-rosette-discount-check-filled:before {
	content: ""
}
.ti-rosette-discount-check-off:before {
	content: "０"
}
.ti-rosette-discount-filled:before {
	content: "％"
}
.ti-rosette-discount-off:before {
	content: ""
}
.ti-rosette-filled:before {
	content: ""
}
.ti-rosette-number-0:before {
	content: ""
}
.ti-rosette-number-1:before {
	content: ""
}
.ti-rosette-number-2:before {
	content: ""
}
.ti-rosette-number-3:before {
	content: ""
}
.ti-rosette-number-4:before {
	content: ""
}
.ti-rosette-number-5:before {
	content: ""
}
.ti-rosette-number-6:before {
	content: ""
}
.ti-rosette-number-7:before {
	content: ""
}
.ti-rosette-number-8:before {
	content: ""
}
.ti-rosette-number-9:before {
	content: ""
}
.ti-rotate:before {
	content: ""
}
.ti-rotate-2:before {
	content: ""
}
.ti-rotate-360:before {
	content: ""
}
.ti-rotate-3d:before {
	content: ""
}
.ti-rotate-clockwise:before {
	content: ""
}
.ti-rotate-clockwise-2:before {
	content: ""
}
.ti-rotate-dot:before {
	content: ""
}
.ti-rotate-rectangle:before {
	content: ""
}
.ti-route:before {
	content: ""
}
.ti-route-2:before {
	content: ""
}
.ti-route-alt-left:before {
	content: "ﲩ"
}
.ti-route-alt-right:before {
	content: "ﲪ"
}
.ti-route-off:before {
	content: ""
}
.ti-route-scan:before {
	content: "ﲿ"
}
.ti-route-square:before {
	content: "ﲬ"
}
.ti-route-square-2:before {
	content: "ﲫ"
}
.ti-route-x:before {
	content: "ﲮ"
}
.ti-route-x-2:before {
	content: "ﲭ"
}
.ti-router:before {
	content: ""
}
.ti-router-off:before {
	content: ""
}
.ti-row-insert-bottom:before {
	content: ""
}
.ti-row-insert-top:before {
	content: ""
}
.ti-row-remove:before {
	content: "﫾"
}
.ti-rss:before {
	content: ""
}
.ti-rubber-stamp:before {
	content: ""
}
.ti-rubber-stamp-off:before {
	content: ""
}
.ti-ruler:before {
	content: ""
}
.ti-ruler-2:before {
	content: ""
}
.ti-ruler-2-off:before {
	content: ""
}
.ti-ruler-3:before {
	content: ""
}
.ti-ruler-measure:before {
	content: ""
}
.ti-ruler-measure-2:before {
	content: "／"
}
.ti-ruler-off:before {
	content: ""
}
.ti-run:before {
	content: ""
}
.ti-rv-truck:before {
	content: "ﳀ"
}
.ti-s-turn-down:before {
	content: ""
}
.ti-s-turn-left:before {
	content: ""
}
.ti-s-turn-right:before {
	content: ""
}
.ti-s-turn-up:before {
	content: ""
}
.ti-sailboat:before {
	content: ""
}
.ti-sailboat-2:before {
	content: ""
}
.ti-sailboat-off:before {
	content: ""
}
.ti-salad:before {
	content: ""
}
.ti-salad-filled:before {
	content: "𐀇"
}
.ti-salt:before {
	content: ""
}
.ti-sandbox:before {
	content: "ﵬ"
}
.ti-satellite:before {
	content: ""
}
.ti-satellite-off:before {
	content: ""
}
.ti-sausage:before {
	content: ""
}
.ti-scale:before {
	content: ""
}
.ti-scale-off:before {
	content: ""
}
.ti-scale-outline:before {
	content: ""
}
.ti-scale-outline-off:before {
	content: ""
}
.ti-scan:before {
	content: ""
}
.ti-scan-eye:before {
	content: ""
}
.ti-scan-position:before {
	content: "ﶬ"
}
.ti-schema:before {
	content: ""
}
.ti-schema-off:before {
	content: ""
}
.ti-school:before {
	content: ""
}
.ti-school-bell:before {
	content: ""
}
.ti-school-off:before {
	content: ""
}
.ti-scissors:before {
	content: ""
}
.ti-scissors-off:before {
	content: ""
}
.ti-scooter:before {
	content: ""
}
.ti-scooter-electric:before {
	content: ""
}
.ti-scoreboard:before {
	content: "恵"
}
.ti-screen-share:before {
	content: ""
}
.ti-screen-share-off:before {
	content: ""
}
.ti-screenshot:before {
	content: ""
}
.ti-scribble:before {
	content: ""
}
.ti-scribble-off:before {
	content: ""
}
.ti-script:before {
	content: ""
}
.ti-script-minus:before {
	content: ""
}
.ti-script-plus:before {
	content: ""
}
.ti-script-x:before {
	content: ""
}
.ti-scuba-diving:before {
	content: "﵎"
}
.ti-scuba-diving-tank:before {
	content: "ﻺ"
}
.ti-scuba-diving-tank-filled:before {
	content: "＄"
}
.ti-scuba-mask:before {
	content: ""
}
.ti-scuba-mask-off:before {
	content: ""
}
.ti-sdk:before {
	content: ""
}
.ti-search:before {
	content: ""
}
.ti-search-off:before {
	content: ""
}
.ti-section:before {
	content: ""
}
.ti-section-filled:before {
	content: "︉"
}
.ti-section-sign:before {
	content: ""
}
.ti-seedling:before {
	content: ""
}
.ti-seedling-filled:before {
	content: "𐀆"
}
.ti-seedling-off:before {
	content: ""
}
.ti-select:before {
	content: ""
}
.ti-select-all:before {
	content: "立"
}
.ti-selector:before {
	content: ""
}
.ti-send:before {
	content: ""
}
.ti-send-2:before {
	content: "ﵝ"
}
.ti-send-off:before {
	content: ""
}
.ti-seo:before {
	content: ""
}
.ti-separator:before {
	content: ""
}
.ti-separator-horizontal:before {
	content: ""
}
.ti-separator-vertical:before {
	content: ""
}
.ti-server:before {
	content: ""
}
.ti-server-2:before {
	content: ""
}
.ti-server-bolt:before {
	content: ""
}
.ti-server-cog:before {
	content: ""
}
.ti-server-off:before {
	content: ""
}
.ti-server-spark:before {
	content: "ﾯ"
}
.ti-servicemark:before {
	content: ""
}
.ti-settings:before {
	content: ""
}
.ti-settings-2:before {
	content: ""
}
.ti-settings-automation:before {
	content: ""
}
.ti-settings-bolt:before {
	content: "玲"
}
.ti-settings-cancel:before {
	content: "瑩"
}
.ti-settings-check:before {
	content: "羚"
}
.ti-settings-code:before {
	content: "聆"
}
.ti-settings-cog:before {
	content: "鈴"
}
.ti-settings-dollar:before {
	content: "零"
}
.ti-settings-down:before {
	content: "靈"
}
.ti-settings-exclamation:before {
	content: "領"
}
.ti-settings-filled:before {
	content: ""
}
.ti-settings-heart:before {
	content: "例"
}
.ti-settings-minus:before {
	content: "禮"
}
.ti-settings-off:before {
	content: ""
}
.ti-settings-pause:before {
	content: "醴"
}
.ti-settings-pin:before {
	content: "隸"
}
.ti-settings-plus:before {
	content: "惡"
}
.ti-settings-question:before {
	content: "了"
}
.ti-settings-search:before {
	content: "僚"
}
.ti-settings-share:before {
	content: "寮"
}
.ti-settings-spark:before {
	content: "ﾮ"
}
.ti-settings-star:before {
	content: "尿"
}
.ti-settings-up:before {
	content: "料"
}
.ti-settings-x:before {
	content: "樂"
}
.ti-shadow:before {
	content: ""
}
.ti-shadow-off:before {
	content: ""
}
.ti-shape:before {
	content: ""
}
.ti-shape-2:before {
	content: ""
}
.ti-shape-3:before {
	content: ""
}
.ti-shape-off:before {
	content: ""
}
.ti-share:before {
	content: ""
}
.ti-share-2:before {
	content: ""
}
.ti-share-3:before {
	content: ""
}
.ti-share-off:before {
	content: ""
}
.ti-shareplay:before {
	content: "ﺥ"
}
.ti-shield:before {
	content: ""
}
.ti-shield-bolt:before {
	content: "燎"
}
.ti-shield-cancel:before {
	content: "療"
}
.ti-shield-check:before {
	content: ""
}
.ti-shield-check-filled:before {
	content: ""
}
.ti-shield-checkered:before {
	content: ""
}
.ti-shield-checkered-filled:before {
	content: ""
}
.ti-shield-chevron:before {
	content: ""
}
.ti-shield-code:before {
	content: "蓼"
}
.ti-shield-cog:before {
	content: "遼"
}
.ti-shield-dollar:before {
	content: "龍"
}
.ti-shield-down:before {
	content: "暈"
}
.ti-shield-exclamation:before {
	content: "阮"
}
.ti-shield-filled:before {
	content: ""
}
.ti-shield-half:before {
	content: ""
}
.ti-shield-half-filled:before {
	content: ""
}
.ti-shield-heart:before {
	content: "劉"
}
.ti-shield-lock:before {
	content: ""
}
.ti-shield-lock-filled:before {
	content: ""
}
.ti-shield-minus:before {
	content: "杻"
}
.ti-shield-off:before {
	content: ""
}
.ti-shield-pause:before {
	content: "柳"
}
.ti-shield-pin:before {
	content: "流"
}
.ti-shield-plus:before {
	content: "溜"
}
.ti-shield-question:before {
	content: "琉"
}
.ti-shield-search:before {
	content: "留"
}
.ti-shield-share:before {
	content: "硫"
}
.ti-shield-star:before {
	content: "紐"
}
.ti-shield-up:before {
	content: "類"
}
.ti-shield-x:before {
	content: ""
}
.ti-ship:before {
	content: ""
}
.ti-ship-off:before {
	content: ""
}
.ti-shirt:before {
	content: ""
}
.ti-shirt-filled:before {
	content: ""
}
.ti-shirt-off:before {
	content: ""
}
.ti-shirt-sport:before {
	content: ""
}
.ti-shoe:before {
	content: ""
}
.ti-shoe-off:before {
	content: ""
}
.ti-shopping-bag:before {
	content: ""
}
.ti-shopping-bag-check:before {
	content: "ﰖ"
}
.ti-shopping-bag-discount:before {
	content: "ﰗ"
}
.ti-shopping-bag-edit:before {
	content: "ﰘ"
}
.ti-shopping-bag-exclamation:before {
	content: "ﰙ"
}
.ti-shopping-bag-heart:before {
	content: "ﶢ"
}
.ti-shopping-bag-minus:before {
	content: "ﰚ"
}
.ti-shopping-bag-plus:before {
	content: "ﰛ"
}
.ti-shopping-bag-search:before {
	content: "ﰜ"
}
.ti-shopping-bag-x:before {
	content: "ﰝ"
}
.ti-shopping-cart:before {
	content: ""
}
.ti-shopping-cart-bolt:before {
	content: "ﭗ"
}
.ti-shopping-cart-cancel:before {
	content: "ﭘ"
}
.ti-shopping-cart-check:before {
	content: "ﭙ"
}
.ti-shopping-cart-code:before {
	content: "ﭚ"
}
.ti-shopping-cart-cog:before {
	content: "ﭛ"
}
.ti-shopping-cart-copy:before {
	content: "ﭜ"
}
.ti-shopping-cart-discount:before {
	content: "ﭝ"
}
.ti-shopping-cart-dollar:before {
	content: "ﭞ"
}
.ti-shopping-cart-down:before {
	content: "ﭟ"
}
.ti-shopping-cart-exclamation:before {
	content: "ﭠ"
}
.ti-shopping-cart-filled:before {
	content: "ﰿ"
}
.ti-shopping-cart-heart:before {
	content: "ﭡ"
}
.ti-shopping-cart-minus:before {
	content: "ﭢ"
}
.ti-shopping-cart-off:before {
	content: ""
}
.ti-shopping-cart-pause:before {
	content: "ﭣ"
}
.ti-shopping-cart-pin:before {
	content: "ﭤ"
}
.ti-shopping-cart-plus:before {
	content: "ﭥ"
}
.ti-shopping-cart-question:before {
	content: "ﭦ"
}
.ti-shopping-cart-search:before {
	content: "ﭧ"
}
.ti-shopping-cart-share:before {
	content: "ﭨ"
}
.ti-shopping-cart-star:before {
	content: "ﭩ"
}
.ti-shopping-cart-up:before {
	content: "ﭪ"
}
.ti-shopping-cart-x:before {
	content: "ﭫ"
}
.ti-shovel:before {
	content: ""
}
.ti-shovel-pitchforks:before {
	content: "ﴺ"
}
.ti-shredder:before {
	content: ""
}
.ti-sign-left:before {
	content: ""
}
.ti-sign-left-filled:before {
	content: ""
}
.ti-sign-right:before {
	content: ""
}
.ti-sign-right-filled:before {
	content: ""
}
.ti-signal-2g:before {
	content: ""
}
.ti-signal-3g:before {
	content: ""
}
.ti-signal-4g:before {
	content: ""
}
.ti-signal-4g-plus:before {
	content: ""
}
.ti-signal-5g:before {
	content: ""
}
.ti-signal-6g:before {
	content: "笠"
}
.ti-signal-e:before {
	content: "粒"
}
.ti-signal-g:before {
	content: "狀"
}
.ti-signal-h:before {
	content: "識"
}
.ti-signal-h-plus:before {
	content: "炙"
}
.ti-signal-lte:before {
	content: "什"
}
.ti-signature:before {
	content: ""
}
.ti-signature-off:before {
	content: ""
}
.ti-sitemap:before {
	content: ""
}
.ti-sitemap-filled:before {
	content: "𐁫"
}
.ti-sitemap-off:before {
	content: ""
}
.ti-skateboard:before {
	content: ""
}
.ti-skateboard-off:before {
	content: ""
}
.ti-skateboarding:before {
	content: "響"
}
.ti-skew-x:before {
	content: "ﴻ"
}
.ti-skew-y:before {
	content: "ﴼ"
}
.ti-ski-jumping:before {
	content: "𤋮"
}
.ti-skull:before {
	content: ""
}
.ti-slash:before {
	content: ""
}
.ti-slashes:before {
	content: ""
}
.ti-sleigh:before {
	content: ""
}
.ti-slice:before {
	content: ""
}
.ti-slideshow:before {
	content: ""
}
.ti-smart-home:before {
	content: ""
}
.ti-smart-home-off:before {
	content: ""
}
.ti-smoking:before {
	content: ""
}
.ti-smoking-no:before {
	content: ""
}
.ti-snowboarding:before {
	content: "﵏"
}
.ti-snowflake:before {
	content: ""
}
.ti-snowflake-off:before {
	content: ""
}
.ti-snowman:before {
	content: ""
}
.ti-soccer-field:before {
	content: ""
}
.ti-social:before {
	content: ""
}
.ti-social-off:before {
	content: ""
}
.ti-sock:before {
	content: ""
}
.ti-sofa:before {
	content: ""
}
.ti-sofa-off:before {
	content: ""
}
.ti-solar-electricity:before {
	content: "ﳁ"
}
.ti-solar-panel:before {
	content: ""
}
.ti-solar-panel-2:before {
	content: ""
}
.ti-sort-0-9:before {
	content: ""
}
.ti-sort-9-0:before {
	content: ""
}
.ti-sort-a-z:before {
	content: ""
}
.ti-sort-ascending:before {
	content: ""
}
.ti-sort-ascending-2:before {
	content: ""
}
.ti-sort-ascending-2-filled:before {
	content: "｛"
}
.ti-sort-ascending-letters:before {
	content: ""
}
.ti-sort-ascending-numbers:before {
	content: ""
}
.ti-sort-ascending-shapes:before {
	content: "ﶔ"
}
.ti-sort-ascending-shapes-filled:before {
	content: "ｚ"
}
.ti-sort-ascending-small-big:before {
	content: "ﶕ"
}
.ti-sort-descending:before {
	content: ""
}
.ti-sort-descending-2:before {
	content: ""
}
.ti-sort-descending-2-filled:before {
	content: "ｙ"
}
.ti-sort-descending-letters:before {
	content: ""
}
.ti-sort-descending-numbers:before {
	content: ""
}
.ti-sort-descending-shapes:before {
	content: "ﶗ"
}
.ti-sort-descending-shapes-filled:before {
	content: "ｘ"
}
.ti-sort-descending-small-big:before {
	content: "ﶖ"
}
.ti-sort-z-a:before {
	content: ""
}
.ti-sos:before {
	content: ""
}
.ti-soup:before {
	content: ""
}
.ti-soup-filled:before {
	content: "︈"
}
.ti-soup-off:before {
	content: ""
}
.ti-source-code:before {
	content: ""
}
.ti-space:before {
	content: ""
}
.ti-space-off:before {
	content: ""
}
.ti-spaces:before {
	content: "ﺤ"
}
.ti-spacing-horizontal:before {
	content: ""
}
.ti-spacing-vertical:before {
	content: ""
}
.ti-spade:before {
	content: ""
}
.ti-spade-filled:before {
	content: ""
}
.ti-sparkles:before {
	content: ""
}
.ti-speakerphone:before {
	content: ""
}
.ti-speedboat:before {
	content: ""
}
.ti-speedboat-filled:before {
	content: "𐃶"
}
.ti-sphere:before {
	content: "視"
}
.ti-sphere-off:before {
	content: "襁"
}
.ti-sphere-plus:before {
	content: "覆"
}
.ti-spider:before {
	content: ""
}
.ti-spider-filled:before {
	content: "𐄉"
}
.ti-spiral:before {
	content: ""
}
.ti-spiral-off:before {
	content: ""
}
.ti-sport-billard:before {
	content: ""
}
.ti-spray:before {
	content: ""
}
.ti-spy:before {
	content: ""
}
.ti-spy-off:before {
	content: ""
}
.ti-sql:before {
	content: ""
}
.ti-square:before {
	content: ""
}
.ti-square-arrow-down:before {
	content: ""
}
.ti-square-arrow-down-filled:before {
	content: "בּ"
}
.ti-square-arrow-left:before {
	content: ""
}
.ti-square-arrow-left-filled:before {
	content: "גּ"
}
.ti-square-arrow-right:before {
	content: ""
}
.ti-square-arrow-right-filled:before {
	content: "דּ"
}
.ti-square-arrow-up:before {
	content: ""
}
.ti-square-arrow-up-filled:before {
	content: "הּ"
}
.ti-square-asterisk:before {
	content: ""
}
.ti-square-asterisk-filled:before {
	content: "וּ"
}
.ti-square-check:before {
	content: ""
}
.ti-square-check-filled:before {
	content: ""
}
.ti-square-chevron-down:before {
	content: ""
}
.ti-square-chevron-down-filled:before {
	content: "זּ"
}
.ti-square-chevron-left:before {
	content: ""
}
.ti-square-chevron-left-filled:before {
	content: "﬷"
}
.ti-square-chevron-right:before {
	content: ""
}
.ti-square-chevron-right-filled:before {
	content: "טּ"
}
.ti-square-chevron-up:before {
	content: ""
}
.ti-square-chevron-up-filled:before {
	content: "יּ"
}
.ti-square-chevrons-down:before {
	content: ""
}
.ti-square-chevrons-down-filled:before {
	content: "ךּ"
}
.ti-square-chevrons-left:before {
	content: ""
}
.ti-square-chevrons-left-filled:before {
	content: "כּ"
}
.ti-square-chevrons-right:before {
	content: ""
}
.ti-square-chevrons-right-filled:before {
	content: "לּ"
}
.ti-square-chevrons-up:before {
	content: ""
}
.ti-square-chevrons-up-filled:before {
	content: "﬽"
}
.ti-square-dashed:before {
	content: "𐂻"
}
.ti-square-dot:before {
	content: ""
}
.ti-square-dot-filled:before {
	content: "מּ"
}
.ti-square-f0:before {
	content: ""
}
.ti-square-f0-filled:before {
	content: ""
}
.ti-square-f1:before {
	content: ""
}
.ti-square-f1-filled:before {
	content: ""
}
.ti-square-f2:before {
	content: ""
}
.ti-square-f2-filled:before {
	content: ""
}
.ti-square-f3:before {
	content: ""
}
.ti-square-f3-filled:before {
	content: ""
}
.ti-square-f4:before {
	content: ""
}
.ti-square-f4-filled:before {
	content: ""
}
.ti-square-f5:before {
	content: ""
}
.ti-square-f5-filled:before {
	content: ""
}
.ti-square-f6:before {
	content: ""
}
.ti-square-f6-filled:before {
	content: ""
}
.ti-square-f7:before {
	content: ""
}
.ti-square-f7-filled:before {
	content: ""
}
.ti-square-f8:before {
	content: ""
}
.ti-square-f8-filled:before {
	content: ""
}
.ti-square-f9:before {
	content: ""
}
.ti-square-f9-filled:before {
	content: ""
}
.ti-square-filled:before {
	content: "ﱀ"
}
.ti-square-forbid:before {
	content: ""
}
.ti-square-forbid-2:before {
	content: ""
}
.ti-square-half:before {
	content: ""
}
.ti-square-key:before {
	content: ""
}
.ti-square-letter-a:before {
	content: ""
}
.ti-square-letter-a-filled:before {
	content: "︇"
}
.ti-square-letter-b:before {
	content: ""
}
.ti-square-letter-b-filled:before {
	content: "︆"
}
.ti-square-letter-c:before {
	content: ""
}
.ti-square-letter-c-filled:before {
	content: "︅"
}
.ti-square-letter-d:before {
	content: ""
}
.ti-square-letter-d-filled:before {
	content: "︄"
}
.ti-square-letter-e:before {
	content: ""
}
.ti-square-letter-e-filled:before {
	content: "︃"
}
.ti-square-letter-f:before {
	content: ""
}
.ti-square-letter-f-filled:before {
	content: "︂"
}
.ti-square-letter-g:before {
	content: ""
}
.ti-square-letter-g-filled:before {
	content: "︁"
}
.ti-square-letter-h:before {
	content: ""
}
.ti-square-letter-h-filled:before {
	content: "︀"
}
.ti-square-letter-i:before {
	content: ""
}
.ti-square-letter-i-filled:before {
	content: "﷿"
}
.ti-square-letter-j:before {
	content: ""
}
.ti-square-letter-j-filled:before {
	content: "﷾"
}
.ti-square-letter-k:before {
	content: ""
}
.ti-square-letter-k-filled:before {
	content: "﷽"
}
.ti-square-letter-l:before {
	content: ""
}
.ti-square-letter-l-filled:before {
	content: "﷼"
}
.ti-square-letter-m:before {
	content: ""
}
.ti-square-letter-m-filled:before {
	content: "ﷻ"
}
.ti-square-letter-n:before {
	content: ""
}
.ti-square-letter-n-filled:before {
	content: "ﷺ"
}
.ti-square-letter-o:before {
	content: ""
}
.ti-square-letter-o-filled:before {
	content: "ﷹ"
}
.ti-square-letter-p:before {
	content: ""
}
.ti-square-letter-p-filled:before {
	content: "ﷸ"
}
.ti-square-letter-q:before {
	content: ""
}
.ti-square-letter-q-filled:before {
	content: "ﷷ"
}
.ti-square-letter-r:before {
	content: ""
}
.ti-square-letter-r-filled:before {
	content: "ﷶ"
}
.ti-square-letter-s:before {
	content: ""
}
.ti-square-letter-s-filled:before {
	content: "ﷵ"
}
.ti-square-letter-t:before {
	content: ""
}
.ti-square-letter-t-filled:before {
	content: "ﷴ"
}
.ti-square-letter-u:before {
	content: ""
}
.ti-square-letter-u-filled:before {
	content: "ﷳ"
}
.ti-square-letter-v:before {
	content: ""
}
.ti-square-letter-v-filled:before {
	content: "ﷲ"
}
.ti-square-letter-w:before {
	content: ""
}
.ti-square-letter-w-filled:before {
	content: "ﷱ"
}
.ti-square-letter-x:before {
	content: ""
}
.ti-square-letter-x-filled:before {
	content: "ﷰ"
}
.ti-square-letter-y:before {
	content: ""
}
.ti-square-letter-y-filled:before {
	content: "﷯"
}
.ti-square-letter-z:before {
	content: ""
}
.ti-square-letter-z-filled:before {
	content: "﷮"
}
.ti-square-minus:before {
	content: ""
}
.ti-square-minus-filled:before {
	content: "﬿"
}
.ti-square-number-0:before {
	content: ""
}
.ti-square-number-0-filled:before {
	content: ""
}
.ti-square-number-1:before {
	content: ""
}
.ti-square-number-1-filled:before {
	content: ""
}
.ti-square-number-2:before {
	content: ""
}
.ti-square-number-2-filled:before {
	content: ""
}
.ti-square-number-3:before {
	content: ""
}
.ti-square-number-3-filled:before {
	content: ""
}
.ti-square-number-4:before {
	content: ""
}
.ti-square-number-4-filled:before {
	content: ""
}
.ti-square-number-5:before {
	content: ""
}
.ti-square-number-5-filled:before {
	content: ""
}
.ti-square-number-6:before {
	content: ""
}
.ti-square-number-6-filled:before {
	content: ""
}
.ti-square-number-7:before {
	content: ""
}
.ti-square-number-7-filled:before {
	content: ""
}
.ti-square-number-8:before {
	content: ""
}
.ti-square-number-8-filled:before {
	content: ""
}
.ti-square-number-9:before {
	content: ""
}
.ti-square-number-9-filled:before {
	content: ""
}
.ti-square-off:before {
	content: ""
}
.ti-square-percentage:before {
	content: "ﶃ"
}
.ti-square-plus:before {
	content: ""
}
.ti-square-plus-2:before {
	content: "ﲖ"
}
.ti-square-root:before {
	content: ""
}
.ti-square-root-2:before {
	content: ""
}
.ti-square-rotated:before {
	content: ""
}
.ti-square-rotated-filled:before {
	content: ""
}
.ti-square-rotated-forbid:before {
	content: ""
}
.ti-square-rotated-forbid-2:before {
	content: ""
}
.ti-square-rotated-off:before {
	content: ""
}
.ti-square-rounded:before {
	content: ""
}
.ti-square-rounded-arrow-down:before {
	content: ""
}
.ti-square-rounded-arrow-down-filled:before {
	content: ""
}
.ti-square-rounded-arrow-left:before {
	content: ""
}
.ti-square-rounded-arrow-left-filled:before {
	content: ""
}
.ti-square-rounded-arrow-right:before {
	content: ""
}
.ti-square-rounded-arrow-right-filled:before {
	content: ""
}
.ti-square-rounded-arrow-up:before {
	content: ""
}
.ti-square-rounded-arrow-up-filled:before {
	content: ""
}
.ti-square-rounded-check:before {
	content: ""
}
.ti-square-rounded-check-filled:before {
	content: ""
}
.ti-square-rounded-chevron-down:before {
	content: ""
}
.ti-square-rounded-chevron-down-filled:before {
	content: ""
}
.ti-square-rounded-chevron-left:before {
	content: ""
}
.ti-square-rounded-chevron-left-filled:before {
	content: ""
}
.ti-square-rounded-chevron-right:before {
	content: ""
}
.ti-square-rounded-chevron-right-filled:before {
	content: ""
}
.ti-square-rounded-chevron-up:before {
	content: ""
}
.ti-square-rounded-chevron-up-filled:before {
	content: ""
}
.ti-square-rounded-chevrons-down:before {
	content: ""
}
.ti-square-rounded-chevrons-down-filled:before {
	content: ""
}
.ti-square-rounded-chevrons-left:before {
	content: ""
}
.ti-square-rounded-chevrons-left-filled:before {
	content: ""
}
.ti-square-rounded-chevrons-right:before {
	content: ""
}
.ti-square-rounded-chevrons-right-filled:before {
	content: ""
}
.ti-square-rounded-chevrons-up:before {
	content: ""
}
.ti-square-rounded-chevrons-up-filled:before {
	content: ""
}
.ti-square-rounded-filled:before {
	content: ""
}
.ti-square-rounded-letter-a:before {
	content: ""
}
.ti-square-rounded-letter-a-filled:before {
	content: "﷭"
}
.ti-square-rounded-letter-b:before {
	content: ""
}
.ti-square-rounded-letter-b-filled:before {
	content: "﷬"
}
.ti-square-rounded-letter-c:before {
	content: ""
}
.ti-square-rounded-letter-c-filled:before {
	content: "﷫"
}
.ti-square-rounded-letter-d:before {
	content: ""
}
.ti-square-rounded-letter-d-filled:before {
	content: "﷪"
}
.ti-square-rounded-letter-e:before {
	content: ""
}
.ti-square-rounded-letter-e-filled:before {
	content: "﷩"
}
.ti-square-rounded-letter-f:before {
	content: ""
}
.ti-square-rounded-letter-f-filled:before {
	content: "﷨"
}
.ti-square-rounded-letter-g:before {
	content: ""
}
.ti-square-rounded-letter-g-filled:before {
	content: "﷧"
}
.ti-square-rounded-letter-h:before {
	content: ""
}
.ti-square-rounded-letter-h-filled:before {
	content: "﷦"
}
.ti-square-rounded-letter-i:before {
	content: ""
}
.ti-square-rounded-letter-i-filled:before {
	content: "﷥"
}
.ti-square-rounded-letter-j:before {
	content: ""
}
.ti-square-rounded-letter-j-filled:before {
	content: "﷤"
}
.ti-square-rounded-letter-k:before {
	content: ""
}
.ti-square-rounded-letter-k-filled:before {
	content: "﷣"
}
.ti-square-rounded-letter-l:before {
	content: ""
}
.ti-square-rounded-letter-l-filled:before {
	content: "﷢"
}
.ti-square-rounded-letter-m:before {
	content: ""
}
.ti-square-rounded-letter-m-filled:before {
	content: "﷡"
}
.ti-square-rounded-letter-n:before {
	content: ""
}
.ti-square-rounded-letter-n-filled:before {
	content: "﷠"
}
.ti-square-rounded-letter-o:before {
	content: ""
}
.ti-square-rounded-letter-o-filled:before {
	content: "﷟"
}
.ti-square-rounded-letter-p:before {
	content: ""
}
.ti-square-rounded-letter-p-filled:before {
	content: "﷞"
}
.ti-square-rounded-letter-q:before {
	content: ""
}
.ti-square-rounded-letter-q-filled:before {
	content: "﷝"
}
.ti-square-rounded-letter-r:before {
	content: ""
}
.ti-square-rounded-letter-r-filled:before {
	content: "﷜"
}
.ti-square-rounded-letter-s:before {
	content: ""
}
.ti-square-rounded-letter-s-filled:before {
	content: "﷛"
}
.ti-square-rounded-letter-t:before {
	content: ""
}
.ti-square-rounded-letter-t-filled:before {
	content: "﷚"
}
.ti-square-rounded-letter-u:before {
	content: ""
}
.ti-square-rounded-letter-u-filled:before {
	content: "﷙"
}
.ti-square-rounded-letter-v:before {
	content: ""
}
.ti-square-rounded-letter-v-filled:before {
	content: "﷘"
}
.ti-square-rounded-letter-w:before {
	content: ""
}
.ti-square-rounded-letter-w-filled:before {
	content: "﷗"
}
.ti-square-rounded-letter-x:before {
	content: ""
}
.ti-square-rounded-letter-x-filled:before {
	content: "﷖"
}
.ti-square-rounded-letter-y:before {
	content: ""
}
.ti-square-rounded-letter-y-filled:before {
	content: "﷕"
}
.ti-square-rounded-letter-z:before {
	content: ""
}
.ti-square-rounded-letter-z-filled:before {
	content: "﷔"
}
.ti-square-rounded-minus:before {
	content: ""
}
.ti-square-rounded-minus-2:before {
	content: "ﲗ"
}
.ti-square-rounded-minus-filled:before {
	content: "נּ"
}
.ti-square-rounded-number-0:before {
	content: ""
}
.ti-square-rounded-number-0-filled:before {
	content: ""
}
.ti-square-rounded-number-1:before {
	content: ""
}
.ti-square-rounded-number-1-filled:before {
	content: ""
}
.ti-square-rounded-number-2:before {
	content: ""
}
.ti-square-rounded-number-2-filled:before {
	content: ""
}
.ti-square-rounded-number-3:before {
	content: ""
}
.ti-square-rounded-number-3-filled:before {
	content: ""
}
.ti-square-rounded-number-4:before {
	content: ""
}
.ti-square-rounded-number-4-filled:before {
	content: ""
}
.ti-square-rounded-number-5:before {
	content: ""
}
.ti-square-rounded-number-5-filled:before {
	content: ""
}
.ti-square-rounded-number-6:before {
	content: ""
}
.ti-square-rounded-number-6-filled:before {
	content: ""
}
.ti-square-rounded-number-7:before {
	content: ""
}
.ti-square-rounded-number-7-filled:before {
	content: ""
}
.ti-square-rounded-number-8:before {
	content: ""
}
.ti-square-rounded-number-8-filled:before {
	content: ""
}
.ti-square-rounded-number-9:before {
	content: ""
}
.ti-square-rounded-number-9-filled:before {
	content: ""
}
.ti-square-rounded-percentage:before {
	content: "ﶄ"
}
.ti-square-rounded-plus:before {
	content: ""
}
.ti-square-rounded-plus-2:before {
	content: "ﲘ"
}
.ti-square-rounded-plus-filled:before {
	content: ""
}
.ti-square-rounded-x:before {
	content: ""
}
.ti-square-rounded-x-filled:before {
	content: ""
}
.ti-square-toggle:before {
	content: ""
}
.ti-square-toggle-horizontal:before {
	content: ""
}
.ti-square-x:before {
	content: ""
}
.ti-square-x-filled:before {
	content: "סּ"
}
.ti-squares:before {
	content: ""
}
.ti-squares-diagonal:before {
	content: ""
}
.ti-squares-filled:before {
	content: "ﺟ"
}
.ti-squares-selected:before {
	content: "ﺣ"
}
.ti-stack:before {
	content: ""
}
.ti-stack-2:before {
	content: ""
}
.ti-stack-2-filled:before {
	content: "﷓"
}
.ti-stack-3:before {
	content: ""
}
.ti-stack-3-filled:before {
	content: "﷒"
}
.ti-stack-back:before {
	content: "ﴦ"
}
.ti-stack-backward:before {
	content: "ﴧ"
}
.ti-stack-filled:before {
	content: "﷑"
}
.ti-stack-forward:before {
	content: "ﴨ"
}
.ti-stack-front:before {
	content: "ﴩ"
}
.ti-stack-middle:before {
	content: "ﴪ"
}
.ti-stack-pop:before {
	content: ""
}
.ti-stack-push:before {
	content: ""
}
.ti-stairs:before {
	content: ""
}
.ti-stairs-down:before {
	content: ""
}
.ti-stairs-up:before {
	content: ""
}
.ti-star:before {
	content: ""
}
.ti-star-filled:before {
	content: ""
}
.ti-star-half:before {
	content: ""
}
.ti-star-half-filled:before {
	content: ""
}
.ti-star-off:before {
	content: ""
}
.ti-stars:before {
	content: ""
}
.ti-stars-filled:before {
	content: ""
}
.ti-stars-off:before {
	content: ""
}
.ti-status-change:before {
	content: ""
}
.ti-steam:before {
	content: ""
}
.ti-steering-wheel:before {
	content: ""
}
.ti-steering-wheel-filled:before {
	content: "＃"
}
.ti-steering-wheel-off:before {
	content: ""
}
.ti-step-into:before {
	content: ""
}
.ti-step-out:before {
	content: ""
}
.ti-stereo-glasses:before {
	content: ""
}
.ti-stethoscope:before {
	content: ""
}
.ti-stethoscope-off:before {
	content: ""
}
.ti-sticker:before {
	content: ""
}
.ti-sticker-2:before {
	content: "ﴽ"
}
.ti-stopwatch:before {
	content: "ﾛ"
}
.ti-storm:before {
	content: ""
}
.ti-storm-off:before {
	content: ""
}
.ti-stretching:before {
	content: ""
}
.ti-stretching-2:before {
	content: "舘"
}
.ti-strikethrough:before {
	content: ""
}
.ti-submarine:before {
	content: ""
}
.ti-subscript:before {
	content: ""
}
.ti-subtask:before {
	content: ""
}
.ti-sum:before {
	content: ""
}
.ti-sum-off:before {
	content: ""
}
.ti-sun:before {
	content: ""
}
.ti-sun-electricity:before {
	content: "ﳂ"
}
.ti-sun-filled:before {
	content: ""
}
.ti-sun-high:before {
	content: ""
}
.ti-sun-high-filled:before {
	content: "𐄈"
}
.ti-sun-low:before {
	content: ""
}
.ti-sun-low-filled:before {
	content: "𐄇"
}
.ti-sun-moon:before {
	content: ""
}
.ti-sun-off:before {
	content: ""
}
.ti-sun-wind:before {
	content: ""
}
.ti-sunglasses:before {
	content: ""
}
.ti-sunglasses-filled:before {
	content: "ﻈ"
}
.ti-sunrise:before {
	content: ""
}
.ti-sunrise-filled:before {
	content: "𐄆"
}
.ti-sunset:before {
	content: ""
}
.ti-sunset-2:before {
	content: ""
}
.ti-sunset-2-filled:before {
	content: "𐄅"
}
.ti-sunset-filled:before {
	content: "𐄄"
}
.ti-superscript:before {
	content: ""
}
.ti-svg:before {
	content: ""
}
.ti-swimming:before {
	content: ""
}
.ti-swipe:before {
	content: ""
}
.ti-swipe-down:before {
	content: "ﵞ"
}
.ti-swipe-down-filled:before {
	content: "ｗ"
}
.ti-swipe-left:before {
	content: "ﵟ"
}
.ti-swipe-left-filled:before {
	content: "ｖ"
}
.ti-swipe-right:before {
	content: "ﵠ"
}
.ti-swipe-right-filled:before {
	content: "ｕ"
}
.ti-swipe-up:before {
	content: "ﵡ"
}
.ti-swipe-up-filled:before {
	content: "ｔ"
}
.ti-switch:before {
	content: ""
}
.ti-switch-2:before {
	content: ""
}
.ti-switch-3:before {
	content: ""
}
.ti-switch-horizontal:before {
	content: ""
}
.ti-switch-vertical:before {
	content: ""
}
.ti-sword:before {
	content: ""
}
.ti-sword-off:before {
	content: ""
}
.ti-swords:before {
	content: ""
}
.ti-table:before {
	content: ""
}
.ti-table-alias:before {
	content: ""
}
.ti-table-column:before {
	content: "﫿"
}
.ti-table-dashed:before {
	content: "𐂺"
}
.ti-table-down:before {
	content: "靖"
}
.ti-table-export:before {
	content: ""
}
.ti-table-filled:before {
	content: ""
}
.ti-table-heart:before {
	content: "精"
}
.ti-table-import:before {
	content: ""
}
.ti-table-minus:before {
	content: "羽"
}
.ti-table-off:before {
	content: ""
}
.ti-table-options:before {
	content: ""
}
.ti-table-plus:before {
	content: "﨟"
}
.ti-table-row:before {
	content: "ff"
}
.ti-table-share:before {
	content: "蘒"
}
.ti-table-shortcut:before {
	content: ""
}
.ti-table-spark:before {
	content: "ﾭ"
}
.ti-tag:before {
	content: "𐂖"
}
.ti-tag-filled:before {
	content: "＂"
}
.ti-tag-minus:before {
	content: ""
}
.ti-tag-off:before {
	content: ""
}
.ti-tag-plus:before {
	content: "𐂗"
}
.ti-tag-starred:before {
	content: "ﲙ"
}
.ti-tags:before {
	content: ""
}
.ti-tags-filled:before {
	content: "！"
}
.ti-tags-off:before {
	content: ""
}
.ti-tallymark-1:before {
	content: ""
}
.ti-tallymark-2:before {
	content: ""
}
.ti-tallymark-3:before {
	content: ""
}
.ti-tallymark-4:before {
	content: ""
}
.ti-tallymarks:before {
	content: ""
}
.ti-tank:before {
	content: ""
}
.ti-target:before {
	content: ""
}
.ti-target-arrow:before {
	content: ""
}
.ti-target-off:before {
	content: ""
}
.ti-tax:before {
	content: "ﻮ"
}
.ti-tax-euro:before {
	content: "ﻰ"
}
.ti-tax-pound:before {
	content: "ﻯ"
}
.ti-teapot:before {
	content: ""
}
.ti-telescope:before {
	content: ""
}
.ti-telescope-off:before {
	content: ""
}
.ti-temperature:before {
	content: ""
}
.ti-temperature-celsius:before {
	content: ""
}
.ti-temperature-fahrenheit:before {
	content: ""
}
.ti-temperature-minus:before {
	content: ""
}
.ti-temperature-minus-filled:before {
	content: "𐄃"
}
.ti-temperature-off:before {
	content: ""
}
.ti-temperature-plus:before {
	content: ""
}
.ti-temperature-plus-filled:before {
	content: "𐄂"
}
.ti-temperature-snow:before {
	content: "ﶣ"
}
.ti-temperature-sun:before {
	content: "ﶤ"
}
.ti-template:before {
	content: ""
}
.ti-template-filled:before {
	content: "𐅷"
}
.ti-template-off:before {
	content: ""
}
.ti-tent:before {
	content: ""
}
.ti-tent-off:before {
	content: ""
}
.ti-terminal:before {
	content: ""
}
.ti-terminal-2:before {
	content: ""
}
.ti-test-pipe:before {
	content: ""
}
.ti-test-pipe-2:before {
	content: ""
}
.ti-test-pipe-2-filled:before {
	content: "ｓ"
}
.ti-test-pipe-off:before {
	content: ""
}
.ti-tex:before {
	content: ""
}
.ti-text-caption:before {
	content: ""
}
.ti-text-color:before {
	content: ""
}
.ti-text-decrease:before {
	content: ""
}
.ti-text-direction-ltr:before {
	content: ""
}
.ti-text-direction-rtl:before {
	content: ""
}
.ti-text-grammar:before {
	content: "ﵭ"
}
.ti-text-increase:before {
	content: ""
}
.ti-text-orientation:before {
	content: ""
}
.ti-text-plus:before {
	content: ""
}
.ti-text-recognition:before {
	content: ""
}
.ti-text-resize:before {
	content: ""
}
.ti-text-scan-2:before {
	content: "ﳃ"
}
.ti-text-size:before {
	content: ""
}
.ti-text-spellcheck:before {
	content: ""
}
.ti-text-wrap:before {
	content: ""
}
.ti-text-wrap-column:before {
	content: "ﺲ"
}
.ti-text-wrap-disabled:before {
	content: ""
}
.ti-texture:before {
	content: ""
}
.ti-theater:before {
	content: ""
}
.ti-thermometer:before {
	content: ""
}
.ti-thumb-down:before {
	content: ""
}
.ti-thumb-down-filled:before {
	content: ""
}
.ti-thumb-down-off:before {
	content: ""
}
.ti-thumb-up:before {
	content: ""
}
.ti-thumb-up-filled:before {
	content: ""
}
.ti-thumb-up-off:before {
	content: ""
}
.ti-tic-tac:before {
	content: ""
}
.ti-ticket:before {
	content: ""
}
.ti-ticket-off:before {
	content: ""
}
.ti-tie:before {
	content: ""
}
.ti-tilde:before {
	content: ""
}
.ti-tilt-shift:before {
	content: ""
}
.ti-tilt-shift-filled:before {
	content: "ﻇ"
}
.ti-tilt-shift-off:before {
	content: ""
}
.ti-time-duration-0:before {
	content: "䀹"
}
.ti-time-duration-10:before {
	content: "𥉉"
}
.ti-time-duration-15:before {
	content: "𥳐"
}
.ti-time-duration-30:before {
	content: "𧻓"
}
.ti-time-duration-45:before {
	content: "齃"
}
.ti-time-duration-5:before {
	content: "龎"
}
.ti-time-duration-60:before {
	content: "﫚"
}
.ti-time-duration-90:before {
	content: "﫛"
}
.ti-time-duration-off:before {
	content: "﫜"
}
.ti-timeline:before {
	content: ""
}
.ti-timeline-event:before {
	content: ""
}
.ti-timeline-event-exclamation:before {
	content: ""
}
.ti-timeline-event-filled:before {
	content: "ﴘ"
}
.ti-timeline-event-minus:before {
	content: ""
}
.ti-timeline-event-plus:before {
	content: ""
}
.ti-timeline-event-text:before {
	content: ""
}
.ti-timeline-event-x:before {
	content: ""
}
.ti-timezone:before {
	content: "ﻭ"
}
.ti-tip-jar:before {
	content: "ﻪ"
}
.ti-tip-jar-euro:before {
	content: "ﻬ"
}
.ti-tip-jar-pound:before {
	content: "ﻫ"
}
.ti-tir:before {
	content: ""
}
.ti-toggle-left:before {
	content: ""
}
.ti-toggle-left-filled:before {
	content: "ﻀ"
}
.ti-toggle-right:before {
	content: ""
}
.ti-toggle-right-filled:before {
	content: "ﺿ"
}
.ti-toilet-paper:before {
	content: ""
}
.ti-toilet-paper-off:before {
	content: ""
}
.ti-toml:before {
	content: "艹"
}
.ti-tool:before {
	content: ""
}
.ti-tools:before {
	content: ""
}
.ti-tools-kitchen:before {
	content: ""
}
.ti-tools-kitchen-2:before {
	content: ""
}
.ti-tools-kitchen-2-off:before {
	content: ""
}
.ti-tools-kitchen-3:before {
	content: "ﴫ"
}
.ti-tools-kitchen-off:before {
	content: ""
}
.ti-tools-off:before {
	content: ""
}
.ti-tooltip:before {
	content: ""
}
.ti-topology-bus:before {
	content: ""
}
.ti-topology-complex:before {
	content: ""
}
.ti-topology-full:before {
	content: ""
}
.ti-topology-full-hierarchy:before {
	content: ""
}
.ti-topology-ring:before {
	content: ""
}
.ti-topology-ring-2:before {
	content: ""
}
.ti-topology-ring-3:before {
	content: ""
}
.ti-topology-star:before {
	content: ""
}
.ti-topology-star-2:before {
	content: ""
}
.ti-topology-star-3:before {
	content: ""
}
.ti-topology-star-ring:before {
	content: ""
}
.ti-topology-star-ring-2:before {
	content: ""
}
.ti-topology-star-ring-3:before {
	content: ""
}
.ti-torii:before {
	content: ""
}
.ti-tornado:before {
	content: ""
}
.ti-tournament:before {
	content: ""
}
.ti-tower:before {
	content: ""
}
.ti-tower-off:before {
	content: ""
}
.ti-track:before {
	content: ""
}
.ti-tractor:before {
	content: ""
}
.ti-trademark:before {
	content: ""
}
.ti-traffic-cone:before {
	content: ""
}
.ti-traffic-cone-off:before {
	content: ""
}
.ti-traffic-lights:before {
	content: ""
}
.ti-traffic-lights-off:before {
	content: ""
}
.ti-train:before {
	content: ""
}
.ti-train-filled:before {
	content: "𐃵"
}
.ti-transaction-bitcoin:before {
	content: "ﵮ"
}
.ti-transaction-dollar:before {
	content: "ﵯ"
}
.ti-transaction-euro:before {
	content: "ﵰ"
}
.ti-transaction-pound:before {
	content: "ﵱ"
}
.ti-transaction-rupee:before {
	content: "ﶅ"
}
.ti-transaction-yen:before {
	content: "ﵲ"
}
.ti-transaction-yuan:before {
	content: "ﵳ"
}
.ti-transfer:before {
	content: "ﰟ"
}
.ti-transfer-in:before {
	content: ""
}
.ti-transfer-out:before {
	content: ""
}
.ti-transfer-vertical:before {
	content: "ﰞ"
}
.ti-transform:before {
	content: ""
}
.ti-transform-filled:before {
	content: ""
}
.ti-transform-point:before {
	content: "ﶩ"
}
.ti-transform-point-bottom-left:before {
	content: "ﶥ"
}
.ti-transform-point-bottom-right:before {
	content: "ﶦ"
}
.ti-transform-point-top-left:before {
	content: "ﶧ"
}
.ti-transform-point-top-right:before {
	content: "ﶨ"
}
.ti-transition-bottom:before {
	content: ""
}
.ti-transition-bottom-filled:before {
	content: "﷐"
}
.ti-transition-left:before {
	content: ""
}
.ti-transition-left-filled:before {
	content: "﷏"
}
.ti-transition-right:before {
	content: ""
}
.ti-transition-right-filled:before {
	content: "﷎"
}
.ti-transition-top:before {
	content: ""
}
.ti-transition-top-filled:before {
	content: "﷍"
}
.ti-trash:before {
	content: ""
}
.ti-trash-filled:before {
	content: ""
}
.ti-trash-off:before {
	content: ""
}
.ti-trash-x:before {
	content: ""
}
.ti-trash-x-filled:before {
	content: ""
}
.ti-treadmill:before {
	content: "﩮"
}
.ti-tree:before {
	content: ""
}
.ti-trees:before {
	content: ""
}
.ti-trekking:before {
	content: ""
}
.ti-trending-down:before {
	content: ""
}
.ti-trending-down-2:before {
	content: ""
}
.ti-trending-down-3:before {
	content: ""
}
.ti-trending-up:before {
	content: ""
}
.ti-trending-up-2:before {
	content: ""
}
.ti-trending-up-3:before {
	content: ""
}
.ti-triangle:before {
	content: ""
}
.ti-triangle-filled:before {
	content: ""
}
.ti-triangle-inverted:before {
	content: ""
}
.ti-triangle-inverted-filled:before {
	content: ""
}
.ti-triangle-minus:before {
	content: "ﲛ"
}
.ti-triangle-minus-2:before {
	content: "ﲚ"
}
.ti-triangle-off:before {
	content: ""
}
.ti-triangle-plus:before {
	content: "ﲝ"
}
.ti-triangle-plus-2:before {
	content: "ﲜ"
}
.ti-triangle-square-circle:before {
	content: ""
}
.ti-triangle-square-circle-filled:before {
	content: "﭂"
}
.ti-triangles:before {
	content: ""
}
.ti-trident:before {
	content: ""
}
.ti-trolley:before {
	content: ""
}
.ti-trolley-filled:before {
	content: "𐃴"
}
.ti-trophy:before {
	content: ""
}
.ti-trophy-filled:before {
	content: ""
}
.ti-trophy-off:before {
	content: ""
}
.ti-trowel:before {
	content: ""
}
.ti-truck:before {
	content: ""
}
.ti-truck-delivery:before {
	content: ""
}
.ti-truck-filled:before {
	content: "𐃳"
}
.ti-truck-loading:before {
	content: ""
}
.ti-truck-off:before {
	content: ""
}
.ti-truck-return:before {
	content: ""
}
.ti-txt:before {
	content: ""
}
.ti-typeface:before {
	content: "ﶫ"
}
.ti-typography:before {
	content: ""
}
.ti-typography-off:before {
	content: ""
}
.ti-u-turn-left:before {
	content: "ﺢ"
}
.ti-u-turn-right:before {
	content: "ﺡ"
}
.ti-ufo:before {
	content: ""
}
.ti-ufo-filled:before {
	content: "𐅥"
}
.ti-ufo-off:before {
	content: ""
}
.ti-uhd:before {
	content: "𐂪"
}
.ti-umbrella:before {
	content: ""
}
.ti-umbrella-2:before {
	content: "．"
}
.ti-umbrella-closed:before {
	content: "，"
}
.ti-umbrella-closed-2:before {
	content: "－"
}
.ti-umbrella-filled:before {
	content: ""
}
.ti-umbrella-off:before {
	content: ""
}
.ti-underline:before {
	content: ""
}
.ti-universe:before {
	content: "ﳄ"
}
.ti-unlink:before {
	content: ""
}
.ti-upload:before {
	content: ""
}
.ti-urgent:before {
	content: ""
}
.ti-usb:before {
	content: ""
}
.ti-user:before {
	content: ""
}
.ti-user-bitcoin:before {
	content: "Ｐ"
}
.ti-user-bolt:before {
	content: "六"
}
.ti-user-cancel:before {
	content: "戮"
}
.ti-user-check:before {
	content: ""
}
.ti-user-circle:before {
	content: ""
}
.ti-user-code:before {
	content: "陸"
}
.ti-user-cog:before {
	content: "倫"
}
.ti-user-dollar:before {
	content: "崙"
}
.ti-user-down:before {
	content: "淪"
}
.ti-user-edit:before {
	content: ""
}
.ti-user-exclamation:before {
	content: ""
}
.ti-user-filled:before {
	content: "ﴙ"
}
.ti-user-heart:before {
	content: ""
}
.ti-user-hexagon:before {
	content: "ﱎ"
}
.ti-user-minus:before {
	content: ""
}
.ti-user-off:before {
	content: ""
}
.ti-user-pause:before {
	content: "輪"
}
.ti-user-pentagon:before {
	content: "ﱏ"
}
.ti-user-pin:before {
	content: ""
}
.ti-user-plus:before {
	content: ""
}
.ti-user-question:before {
	content: ""
}
.ti-user-scan:before {
	content: "ﲯ"
}
.ti-user-screen:before {
	content: "ﺠ"
}
.ti-user-search:before {
	content: ""
}
.ti-user-share:before {
	content: "律"
}
.ti-user-shield:before {
	content: ""
}
.ti-user-square:before {
	content: "ﱑ"
}
.ti-user-square-rounded:before {
	content: "ﱐ"
}
.ti-user-star:before {
	content: ""
}
.ti-user-up:before {
	content: ""
}
.ti-user-x:before {
	content: ""
}
.ti-users:before {
	content: ""
}
.ti-users-group:before {
	content: "﨡"
}
.ti-users-minus:before {
	content: "﨎"
}
.ti-users-plus:before {
	content: "﨏"
}
.ti-uv-index:before {
	content: ""
}
.ti-ux-circle:before {
	content: ""
}
.ti-vaccine:before {
	content: ""
}
.ti-vaccine-bottle:before {
	content: ""
}
.ti-vaccine-bottle-off:before {
	content: ""
}
.ti-vaccine-off:before {
	content: ""
}
.ti-vacuum-cleaner:before {
	content: ""
}
.ti-variable:before {
	content: ""
}
.ti-variable-minus:before {
	content: ""
}
.ti-variable-off:before {
	content: ""
}
.ti-variable-plus:before {
	content: ""
}
.ti-vector:before {
	content: ""
}
.ti-vector-bezier:before {
	content: ""
}
.ti-vector-bezier-2:before {
	content: ""
}
.ti-vector-bezier-arc:before {
	content: ""
}
.ti-vector-bezier-circle:before {
	content: ""
}
.ti-vector-off:before {
	content: ""
}
.ti-vector-spline:before {
	content: ""
}
.ti-vector-triangle:before {
	content: ""
}
.ti-vector-triangle-off:before {
	content: ""
}
.ti-venus:before {
	content: ""
}
.ti-versions:before {
	content: ""
}
.ti-versions-filled:before {
	content: ""
}
.ti-versions-off:before {
	content: ""
}
.ti-video:before {
	content: ""
}
.ti-video-filled:before {
	content: "𐂛"
}
.ti-video-minus:before {
	content: ""
}
.ti-video-off:before {
	content: ""
}
.ti-video-plus:before {
	content: ""
}
.ti-view-360:before {
	content: ""
}
.ti-view-360-arrow:before {
	content: ""
}
.ti-view-360-number:before {
	content: ""
}
.ti-view-360-off:before {
	content: ""
}
.ti-viewfinder:before {
	content: ""
}
.ti-viewfinder-off:before {
	content: ""
}
.ti-viewport-narrow:before {
	content: ""
}
.ti-viewport-short:before {
	content: "ﻩ"
}
.ti-viewport-tall:before {
	content: "ﻨ"
}
.ti-viewport-wide:before {
	content: ""
}
.ti-vinyl:before {
	content: ""
}
.ti-vip:before {
	content: ""
}
.ti-vip-off:before {
	content: ""
}
.ti-virus:before {
	content: ""
}
.ti-virus-off:before {
	content: ""
}
.ti-virus-search:before {
	content: ""
}
.ti-vocabulary:before {
	content: ""
}
.ti-vocabulary-off:before {
	content: ""
}
.ti-volcano:before {
	content: ""
}
.ti-volume:before {
	content: ""
}
.ti-volume-2:before {
	content: ""
}
.ti-volume-3:before {
	content: ""
}
.ti-volume-off:before {
	content: ""
}
.ti-vs:before {
	content: "ﱒ"
}
.ti-walk:before {
	content: ""
}
.ti-wall:before {
	content: ""
}
.ti-wall-off:before {
	content: ""
}
.ti-wallet:before {
	content: ""
}
.ti-wallet-off:before {
	content: ""
}
.ti-wallpaper:before {
	content: ""
}
.ti-wallpaper-off:before {
	content: ""
}
.ti-wand:before {
	content: ""
}
.ti-wand-off:before {
	content: ""
}
.ti-wash:before {
	content: ""
}
.ti-wash-dry:before {
	content: ""
}
.ti-wash-dry-1:before {
	content: ""
}
.ti-wash-dry-2:before {
	content: ""
}
.ti-wash-dry-3:before {
	content: ""
}
.ti-wash-dry-a:before {
	content: ""
}
.ti-wash-dry-dip:before {
	content: ""
}
.ti-wash-dry-f:before {
	content: ""
}
.ti-wash-dry-flat:before {
	content: "奔"
}
.ti-wash-dry-hang:before {
	content: ""
}
.ti-wash-dry-off:before {
	content: ""
}
.ti-wash-dry-p:before {
	content: ""
}
.ti-wash-dry-shade:before {
	content: ""
}
.ti-wash-dry-w:before {
	content: ""
}
.ti-wash-dryclean:before {
	content: ""
}
.ti-wash-dryclean-off:before {
	content: ""
}
.ti-wash-eco:before {
	content: "婢"
}
.ti-wash-gentle:before {
	content: ""
}
.ti-wash-hand:before {
	content: "嬨"
}
.ti-wash-machine:before {
	content: ""
}
.ti-wash-off:before {
	content: ""
}
.ti-wash-press:before {
	content: ""
}
.ti-wash-temperature-1:before {
	content: ""
}
.ti-wash-temperature-2:before {
	content: ""
}
.ti-wash-temperature-3:before {
	content: ""
}
.ti-wash-temperature-4:before {
	content: ""
}
.ti-wash-temperature-5:before {
	content: ""
}
.ti-wash-temperature-6:before {
	content: ""
}
.ti-wash-tumble-dry:before {
	content: ""
}
.ti-wash-tumble-off:before {
	content: ""
}
.ti-waterpolo:before {
	content: "﩯"
}
.ti-wave-saw-tool:before {
	content: ""
}
.ti-wave-sine:before {
	content: ""
}
.ti-wave-square:before {
	content: ""
}
.ti-waves-electricity:before {
	content: "ﳅ"
}
.ti-webhook:before {
	content: ""
}
.ti-webhook-off:before {
	content: ""
}
.ti-weight:before {
	content: ""
}
.ti-wheat:before {
	content: "𐂨"
}
.ti-wheat-off:before {
	content: "𐂩"
}
.ti-wheel:before {
	content: "ﱤ"
}
.ti-wheelchair:before {
	content: ""
}
.ti-wheelchair-off:before {
	content: ""
}
.ti-whirl:before {
	content: ""
}
.ti-wifi:before {
	content: ""
}
.ti-wifi-0:before {
	content: ""
}
.ti-wifi-1:before {
	content: ""
}
.ti-wifi-2:before {
	content: ""
}
.ti-wifi-off:before {
	content: ""
}
.ti-wind:before {
	content: ""
}
.ti-wind-electricity:before {
	content: "ﳆ"
}
.ti-wind-off:before {
	content: ""
}
.ti-windmill:before {
	content: ""
}
.ti-windmill-filled:before {
	content: ""
}
.ti-windmill-off:before {
	content: ""
}
.ti-window:before {
	content: ""
}
.ti-window-maximize:before {
	content: ""
}
.ti-window-minimize:before {
	content: ""
}
.ti-window-off:before {
	content: ""
}
.ti-windsock:before {
	content: ""
}
.ti-windsock-filled:before {
	content: "𐂚"
}
.ti-wiper:before {
	content: ""
}
.ti-wiper-wash:before {
	content: ""
}
.ti-woman:before {
	content: ""
}
.ti-woman-filled:before {
	content: "﷌"
}
.ti-wood:before {
	content: ""
}
.ti-world:before {
	content: ""
}
.ti-world-bolt:before {
	content: "慄"
}
.ti-world-cancel:before {
	content: "栗"
}
.ti-world-check:before {
	content: "率"
}
.ti-world-code:before {
	content: "隆"
}
.ti-world-cog:before {
	content: "利"
}
.ti-world-dollar:before {
	content: "吏"
}
.ti-world-down:before {
	content: "履"
}
.ti-world-download:before {
	content: ""
}
.ti-world-exclamation:before {
	content: "易"
}
.ti-world-heart:before {
	content: "李"
}
.ti-world-latitude:before {
	content: ""
}
.ti-world-longitude:before {
	content: ""
}
.ti-world-minus:before {
	content: "梨"
}
.ti-world-off:before {
	content: ""
}
.ti-world-pause:before {
	content: "泥"
}
.ti-world-pin:before {
	content: "理"
}
.ti-world-plus:before {
	content: "痢"
}
.ti-world-question:before {
	content: "罹"
}
.ti-world-search:before {
	content: "裏"
}
.ti-world-share:before {
	content: "裡"
}
.ti-world-star:before {
	content: "里"
}
.ti-world-up:before {
	content: "離"
}
.ti-world-upload:before {
	content: ""
}
.ti-world-www:before {
	content: ""
}
.ti-world-x:before {
	content: "匿"
}
.ti-wrecking-ball:before {
	content: ""
}
.ti-writing:before {
	content: ""
}
.ti-writing-off:before {
	content: ""
}
.ti-writing-sign:before {
	content: ""
}
.ti-writing-sign-off:before {
	content: ""
}
.ti-x:before {
	content: ""
}
.ti-x-power-y:before {
	content: "𐁲"
}
.ti-xbox-a:before {
	content: ""
}
.ti-xbox-a-filled:before {
	content: "﷋"
}
.ti-xbox-b:before {
	content: ""
}
.ti-xbox-b-filled:before {
	content: "﷊"
}
.ti-xbox-x:before {
	content: ""
}
.ti-xbox-x-filled:before {
	content: "﷉"
}
.ti-xbox-y:before {
	content: ""
}
.ti-xbox-y-filled:before {
	content: "﷈"
}
.ti-xd:before {
	content: "勉"
}
.ti-xxx:before {
	content: "ﰠ"
}
.ti-yin-yang:before {
	content: ""
}
.ti-yin-yang-filled:before {
	content: ""
}
.ti-yoga:before {
	content: ""
}
.ti-zeppelin:before {
	content: ""
}
.ti-zeppelin-filled:before {
	content: "ﷇ"
}
.ti-zeppelin-off:before {
	content: ""
}
.ti-zip:before {
	content: ""
}
.ti-zodiac-aquarius:before {
	content: ""
}
.ti-zodiac-aries:before {
	content: ""
}
.ti-zodiac-cancer:before {
	content: ""
}
.ti-zodiac-capricorn:before {
	content: ""
}
.ti-zodiac-gemini:before {
	content: ""
}
.ti-zodiac-leo:before {
	content: ""
}
.ti-zodiac-libra:before {
	content: ""
}
.ti-zodiac-pisces:before {
	content: ""
}
.ti-zodiac-sagittarius:before {
	content: ""
}
.ti-zodiac-scorpio:before {
	content: ""
}
.ti-zodiac-taurus:before {
	content: ""
}
.ti-zodiac-virgo:before {
	content: ""
}
.ti-zoom:before {
	content: "ﶪ"
}
.ti-zoom-cancel:before {
	content: ""
}
.ti-zoom-cancel-filled:before {
	content: "ﷆ"
}
.ti-zoom-check:before {
	content: ""
}
.ti-zoom-check-filled:before {
	content: ""
}
.ti-zoom-code:before {
	content: ""
}
.ti-zoom-code-filled:before {
	content: "ﷅ"
}
.ti-zoom-exclamation:before {
	content: ""
}
.ti-zoom-exclamation-filled:before {
	content: "ﷄ"
}
.ti-zoom-filled:before {
	content: ""
}
.ti-zoom-in:before {
	content: ""
}
.ti-zoom-in-area:before {
	content: ""
}
.ti-zoom-in-area-filled:before {
	content: ""
}
.ti-zoom-in-filled:before {
	content: ""
}
.ti-zoom-money:before {
	content: ""
}
.ti-zoom-money-filled:before {
	content: "ﷃ"
}
.ti-zoom-out:before {
	content: ""
}
.ti-zoom-out-area:before {
	content: ""
}
.ti-zoom-out-area-filled:before {
	content: "ﷂ"
}
.ti-zoom-out-filled:before {
	content: ""
}
.ti-zoom-pan:before {
	content: ""
}
.ti-zoom-pan-filled:before {
	content: "ﷁ"
}
.ti-zoom-question:before {
	content: ""
}
.ti-zoom-question-filled:before {
	content: "ﷀ"
}
.ti-zoom-replace:before {
	content: ""
}
.ti-zoom-reset:before {
	content: ""
}
.ti-zoom-scan:before {
	content: "ﲰ"
}
.ti-zoom-scan-filled:before {
	content: "ﶿ"
}
.ti-zzz:before {
	content: ""
}
.ti-zzz-off:before {
	content: ""
}
.ti-123:before {
	content: ""
}
.ti-360:before {
	content: ""
}
.ti-code-asterix:before {
	content: ""
}
.ti-discount-2:before {
	content: ""
}
.ti-discount-2-off:before {
	content: ""
}
.ti-discount-check:before {
	content: ""
}
.ti-hand-rock:before {
	content: ""
}
.ti-sort-deacending-small-big:before {
	content: "ﶖ"
}
.ti-shi-jumping:before {
	content: "𤋮"
}
.ti-box-seam:before {
	content: ""
}
.ti-kering:before {
	content: ""
}
.ti-2fa:before {
	content: ""
}
.ti-3d-cube-sphere:before {
	content: ""
}
.ti-3d-cube-sphere-off:before {
	content: ""
}
.ti-3d-rotate:before {
	content: ""
}
.ti-12-hours:before {
	content: "ﱓ"
}
.ti-24-hours:before {
	content: ""
}
.ti-360-view:before {
	content: ""
}
.ti-circle-0:before {
	content: ""
}
.ti-circle-1:before {
	content: ""
}
.ti-circle-2:before {
	content: ""
}
.ti-circle-3:before {
	content: ""
}
.ti-circle-4:before {
	content: ""
}
.ti-circle-5:before {
	content: ""
}
.ti-circle-6:before {
	content: ""
}
.ti-circle-7:before {
	content: ""
}
.ti-circle-8:before {
	content: ""
}
.ti-circle-9:before {
	content: ""
}
.ti-hexagon-0:before {
	content: ""
}
.ti-hexagon-1:before {
	content: ""
}
.ti-hexagon-2:before {
	content: ""
}
.ti-hexagon-3:before {
	content: ""
}
.ti-hexagon-4:before {
	content: ""
}
.ti-hexagon-5:before {
	content: ""
}
.ti-hexagon-6:before {
	content: ""
}
.ti-hexagon-7:before {
	content: ""
}
.ti-hexagon-8:before {
	content: ""
}
.ti-hexagon-9:before {
	content: ""
}
.ti-square-0:before {
	content: ""
}
.ti-square-1:before {
	content: ""
}
.ti-square-2:before {
	content: ""
}
.ti-square-3:before {
	content: ""
}
.ti-square-4:before {
	content: ""
}
.ti-square-5:before {
	content: ""
}
.ti-square-6:before {
	content: ""
}
.ti-square-7:before {
	content: ""
}
.ti-square-8:before {
	content: ""
}
.ti-square-9:before {
	content: ""
}
.ti-message-circle-2:before {
	content: ""
}
.ti-mood-suprised:before {
	content: ""
}
.ti-circle-dashed-letter-letter-v:before {
	content: "ﾄ"
}
.ti-seeding:before {
	content: ""
}
.ti-seeding-off:before {
	content: ""
}
.ti-discount-check-filled:before {
	content: ""
}
.ti-message-circle-2-filled:before {
	content: "ﻏ"
}
.ti-seeding-filled:before {
	content: "𐀆"
}
@font-face {
	font-family: flaticon_bytexbd;
	src: url(flaticon_bytexbd-FJ6uYBTP.woff2) format("woff2"), url(flaticon_bytexbd-BkxBqO8S.woff) format("woff"), url(flaticon_bytexbd-BnGWzaFI.ttf) format("truetype"), url(flaticon_bytexbd-BfliBbge.svg#flaticon_bytexbd) format("svg")
}
i[class^=flaticon-]:before, i[class*=" flaticon-"]:before {
	font-family: flaticon_bytexbd!important;
	font-style: normal;
	font-weight: 400!important;
	font-variant: normal;
	text-transform: none;
	line-height: 1!important;
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale
}
.flaticon-coding:before {
	content: ""
}
.flaticon-trust:before {
	content: ""
}
.flaticon-analysis:before {
	content: ""
}
.flaticon-tap:before {
	content: ""
}
.flaticon-update:before {
	content: ""
}
.flaticon-support:before {
	content: ""
}
.flaticon-email:before {
	content: ""
}
.flaticon-cyber-security:before {
	content: ""
}
.flaticon-new-features:before {
	content: ""
}
.flaticon-support-1:before {
	content: ""
}
* {
	margin: 0;
	padding: 0
}
:root {
--Animation-Duration: all .35s ease;
--Font-Primary: "Sora", sans-serif;
--Font-Tabler: "tabler-icons";
--Primary: #3d835d;
--Primary-Hover: #51534d;
--Secondary: #F5F2F0;
--Secondary-Hover: #ebe8e7;
--Secondary-Two: rgba(189, 225, 98, .3);
--Heading: #052E26;
--Text: #132B49;
--Background: #052E26;
--Border: rgba(19, 43, 73, .3);
--White: #FFFFFF;
--Success: #3CB371;
--Success-Hover: #34885a;
--Warning: #F7921F;
--Warning-Hover: #be7016;
--Info: #02A5CE;
--Info-Hover: #156e85;
--Danger: #DC3545;
--Danger-Hover: #9c1321
}
/*
:root {
--Animation-Duration: all .35s ease;
--Font-Primary: "Sora", sans-serif;
--Font-Tabler: "tabler-icons";
--Primary: #0B5D4B;
--Primary-Hover: #094A3C;
--Secondary: #fff;
--Secondary-Hover: #ebe8e7;
--Secondary-Two: #ebe8e7;
--Heading: #052E26;
--Text: #132B49;
--Background: #052E26;
--Border: rgba(19, 43, 73, .15);
--White: #FFFFFF;
--Success: #3CB371;
--Success-Hover: #34885a;
--Warning: #C9A45B;
--Warning-Hover: #A8843F;
--Info: #0EA5B7;
--Info-Hover: #0B7D8A;
--Danger: #DC3545;
--Danger-Hover: #9c1321
}
*/

body, html {
	font-family: var(--Font-Primary);
	color: var(--Text);
	scroll-behavior: smooth;
	overflow-x: hidden;
	padding: 0!important
}
h1, .h1, h2, .h2, h3, .h3, h4, .h4, h5, .h5, h6, .h6 {
	color: var(--Heading);
	font-weight: 600;
	line-height: 1.2
}
h1, .h1, h2, .h2, h3, .h3 {
	letter-spacing: -1.4px
}
h4, .h4, h5, .h5, h6, .h6 {
	letter-spacing: -.4px
}
h4 {
	font-size: clamp(20px, 2vw, 24px)
}
h5 {
	font-size: clamp(18px, 2vw, 20px)
}
p {
	font-size: 16px;
	line-height: 1.65;
	color: var(--Text)
}
a {
	transition: var(--Animation-Duration);
	text-decoration: none;
	outline: 0 solid transparent;
	color: var(--Heading);
	font-weight: 600
}
a:hover, a:focus {
	outline: 0 solid transparent;
	text-decoration: none;
	color: var(--Heading);
	font-weight: 600
}
ul, ol {
	margin-bottom: 0
}
ul li, ol li {
	line-height: 1.75
}
.border, .border-end, .border-start, .border-top, .border-bottom {
	border-color: var(--Border)!important
}
img {
	max-width: 100%;
	height: auto
}
input:required, textarea:required, input:invalid, textarea:invalid {
box-shadow:none!important
}
.bg-img {
	background-size: cover;
	background-position: center center;
	background-repeat: no-repeat
}
.bg-fixed {
	background-attachment: fixed
}
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 320px
}

@media (min-width: 400px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 360px
}
}

@media (min-width: 480px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 420px
}
}

@media (min-width: 576px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 540px
}
}

@media (min-width: 768px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 720px
}
}

@media (min-width: 992px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 960px
}
}

@media (min-width: 1200px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 1140px
}
}

@media (min-width: 1400px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 1320px
}
}
.custom-container {
	width: 300px;
	margin-left: auto;
	margin-right: auto
}

@media (min-width: 480px) {
.custom-container {
	width: 420px
}
}

@media (min-width: 576px) {
.custom-container {
	width: 540px
}
}

@media (min-width: 768px) {
.custom-container {
	width: 720px
}
}

@media (min-width: 992px) {
.custom-container {
	width: 960px
}
}

@media (min-width: 1200px) {
.custom-container {
	width: 1140px
}
}

@media (min-width: 1400px) {
.custom-container {
	width: 1320px
}
}
.fz-12 {
	font-size: 12px!important
}
.fz-14 {
	font-size: 14px!important
}
.fz-16 {
	font-size: 16px!important
}
.fz-18 {
	font-size: 18px!important
}
.shadow-sm {
	box-shadow: 0 .125rem .25rem #2f5bea13!important
}
.shadow {
	box-shadow: 0 .5rem 1rem #2f5bea26!important
}
.shadow-lg {
	box-shadow: 0 1rem 3rem #2f5bea2d!important
}
.btn {
	transition: var(--Animation-Duration);
	font-family: var(--Font-Primary);
	text-transform: capitalize;
	display: inline-flex;
	align-items: center;
	justify-content: center;
	font-size: 14px;
	padding: 10px 20px;
	gap: 6px;
	border-radius: 6px;
	border: 0;
	position: relative;
	height: 48px;
	min-width: auto;
	overflow: hidden;
	font-weight: 600
}

@media only screen and (min-width:1200px) {
.btn {
	height: 54px;
	padding: 12px 24px
}
}

@media only screen and (min-width:1400px) {
.btn {
	height: 60px;
	padding: 16px 32px;
	font-size: 16px
}
}
.btn>span {
	font-size: 16px;
	display: flex;
	align-items: center;
	gap: 4px;
	transition: opacity .35s ease, transform .35s ease;
	position: relative;
	opacity: 1
}
.btn>span:last-child {
	position: absolute;
	opacity: 0;
	transform: translateY(50px)
}
.btn i {
	font-size: 140%;
	transition: var(--Animation-Duration)
}
.btn:active, .btn:hover, .btn:focus {
	box-shadow: none
}
.btn:active span:first-child, .btn:hover span:first-child, .btn:focus span:first-child {
	opacity: 0;
	transform: translateY(-50px)
}
.btn:active span:last-child, .btn:hover span:last-child, .btn:focus span:last-child {
	opacity: 1;
	transform: translateY(0)
}
.btn-primary {
	background-color: var(--Primary);
	color: #FFFFFF;
}
.btn-primary:active, .btn-primary:hover, .btn-primary:focus {
	background-color: var(--Primary-Hover);
	color: var(--White)
}
.btn-secondary {
	background-color: var(--Secondary);
	color: var(--Heading)
}
.btn-secondary:active, .btn-secondary:hover, .btn-secondary:focus {
	background-color: var(--Secondary-Hover);
	color: var(--Heading)
}
.btn-success {
	background-color: var(--Success);
	color: var(--White)
}
.btn-success:active, .btn-success:hover, .btn-success:focus {
	background-color: var(--Success-Hover);
	color: var(--White)
}
.btn-info {
	background-color: var(--Info);
	color: var(--White)
}
.btn-info:active, .btn-info:hover, .btn-info:focus {
	background-color: var(--Info-Hover);
	color: var(--White)
}
.btn-warning {
	background-color: var(--Warning);
	color: var(--White)
}
.btn-warning:active, .btn-warning:hover, .btn-warning:focus {
	background-color: var(--Warning-Hover);
	color: var(--White)
}
.btn-danger {
	background-color: var(--Danger);
	color: var(--White)
}
.btn-danger:active, .btn-danger:hover, .btn-danger:focus {
	background-color: var(--Danger-Hover);
	color: var(--White)
}
.btn-light {
	background-color: var(--White);
	color: var(--Heading)
}
.btn-light:active, .btn-light:hover, .btn-light:focus {
	background-color: var(--White);
	color: var(--Heading)
}
.btn-dark {
	background-color: var(--Heading);
	color: var(--White)
}
.btn-dark:active, .btn-dark:hover, .btn-dark:focus {
	background-color: var(--Text);
	color: var(--White)
}
.btn-link {
	position: relative;
	z-index: 1;
	color: var(--Heading);
	gap: 6px;
	padding: 0!important;
	min-width: 0;
	height: auto;
	background-color: transparent;
	border: 0;
	text-decoration: none;
	border-radius: 0!important
}
.btn-link:active, .btn-link:hover, .btn-link:focus {
	box-shadow: none;
	color: var(--Primary-Hover)
}
.btn-group-sm>.btn, .btn-sm {
	padding: .375rem 1.25rem;
	font-size: 12px;
	height: 37px;
	min-width: 100px
}
.btn-outline-primary {
	border: 1px solid var(--Primary);
	color: var(--Heading)
}
.btn-outline-primary.active, .btn-outline-primary:hover, .btn-outline-primary:focus {
	background-color: var(--Primary);
	border-color: var(--Primary);
	color: var(--Heading)
}
.btn-outline-secondary {
	border: 1px solid var(--Secondary);
	color: var(--Heading)
}
.btn-outline-secondary:active, .btn-outline-secondary:hover, .btn-outline-secondary:focus {
	background-color: var(--Secondary);
	border-color: var(--Secondary);
	color: var(--Heading)
}
.btn-outline-success {
	border: 1px solid var(--Success);
	color: var(--Success)
}
.btn-outline-success:hover, .btn-outline-success:focus {
	background-color: var(--Success);
	border-color: var(--Success);
	color: var(--White)
}
.btn-outline-warning {
	border: 1px solid var(--Warning);
	color: var(--Warning)
}
.btn-outline-warning:hover, .btn-outline-warning:focus {
	background-color: var(--Warning);
	border-color: var(--Warning);
	color: var(--Heading)
}
.btn-outline-info {
	border: 1px solid var(--Info);
	color: var(--Info)
}
.btn-outline-info:hover, .btn-outline-info:focus {
	background-color: var(--Info);
	border-color: var(--Info);
	color: var(--White)
}
.btn-outline-danger {
	border: 1px solid var(--Danger);
	color: var(--Danger)
}
.btn-outline-danger:hover, .btn-outline-danger:focus {
	background-color: var(--Danger);
	border-color: var(--Danger);
	color: var(--White)
}
.btn-outline-light {
	border: 1px solid var(--White);
	color: var(--White)
}
.btn-outline-light:hover, .btn-outline-light:focus {
	background-color: var(--White);
	border-color: var(--White);
	color: var(--Primary)
}
.btn-outline-dark {
	border: 1px solid var(--Heading);
	color: var(--Heading)
}
.btn-outline-dark:hover, .btn-outline-dark:focus {
	background-color: var(--Heading);
	border-color: var(--Heading);
	color: var(--White)
}
.btn-view-more {
	display: inline-flex;
	align-items: center;
	position: relative;
	white-space: nowrap;
	width: auto;
	height: 44px;
}
.btn-view-more span {
	height: 44px
}
.btn-view-more span:first-child {
	transition: var(--Animation-Duration);
	border: 1.5px solid var(--Heading);
	display: inline-flex;
	align-items: center;
	justify-content: center;
	font-size: 24px;
	width: 44px;
	padding: 10px;
	border-radius: 5rem;
	color: var(--Heading);
	font-weight: 600
}
.btn-view-more span:last-child {
	position: absolute;
	top: 0;
	left: -1px;
	transition: var(--Animation-Duration);
	border: 1.5px solid var(--Primary);
	display: inline-flex;
	align-items: center;
	padding: 10px 14px 10px 10px;
	border-radius: 5rem;
	color: var(--Heading);
	font-weight: 600;
	gap: 4px;
	opacity: 0;
	visibility: hidden
}
.btn-view-more span:last-child i {
	font-size: 24px
}
.btn-view-more.active span:first-child, .btn-view-more:hover span:first-child, .btn-view-more:focus span:first-child {
	opacity: 0;
	visibility: hidden
}
.btn-view-more.active span:last-child, .btn-view-more:hover span:last-child, .btn-view-more:focus span:last-child {
	opacity: 1;
	visibility: visible
}
.btn-download {
	display: flex;
	align-items: center;
	gap: 6px;
	height: 60px;
	padding: 0 30px;
	border-radius: 5rem;
	border: 1px solid var(--White);
	color: var(--White);
	outline: none;
	box-shadow: none;
	transition: var(--Animation-Duration)
}
.btn-download i {
	font-size: 36px
}
.btn-download>div {
	line-height: 1
}
.btn-download .sub-text {
	font-size: 12px;
	font-weight: 500;
	color: #faf8ff;
	display: block;
	margin-bottom: 4px
}
.btn-download p {
	color: var(--White);
	line-height: 1.1
}
.btn-download:hover, .btn-download:focus {
	box-shadow: none;
	background-color: #282c32;
	border-color: #282c32;
	color: var(--White)
}
.bg-primary {
	background-color: var(--Primary)!important
}
.bg-secondary {
	background-color: var(--Secondary)!important
}
.bg-success {
	background-color: var(--Success)!important
}
.bg-danger {
	background-color: var(--Danger)!important
}
.bg-warning {
	background-color: var(--Warning)!important
}
.bg-info {
	background-color: var(--Info)!important
}
.bg-dark {
	background-color: var(--Heading)!important
}
.bg-gray {
	background-color: var(--Secondary)!important
}
.text-primary {
	color: var(--Primary-Hover)!important
}
.text-dark {
	color: var(--Text)!important
}
.text-heading {
	color: var(--Heading)!important
}
.text-success {
	color: var(--Success)!important
}
.text-danger {
	color: var(--Danger)!important
}
.text-warning {
	color: var(--Warning)!important
}
.text-info {
	color: var(--Info)!important
}
.bizora-scrolltop {
	position: fixed;
	bottom: 2rem;
	right: 2rem;
	transition: var(--Animation-Duration);
	z-index: 9999;
	width: 2.5rem;
	height: 2.5rem;
	font-size: 1.5rem;
	display: flex;
	align-items: center;
	justify-content: center;
	border-radius: 50%;
	color: var(--Heading);
	cursor: pointer;
	transform: translateY(100px);
	border: 0!important;
	background-color: var(--Secondary)
}
.bizora-scrolltop span {
	font-size: 1.75rem
}
.bizora-scrolltop.scrolltop-show {
	transform: translateY(0)
}
.bizora-scrolltop.scrolltop-hide {
	transform: translateY(100px)
}

@media only screen and (min-width:992px) {
.bizora-scrolltop {
	width: 3rem;
	height: 3rem;
	right: 3rem;
	bottom: 3rem
}
}
.bizora-scrolltop:before {
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	right: 0;
	bottom: 0;
	border-radius: 50%;
	background: conic-gradient(var(--Primary) var(--scroll-progress), var(--Secondary) 0);
	z-index: -1
}
.divider {
	width: 100%;
	display: block;
	height: 60px
}

@media only screen and (min-width:576px) {
.divider {
	height: 70px
}
}

@media only screen and (min-width:768px) {
.divider {
	height: 80px
}
}

@media only screen and (min-width:992px) {
.divider {
	height: 95px
}
}

@media only screen and (min-width:1200px) {
.divider {
	height: 110px
}
}

@media only screen and (min-width:1400px) {
.divider {
	height: 130px
}
}
.divider-sm {
	width: 100%;
	display: block;
	height: 50px
}

@media only screen and (min-width:768px) {
.divider-sm {
	height: 60px
}
}
.section-heading {
	position: relative;
	z-index: 1
}
.section-heading .subtitle {
	background: var(--Secondary-Two);
	color: var(--Heading);
	font-size: 1rem;
	font-weight: 500;
	border-radius: 6px;
	padding: 6px 24px;
	text-transform: capitalize;
	display: inline-flex;
	margin-bottom: 1rem
}
.section-heading .subtitle.text-white {
	color: var(--Heading)!important;
	background: var(--Primary)
}
.section-heading h2 {
	font-size: clamp(28px, 4.5vw, 48px);
	line-height: 1.25;
	color: var(--Heading);
	letter-spacing: -1.44px
}
.section-heading p {
	line-height: 1.75
}

@media only screen and (min-width:1200px) {
.section-heading p {
	font-size: 18px
}
}
.section-heading .question-mark {
	position: absolute;
	bottom: -20%;
	right: 10%;
	z-index: -10
}
.section-heading img {
	border-radius: 18px;
	width: 100%
}
.search-bg-overlay {
	position: fixed;
	width: 100%;
	height: 100%;
	background-color: var(--Background);
	opacity: 0;
	top: 0;
	left: 0;
	z-index: 100000;
	visibility: hidden;
	transition: var(--Animation-Duration)
}
.search-bg-overlay.open {
	opacity: .98;
	visibility: visible
}
.search-form-popup {
	transition: var(--Animation-Duration);
	background-color: var(--Primary);
	transform: scale(.9) translate(-50%, -50%);
	position: fixed;
	z-index: 100000;
	padding: 2rem 1.5rem;
	left: 50%;
	top: 50%;
	min-width: 290px;
	border-radius: 12px;
	opacity: 0;
	visibility: hidden;
	text-align: center
}

@media only screen and (min-width:480px) {
.search-form-popup {
	min-width: 360px
}
}

@media only screen and (min-width:768px) {
.search-form-popup {
	padding: 4rem 3rem;
	min-width: 500px
}
}
.search-form-popup .close-btn {
	position: absolute;
	top: -1rem;
	right: -1rem;
	z-index: 1000;
	width: 32px;
	height: 32px;
	border-radius: 50%;
	border: 0;
	font-size: 1.25rem;
	display: flex;
	align-items: center;
	justify-content: center;
	background-color: #ffffff1a;
	color: var(--White);
	transition: var(--Animation-Duration)
}
.search-form-popup .close-btn:hover, .search-form-popup .close-btn:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}

@media only screen and (min-width:768px) {
.search-form-popup .close-btn {
	width: 40px;
	height: 40px;
	top: -2rem;
	right: -2rem
}
}
.search-form-popup form {
	display: flex;
	gap: 30px
}
.search-form-popup form .form-control {
	width: 100%;
	height: 48px;
	border-radius: 6px;
	border: 1px solid var(--Border);
	background-color: transparent;
	color: var(--Text);
	font-size: 16px;
	padding: 15px 24px
}

@media only screen and (min-width:1200px) {
.search-form-popup form .form-control {
	font-size: 18px;
	height: 64px
}
}
.search-form-popup form .form-control::-moz-placeholder {
color:var(--Text);
opacity:.85
}
.search-form-popup form .form-control::placeholder {
color:var(--Text);
opacity:.85
}
.search-form-popup form .form-control:focus {
	box-shadow: none
}
.search-form-popup form .btn {
	border-radius: 6px;
	height: 48px
}

@media only screen and (min-width:1200px) {
.search-form-popup form .btn {
	height: 64px
}
}
.search-form-popup.open {
	opacity: 1;
	visibility: visible;
	transform: scale(1) translate(-50%, -50%)
}
.error-content h2 {
	font-size: clamp(28px, 4.5vw, 48px)
}

@media only screen and (min-width:1200px) {
.error-content p {
	font-size: 18px
}
}
.tilt-image {
	transition: transform .2s ease;
	transform-style: preserve-3d;
	will-change: transform;
	cursor: pointer
}
.imgZoomInOut {
	transition: width .5s ease
}
.translateY8 {
	transition: var(--Animation-Duration)
}
.translateY8:hover, .translateY8:focus {
	transform: translateY(-8px)
}
.img-rotate360 {
	animation: rotate360 8s linear infinite
}
@keyframes rotate360 {
0% {
transform:rotate(0)
}
to {
transform:rotate(360deg)
}
}
.preloader {
	position: fixed;
	width: 100vw;
	height: 100vh;
	z-index: 9999999;
	top: 0;
	left: 0;
	background-color: var(--Heading);
	display: flex;
	align-items: center;
	justify-content: center;
	overflow: hidden
}
.jarallax {
	position: relative;
	z-index: 0
}
.jarallax>.jarallax-img, picture.jarallax-img img {
	position: absolute;
	-o-object-fit: cover;
	object-fit: cover;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: -1
}
.header-search-btn {
	cursor: pointer
}
.header-search-btn .btn {
	display: flex;
	align-items: center;
	justify-content: center;
	flex-shrink: 0;
	padding: 0;
	border-radius: 50%;
	transition: var(--Animation-Duration)
}
.header-search-btn .btn svg path {
	transition: var(--Animation-Duration);
	fill: var(--White)
}
.header-search-btn .btn:hover svg path, .header-search-btn .btn:focus svg path {
	fill: var(--Primary)
}
.style-two .header-search-btn .btn svg path {
	fill: var(--Heading)
}
.style-two .header-search-btn .btn:hover svg path, .style-two .header-search-btn .btn:focus svg path {
	fill: var(--Primary)
}
.offcanvas-btn {
	transition: var(--Animation-Duration);
	width: 52px;
	height: 52px;
	flex-shrink: 0;
	border: 1px solid var(--White);
	border-radius: 6px;
	display: flex;
	align-items: center;
	justify-content: center
}
.offcanvas-btn svg path {
	transition: var(--Animation-Duration);
	fill: var(--White)
}
.offcanvas-btn:hover, .offcanvas-btn:focus {
	border-color: var(--Primary)
}
.offcanvas-btn:hover svg path, .offcanvas-btn:focus svg path {
	fill: var(--Primary)
}
.header-navigation {
	gap: 2rem
}

@media only screen and (min-width:1200px) {
.header-navigation {
	padding-left: 40px
}
}
.header-section {
	background-color: transparent;
	position: fixed;
	width: 100%;
	top: 0;
	left: 0;
	z-index: 1000;
	transition: var(--Animation-Duration)
}

@media only screen and (min-width:1200px) {
.header-section {
	box-shadow: none
}
}
.header-section.mobile-menu-open {
	background-color: var(--White)
}
.header-section .navbar-toggler {
	padding: 0;
	width: 2.25rem;
	height: 2.25rem;
	font-size: 1.5rem;
	color: var(--Primary);
	border: 2px solid var(--Primary);
	transition: var(--Animation-Duration)
}
.header-section .navbar-toggler:focus {
	box-shadow: none
}
.header-section .navbar {
	background-color: var(--Background);
	transition: var(--Animation-Duration);
	padding-top: 1rem;
	padding-bottom: 1rem;
	border-bottom: 1px solid rgba(255,255,255,.2)
}

@media only screen and (min-width:1200px) {
.header-section .navbar {
	background-color: transparent;
	height: 100px;
	padding-top: 0;
	padding-bottom: 0
}
}
.header-section .navbar .navbar-brand {
	margin-right: 2rem;
	line-height: 1!important
}

@media only screen and (min-width:992px) {
.header-section .navbar .navbar-brand {
	margin-right: 3rem
}
}

@media only screen and (min-width:1200px) {
.header-section .navbar .navbar-brand {
	margin-right: 4rem
}
}

@media only screen and (min-width:1400px) {
.header-section .navbar .navbar-brand {
	margin-right: 5rem
}
}
.header-section .header-top {
	width: 100%;
	height: 48px;
	transition: var(--Animation-Duration);
	background-color: var(--Primary)
}
.header-section .header-top .left-side i, .header-section .header-top .right-side i {
	color: var(--Heading);
	font-size: 20px
}
.header-section .header-top .left-side span, .header-section .header-top .right-side span {
	color: var(--Heading);
	font-size: 14px
}
.header-section .navbar-nav {
	margin-top: .5rem;
	margin-bottom: .5rem
}

@media only screen and (min-width:992px) {
.header-section .navbar-nav {
	margin-top: 0;
	margin-bottom: 0
}
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav {
	gap: 30px
}
}

@media only screen and (min-width:1400px) {
.header-section .navbar-nav {
	gap: 40px
}
}
.header-section .navbar-nav li>a {
	transition: var(--Animation-Duration);
	display: inline-block;
	color: var(--White);
	font-weight: 500;
	font-size: 1rem;
	text-transform: capitalize;
	padding-top: .5rem;
	padding-bottom: .5rem;
	display: flex;
	align-items: center;
	gap: 4px
}
.header-section .navbar-nav li>a i {
	font-size: 1rem
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li>a {
	padding-top: 1.5rem;
	padding-bottom: 1.5rem
}
}
.header-section .navbar-nav li>a:hover, .header-section .navbar-nav li>a:focus {
	color: var(--Primary)
}
.header-section .navbar-nav li .bizora-dd-menu {
	list-style: none;
	background-color: transparent;
	position: relative;
	z-index: 100;
	top: 100%;
	width: 100%;
	border: 0;
	border-radius: .5rem;
	display: none;
	padding-left: 0
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li .bizora-dd-menu {
	padding: 1rem 0;
	transition: var(--Animation-Duration);
	background-color: var(--Background);
	position: absolute;
	top: calc(100% + 8px);
	width: 16rem;
	visibility: hidden;
	opacity: 0;
	display: block;
	left: -1rem;
	border: 1px solid rgba(255,255,255,.1);
	box-shadow: 0 8px 30px #ffffff14
}
}
.header-section .navbar-nav li .bizora-dd-menu li>a {
	transition: var(--Animation-Duration);
	position: relative;
	font-size: 1rem;
	padding: .375rem 1rem;
	color: var(--White);
	text-transform: capitalize;
	align-items: center;
	justify-content: space-between
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li .bizora-dd-menu li>a {
	padding: .375rem 1.5rem
}
}
.header-section .navbar-nav li .bizora-dd-menu li>a:hover, .header-section .navbar-nav li .bizora-dd-menu li>a:focus {
	background-color: transparent;
	color: var(--Primary)
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li .bizora-dd-menu li>a:hover, .header-section .navbar-nav li .bizora-dd-menu li>a:focus {
	color: var(--Primary)
}
}
.header-section .navbar-nav li.bizora-dd {
	position: relative;
	z-index: 1
}
.header-section .navbar-nav li.bizora-dd .dropdown-toggler {
	position: absolute;
	width: 100%;
	height: 36px;
	z-index: 100;
	background-color: transparent;
	color: var(--Info);
	top: 2px;
	cursor: pointer;
	left: 0;
	display: flex;
	align-items: center;
	justify-content: flex-end;
	font-size: 1rem
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li.bizora-dd .dropdown-toggler {
	display: none
}
}
.header-section .navbar-nav li.bizora-dd>a {
	position: relative
}
.header-section .navbar-nav li.bizora-dd:hover>a, .header-section .navbar-nav li.bizora-dd:focus>a {
	color: var(--Primary)
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li.bizora-dd:hover .bizora-dd-menu, .header-section .navbar-nav li.bizora-dd:focus .bizora-dd-menu {
	visibility: visible;
	opacity: 1;
	top: 100%
}
}
.header-section .navbar-nav li.bizora-dd .bizora-dd .dropdown-toggler {
	right: 1rem
}
.header-section .navbar-nav li.bizora-dd .bizora-dd>a {
	position: relative;
	width: 100%
}
.header-section .navbar-nav li.bizora-dd .bizora-dd .bizora-dd-menu {
	display: none;
	padding-left: 1rem
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li.bizora-dd .bizora-dd .bizora-dd-menu {
	margin-left: .25rem;
	top: -8px;
	left: 100%;
	visibility: hidden;
	opacity: 0;
	display: block;
	padding-left: 0
}
}

@media only screen and (min-width:1200px) {
.header-section .navbar-nav li.bizora-dd .bizora-dd:hover .bizora-dd-menu, .header-section .navbar-nav li.bizora-dd .bizora-dd:focus .bizora-dd-menu {
	visibility: visible;
	opacity: 1
}
}
.header-section .navbar-nav li.active a, .header-section .navbar-nav li.active li.active a {
	color: var(--Primary)
}
.header-section.style-two {
	background-color: var(--White);
	border-bottom: 0
}
.header-section.style-two .navbar {
	background-color: var(--White)
}
.header-section.style-two .navbar-toggler {
	color: var(--Heading);
	border: 2px solid var(--Heading)
}
.header-section.style-two .navbar-nav li>a {
	color: var(--Heading)
}
.header-section.style-two .navbar-nav li>a:hover, .header-section.style-two .navbar-nav li>a:focus {
	color: var(--Primary-Hover)
}

@media only screen and (min-width:1200px) {
.header-section.style-two .navbar-nav li .bizora-dd-menu {
	background-color: var(--White);
	border: 1px solid rgba(10,10,10,.1);
	box-shadow: 0 8px 30px #0a0a0a14
}
}
.header-section.style-two .navbar-nav li .bizora-dd-menu li>a {
	color: var(--Heading)
}
.header-section.style-two .navbar-nav li .bizora-dd-menu li>a:hover, .header-section.style-two .navbar-nav li .bizora-dd-menu li>a:focus {
	background-color: transparent;
	color: var(--Primary-Hover)
}
.header-section.style-two .navbar-nav li.bizora-dd .dropdown-toggler {
	color: var(--Heading)
}
.header-section.style-two .navbar-nav li.bizora-dd:hover>a, .header-section.style-two .navbar-nav li.bizora-dd:focus>a {
	color: var(--Heading)
}
.header-section.style-two .navbar-nav li.active a, .header-section.style-two .navbar-nav li.active li.active a {
	color: var(--Primary-Hover)
}
.header-section.sticky-on .navbar {
	box-shadow: 0 30px 42px #ffffff1a;
	background-color: var(--Background);
	border-bottom-color: transparent
}

@media only screen and (min-width:1200px) {
.header-section.sticky-on .navbar {
	height: 90px
}
}
.header-section.sticky-on .header-top {
	height: 40px
}
.header-section.sticky-on.style-two {
	background-color: var(--White);
	box-shadow: 0 30px 42px #2127251a;
	border-bottom-color: transparent
}
.header-section.sticky-on.style-two .navbar {
	background-color: var(--White)
}
.bizora-offcanvas {
	width: 320px!important;
	background-color: var(--White)
}

@media only screen and (min-width:576px) {
.bizora-offcanvas {
	width: 400px!important
}
}
.bizora-offcanvas .offcanvas-header {
	height: 110px;
	justify-content: space-between;
	padding-left: 20px;
	padding-right: 20px;
	background-color: var(--Background)
}

@media only screen and (min-width:576px) {
.bizora-offcanvas .offcanvas-header {
	padding-left: 40px;
	padding-right: 40px
}
}
.bizora-offcanvas .offcanvas-header .btn-close {
	transition: var(--Animation-Duration);
	background-color: #ffffff80;
	display: flex;
	align-items: center;
	justify-content: center;
	border-radius: 8px;
	width: 40px;
	height: 40px;
	padding: 0;
	margin: 0
}
.bizora-offcanvas .offcanvas-body {
	padding: 1.5rem;
	scrollbar-width: thin
}

@media only screen and (min-width:576px) {
.bizora-offcanvas .offcanvas-body {
	padding: 2rem
}
}
.bizora-offcanvas .offcanvas-body .section-heading h2 {
	font-size: clamp(24px, 2.5vw, 40px)
}

@media only screen and (min-width:1200px) {
.bizora-dd-menu {
	opacity: 0;
	visibility: hidden;
	transform: translateY(10px);
	transition: opacity .35s ease, transform .35s ease
}
.bizora-dd-menu li {
	opacity: 0;
	transform: translateY(10px);
	transition: opacity .35s ease, transform .35s ease
}
.bizora-dd:hover .bizora-dd-menu {
	opacity: 1;
	visibility: visible;
	transform: translateY(0)
}
.bizora-dd:hover .bizora-dd-menu li {
	opacity: 1;
	transform: translateY(0)
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(1) {
	transition-delay: .1s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(2) {
	transition-delay: .2s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(3) {
	transition-delay: .3s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(4) {
	transition-delay: .4s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(5) {
	transition-delay: .5s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(6) {
	transition-delay: .6s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(7) {
	transition-delay: .7s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(8) {
	transition-delay: .8s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(9) {
	transition-delay: .9s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(10) {
	transition-delay: 1s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(11) {
	transition-delay: 1.1s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(12) {
	transition-delay: 1.2s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(13) {
	transition-delay: 1.3s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(14) {
	transition-delay: 1.4s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(15) {
	transition-delay: 1.5s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(16) {
	transition-delay: 1.6s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(17) {
	transition-delay: 1.7s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(18) {
	transition-delay: 1.8s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(19) {
	transition-delay: 1.9s
}
.bizora-dd:hover .bizora-dd-menu li:nth-child(20) {
	transition-delay: 2s
}
}
.navbar-nav-scroll {
	max-height: 55vh
}
.hero-content {
	margin-top: 60px
}

@media only screen and (min-width:768px) {
.hero-content {
	margin-top: 70px
}
}

@media only screen and (min-width:992px) {
.hero-content {
	margin-top: 80px
}
}

@media only screen and (min-width:1200px) {
.hero-content {
	margin-top: 130px
}
}
.hero-content h2 {
	font-size: clamp(42px, 6vw, 90px);
	font-weight: 600;
	line-height: 1.1;
	letter-spacing: -2.7px
}
.hero-content h5 {
	color: var(--White);
	line-height: 1.5;
	font-size: clamp(16px, 2vw, 20px)
}
.hero-content p {
	font-size: 1rem;
	margin-bottom: 2rem
}

@media only screen and (min-width:1200px) {
.hero-content p {
	font-size: 1.25rem;
	margin-bottom: 40px
}
}
.hero-content .imgs-group {
	display: flex;
	align-items: center
}
.hero-content .imgs-group img {
	flex: 0 0 50px;
	width: 50px;
	height: 50px;
	border-radius: 50%;
	border: 2px solid #FEFEFE;
	-o-object-fit: cover;
	object-fit: cover
}

@media only screen and (min-width:1400px) {
.hero-content .imgs-group img {
	flex: 0 0 60px;
	width: 60px;
	height: 60px
}
}
.hero-content .imgs-group img:nth-child(2) {
	transform: translate(-24px)
}
.hero-content .imgs-group img:nth-child(3) {
	transform: translate(-48px)
}
.hero-content .imgs-group img:nth-child(4) {
	transform: translate(-72px)
}
.hero-content .imgs-group img:nth-child(5) {
	transform: translate(-96px)
}
.hero-content .imgs-group img:nth-child(6) {
	transform: translate(-120px)
}
.hero-content .imgs-group img:nth-child(7) {
	transform: translate(-144px)
}
.hero-content .imgs-group img:nth-child(8) {
	transform: translate(-168px)
}
.hero-content .imgs-group img:nth-child(9) {
	transform: translate(-192px)
}
.hero-content .imgs-group img:nth-child(10) {
	transform: translate(-216px)
}
.hero-content .imgs-group img:nth-child(11) {
	transform: translate(-240px)
}
.hero-content .imgs-group img:nth-child(12) {
	transform: translate(-264px)
}
.hero-content .imgs-group img:nth-child(13) {
	transform: translate(-288px)
}
.hero-content .imgs-group img:nth-child(14) {
	transform: translate(-312px)
}
.hero-content .imgs-group img:nth-child(15) {
	transform: translate(-336px)
}
.hero-content .imgs-group img:nth-child(16) {
	transform: translate(-360px)
}
.hero-content .imgs-group img:nth-child(17) {
	transform: translate(-384px)
}
.hero-content .imgs-group img:nth-child(18) {
	transform: translate(-408px)
}
.hero-content .imgs-group img:nth-child(19) {
	transform: translate(-432px)
}
.hero-content .imgs-group img:nth-child(20) {
	transform: translate(-456px)
}
.hero-content .imgs-group div {
	flex: 0 0 50px;
	width: 50px;
	height: 50px;
	border-radius: 50%;
	border: 2px solid #FEFEFE;
	display: flex;
	align-items: center;
	justify-content: center;
	background-color: var(--Primary);
	color: var(--Heading);
	font-size: 16px;
	font-weight: 600;
	text-transform: uppercase;
	text-align: center;
	transform: translate(-48px)
}

@media only screen and (min-width:1400px) {
.hero-content .imgs-group div {
	flex: 0 0 60px;
	width: 60px;
	height: 60px
}
}
.hero-content .imgs-group-wrap h5 {
	transform: translate(-24px);
	font-size: clamp(16px, 2vw, 20px)
}
.hero-image {
	position: relative;
	z-index: 1;
	margin-top: 60px;
	border-radius: 20px;
	height: 400px
}

@media only screen and (min-width:768px) {
.hero-image {
	margin-top: 70px;
	height: 500px
}
}

@media only screen and (min-width:992px) {
.hero-image {
	margin-top: 80px;
	height: 600px
}
}

@media only screen and (min-width:1200px) {
.hero-image {
	margin-top: 130px;
	height: 700px
}
}
.hero-image .overlay-text {
	position: absolute;
	z-index: 99;
	top: 50%;
	transform: translateY(-50%) rotate(-90deg);
	left: -150px;
	-webkit-text-stroke-width: 1px;
	-webkit-text-stroke-color: var(--Heading);
	font-size: clamp(32px, 3.5vw, 48px);
	font-weight: 600;
	letter-spacing: -1.4px;
	text-transform: uppercase;
	color: transparent;
	line-height: 1.1
}
.hero-image .hero-img-container {
	position: absolute;
	z-index: 10;
	top: 0;
	left: 0;
	width: 140%;
	height: 100%;
	border-radius: 20px 0 0 20px
}
.hero-image .hero-img-container img {
	width: 100%;
	height: 100%;
	-o-object-fit: cover;
	object-fit: cover;
	border-radius: 20px 0 0 20px
}
.hero-form {
	padding: 40px 36px;
	border-radius: 20px;
	background: var(--White);
	margin-top: 60px
}

@media only screen and (min-width:768px) {
.hero-form {
	margin-top: 70px
}
}

@media only screen and (min-width:992px) {
.hero-form {
	margin-top: 80px
}
}

@media only screen and (min-width:1200px) {
.hero-form {
	margin-top: 130px
}
}
.hero-form .form-control {
	border: 1px solid rgba(19,43,73,.2);
	background: var(--Secondary)
}
.hero-form .form-control:focus {
	border-color: var(--Text)
}
.hero-section {
	position: relative;
	z-index: 1;
	background-color: var(--Background);
	padding-top: 75px
}

@media only screen and (min-width:1200px) {
.hero-section {
	padding-top: 100px
}
}
.hero-section .shape1 {
	position: absolute;
	top: 0;
	left: 0;
	z-index: -1
}
.hero-section .shape2 {
	position: absolute;
	top: 30%;
	right: 10%;
	z-index: -1
}
.hero-section .shape3 {
	position: absolute;
	bottom: 10%;
	right: 15%;
	z-index: 1
}
.hero-section .shape4 {
	position: absolute;
	bottom: 0;
	left: 0;
	z-index: 1
}
.hero-section .hero-button-prev, .hero-section .hero-button-next {
	transition: var(--Animation-Duration);
	background: #fff3;
	position: absolute;
	z-index: 10;
	top: 50%;
	transform: translateY(-50%);
	border: 0;
	width: 52px;
	height: 52px;
	border-radius: 10px;
	display: flex;
	align-items: center;
	justify-content: center;
	font-size: 24px;
	cursor: pointer;
	color: var(--White)
}

@media only screen and (min-width:1200px) {
.hero-section .hero-button-prev, .hero-section .hero-button-next {
	width: 64px;
	height: 64px
}
}
.hero-section .hero-button-prev:hover, .hero-section .hero-button-prev:focus, .hero-section .hero-button-next:hover, .hero-section .hero-button-next:focus {
	background: var(--Primary);
	color: var(--Heading)
}
.hero-section .hero-button-prev {
	left: -100px
}
.hero-section .hero-button-next {
	right: -100px
}
.hero-section:hover .hero-button-prev, .hero-section:focus .hero-button-prev {
	left: 30px
}

@media only screen and (min-width:1200px) {
.hero-section:hover .hero-button-prev, .hero-section:focus .hero-button-prev {
	left: 60px
}
}
.hero-section:hover .hero-button-next, .hero-section:focus .hero-button-next {
	right: 30px
}

@media only screen and (min-width:1200px) {
.hero-section:hover .hero-button-next, .hero-section:focus .hero-button-next {
	right: 60px
}
}
.hero-section.style-two {
	overflow: hidden;
	padding-top: 122px
}

@media only screen and (min-width:1200px) {
.hero-section.style-two {
	padding-top: 148px
}
}
.hero-section.style-two:after {
	background: linear-gradient(280deg, #052e2600 -.73%, #052e26 78.97%);
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: -1
}
.hero-swiper .swiper-slide {
	position: relative;
	z-index: 1;
	width: 100%;
	height: 550px;
	overflow: hidden
}
.hero-swiper .swiper-slide .background-image {
	position: absolute;
	z-index: -100;
	top: 50%;
	left: 50%;
	transform: translate(-50%, -50%) scale(1);
	width: 100%;
	height: 100%;
	background-size: cover;
	background-position: center;
	animation: growUp 40s ease-in-out infinite
}

@media only screen and (min-width:992px) {
.hero-swiper .swiper-slide {
	height: 650px
}
}

@media only screen and (min-width:1200px) {
.hero-swiper .swiper-slide {
	height: 700px
}
}

@media only screen and (min-width:1400px) {
.hero-swiper .swiper-slide {
	height: 800px
}
}
.hero-swiper .swiper-slide:after {
	background: linear-gradient(186deg, #052e2633 4.55%, #052e26 96.03%);
	position: absolute;
	width: 100%;
	height: 100%;
	top: 0;
	left: 0;
	z-index: -10;
	content: ""
}
@keyframes growUp {
0% {
transform:translate(-50%, -50%) scale(1)
}
50% {
transform:translate(-50%, -50%) scale(1.6)
}
to {
transform:translate(-50%, -50%) scale(1)
}
}
.about-cool-facts {
	display: flex;
	align-items: center;
	gap: 2rem
}

@media only screen and (min-width:1200px) {
.about-cool-facts {
	gap: 3rem
}
}
.about-cool-facts .line {
	width: 1px;
	height: 86px;
	background: var(--Border);
	flex-shrink: 0
}
.about-cool-facts h2 {
	font-size: clamp(32px, 4vw, 48px)
}
.about-list {
	display: flex;
	flex-direction: column;
	gap: 1rem;
	padding-left: 0;
	list-style: none;
	flex-wrap: wrap
}
.about-list li {
	display: flex;
	align-items: center;
	gap: 16px;
	font-size: 1rem;
	color: var(--Heading);
	font-weight: 600
}

@media only screen and (min-width:1400px) {
.about-list li {
	font-size: 18px
}
}
.about-list li svg {
	flex-shrink: 0
}
.about-countdown {
	padding: 20px 24px;
	border-radius: 20px;
	background-color: var(--White);
	width: 200px;
	flex-shrink: 0
}
.about-countdown h2 {
	font-size: clamp(32px, 5vw, 48px)
}
.about-countdown h6 {
	color: #132b49;
	line-height: 1.5
}
.about-img {
	position: relative
}
.about-img .first-img {
	border-radius: 100px 20px 20px
}
.about-img .first-img-reverse {
	border-radius: 20px 20px 100px
}
.about-img .dots-img {
	padding-right: 40px
}
.experience-card {
	transition: var(--Animation-Duration);
	border-radius: 20px;
	background-color: var(--Heading);
	padding: 20px;
	display: flex;
	align-items: center;
	flex-wrap: wrap;
	gap: 14px
}

@media only screen and (min-width:576px) {
.experience-card {
	justify-content: center;
	flex-wrap: nowrap;
	gap: 20px
}
}

@media only screen and (min-width:768px) {
.experience-card {
	padding: 30px
}
}

@media only screen and (min-width:992px) {
.experience-card {
	justify-content: flex-start;
	flex-wrap: wrap
}
}

@media only screen and (min-width:1200px) {
.experience-card {
	justify-content: center;
	flex-wrap: nowrap
}
}
.experience-card h2 {
	line-height: 1;
	font-size: clamp(32px, 4vw, 54px);
	transition: var(--Animation-Duration)
}
.experience-card h5 {
	color: #edf0f6;
	line-height: 1.5;
	letter-spacing: -.4px;
	font-size: clamp(16px, 2vw, 20px);
	transition: var(--Animation-Duration)
}
.experience-card:hover, .experience-card:focus {
	background-color: var(--Primary)
}
.experience-card:hover h2, .experience-card:hover h5, .experience-card:focus h2, .experience-card:focus h5 {
	color: var(--Heading)!important
}
.about-section {
	position: relative;
	z-index: 1
}
.about-section.style-one:after {
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	background-color: var(--Secondary);
	z-index: -1;
	opacity: .8
}
.step-card {
	position: relative;
	z-index: 1;
	text-align: center
}
.step-card .step-number {
	position: relative;
	z-index: 1;
	padding-bottom: 88px
}
.step-card .step-number:after {
	content: "";
	position: absolute;
	top: 26px;
	left: 0;
	width: 100%;
	border-top: 1px dashed rgba(5,46,38,.3);
	z-index: -10
}
.step-card .step-number span {
	width: 105px;
	height: 52px;
	display: flex;
	align-items: center;
	justify-content: center;
	border-radius: 12px;
	background: var(--Primary);
	color: #FFFFFF;
	font-size: 16px;
	font-weight: 600;
	margin-left: auto;
	margin-right: auto;
	position: relative;
	z-index: 5
}
.step-card .step-number .arrow-down {
	position: absolute;
	top: 0;
	left: 50%;
	transform: translate(-50%);
	z-index: -5
}
.step-section .row .col-12:first-child .step-card .step-number:before {
	content: "";
	position: absolute;
	width: 8px;
	height: 8px;
	background-color: var(--Heading);
	border-radius: 50%;
	opacity: .3;
	top: 22px;
	left: -4px;
	z-index: 1
}
.step-section .row .col-12:last-child .step-card .step-number:before {
	content: "";
	position: absolute;
	width: 8px;
	height: 8px;
	background-color: var(--Heading);
	border-radius: 50%;
	opacity: .3;
	top: 22px;
	right: -4px;
	z-index: 1
}
.team-card {
	z-index: 1;
	overflow: hidden;
	transition: var(--Animation-Duration);
	border-radius: 20px;
	border: 1px solid transparent;
	position: relative
}
.team-card:after {
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	border-radius: 18px;
	background: linear-gradient(180deg, #052e2600 50.47%, #052e26);
	opacity: 0;
	visibility: hidden
}
.team-card img {
	transition: var(--Animation-Duration);
	border-radius: 20px;
	width: 100%
}
.team-card .team-body {
	transition: var(--Animation-Duration);
	position: absolute;
	bottom: 0;
	left: 24px;
	z-index: 10;
	opacity: 0;
	visibility: hidden
}
.team-card .team-body h5, .team-card .team-body p {
	color: #f6f5f3
}
.team-card .social-nav {
	transition: var(--Animation-Duration);
	display: flex;
	flex-direction: column;
	position: absolute;
	z-index: 100;
	left: -200px;
	opacity: 0;
	visibility: hidden;
	top: 20px;
	gap: 8px
}
.team-card .social-nav a {
	width: 44px;
	height: 44px;
	border-radius: 6px;
	color: #0a165e;
	background-color: var(--White);
	transition: var(--Animation-Duration);
	font-size: 22px;
	display: flex;
	align-items: center;
	justify-content: center
}
.team-card .social-nav a:hover, .team-card .social-nav a:focus {
	background-color: var(--Primary)
}
.team-card h5 {
	transition: var(--Animation-Duration)
}
.team-card:hover:after, .team-card:focus:after {
	opacity: 1;
	visibility: visible
}
.team-card:hover .team-body, .team-card:focus .team-body {
	opacity: 1;
	visibility: visible;
	bottom: 24px
}
.team-card:hover .social-nav, .team-card:focus .social-nav {
	left: 24px;
	opacity: 1;
	visibility: visible
}
.team-card:hover h5, .team-card:focus h5 {
	color: var(--Primary)
}
.team-card:hover img, .team-card:focus img {
	transform: scale3d(1.15, 1.15, 1.15);
	filter: grayscale(1)
}
.team-pagination, .testimonial-pagination {
	display: flex;
	align-items: center;
	justify-content: center;
	gap: 14px;
	width: 100%;
	height: 22px
}
.team-pagination .swiper-pagination-bullet, .testimonial-pagination .swiper-pagination-bullet {
	position: relative;
	width: 8px;
	height: 8px;
	border-radius: 50%;
	background-color: var(--White);
	animation: var(--Animation-Duration);
	z-index: 1;
	flex-shrink: 0
}
.team-pagination .swiper-pagination-bullet.swiper-pagination-bullet-active, .testimonial-pagination .swiper-pagination-bullet.swiper-pagination-bullet-active {
	animation: var(--Animation-Duration);
	margin-left: 6px;
	margin-right: 6px
}
.team-pagination .swiper-pagination-bullet.swiper-pagination-bullet-active:after, .testimonial-pagination .swiper-pagination-bullet.swiper-pagination-bullet-active:after {
	animation: var(--Animation-Duration);
	content: "";
	position: absolute;
	top: 50%;
	left: 50%;
	transform: translate(-50%, -50%);
	width: 20px;
	height: 20px;
	z-index: -1;
	border-radius: 50%;
	border: 2px solid var(--White);
	background-color: transparent
}
.team-details-content h2 {
	font-size: clamp(24px, 2.5vw, 50px)
}
.team-details-content .social-nav {
	display: flex;
	align-items: center;
	gap: 8px
}
.team-details-content .social-nav a {
	transition: var(--Animation-Duration);
	background-color: var(--Secondary);
	color: var(--Heading);
	display: flex;
	align-items: center;
	justify-content: center;
	width: 36px;
	height: 36px;
	border-radius: 8px;
	font-size: 16px
}

@media only screen and (min-width:1200px) {
.team-details-content .social-nav a {
	width: 44px;
	height: 44px;
	font-size: 20px
}
}
.team-details-content .social-nav a:hover, .team-details-content .social-nav a:focus {
	background-color: var(--Primary);
	transform: translateY(-5px);
	color: var(--Heading)
}
.team-details-section img {
	width: 100%;
	border-radius: 20px
}
.team-details-section p {
	font-size: 18px
}
.progress-item .progress-info {
	position: relative;
	z-index: 1;
	display: flex;
	align-items: center;
	justify-content: space-between;
	gap: 20px;
	font-size: 16px;
	font-weight: 600;
	color: var(--Heading)
}
.progress-item .progress-info .percentage {
	position: absolute;
	z-index: 100;
	right: 0
}
.progress-item .progress {
	width: 100%;
	height: 10px;
	border-radius: 2px;
	background: #bde16266
}
.progress-item .progress-bar {
	border-radius: 0;
	background: var(--Primary)
}
.testimonial-card {
	position: relative;
	transition: var(--Animation-Duration);
	padding: 30px;
	border-radius: 20px;
	background: var(--White)
}
.testimonial-card .testimonial-image {
	display: flex;
	align-items: center;
	gap: 12px;
	margin-bottom: 20px
}
.testimonial-card .testimonial-image img {
	width: 64px;
	height: 64px;
	-o-object-fit: cover;
	object-fit: cover;
	border-radius: 10px
}
.testimonial-card .testimonial-text {
	font-size: 16px;
	margin-bottom: 24px;
	color: #132b49
}

@media only screen and (min-width:768px) {
.testimonial-card .testimonial-text {
	font-size: 18px
}
}
.testimonial-card .rating {
	display: flex;
	align-items: center;
	gap: 4px;
	color: #ecb014;
	font-size: 20px
}
@keyframes zoomInOut {
0% {
transform:scale(1)
}
50% {
transform:scale(1.1)
}
to {
transform:scale(1)
}
}
.testimonial-swiper-four {
	position: relative;
	z-index: 1
}
.testimonial-navigation {
	position: absolute;
	bottom: 40px;
	right: 40px;
	z-index: 10;
	gap: 20px
}
.testimonial-card-four {
	border-radius: 20px;
	background: var(--White);
	padding: 30px 24px;
	padding-bottom: 7rem
}

@media only screen and (min-width:576px) {
.testimonial-card-four {
	padding-bottom: 30px
}
}

@media only screen and (min-width:768px) {
.testimonial-card-four {
	padding-bottom: 7rem
}
}

@media only screen and (min-width:1200px) {
.testimonial-card-four {
	padding: 40px
}
}
.testimonial-card-four .quote-icon {
	flex-shrink: 0
}
.testimonial-card-four .testimonial-text {
	font-size: 16px;
	color: #132b49
}

@media only screen and (min-width:1200px) {
.testimonial-card-four .testimonial-text {
	font-size: 24px
}
}
.testimonial-card-four .testimonial-img img {
	width: 60px;
	height: 60px;
	border-radius: 50%;
	flex-shrink: 0
}

@media only screen and (min-width:1200px) {
.testimonial-card-four .testimonial-img img {
	width: 80px;
	height: 80px
}
}
.testimonial-card-four hr {
	border-top-color: var(--Border);
	margin: 28px 0
}
.testimonial-four-button-prev, .testimonial-four-button-next {
	width: 48px;
	height: 48px;
	border-radius: 50%;
	display: flex;
	align-items: center;
	justify-content: center;
	transition: var(--Animation-Duration);
	font-size: 24px;
	background-color: var(--Heading);
	color: var(--White);
	border: 0;
	cursor: pointer
}

@media only screen and (min-width:1200px) {
.testimonial-four-button-prev, .testimonial-four-button-next {
	width: 60px;
	height: 60px;
	font-size: 28px
}
}
.testimonial-four-button-prev:hover, .testimonial-four-button-prev:focus, .testimonial-four-button-next:hover, .testimonial-four-button-next:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}
.testimonial-section {
	position: relative;
	z-index: 1;
	overflow: hidden
}
.testimonial-section .shape {
	position: absolute;
	top: -2px;
	right: -2px;
	z-index: -9;
	max-width: 500px
}
.testimonial-section .shape img {
	width: 100%;
	height: auto;
	-o-object-fit: cover;
	object-fit: cover
}
.testimonial-section.style-two:after {
	content: "";
	position: absolute;
	width: 100%;
	height: 100%;
	top: 0;
	left: 0;
	z-index: -1;
	background: linear-gradient(0deg, #052e26eb, #052e26eb)
}
.rating-card {
	position: relative;
	z-index: 1;
	border-radius: 20px;
	padding: 40px;
	overflow: hidden
}
.rating-card:after {
	content: "";
	position: absolute;
	width: 430px;
	height: 430px;
	top: -150px;
	left: -150px;
	z-index: -1;
	border-radius: 50%;
	background-color: var(--White)
}
.rating-card:before {
	content: "";
	position: absolute;
	width: 100%;
	height: 100%;
	top: 0;
	left: 0;
	z-index: -1;
	border-radius: 18px;
	background: linear-gradient(215deg, #bde162e6 7.78%, #052e26e6 98.17%)
}
.rating-card h2 {
	color: var(--Heading);
	font-size: clamp(48px, 5vw, 90px);
	line-height: 1.35;
	letter-spacing: -2.7px
}
.rating-card .stars {
	display: flex;
	align-items: center;
	color: var(--Warning);
	font-size: 24px;
	gap: 2px;
	margin-bottom: .75rem
}
.rating-card h6 {
	color: var(--Heading);
	font-size: 18px;
	font-weight: 400
}
.rating-card p {
	color: var(--Secondary);
	margin-top: 120px
}
.testimonial-card-three {
	border-radius: 22px;
	display: flex;
	align-items: stretch;
	border: 1px solid rgba(19,43,73,.3);
	background: var(--White);
	margin-bottom: 1px;
	margin-top: 1px
}
.testimonial-card-three .testimonial-image {
	border-radius: 20px 0 0 20px;
	width: 40%;
	flex: 0 0 40%
}
.testimonial-card-three .testimonial-image img {
	width: 100%;
	height: 100%;
	-o-object-fit: cover;
	object-fit: cover;
	border-radius: 20px 0 0 20px
}
.testimonial-card-three .testimonial-info {
	flex: 1;
	padding: 20px
}

@media only screen and (min-width:576px) {
.testimonial-card-three .testimonial-info {
	padding: 30px
}
}
.testimonial-card-three .testimonial-text {
	font-size: 14px
}

@media only screen and (min-width:576px) {
.testimonial-card-three .testimonial-text {
	font-size: 16px
}
}

@media only screen and (min-width:1200px) {
.testimonial-card-three .testimonial-text {
	font-size: 18px
}
}
.popup-video {
	position: relative;
	z-index: 1
}
.popup-video .video-btn {
	position: relative;
	z-index: 1;
	transition: var(--Animation-Duration);
	display: flex;
	width: 100px;
	height: 100px;
	border-radius: 50%;
	background-color: var(--Primary);
	align-items: center;
	justify-content: center;
	color: var(--White);
	font-size: 12px;
	cursor: pointer
}
.video-popup-iframe {
	display: none;
	position: fixed;
	z-index: 999999999;
	left: 0;
	top: 0;
	width: 100%;
	height: 100%;
	background-color: #000000e6;
	justify-content: center;
	align-items: center;
	transition: var(--Animation-Duration)
}
.video-popup-iframe .video-content {
	position: relative;
	width: 90%;
	max-width: 900px;
	padding: 0;
	z-index: 1
}
.video-popup-iframe .video-content iframe {
	border-radius: 8px
}
.video-popup-iframe .video-content .close-btn {
	position: absolute;
	top: -3rem;
	right: 0;
	z-index: 1000;
	width: 30px;
	height: 30px;
	border-radius: 50%;
	border: 0;
	font-size: 1rem;
	display: flex;
	align-items: center;
	justify-content: center;
	background-color: var(--White);
	cursor: pointer;
	color: var(--Heading);
	transition: var(--Animation-Duration)
}
.video-popup-iframe .video-content .close-btn:hover, .video-popup-iframe .video-content .close-btn:focus {
	background-color: var(--Heading);
	color: var(--White)
}

@media only screen and (min-width:992px) {
.video-popup-iframe .video-content .close-btn {
	top: -1.75rem;
	right: -1.75rem
}
}
@keyframes video-sonar {
0% {
opacity:1;
transform:scale(.5)
}
to {
opacity:0;
transform:scale(1.3)
}
}
.video-sonar {
	position: absolute;
	width: 100%;
	height: 100%;
	border-radius: 50%;
	top: 0;
	left: 0;
	z-index: -10;
	background-color: var(--White);
	animation: video-sonar 2s linear infinite
}
.video-sonar:before {
	position: absolute;
	width: 160%;
	height: 160%;
	border-radius: 50%;
	background-color: #fffc;
	content: "";
	top: 50%;
	left: 50%;
	z-index: -100;
	transform: translate(-50%, -50%)
}
.video-sonar:after {
	position: absolute;
	width: 130%;
	height: 130%;
	border-radius: 50%;
	background-color: #fffc;
	content: "";
	top: 50%;
	left: 50%;
	z-index: -50;
	transform: translate(-50%, -50%)
}
.video-section {
	position: relative;
	z-index: 1;
	width: 100%;
	height: 400px
}

@media only screen and (min-width:576px) {
.video-section {
	height: 500px
}
}

@media only screen and (min-width:768px) {
.video-section {
	height: 600px
}
}

@media only screen and (min-width:1400px) {
.video-section {
	height: 700px
}
}
.video-section .play-video-btn {
	position: absolute;
	top: 50%;
	left: 50%;
	transform: translate(-50%, -50%);
	z-index: 10;
	width: 100px;
	height: 100px;
	border-radius: 50%;
	background-color: var(--Primary);
	display: flex;
	align-items: center;
	justify-content: center;
	cursor: pointer;
	font-size: 24px;
	color: var(--Heading)
}
.video-section .video-sonar {
	background-color: var(--Primary)
}
.video-section .video-sonar:before {
	background-color: #bde16299
}
.video-section .video-sonar:after {
	background-color: #bde162cc
}
.blog-card {
	position: relative;
	z-index: 1;
	transition: var(--Animation-Duration)
}
.blog-card .blog-img {
	border-radius: 20px 20px 0 0
}
.blog-card .blog-img img {
	width: 100%;
	border-radius: 20px 20px 0 0
}
.blog-card .blog-body {
	padding: 20px;
	border-radius: 0 0 20px 20px;
	transition: var(--Animation-Duration);
	border: 1px solid rgba(73,81,91,.3);
	border-top: 0
}

@media only screen and (min-width:768px) {
.blog-card .blog-body {
	padding: 30px
}
}
.blog-card .blog-meta {
	display: flex;
	align-items: center;
	flex-wrap: wrap;
	gap: 10px
}
.blog-card .blog-meta .dot {
	width: 6px;
	height: 6px;
	border-radius: 50%;
	background-color: #132b49;
	flex-shrink: 0
}
.blog-card .blog-meta .post-category, .blog-card .blog-meta .post-date {
	transition: var(--Animation-Duration);
	color: #132b49;
	font-weight: 400;
	font-size: 16px
}
.blog-card .blog-meta .post-category:hover, .blog-card .blog-meta .post-category:focus, .blog-card .blog-meta .post-date:hover, .blog-card .blog-meta .post-date:focus {
	color: var(--Primary-Hover)
}
.blog-card .post-title {
	color: var(--Heading);
	transition-duration: .35s;
	background-image: linear-gradient(currentColor, currentColor);
	background-size: 0% 2px;
	background-repeat: no-repeat;
	background-position: 0 100%;
	transition: background-size .5s ease;
	font-size: clamp(20px, 3vw, 22px);
	font-weight: 600;
	line-height: 1.45
}
.blog-card .post-title:hover, .blog-card .post-title:focus {
	background-size: 100% 2px
}
.blog-card.style-two {
	border: 0;
	border-radius: 20px
}
.blog-card.style-two .blog-img {
	margin-bottom: 24px;
	border-radius: 20px
}
.blog-card.style-two .blog-img img {
	border-radius: 20px
}
.blog-card.style-two .blog-body {
	padding: 0;
	border: 0
}
.blog-card.style-two .post-title {
	color: var(--Heading);
	transition-duration: .35s;
	background-image: linear-gradient(currentColor, currentColor);
	background-size: 0% 3px;
	background-repeat: no-repeat;
	background-position: 0 100%;
	transition: background-size .5s ease;
	font-size: clamp(20px, 3vw, 48px);
	font-weight: 600;
	line-height: 1.25;
	letter-spacing: -1.44px
}
.blog-card.style-two .post-title:hover, .blog-card.style-two .post-title:focus {
	background-size: 100% 3px
}
.blog-card-two {
	position: relative;
	z-index: 1;
	transition: var(--Animation-Duration);
	overflow: hidden;
	border-radius: 20px
}
.blog-card-two:after {
	width: 100%;
	height: 100%;
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	border-radius: 20px;
	background: linear-gradient(180deg, rgba(5,46,38,0) 0%, var(--Heading) 100%);
	z-index: 0
}
.blog-card-two img {
	border-radius: 20px;
	transition: var(--Animation-Duration)
}
.blog-card-two .blog-body {
	transition: var(--Animation-Duration);
	width: 100%;
	position: absolute;
	z-index: 10;
	bottom: -75px;
	left: 0;
	padding: 30px
}
.blog-card-two .blog-meta {
	display: flex;
	align-items: center;
	flex-wrap: wrap;
	gap: 10px
}
.blog-card-two .blog-meta .dot {
	width: 6px;
	height: 6px;
	border-radius: 50%;
	background-color: #edf0f6;
	flex-shrink: 0
}
.blog-card-two .blog-meta .post-category, .blog-card-two .blog-meta .post-date {
	transition: var(--Animation-Duration);
	color: #edf0f6;
	font-weight: 400;
	font-size: 16px
}
.blog-card-two .blog-meta .post-category:hover, .blog-card-two .blog-meta .post-category:focus, .blog-card-two .blog-meta .post-date:hover, .blog-card-two .blog-meta .post-date:focus {
	color: var(--Primary)
}
.blog-card-two .post-title {
	color: var(--White);
	transition-duration: .35s;
	background-image: linear-gradient(currentColor, currentColor);
	background-size: 0% 2px;
	background-repeat: no-repeat;
	background-position: 0 100%;
	transition: background-size .5s ease;
	font-size: 22px;
	font-weight: 600;
	line-height: 1.45
}
.blog-card-two .post-title:hover, .blog-card-two .post-title:focus {
	background-size: 100% 2px;
	color: var(--Primary)
}
.blog-card-two .btn-view-more span {
	color: var(--White);
	border-color: var(--Primary)
}
.blog-card-two .btn-view-more span:first-child {
	opacity: 0;
	visibility: hidden
}
.blog-card-two .btn-view-more span:last-child {
	opacity: 1;
	visibility: visible
}
.blog-card-two:hover .blog-body, .blog-card-two:focus .blog-body {
	bottom: 0
}
.blog-card-two:hover img, .blog-card-two:focus img {
	transform: scale3d(1.1, 1.1, 1.1)
}
.blog-card-two.style-two .blog-body {
	padding: 38px;
	bottom: -83px
}
.blog-card-two.style-two .post-title {
	font-size: clamp(20px, 3vw, 28px)
}
.blog-card-two.style-two .post-title:hover, .blog-card-two.style-two .post-title:focus {
	background-size: 100% 2px;
	color: var(--Primary)
}
.blog-card-two.style-two:hover .blog-body, .blog-card-two.style-two:focus .blog-body {
	bottom: 0
}
.blog-card-three {
	position: relative;
	z-index: 1;
	display: flex;
	align-items: stretch;
	background-color: var(--Secondary);
	border-radius: 20px
}
.blog-card-three .blog-img {
	border-radius: 20px 0 0 20px;
	transition: var(--Animation-Duration);
	flex-shrink: 0;
	flex: 0 0 35%;
	width: 35%
}
.blog-card-three .blog-img img {
	width: 100%;
	height: 100%;
	-o-object-fit: cover;
	object-fit: cover;
	border-radius: 20px 0 0 20px
}
.blog-card-three .blog-body {
	padding: 24px;
	background-color: var(--Secondary);
	border-radius: 0 20px 20px 0;
	transition: var(--Animation-Duration)
}
.blog-card-three .blog-body .post-title {
	transition: var(--Animation-Duration);
	color: var(--Heading);
	line-height: 1.4;
	transition-duration: .35s;
	background-image: linear-gradient(currentColor, currentColor);
	background-size: 0% 2px;
	background-repeat: no-repeat;
	background-position: 0 100%;
	transition: background-size .5s ease;
	font-size: clamp(18px, 2vw, 22px);
	font-weight: 600;
	letter-spacing: -1px
}
.blog-card-three .blog-body .post-title:hover, .blog-card-three .blog-body .post-title:focus {
	background-size: 100% 2px
}
.blog-card-three .blog-body .blog-meta {
	display: flex;
	align-items: center;
	flex-wrap: wrap;
	gap: 10px
}
.blog-card-three .blog-body .blog-meta .dot {
	width: 6px;
	height: 6px;
	border-radius: 50%;
	background-color: #132b49;
	flex-shrink: 0
}
.blog-card-three .blog-body .blog-meta .post-category, .blog-card-three .blog-body .blog-meta .post-date {
	transition: var(--Animation-Duration);
	color: #132b49;
	font-weight: 400;
	font-size: 16px
}
.blog-card-three .blog-body .blog-meta .post-category:hover, .blog-card-three .blog-body .blog-meta .post-category:focus, .blog-card-three .blog-body .blog-meta .post-date:hover, .blog-card-three .blog-body .blog-meta .post-date:focus {
	color: var(--Primary-Hover)
}
.blog-card-three .btn-link:hover, .blog-card-three .btn-link:focus {
	color: var(--Heading)
}
.widget-card {
	background-color: var(--Secondary);
	padding: 32px 24px;
	border-radius: 20px;
	width: 100%
}

@media only screen and (min-width:992px) {
.widget-card {
	padding: 40px 36px
}
}
.widget-card .widget-title {
	font-weight: 600;
	margin-bottom: 1.5rem
}
.widget-card form {
	position: relative;
	z-index: 1;
	display: flex;
	align-items: center;
	gap: 12px
}
.widget-card form .form-control {
	transition: var(--Animation-Duration);
	background-color: var(--White);
	border-radius: 8px;
	height: 50px;
	color: var(--Text);
	border: 1px solid transparent;
	padding-left: 20px;
	padding-right: 20px
}
.widget-card form .form-control::-moz-placeholder {
color:var(--Text);
opacity:.8
}
.widget-card form .form-control::placeholder {
color:var(--Text);
opacity:.8
}
.widget-card form .form-control:focus {
	box-shadow: none;
	border-color: var(--Border)
}
.widget-card form button {
	transition: var(--Animation-Duration);
	background-color: transparent;
	color: var(--Heading);
	position: absolute;
	right: 0;
	border: 0;
	width: 60px;
	height: 100%;
	border-radius: 0 8px 8px 0;
	font-size: 24px;
	z-index: 10
}
.widget-card form button:hover, .widget-card form button:focus {
	color: var(--Primary-Hover)
}
.blog-list {
	padding: 0;
	list-style: none;
	display: flex;
	flex-direction: column;
	margin-bottom: 0;
	gap: 12px
}
.blog-list li a {
	position: relative;
	z-index: 1;
	width: 100%;
	color: var(--Text);
	border-radius: 8px;
	font-size: 16px;
	display: flex;
	align-items: center;
	justify-content: space-between;
	font-weight: 400;
	transition: var(--Animation-Duration)
}

@media only screen and (min-width:992px) {
.blog-list li a {
	font-size: 18px
}
}
.blog-list li a:hover, .blog-list li a:focus {
	color: var(--Primary-Hover);
	padding-left: .5rem;
	padding-right: .5rem
}
.widget-blog {
	display: flex;
	align-items: center;
	gap: 20px
}
.widget-blog .blog-thumbnail {
	border-radius: 10px;
	flex: 0 0 100px;
	max-width: 100px
}
.widget-blog .blog-thumbnail img {
	width: 100%;
	border-radius: 10px
}
.widget-blog .blog-content .post-date {
	color: #49515b;
	font-size: 14px;
	font-weight: 400;
	display: block
}

@media only screen and (min-width:1200px) {
.widget-blog .blog-content .post-date {
	font-size: 16px
}
}
.widget-blog .blog-content .post-title {
	font-size: 16px;
	font-weight: 600;
	overflow: hidden;
	text-overflow: ellipsis;
	display: -webkit-box;
	-webkit-box-orient: vertical;
	-webkit-line-clamp: 2;
	letter-spacing: -1px
}
.widget-blog .blog-content .post-title:hover, .widget-blog .blog-content .post-title:focus {
	color: var(--Primary-Hover)
}
.tag-list {
	display: flex;
	gap: 12px;
	flex-wrap: wrap
}
.tag-list a {
	padding: 6px 20px;
	color: var(--Heading);
	font-size: 16px;
	font-weight: 400;
	display: block;
	border-radius: 6px;
	background-color: var(--White);
	transition: var(--Animation-Duration)
}
.tag-list a:hover, .tag-list a:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}
.bizora-pagination {
	display: flex;
	align-items: center;
	gap: 8px;
	justify-content: center
}

@media only screen and (min-width:1200px) {
.bizora-pagination {
	gap: 12px
}
}
.bizora-pagination li a {
	display: flex;
	align-items: center;
	justify-content: center;
	width: 36px;
	height: 36px;
	border-radius: 6px;
	font-size: 14px;
	font-weight: 600;
	background-color: var(--Secondary);
	color: var(--Heading)
}

@media only screen and (min-width:576px) {
.bizora-pagination li a {
	width: 42px;
	height: 42px
}
}

@media only screen and (min-width:1200px) {
.bizora-pagination li a {
	width: 60px;
	height: 60px;
	font-size: 1rem
}
}
.bizora-pagination li a:hover, .bizora-pagination li a:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}
.bizora-pagination li.active a {
	background-color: var(--Primary);
	color: var(--Heading)
}
.quote-card {
	border-radius: 10px;
	background: var(--Secondary);
	padding: 32px 24px;
	display: flex;
	gap: 24px
}

@media only screen and (min-width:992px) {
.quote-card {
	padding: 40px 36px
}
}
.quote-card svg {
	width: 60px;
	flex-shrink: 0
}
.quote-card h5 {
	font-size: 16px;
	margin-bottom: 0;
	letter-spacing: -.4px;
	line-height: 1.5;
	font-weight: 500
}

@media only screen and (min-width:992px) {
.quote-card h5 {
	font-size: 20px!important
}
}
.blog-comments-list {
	display: flex;
	flex-direction: column;
	gap: 32px;
	list-style: none;
	padding: 0
}

@media only screen and (min-width:1200px) {
.blog-comments-list {
	gap: 48px
}
}
.blog-comments-list ul {
	list-style: none;
	padding-left: 24px
}

@media only screen and (min-width:576px) {
.blog-comments-list ul {
	padding-left: 48px
}
}
.blog-comments-list .single-comment {
	display: flex;
	flex-direction: column;
	gap: 32px
}

@media only screen and (min-width:1200px) {
.blog-comments-list .single-comment {
	gap: 48px
}
}
.blog-comments-list .single-comment ul {
	display: flex;
	flex-direction: column;
	gap: 32px
}

@media only screen and (min-width:1200px) {
.blog-comments-list .single-comment ul {
	gap: 48px
}
}
.comment-content {
	display: flex;
	gap: 24px
}
.comment-content img {
	flex: 0 0 60px;
	width: 60px;
	height: 60px;
	-o-object-fit: cover;
	object-fit: cover;
	border-radius: 10px
}

@media only screen and (min-width:1200px) {
.comment-content img {
	flex: 0 0 90px;
	width: 90px;
	height: 90px
}
}
.comment-form .form-control {
	background-color: var(--Secondary)
}
.tag-share-wrap {
	display: flex;
	align-items: center;
	justify-content: space-between;
	flex-wrap: wrap;
	gap: 48px;
	padding: 20px 0;
	border-top: 1px solid #EDF0F6;
	border-bottom: 1px solid #EDF0F6
}

@media only screen and (min-width:1200px) {
.tag-share-wrap {
	padding: 24px 0
}
}
.tag-share-wrap .tag-list {
	display: flex;
	align-items: center;
	gap: 10px
}
.tag-share-wrap .tag-list li {
	font-size: 14px;
	font-weight: 600;
	color: var(--Heading)
}

@media only screen and (min-width:1200px) {
.tag-share-wrap .tag-list li {
	font-size: 16px
}
}
.tag-share-wrap .tag-list li a {
	padding: 0;
	transition: var(--Animation-Duration);
	color: #132b49;
	font-size: 14px;
	font-weight: 400
}
.tag-share-wrap .tag-list li a:hover, .tag-share-wrap .tag-list li a:focus {
	color: var(--Primary-Hover);
	background-color: transparent
}
.tag-share-wrap .share-list {
	display: flex;
	align-items: center;
	gap: 10px
}
.tag-share-wrap .share-list li {
	font-size: 16px;
	font-weight: 600
}
.tag-share-wrap .share-list li a {
	padding: 0 6px!important;
	transition: var(--Animation-Duration);
	color: var(--Text);
	font-size: 18px
}
.tag-share-wrap .share-list li a:hover, .tag-share-wrap .share-list li a:focus {
	color: var(--Primary-Hover)
}
.single-blog-content {
	display: flex;
	flex-direction: column;
	gap: 24px
}
.single-blog-content h1, .single-blog-content .h1, .single-blog-content h2, .single-blog-content .h2, .single-blog-content h3, .single-blog-content .h3, .single-blog-content h4, .single-blog-content .h4, .single-blog-content h5, .single-blog-content .h5, .single-blog-content h6, .single-blog-content .h6 {
	margin-bottom: 0
}
.single-blog-content p {
	font-size: 1rem;
	margin-bottom: 0
}

@media only screen and (min-width:992px) {
.single-blog-content p {
	font-size: 18px
}
}
.single-blog-content img {
	border-radius: 20px;
	width: 100%
}
.single-blog-content .post-title {
	position: relative;
	z-index: 1;
	color: var(--Heading);
	line-height: 1.2;
	transition: var(--Animation-Duration);
	background-image: none;
	font-size: clamp(24px, 4vw, 48px);
	pointer-events: none;
	letter-spacing: -1px
}
.single-blog-content .blog-meta {
	flex-wrap: wrap
}
.single-blog-content .blog-meta a {
	font-size: 16px;
	font-weight: 400;
	color: var(--Text);
	display: flex;
	align-items: center;
	gap: 6px
}
.single-blog-content .blog-meta a i {
	font-size: 20px;
	color: var(--Primary)
}
.single-blog-content .blog-meta a:hover, .single-blog-content .blog-meta a:focus {
	color: var(--Primary-Hover)
}
.footer-card {
	position: relative;
	display: flex;
	flex-direction: column
}
.footer-card p {
	font-size: 16px;
	color: var(--Secondary);
	margin-bottom: 40px
}
.footer-card h5 {
	font-weight: 600
}
.social-nav {
	display: none;
	align-items: center;
	gap: 8px
}
.social-nav a {
	transition: var(--Animation-Duration);
	display: flex;
	align-items: center;
	justify-content: center;
	width: 36px;
	height: 36px;
	border-radius: 6px;
	font-size: 18px;
	color: var(--Heading);
	background-color: var(--White)
}

@media only screen and (min-width:1200px) {
.social-nav a {
	width: 44px;
	height: 44px;
	font-size: 20px
}
}
.social-nav a:hover, .social-nav a:focus {
	background-color: var(--Primary);
	color: #FFFFFF;
	transform: translateY(-5px)
}

.service-card-two p:hover, .service-card-two p:focus {
	color: #FFFFFF;
}.service-card-two h4:hover, .service-card-two h4:focus {
	color: #FFFFFF;
}


.footer-nav {
	display: flex;
	list-style: none;
	flex-direction: column;
	gap: .75rem;
	padding-left: 0
}
.footer-nav li a {
	color: var(--Secondary);
	font-size: 16px;
	text-transform: capitalize;
	font-weight: 400;
	display: flex;
	align-items: center;
	gap: 8px;
	transform: translate(-16px)
}
.footer-nav li a i {
	font-size: 18px
}
.footer-nav li a span {
	width: 8px;
	height: 8px;
	border-radius: 2px;
	background-color: var(--Primary);
	flex-shrink: 0;
	opacity: 0;
	transition: var(--Animation-Duration);
	visibility: hidden
}
.footer-nav li a:hover, .footer-nav li a:focus {
	color: var(--Primary);
	transform: translate(0)
}
.footer-nav li a:hover span, .footer-nav li a:focus span {
	opacity: 1;
	visibility: visible
}
.footer-nav.style-two li a {
	transform: translate(0)
}
.copyright-section {
	padding-top: 32px;
	padding-bottom: 48px;
	border-top: 1px solid rgba(255,255,255,.3);
	text-align: center
}
.copyright-section .copyright {
	font-size: 16px;
	color: var(--Secondary);
	display: flex;
	align-items: center;
	justify-content: center;
	gap: 4px;
	flex-wrap: wrap
}

@media only screen and (min-width:1200px) {
.copyright-section .copyright {
	font-size: 18px
}
}
.copyright-section .copyright a {
	font-size: 16px;
	color: var(--Secondary)
}

@media only screen and (min-width:1200px) {
.copyright-section .copyright a {
	font-size: 18px
}
}
.copyright-section .copyright a:hover, .copyright-section .copyright a:focus {
	color: var(--Primary)
}
.copyright-section.style-two {
	border-top: 1px solid rgba(82,93,113,.5)
}
.footer-section {
	position: relative;
	z-index: 1;
	overflow: hidden
}
.footer-section .shape {
	position: absolute;
	bottom: -2px;
	left: -2px;
	max-width: 500px;
	z-index: -1
}
.footer-section .shape img {
	width: 100%;
	height: auto;
	-o-object-fit: cover;
	object-fit: cover
}
.footer-section.style-two:after {
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: -1;
	background: linear-gradient(0deg, #052e26f2, #052e26f2)
}
.cta-section {
	position: relative;
	z-index: 1;
	overflow: hidden
}
.cta-section .shape {
	position: absolute;
	top: -2px;
	right: -2px;
	z-index: -1;
	opacity: .1;
	max-width: 500px
}
.cta-section .shape img {
	width: 100%;
	height: auto;
	-o-object-fit: cover;
	object-fit: cover
}
.cta-section .cta-content {
	border-radius: 20px;
	background: #24835c;
	padding: 40px;
	display: flex;
	align-items: center;
	justify-content: space-between;
	flex-wrap: wrap;
	gap: 50px;
}


@media only screen and (min-width:992px) {
.cta-section .cta-content {
	flex-wrap: nowrap;
	padding: 50px
}
}

@media only screen and (min-width:1200px) {
.cta-section .cta-content {
	padding: 80px 90px;
	gap: 100px
}
}

@media only screen and (min-width:1400px) {
.cta-section .cta-content {
	padding: 100px 110px;
	gap: 200px
}
}
.cta-section .cta-content h2 {
	font-weight: 600;
	font-size: clamp(36px, 5vw, 60px);
	color: var(--White);
}
.cta-section .cta-content a {
	flex-shrink: 0
}
.cta-content hr {
	background-color: #ffffff4d;
	margin-top: 100px
}
.cool-facts {
	text-align: center;
	background-color: var(--Primary);
	padding: 3rem 1rem;
	height: 100%
}

@media only screen and (min-width:1200px) {
.cool-facts {
	padding: 4rem 1rem
}
}
.cool-facts h2 {
	font-size: clamp(36px, 4vw, 50px);
	margin-bottom: 1rem;
	line-height: 1;
	color: var(--White)
}
.cool-facts p {
	color: var(--White)
}

@media only screen and (min-width:1200px) {
.cool-facts p {
	font-size: 18px
}
}
.cookiealert {
	position: fixed;
	left: 1rem;
	bottom: 1rem;
	z-index: 1000;
	max-width: 280px;
	padding: 30px 22px;
	border-radius: 12px;
	opacity: 0;
	visibility: hidden;
	transform: translateY(-16px);
	transition: var(--Animation-Duration);
	background-color: var(--Background);
	color: var(--White)
}

@media only screen and (min-width:576px) {
.cookiealert {
	max-width: 360px
}
}

@media only screen and (min-width:768px) {
.cookiealert {
	max-width: 550px
}
}

@media only screen and (min-width:992px) {
.cookiealert {
	max-width: 700px;
	left: 2rem;
	bottom: 2rem;
	padding: 40px 32px
}
}
.cookiealert.show {
	opacity: 1;
	visibility: visible;
	transform: translateY(0)
}
.cookiealert p {
	font-size: 12px;
	color: var(--Text)
}

@media only screen and (min-width:768px) {
.cookiealert p {
	font-size: 14px
}
}

@media only screen and (min-width:1200px) {
.cookiealert p {
	font-size: 16px
}
}
.cookiealert a {
	color: var(--White);
	font-weight: 600
}
.cookiealert a:hover, .cookiealert a:focus {
	color: var(--Primary)
}
.form-control {
	transition: var(--Animation-Duration);
	border-radius: 6px;
	background: var(--White);
	height: 52px;
	font-size: 1rem;
	border: 1px solid transparent;
	padding: 12px 20px;
	color: #132b49
}
.form-control:focus {
	box-shadow: none;
	border-color: var(--Border)
}
.form-control::-moz-placeholder {
color:#132b49
}
.form-control::placeholder {
color:#132b49
}
.form-select {
	transition: var(--Animation-Duration);
	border-radius: 6px;
	background: var(--White);
	height: 52px;
	font-size: 1rem;
	border: 1px solid transparent;
	padding: 0 1.25rem;
	color: #132b49;
	cursor: pointer
}
.form-select:focus {
	box-shadow: none;
	border-color: var(--Border)
}
textarea.form-control {
	min-height: 10rem
}
.contact-info-wrapper {
	background-color: var(--Secondary);
	border-radius: 20px;
	padding: 30px;
	display: flex;
	flex-direction: column;
	align-items: center;
	gap: 60px
}

@media only screen and (min-width:576px) {
.contact-info-wrapper {
	padding: 40px
}
}

@media only screen and (min-width:768px) {
.contact-info-wrapper {
	padding: 50px
}
}

@media only screen and (min-width:992px) {
.contact-info-wrapper {
	flex-direction: row;
	gap: 20px
}
}

@media only screen and (min-width:1200px) {
.contact-info-wrapper {
	padding: 60px;
	gap: 40px
}
}
.contact-sm-card {
	display: flex;
	align-items: center;
	gap: 1rem
}
.contact-sm-card .icon {
	width: 84px;
	height: 84px;
	background-color: var(--Heading);
	display: flex;
	align-items: center;
	border-radius: 50%;
	justify-content: center;
	flex-shrink: 0
}
.contact-sm-card p {
	margin-bottom: .5rem;
	font-size: 14px
}

@media only screen and (min-width:1200px) {
.contact-sm-card p {
	font-size: 18px
}
}
.contact-sm-card p:last-child {
	margin-bottom: 0
}
.contact-form .form-control {
	background-color: var(--White);
	border: 0
}
.maps-section {
	transform: translateY(6px)
}
.maps-section iframe {
	width: 100%;
	height: 400px;
	filter: grayscale(.5)
}

@media only screen and (min-width:768px) {
.maps-section iframe {
	height: 500px
}
}

@media only screen and (min-width:1200px) {
.maps-section iframe {
	height: 600px
}
}

@media only screen and (min-width:1400px) {
.maps-section iframe {
	height: 700px
}
}
.footer-contact-section {
	position: relative;
	z-index: 100;
	background-color: var(--Secondary);
	border-radius: 20px;
	transform: translateY(-60px);
	display: flex;
	align-items: stretch;
	flex-wrap: wrap
}

@media only screen and (min-width:576px) {
.footer-contact-section {
	transform: translateY(-70px)
}
}

@media only screen and (min-width:768px) {
.footer-contact-section {
	transform: translateY(-80px)
}
}

@media only screen and (min-width:992px) {
.footer-contact-section {
	transform: translateY(-95px)
}
}

@media only screen and (min-width:1200px) {
.footer-contact-section {
	transform: translateY(-110px)
}
}

@media only screen and (min-width:1400px) {
.footer-contact-section {
	transform: translateY(-130px)
}
}
.footer-contact-section .footer-contact-form {
	flex: 0 0 100%;
	width: 100%;
	padding: 40px;
	border-radius: 20px 0 0 20px
}

@media only screen and (min-width:768px) {
.footer-contact-section .footer-contact-form {
	flex: 0 0 55%;
	width: 55%
}
}

@media only screen and (min-width:992px) {
.footer-contact-section .footer-contact-form {
	padding: 60px
}
}

@media only screen and (min-width:1200px) {
.footer-contact-section .footer-contact-form {
	padding: 80px
}
}
.footer-contact-section .footer-contact-form .form-control {
	background-color: transparent;
	border-radius: 0;
	border: 0;
	border-bottom: 1px solid var(--Border);
	padding-left: 0
}
.footer-contact-section .footer-contact-form .form-control:focus {
	border-bottom-color: #132b49
}
.footer-contact-section .footer-contact-maps {
	flex: 0 0 100%;
	width: 100%;
	border-radius: 0 20px 20px 0;
	height: 300px
}

@media only screen and (min-width:768px) {
.footer-contact-section .footer-contact-maps {
	flex: 0 0 45%;
	width: 45%;
	height: auto
}
}
.footer-contact-section .footer-contact-maps iframe {
	width: 100%;
	height: 100%;
	border-radius: 0 0 20px 20px
}

@media only screen and (min-width:768px) {
.footer-contact-section .footer-contact-maps iframe {
	border-radius: 0 20px 20px 0
}
}
.faq-accordion .accordion {
	display: flex;
	flex-direction: column;
	gap: 20px
}
.faq-accordion .accordion-item {
	position: relative;
	border-radius: 10px;
	background: var(--Secondary);
	border: 0
}
.faq-accordion .accordion-item:first-of-type .accordion-button {
	border-top-left-radius: 10px!important;
	border-top-right-radius: 10px!important
}
.faq-accordion .accordion-item:last-of-type .accordion-button {
	border-bottom-left-radius: 10px!important;
	border-bottom-right-radius: 10px!important
}
.faq-accordion .accordion-item .accordion-button {
	border-radius: 10px;
	background: var(--Secondary);
	color: var(--Heading);
	font-size: 18px;
	font-weight: 600;
	padding: 16px 30px
}

@media only screen and (min-width:1200px) {
.faq-accordion .accordion-item .accordion-button {
	font-size: 20px
}
}
.faq-accordion .accordion-item .accordion-button:focus {
	box-shadow: none!important
}
.faq-accordion .accordion-item .accordion-button:after {
	width: 32px;
	height: 32px;
	border-radius: 50%;
	background-position: center;
	background-color: var(--Heading);
	color: var(--White);
	background-image: url(data:image/svg+xml,%3Csvg%20xmlns%3D%22http%3A//www.w3.org/2000/svg%22%20width%3D%2224%22%20height%3D%2224%22%20viewBox%3D%220%200%2024%2024%22%20fill%3D%22none%22%20stroke%3D%22white%22%20stroke-width%3D%222%22%20stroke-linecap%3D%22round%22%20stroke-linejoin%3D%22round%22%20class%3D%22icon%20icon-tabler%20icons-tabler-outline%20icon-tabler-chevron-down%22%3E%3Cpath%20stroke%3D%22none%22%20d%3D%22M0%200h24v24H0z%22%20fill%3D%22none%22/%3E%3Cpath%20d%3D%22M6%209l6%206l6%20-6%22/%3E%3C/svg%3E)
}
.faq-accordion .accordion-item .accordion-button:not(.collapsed) {
	box-shadow: none;
	color: var(--Heading);
	background-color: var(--Primary);
	border-radius: 10px 10px 0 0!important
}
.faq-accordion .accordion-item .accordion-button:not(.collapsed):after {
	transform: rotate(180deg)
}
.faq-accordion .accordion-item .accordion-body {
	background-color: var(--Secondary);
	padding: 20px 30px;
	color: var(--Text);
	font-size: 16px;
	border-radius: 0 0 10px 10px
}
.faq-accordion.style-two .accordion-item {
	background: transparent;
	border-radius: 10px
}
.faq-accordion.style-two .accordion-item .accordion-button {
	background-color: var(--White);
	border-radius: 10px
}
.faq-accordion.style-two .accordion-item .accordion-button:after {
	color: #F5F2F0;
	background-color: transparent;
	background-image: url(data:image/svg+xml,%3Csvg%20%20xmlns=%22http://www.w3.org/2000/svg%22%20%20width=%2224%22%20%20height=%2224%22%20%20viewBox=%220%200%2024%2024%22%20%20fill=%22none%22%20%20stroke=%22currentColor%22%20%20stroke-width=%222%22%20%20stroke-linecap=%22round%22%20%20stroke-linejoin=%22round%22%20%20class=%22icon%20icon-tabler%20icons-tabler-outline%20icon-tabler-plus%22%3E%3Cpath%20stroke=%22none%22%20d=%22M0%200h24v24H0z%22%20fill=%22none%22/%3E%3Cpath%20d=%22M12%205l0%2014%22%20/%3E%3Cpath%20d=%22M5%2012l14%200%22%20/%3E%3C/svg%3E)
}
.faq-accordion.style-two .accordion-item .accordion-button:not(.collapsed) {
	color: #F5F2F0;
	background-color: var(--Primary);
	border-radius: 10px 10px 0 0
}
.faq-accordion.style-two .accordion-item .accordion-button:not(.collapsed):after {
	background-image: url(data:image/svg+xml,%3Csvg%20%20xmlns=%22http://www.w3.org/2000/svg%22%20%20width=%2224%22%20%20height=%2224%22%20%20viewBox=%220%200%2024%2024%22%20%20fill=%22none%22%20%20stroke=%22currentColor%22%20%20stroke-width=%222%22%20%20stroke-linecap=%22round%22%20%20stroke-linejoin=%22round%22%20%20class=%22icon%20icon-tabler%20icons-tabler-outline%20icon-tabler-minus%22%3E%3Cpath%20stroke=%22none%22%20d=%22M0%200h24v24H0z%22%20fill=%22none%22/%3E%3Cpath%20d=%22M5%2012l14%200%22%20/%3E%3C/svg%3E)
}
.faq-accordion.style-two .accordion-item .accordion-body {
	background-color: var(--White);
	color: var(--Text);
	border-radius: 0 0 10px 10px
}
.faq-accordion.style-three .accordion-item {
	background: transparent;
	border-radius: 10px
}
.faq-accordion.style-three .accordion-item .accordion-button {
	background-color: var(--Secondary);
	border-radius: 10px
}
.faq-accordion.style-three .accordion-item .accordion-button:after {
	color: var(--Heading);
	background-color: transparent;
	background-image: url(data:image/svg+xml,%3Csvg%20%20xmlns=%22http://www.w3.org/2000/svg%22%20%20width=%2224%22%20%20height=%2224%22%20%20viewBox=%220%200%2024%2024%22%20%20fill=%22none%22%20%20stroke=%22currentColor%22%20%20stroke-width=%222%22%20%20stroke-linecap=%22round%22%20%20stroke-linejoin=%22round%22%20%20class=%22icon%20icon-tabler%20icons-tabler-outline%20icon-tabler-plus%22%3E%3Cpath%20stroke=%22none%22%20d=%22M0%200h24v24H0z%22%20fill=%22none%22/%3E%3Cpath%20d=%22M12%205l0%2014%22%20/%3E%3Cpath%20d=%22M5%2012l14%200%22%20/%3E%3C/svg%3E)
}
.faq-accordion.style-three .accordion-item .accordion-button:not(.collapsed) {
	color: var(--Heading);
	background-color: var(--Primary);
	border-radius: 10px 10px 0 0
}
.faq-accordion.style-three .accordion-item .accordion-button:not(.collapsed):after {
	background-image: url(data:image/svg+xml,%3Csvg%20%20xmlns=%22http://www.w3.org/2000/svg%22%20%20width=%2224%22%20%20height=%2224%22%20%20viewBox=%220%200%2024%2024%22%20%20fill=%22none%22%20%20stroke=%22currentColor%22%20%20stroke-width=%222%22%20%20stroke-linecap=%22round%22%20%20stroke-linejoin=%22round%22%20%20class=%22icon%20icon-tabler%20icons-tabler-outline%20icon-tabler-minus%22%3E%3Cpath%20stroke=%22none%22%20d=%22M0%200h24v24H0z%22%20fill=%22none%22/%3E%3Cpath%20d=%22M5%2012l14%200%22%20/%3E%3C/svg%3E)
}
.faq-accordion.style-three .accordion-item .accordion-body {
	background-color: var(--Secondary);
	color: var(--Text);
	border-radius: 0 0 10px 10px
}
.faq-question-section {
	background-position: center center;
	background-repeat: no-repeat
}
.faq-section.style-two {
	background-repeat: repeat
}
.faq-img, .faq-img img {
	border-radius: 20px
}
.breadcrumb-section {
	position: relative;
	z-index: 1
}
.breadcrumb-section:after {
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: -10;
	background: linear-gradient(0deg, #052e26e6, #052e26e6)
}
.breadcrumb-section .breadcrumb-content {
	text-align: center;
	padding-top: 75px
}

@media only screen and (min-width:1200px) {
.breadcrumb-section .breadcrumb-content {
	padding-top: 100px
}
}
.breadcrumb-section .breadcrumb-content h2 {
	color: var(--White);
	font-size: clamp(32px, 5vw, 80px);
	line-height: 1.2;
	letter-spacing: -1.92px;
	overflow: hidden;
	text-overflow: ellipsis;
	display: -webkit-box;
	-webkit-box-orient: vertical;
	-webkit-line-clamp: 2
}

@media only screen and (min-width:1200px) {
.breadcrumb-section .breadcrumb-content h2 {
	margin-bottom: 1rem
}
}
.breadcrumb-section .breadcrumb-content ul {
	display: inline-flex;
	justify-content: center;
	flex-wrap: wrap;
	align-items: center;
	gap: 8px
}
.breadcrumb-section .breadcrumb-content ul li {
	color: var(--Secondary);
	font-size: 14px;
	font-weight: 400;
	font-family: var(--Font-Primary);
	line-height: 1.1
}

@media only screen and (min-width:1200px) {
.breadcrumb-section .breadcrumb-content ul li {
	font-size: 16px
}
}
.breadcrumb-section .breadcrumb-content ul li a {
	color: #f7f8ff80;
	font-size: 14px;
	position: relative;
	z-index: 1;
	padding-right: 12px;
	font-weight: 400;
	transition: var(--Animation-Duration);
	font-family: var(--Font-Primary);
	line-height: 1.1
}

@media only screen and (min-width:1200px) {
.breadcrumb-section .breadcrumb-content ul li a {
	font-size: 16px
}
}
.breadcrumb-section .breadcrumb-content ul li a:hover, .breadcrumb-section .breadcrumb-content ul li a:focus {
	color: var(--Primary)
}
.breadcrumb-section .breadcrumb-content ul li a:after {
	content: "";
	position: absolute;
	right: -5px;
	top: 55%;
	transform: translateY(-50%);
	font-family: var(--Font-Tabler);
	font-size: 16px;
	color: var(--Secondary)
}
.partner-section {
	padding-top: 70px
}

@media only screen and (min-width:1200px) {
.partner-section {
	padding-top: 100px
}
}
.partner-section h5 {
	line-height: 1.5
}
.partner-content p {
	font-size: 20px;
	font-weight: 600;
	flex-shrink: 0;
	color: var(--Heading)
}
.partner-content a {
	display: block;
	text-align: center
}
.partner-content a img {
	max-height: 24px;
	filter: none;
}

@media only screen and (min-width:1400px) {
.partner-content a img {
	max-height: 30px
}
}
.partner-content a:hover, .partner-content a:focus {
	transform: translate(-5px)
}
.partner-content.style-two {
	margin-top: 70px;
	display: flex;
	align-items: stretch;
	gap: 0
}

@media only screen and (min-width:1200px) {
.partner-content.style-two {
	margin-top: 100px
}
}
.partner-content.style-two .partner-title {
	flex-shrink: 0;
	padding: 40px 24px;
	border: 1px solid var(--Border);
	    text-align: center;
}
.partner-content.style-two .partner-swiper {
	border: 1px solid var(--Border);
	border-left: 0;
	border-radius: 0 10rem 10rem 0;
	padding: 54px 24px;
	display: flex;
	align-items: center
}
.features-img {
	position: relative;
	z-index: 1;
	border-radius: 20px
}
.features-img:after {
	width: 70%;
	height: 70%;
	content: "";
	position: absolute;
	bottom: -30px;
	left: -30px;
	border-radius: 20px;
	background-color: var(--Secondary);
	z-index: -1
}

@media only screen and (min-width:1400px) {
.features-img:after {
	bottom: -50px;
	left: -50px
}
}
.features-img.style-two:after {
	bottom: -30px;
	left: auto;
	right: -30px
}

@media only screen and (min-width:1400px) {
.features-img.style-two:after {
	bottom: -50px;
	left: auto;
	right: -50px
}
}
.features-img.style-three:after {
	display: none
}
.features-img img {
	border-radius: 20px;
	position: relative;
	z-index: 10;
	width: 100%
}
.features-img .float-img {
	position: absolute;
	left: 30px;
	bottom: 30px;
	z-index: 10;
	border-radius: 12px;
	max-width: 200px
}

@media only screen and (min-width:992px) {
.features-img .float-img {
	max-width: 250px
}
}

@media only screen and (min-width:1200px) {
.features-img .float-img {
	max-width: 320px;
	bottom: 60px
}
}
.features-img .play-video-btn {
	position: absolute;
	top: 50%;
	left: 50%;
	transform: translate(-50%, -50%);
	z-index: 10;
	width: 100px;
	height: 100px;
	border-radius: 50%;
	background-color: var(--Primary);
	display: flex;
	align-items: center;
	justify-content: center;
	cursor: pointer;
	font-size: 24px;
	color: var(--Heading)
}
.features-img .video-sonar {
	background-color: var(--Primary)
}
.features-img .video-sonar:before {
	background-color: #bde16299
}
.features-img .video-sonar:after {
	background-color: #bde162cc
}
.features-content {
	display: flex;
	flex-direction: column;
	gap: 36px
}
.feature-card {
	transition: var(--Animation-Duration);
	display: flex;
	align-items: center;
	gap: 1.5rem
}
.feature-card .feature-icon {
	transition: var(--Animation-Duration);
	border-radius: 10px;
	background: var(--Secondary);
	color: var(--Heading);
	display: flex;
	justify-content: center;
	align-items: center;
	width: 80px;
	height: 80px;
	flex-shrink: 0
}

@media only screen and (min-width:1400px) {
.feature-card .feature-icon {
	width: 90px;
	height: 90px
}
}
.feature-card .feature-content p {
	line-height: 1.8
}
.feature-card:hover .feature-icon, .feature-card:focus .feature-icon {
	background-color: var(--Primary);
	color: var(--Heading)
}
.features-section.style-two {
	padding-top: 80px
}
.features-section.style-two .border-top {
	margin-top: 80px
}
.features-section.style-three {
	padding-top: 80px;
	padding-bottom: 80px
}
.features-section.style-three .feature-card .feature-icon {
	background-color: var(--White);
	color: var(--Heading)
}
.features-section.style-three .feature-card:hover .feature-icon, .features-section.style-three .feature-card:focus .feature-icon {
	background-color: var(--Primary);
	color: var(--Heading)
}
.service-card {
	transition: var(--Animation-Duration);
	background: var(--White);
	padding: 30px 24px;
	border-radius: 20px;
	overflow: hidden;
	height: 100%
}

@media only screen and (min-width:1400px) {
.service-card {
	padding: 40px 36px
}
}
.service-card .service-icon {
	transition: var(--Animation-Duration);
	width: 80px;
	height: 80px;
	display: flex;
	align-items: center;
	justify-content: center;
	border-radius: 10px;
	background: var(--Secondary);
	margin-bottom: 50px;
	font-size: 40px;
	color: var(--Heading)
}
.service-card .service-icon i {
	line-height: .7
}
.service-card h4 {
	transition: var(--Animation-Duration)
}
.service-card p {
	line-height: 1.8
}
.service-card:hover .service-icon, .service-card:focus .service-icon {
	background: var(--Primary);
	color: var(--Heading)
}
.service-card:hover h4, .service-card:focus h4 {
	color: var(--Primary-Hover)
}
.service-card.style-two {
	background: var(--Secondary);
	min-height: 100%
}
.service-card.style-two .service-icon {
	background: var(--White)
}
.service-card.style-two:hover .service-icon, .service-card.style-two:focus .service-icon {
	background: var(--Primary);
	color: var(--White)
}
.service-card-two {
	position: relative;
	z-index: 1;
	transition: var(--Animation-Duration);
	padding: 28px 24px;
	border-radius: 20px;
	background: var(--Secondary)
}
.service-card-two img {
	width: 100%;
	border-radius: 12px
}
.service-card-two p {
	line-height: 1.8
}
.service-card-two:hover, .service-card-two:focus {
	background: #24835c
}
.service-list {
	display: flex;
	flex-direction: column;
	gap: 14px;
	padding: 0;
	margin: 0
}
.service-list li {
	list-style: none
}
.service-list li a {
	display: flex;
	align-items: center;
	gap: 12px;
	justify-content: space-between;
	font-size: 16px;
	padding: 16px 20px 16px 24px;
	border-radius: 8px;
	background-color: var(--White);
	color: var(--Heading);
	transition: var(--Animation-Duration)
}
.service-list li a i {
	transition: var(--Animation-Duration);
	font-size: 20px
}
.service-list li a:hover, .service-list li a:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}
.service-info-card {
	position: relative;
	z-index: 1;
	border-radius: 20px;
	padding: 50px;
	text-align: center
}
.service-info-card:after {
	border-radius: 20px;
	content: "";
	position: absolute;
	top: 0;
	left: 0;
	z-index: -1;
	width: 100%;
	height: 100%;
	background: linear-gradient(139deg, #052e26e6 -3.14%, #052e26e6 93.63%)
}
.service-info-card .icon {
	width: 90px;
	height: 90px;
	border-radius: 10px;
	background-color: var(--White);
	transition: var(--Animation-Duration);
	display: flex;
	justify-content: center;
	align-items: center;
	flex-shrink: 0;
	color: var(--Heading);
	margin-left: auto;
	margin-right: auto;
	margin-bottom: 20px
}
.service-info-card:hover .icon, .service-info-card:focus .icon {
	background-color: var(--Primary)
}
.info-card {
	display: flex;
	align-items: center;
	gap: 16px;
	transition: var(--Animation-Duration)
}
.info-card .icon {
	width: 48px;
	height: 48px;
	border-radius: 50%;
	border: 1.5px solid #49515B;
	transition: var(--Animation-Duration);
	display: flex;
	justify-content: center;
	align-items: center;
	flex-shrink: 0;
	color: var(--Heading)
}
.info-card .icon svg {
	transition: var(--Animation-Duration)
}

@media only screen and (min-width:992px) {
.info-card .icon {
	width: 60px;
	height: 60px
}
}
.info-card h5 {
	transition: var(--Animation-Duration)
}
.info-card:hover .icon, .info-card:focus .icon {
	border-color: var(--Primary)
}
.info-card:hover .icon svg, .info-card:focus .icon svg {
	transform: scale(1.2)
}
.info-card:hover h5, .info-card:focus h5 {
	color: var(--Primary)
}
.service-details-content {
	display: flex;
	flex-direction: column;
	gap: 24px
}
.service-details-content h1, .service-details-content .h1, .service-details-content h2, .service-details-content .h2, .service-details-content h3, .service-details-content .h3, .service-details-content h4, .service-details-content .h4, .service-details-content h5, .service-details-content .h5, .service-details-content h6, .service-details-content .h6 {
	margin-bottom: 0
}
.service-details-content p {
	font-size: 16px;
	margin-bottom: 0
}

@media only screen and (min-width:992px) {
.service-details-content p {
	font-size: 18px
}
}
.service-details-content img {
	border-radius: 20px;
	width: 100%
}
.service-details-content ul {
	display: flex;
	flex-direction: column;
	gap: 12px
}
.service-details-content ul li {
	font-size: 16px;
	display: flex;
	align-items: center;
	gap: 12px
}

@media only screen and (min-width:992px) {
.service-details-content ul li {
	font-size: 18px
}
}
.magnet-img {
	max-width: 250px;
	margin-top: 150px
}
.service-section {
	position: relative;
	z-index: 1;
	overflow: hidden
}
.service-section .shape {
	position: absolute;
	top: -2px;
	right: -2px;
	z-index: -9;
	max-width: 500px
}
.service-section .shape img {
	width: 100%;
	height: auto;
	-o-object-fit: cover;
	object-fit: cover
}
.service-section.style-two .shape {
	top: -2px;
	right: -2px;
	z-index: -9;
	max-width: 100%!important;
	max-height: 100%!important;
	opacity: .5
}

@media only screen and (min-width:576px) {
.swiper.project-swiper {
	width: 130%
}
}

@media only screen and (min-width:576px) {
.swiper.testimonial-swiper-two {
	width: 140%
}
}

@media only screen and (min-width:1400px) {
.swiper.testimonial-swiper-two {
	width: 150%
}
}
.project-navigation, .testimonial-navigation-two {
	display: flex;
	align-items: center;
	gap: 20px
}
.project-navigation .project-button-prev, .project-navigation .project-button-next, .project-navigation .testimonial-button-prev, .project-navigation .testimonial-button-next, .testimonial-navigation-two .project-button-prev, .testimonial-navigation-two .project-button-next, .testimonial-navigation-two .testimonial-button-prev, .testimonial-navigation-two .testimonial-button-next {
	display: flex;
	align-items: center;
	justify-content: center;
	width: 48px;
	height: 48px;
	border-radius: 50%;
	background-color: #052e26;
	transition: var(--Animation-Duration);
	font-size: 20px;
	color: var(--White)
}

@media only screen and (min-width:1200px) {
.project-navigation .project-button-prev, .project-navigation .project-button-next, .project-navigation .testimonial-button-prev, .project-navigation .testimonial-button-next, .testimonial-navigation-two .project-button-prev, .testimonial-navigation-two .project-button-next, .testimonial-navigation-two .testimonial-button-prev, .testimonial-navigation-two .testimonial-button-next {
	width: 60px;
	height: 60px;
	font-size: 24px
}
}
.project-navigation .project-button-prev:hover, .project-navigation .project-button-prev:focus, .project-navigation .project-button-next:hover, .project-navigation .project-button-next:focus, .project-navigation .testimonial-button-prev:hover, .project-navigation .testimonial-button-prev:focus, .project-navigation .testimonial-button-next:hover, .project-navigation .testimonial-button-next:focus, .testimonial-navigation-two .project-button-prev:hover, .testimonial-navigation-two .project-button-prev:focus, .testimonial-navigation-two .project-button-next:hover, .testimonial-navigation-two .project-button-next:focus, .testimonial-navigation-two .testimonial-button-prev:hover, .testimonial-navigation-two .testimonial-button-prev:focus, .testimonial-navigation-two .testimonial-button-next:hover, .testimonial-navigation-two .testimonial-button-next:focus {
	background-color: var(--Primary);
	color: var(--Heading)
}
.project-card {
	position: relative;
	z-index: 1;
	transition: var(--Animation-Duration);
	border-radius: 18px;
	overflow: hidden
}
.project-card img {
	transition: var(--Animation-Duration);
	border-radius: 18px;
	width: 100%
}
.project-card .project-info {
	transition: var(--Animation-Duration);
	background-color: var(--White);
	border-radius: 12px;
	width: calc(100% - 40px);
	position: absolute;
	display: flex;
	align-items: end;
	justify-content: space-between;
	gap: .5rem;
	bottom: 28px;
	left: 20px;
	padding: 16px;
	visibility: hidden;
	opacity: 0;
	z-index: 20;
	transform: scale(.9)
}

@media only screen and (min-width:1200px) {
.project-card .project-info {
	padding: 20px 24px
}
}
.project-card .project-info h4 {
	transition: var(--Animation-Duration);
	font-size: clamp(20px, 2vw, 24px);
	color: var(--Heading)
}
.project-card .project-info p {
	font-size: 14px
}

@media only screen and (min-width:1200px) {
.project-card .project-info p {
	font-size: 16px
}
}
.project-card .project-info .arrow-icon {
	color: var(--Primary);
	font-size: 36px;
	line-height: .7
}
.project-card:hover .project-info, .project-card:focus .project-info {
	visibility: visible;
	opacity: 1;
	transform: scale(1)
}
.project-card:hover img, .project-card:focus img {
	transform: scale3d(1.1, 1.1, 1.1);
	filter: blur(4px)
}
.project-section.theme-two {
	background-color: var(--Background)
}
.project-details-content {
	display: flex;
	flex-direction: column;
	gap: 24px
}
.project-details-content h1, .project-details-content .h1, .project-details-content h2, .project-details-content .h2, .project-details-content h3, .project-details-content .h3, .project-details-content h4, .project-details-content .h4, .project-details-content h5, .project-details-content .h5, .project-details-content h6, .project-details-content .h6 {
	margin-bottom: 0
}
.project-details-content h2 {
	font-size: clamp(24px, 3vw, 36px)
}
.project-details-content p {
	font-size: 16px;
	margin-bottom: 0
}

@media only screen and (min-width:992px) {
.project-details-content p {
	font-size: 18px
}
}
.project-details-content img {
	border-radius: 20px;
	width: 100%
}
.project-details-content ul {
	display: flex;
	flex-direction: column;
	gap: 12px
}
.project-details-content ul li {
	font-size: 16px;
	display: flex;
	align-items: center;
	gap: 12px
}

@media only screen and (min-width:992px) {
.project-details-content ul li {
	font-size: 18px
}
}
.project-details-img {
	border-radius: 20px;
	width: 100%
}
.project-widget {
	border-radius: 20px;
	background-color: var(--Secondary);
	padding: 32px 24px
}

@media only screen and (min-width:992px) {
.project-widget {
	padding: 40px 36px
}
}
.project-widget .widget-title {
	color: var(--Heading)
}
.project-widget .project-meta-list {
	display: flex;
	flex-direction: column;
	gap: 1rem
}
.project-widget .project-meta-list li {
	display: flex;
	align-items: center;
	gap: 1rem
}
.project-widget .project-meta-list li h6 {
	flex: 0 0 84px;
	width: 84px
}
.project-widget .project-meta-list li a {
	color: var(--Primary-Hover)
}
.project-widget .project-meta-list li a:hover, .project-widget .project-meta-list li a:focus {
	text-decoration: underline
}
.project-widget .social-nav {
	display: flex;
	align-items: center;
	gap: 15px;
}
.project-widget .social-nav a {
	transition: var(--Animation-Duration);
	display: flex;
	align-items: center;
	justify-content: center;
	width: 36px;
	height: 36px;
	border-radius: 6px;
	font-size: 16px;
	color: var(--White);
	background-color: var(--Heading)
}

@media only screen and (min-width:1200px) {
.project-widget .social-nav a {
	width: 44px;
	height: 44px;
	font-size: 20px
}
}
.project-widget .social-nav a:hover, .project-widget .social-nav a:focus {
	background-color: var(--Primary);
	color: var(--Heading);
	transform: translateY(-5px)
}
.project-nav {
	display: flex;
	align-items: center;
	justify-content: space-between;
	gap: 24px;
	margin-top: 100px;
	border-top: 1px solid rgba(73,81,91,.2);
	padding-top: 2rem
}
.project-nav a {
	display: flex;
	align-items: center;
	flex-wrap: wrap;
	gap: 1rem;
	transition: var(--Animation-Duration)
}
.project-nav a .icon {
	width: 48px;
	height: 48px;
	display: flex;
	align-items: center;
	justify-content: center;
	flex-shrink: 0;
	border-radius: 6px;
	border: 1px solid #161616;
	transition: var(--Animation-Duration);
	font-size: 20px
}

@media only screen and (min-width:1200px) {
.project-nav a .icon {
	width: 60px;
	height: 60px;
	font-size: 24px
}
}
.project-nav a:last-child {
	text-align: right
}
.project-nav a h5 {
	transition: var(--Animation-Duration);
	display: -webkit-box;
	-webkit-line-clamp: 2;
	-webkit-box-orient: vertical;
	overflow: hidden;
	text-overflow: ellipsis
}
.project-nav a:last-child {
	text-align: right;
	justify-content: flex-end
}
.project-nav a:hover .icon, .project-nav a:focus .icon {
	background-color: var(--Primary);
	border-color: var(--Primary);
	color: var(--White)
}
.project-nav a:hover h5, .project-nav a:focus h5 {
	color: var(--Primary)
}
.pricing-section {
	position: relative;
	z-index: 1;
	overflow: hidden
}
.pricing-section .shape {
	position: absolute;
	top: -2px;
	right: -2px;
	max-width: 500px;
	z-index: -1;
	opacity: .1
}
.pricing-section .shape img {
	width: 100%;
	height: auto;
	-o-object-fit: cover;
	object-fit: cover
}
.price-banner-card {
	position: relative;
	z-index: 1;
	padding: 40px 36px 0;
	border-radius: 20px;
	background-color: #212529;
	overflow: hidden
}
.price-banner-card img {
	width: 100%;
	border-radius: 20px
}
.price-banner-card p {
	color: var(--Secondary)
}
.price-banner-card:before {
	content: "";
	position: absolute;
	bottom: -310px;
	left: 50%;
	width: 500px;
	height: 500px;
	background-color: var(--Primary);
	border-radius: 50%;
	transform: translate(-50%);
	z-index: -10
}

@media only screen and (min-width:576px) {
.price-banner-card:before {
	width: 600px;
	height: 600px
}
}

@media only screen and (min-width:768px) {
.price-banner-card:before {
	width: 450px;
	height: 450px
}
}

@media only screen and (min-width:992px) {
.price-banner-card:before {
	bottom: -210px
}
}
.price-card {
	display: flex;
	align-items: center;
	gap: 30px;
	padding: 30px 26px;
	border-radius: 18px;
	background-color: var(--White);
	flex-wrap: wrap
}

@media only screen and (min-width:992px) {
.price-card {
	flex-wrap: nowrap;
	gap: 60px
}
}

@media only screen and (min-width:1200px) {
.price-card {
	gap: 100px;
	padding: 38px 36px
}
}

@media only screen and (min-width:1400px) {
.price-card {
	gap: 140px
}
}
.price-card .pricing-value {
	transition: all .4s ease;
	flex-shrink: 0
}
.price-card .price-display {
	transition: opacity .4s ease
}
.price-card .price-display.fade-out {
	opacity: 0
}
.price-card .price-display.fade-in {
	opacity: 1
}
.price-card .price-display .price-amount {
	font-size: clamp(36px, 4vw, 48px)
}
.price-card .price-display .price-type {
	font-size: clamp(16px, 2vw, 18px);
	color: #132b49
}
.pricing-plan-switching {
	display: flex;
	border-radius: 6px;
	background: var(--White);
	align-items: center;
	justify-content: center;
	gap: 2px;
	width: 222px;
	height: 54px
}
.pricing-plan-switching .btn {
	padding: 0;
	border: 0;
	height: 54px;
	width: 110px;
	border-radius: 6px;
	color: var(--Heading)
}
.pricing-plan-switching .btn.active {
	background: var(--Primary);
	color: var(--Heading);
	pointer-events: none
}
.price-banner {
	order: 5
}

@media only screen and (min-width:768px) {
.price-banner {
	order: 0
}
}
.price-table-cards {
	order: 0
}

@media only screen and (min-width:768px) {
.price-table-cards {
	order: 5
}
}




.navbar-brand img {
    height: 60px;     
    width: auto;   
    object-fit: contain;
}
@media (max-width: 768px) {
    .navbar-brand img {
        height: 40px;
    }
}
.footer-logo img {
    height: auto;     
    width: 100%;   
    object-fit: contain;
}
@media (max-width: 768px) {
    .footer-logo img {
        height: 100%;
		    width: 100%;   
    }
}

.contact-sm-card a {
    color: inherit;
    text-decoration: none;
    transition: 0.3s;
}

.contact-sm-card a:hover {
    color: #FFFFFF;
}


.contact-sm-card {
    display: flex;
    align-items: center;
    gap: 15px;
    width: 30%;
}

/* ?????? */
@media (max-width: 768px) {
    .contact-sm-card {
        width: 100%;
    }
}
.contact-wrapper {
    display: grid;
    grid-template-columns: repeat(3, 1fr);
    gap: 20px;
}

@media (max-width: 768px) {
    .contact-wrapper {
        grid-template-columns: 1fr;
    }
}